WebSVN – Kolibri OS – Path Comparison – /

Regard whitespace Rev 8535 → Rev 8534

/programs/develop/tinypy/std_modules/bitwise/init.c
File deleted

Property changes:
Deleted: svn:executable
-*
\ No newline at end of property

/programs/develop/tinypy/std_modules/ksys/init.c
File deleted

Property changes:
Deleted: svn:executable
-*
\ No newline at end of property

/programs/develop/tinypy/std_modules/ksys/fs.c
File deleted

Property changes:
Deleted: svn:executable
-*
\ No newline at end of property

 /programs/develop/tinypy/tinypy/Makefile
 ,31 → 2,35
 CC = kos32-gcc
 LD = kos32-ld
+SDK_DIR:= $(abspath ../../../../contrib/sdk)
 LDFLAGS = -static -nostdlib -T $(SDK_DIR)/sources/newlib/app.lds \
-          --image-base 0 -lgcc -lSDLn  -lc.dll -lsound
+          --image-base 0 -lgcc -lc.dll
-SDL_DIR = $(SDK_DIR)/sources/SDL-1.2.2_newlib
+CFLAGS = -U_Win32 -U_WIN32 -U__MINGW32__ -mpreferred-stack-boundary=2 \
+                        -mincoming-stack-boundary=2 -fno-builtin -fno-common
-CFLAGS = -DCONIO -U_Win32 -U_WIN32 -U__MINGW32__ -mpreferred-stack-boundary=2 \
-                        -mincoming-stack-boundary=2 -fno-builtin -fno-common  -O3
+INCLUDES= -I. -I$(SDK_DIR)/sources/newlib/libc/include
+LIBPATH:= -L $(SDK_DIR)/lib -L /home/autobuild/tools/win32/mingw32/lib
-INCLUDES= -I. -I$(SDK_DIR)/sources/newlib/libc/include -I$(SDL_DIR)/include
-LIBPATH:= -L $(SDK_DIR)/lib -L /home/autobuild/tools/win32/mingw32/lib -L.
+MODULES_DIR = $(abspath ../modules)
-STD_MODULES= ../std_modules/modules.o
+MODULES_OBJ =   $(MODULES_DIR)/kolibri/init.o  \
+                                $(MODULES_DIR)/kolibri/fs.o    \
+                                $(MODULES_DIR)/kolibri/net.o   \
+                                $(MODULES_DIR)/kolibri/gui.o   \
+                                $(MODULES_DIR)/kolibri/debug.o
-OBJECTS =  tpmain.o $(STD_MODULES)
+OBJECTS = tpmain.o $(MODULES_OBJ)
 all:$(NAME)
 $(NAME): $(OBJECTS)
-        $(LD) $(LIBPATH) --subsystem native -o $@ $(OBJECTS) $(LDFLAGS) -n -Map $(NAME).map
-        strip -S $(NAME)
-        kos32-objcopy $@ -O binary
-        kpack $@
+        $(LD) $(LIBPATH) --subsystem native -o $@ $(OBJECTS) $(LDFLAGS) -n # -Map $(NAME).map
+        objcopy $@ -O binary
 %.o : %.c Makefile
         $(CC) -c $(INCLUDES) $(CFLAGS) -o $@ $<
 clean:
-        rm -f $(NAME).map $(OBJECTS) *.o core/*.tpc core/*.pyc
+        rm -f *.o $(NAME).map $(MODULES_OBJ)

 /programs/develop/tinypy/tinypy/koconsole.c
 ,0 → 1,68
+#include "kolibri.h"
+/*
+#define __stdcall __attribute__((stdcall))
+#define _cdecl __attribute__((cdecl))
+#define _stdcall __attribute__((stdcall))
+*/
+void (* _stdcall con_init)(unsigned w_w, unsigned w_h, unsigned s_w, unsigned s_h, const char* t);
+int (* _cdecl con_printf)(const char* format,...);
+void (* _stdcall con_exit)(char bCloseWindow);
+void (* __stdcall con_gets)(char* str, int n);
+void (* _stdcall con_set_title)(const char* title);
+void CONSOLE_INIT(const char title[])
+{
+  kol_struct_import *imp;
+  if (!(imp = kol_cofflib_load("/sys/lib/console.obj")) ||
+      !(con_init = ( _stdcall  void (*)(unsigned, unsigned, unsigned, unsigned, const char*))
+                  kol_cofflib_procload (imp, "con_init")) ||
+      !(con_printf = ( _cdecl int (*)(const char*,...))
+                  kol_cofflib_procload (imp, "con_printf"))||
+      !(con_gets = ( __stdcall void (*)(char*, int))
+                  kol_cofflib_procload (imp, "con_gets"))||
+      !(con_exit = ( _stdcall void (*)(char))
+                  kol_cofflib_procload (imp, "con_exit")) ||
+      !(con_set_title = ( _stdcall void (*)(const char*))
+                  kol_cofflib_procload (imp, "con_set_title")))
+  {
+    kol_exit();
+  }
+  con_init(-1, -1, -1, -1, title);
+}
+kol_struct_import* kol_cofflib_load(char *name)
+{
+  kol_struct_import* result;
+  asm ("int $0x40":"=a"(result):"a"(68), "b"(19), "c"(name));
+  return result;
+}
+void* kol_cofflib_procload (kol_struct_import *imp, char *name)
+{
+  int i;
+  for (i=0;;i++)
+  {
+    if ( NULL == ((imp+i) -> name))
+      break;
+    else
+      if ( 0 == strcmp(name, (imp+i)->name) )
+        return (imp+i)->data;
+  }
+  return NULL;
+}
+void kol_board_puts(char *s)
+{
+  unsigned i;
+  i = 0;
+  while (*(s+i))
+  {
+    asm ("int $0x40"::"a"(63), "b"(1), "c"(*(s+i)));
+    i++;
+  }
+}
+void kol_exit()
+{
+  asm ("int $0x40"::"a"(-1));
+}

 /programs/develop/tinypy/tinypy/test.py
 ,0 → 1,21
+import kolibri
+def onshow():
+    print("Show window")
+def onkey():
+    print("Key pressed")
+def onbtn():
+    print("Button pressed")
+kolibri.debug_print("Debug test line\n")
+w = kolibri.window(10,10,400, 400, False)
+w.on_show = onshow
+w.on_key = onkey
+w.on_button = onbtn
+w.show()
+print("running")
+w.run()
+print("Exit")

 /programs/develop/tinypy/tinypy/tpmain.c
 ,24 → 1,22
-#include "tinypy.c"
+/* INCLUDE */
+#include "tp.c"
-extern void init_std_modules(TP);
+const char header[] = "TinyPy for KolibriOS";
-int main(int argc, char *argv[]) {
+int main(int argc, const char *argv[]) {
+    /* INIT */
     tp_vm *tp = tp_init(argc,argv);
-    #ifdef CONIO
-    console_load();
-    #endif
-    init_std_modules(tp);
-    tp_ez_call(tp,"py2bc","tinypy",tp_None);
+    kolibri_init(tp);
+    CONSOLE_INIT(header);
+    tp_call(tp,"py2bc","tinypy",tp_None);
+//  con_printf("Done");
     tp_deinit(tp);
-    #ifdef CONIO
-    if(con_enabled==1){
+    // Exit console
         con_exit(0);
-    }
-    #endif
-    return(0);
+    // Exit program
+    return 0;
 }
+/**/

 /programs/develop/tinypy/tinypy/kolibri.h
 ,0 → 1,98
+#ifndef NULL
+#define NULL ((void*)0)
+#endif
+#pragma pack(push,1)
+typedef struct
+{
+unsigned        p00;
+unsigned        p04;
+char            *p08;
+unsigned        p12;
+unsigned        p16;
+char            p20;
+char            *p21;
+} kol_struct70;
+#pragma pack(pop)
+#pragma pack(push,1)
+typedef struct
+{
+unsigned        p00;
+char            p04;
+char            p05[3];
+unsigned        p08;
+unsigned        p12;
+unsigned        p16;
+unsigned        p20;
+unsigned        p24;
+unsigned        p28;
+unsigned long long      p32;
+unsigned        p40;
+} kol_struct_BDVK;
+#pragma pack(pop)
+#pragma pack(push,1)
+typedef struct
+{
+char    *name;
+void    *data;
+} kol_struct_import;
+#pragma pack(pop)
+void kol_exit();
+void kol_sleep(unsigned d);
+void kol_wnd_define(unsigned x, unsigned y, unsigned w, unsigned h, unsigned c);
+void kol_wnd_move(unsigned x, unsigned y);
+void kol_wnd_caption(char *s);
+void kol_event_mask(unsigned e);
+unsigned kol_event_wait();
+unsigned kol_event_wait_time(unsigned time);
+unsigned kol_event_check();
+void kol_paint_start();
+void kol_paint_end();
+void kol_paint_pixel(unsigned x, unsigned y, unsigned c);
+void kol_paint_bar(unsigned x, unsigned y, unsigned w, unsigned h, unsigned c);
+void kol_paint_line(unsigned x1, unsigned y1, unsigned x2, unsigned y2, unsigned c);
+void kol_paint_string(unsigned x, unsigned y, char *s, unsigned c);
+void kol_paint_image(unsigned x, unsigned y, unsigned w, unsigned h, char *d);
+void kol_paint_image_pal(unsigned x, unsigned y, unsigned w, unsigned h, char *d, unsigned *palette);
+unsigned kol_key_get();
+unsigned kol_key_control();
+void kol_key_lang_set(unsigned lang);
+unsigned kol_key_lang_get();
+void kol_key_mode_set(unsigned mode);
+unsigned kol_key_mode_get();
+void kol_btn_define(unsigned x, unsigned y, unsigned w, unsigned h, unsigned d, unsigned c);
+unsigned kol_btn_get();
+void kol_btn_type(unsigned t);
+unsigned kol_mouse_pos();
+unsigned kol_mouse_posw();
+unsigned kol_mouse_btn();
+void kol_board_putc(char c);
+void kol_board_puts(char *s);
+void kol_board_puti(int n);
+int kol_file_70(kol_struct70 *k);
+kol_struct_import* kol_cofflib_load(char *name);
+void* kol_cofflib_procload (kol_struct_import *imp, char *name);
+unsigned kol_cofflib_procnum (kol_struct_import *imp);
+void kol_cofflib_procname (kol_struct_import *imp, char *name, unsigned n);
+unsigned kol_system_end(unsigned param);
+unsigned kol_system_cpufreq();
+unsigned kol_system_mem();
+unsigned kol_system_memfree();
+unsigned kol_system_time_get();
+unsigned kol_system_date_get();
+void kol_path_file2dir(char *dir, char *fname);
+void kol_path_full(char *full, char *fname);
+void kol_screen_wait_rr();
+void kol_screen_get_size(unsigned *w, unsigned *h);
+unsigned kol_skin_height();
+unsigned kol_thread_start(unsigned start, unsigned stack);
+unsigned kol_time_tick();
+unsigned kol_sound_speaker(char data[]);
+unsigned kol_process_info(unsigned slot, char buf1k[]);
+int kol_process_kill_pid(unsigned process);
+void kol_get_kernel_ver(char buff16b[]);
+int kol_kill_process(unsigned process);

 /programs/develop/tinypy/tinypy/builtins.c
 ,0 → 1,209
+tp_obj tp_print(TP) {
+    int n = 0;
+    tp_obj e;
+    TP_LOOP(e)
+        if (n) { con_printf(" "); }
+        con_printf("%s",TP_CSTR(e));
+        n += 1;
+    TP_END;
+    con_printf("\n");
+    return tp_None;
+}
+#define BUF_SIZE 2048
+tp_obj tp_raw_input(TP) {
+    tp_obj prompt;
+    char *buf = malloc(BUF_SIZE);
+    if (tp->params.list.val->len)
+    {
+        prompt = TP_OBJ();
+        con_printf("%s", TP_CSTR(prompt));
+    }
+    con_gets(buf, BUF_SIZE);
+    return tp_string(buf);
+}
+tp_obj tp_bind(TP) {
+    tp_obj r = TP_OBJ();
+    tp_obj self = TP_OBJ();
+    return tp_fnc_new(tp,r.fnc.ftype|2,r.fnc.val,self,r.fnc.info->globals);
+}
+tp_obj tp_min(TP) {
+    tp_obj r = TP_OBJ();
+    tp_obj e;
+    TP_LOOP(e)
+        if (tp_cmp(tp,r,e) > 0) { r = e; }
+    TP_END;
+    return r;
+}
+tp_obj tp_syscall(TP) {
+    tp_obj r = TP_OBJ();
+    int result;
+    asm("int $0x40":"=a"(result):
+        "a"((int)tp_get(tp, r, tp_string_n("eax", 3)).number.val),
+        "b"((int)tp_get(tp, r, tp_string_n("ebx", 3)).number.val),
+        "c"((int)tp_get(tp, r, tp_string_n("ecx", 3)).number.val),
+        "d"((int)tp_get(tp, r, tp_string_n("edx", 3)).number.val));
+    return tp_number(result);
+}
+tp_obj tp_max(TP) {
+    tp_obj r = TP_OBJ();
+    tp_obj e;
+    TP_LOOP(e)
+        if (tp_cmp(tp,r,e) < 0) { r = e; }
+    TP_END;
+    return r;
+}
+tp_obj tp_copy(TP) {
+    tp_obj r = TP_OBJ();
+    int type = r.type;
+    if (type == TP_LIST) {
+        return _tp_list_copy(tp,r);
+    } else if (type == TP_DICT) {
+        return _tp_dict_copy(tp,r);
+    }
+    tp_raise(tp_None,"tp_copy(%s)",TP_CSTR(r));
+}
+tp_obj tp_len_(TP) {
+    tp_obj e = TP_OBJ();
+    return tp_len(tp,e);
+}
+tp_obj tp_assert(TP) {
+    int a = TP_NUM();
+    if (a) { return tp_None; }
+    tp_raise(tp_None,"%s","assert failed");
+}
+tp_obj tp_range(TP) {
+    int a,b,c,i;
+    tp_obj r = tp_list(tp);
+    switch (tp->params.list.val->len) {
+        case 1: a = 0; b = TP_NUM(); c = 1; break;
+        case 2:
+        case 3: a = TP_NUM(); b = TP_NUM(); c = TP_DEFAULT(tp_number(1)).number.val; break;
+        default: return r;
+    }
+    if (c != 0) {
+        for (i=a; (c>0) ? i<b : i>b; i+=c) {
+            _tp_list_append(tp,r.list.val,tp_number(i));
+        }
+    }
+    return r;
+}
+tp_obj tp_system(TP) {
+    char const *s = TP_STR();
+    int r = system(s);
+    return tp_number(r);
+}
+tp_obj tp_istype(TP) {
+    tp_obj v = TP_OBJ();
+    char const *t = TP_STR();
+    if (strcmp("string",t) == 0) { return tp_number(v.type == TP_STRING); }
+    if (strcmp("list",t) == 0) { return tp_number(v.type == TP_LIST); }
+    if (strcmp("dict",t) == 0) { return tp_number(v.type == TP_DICT); }
+    if (strcmp("number",t) == 0) { return tp_number(v.type == TP_NUMBER); }
+    tp_raise(tp_None,"is_type(%s,%s)",TP_CSTR(v),t);
+}
+tp_obj tp_float(TP) {
+    tp_obj v = TP_OBJ();
+    int ord = TP_DEFAULT(tp_number(0)).number.val;
+    int type = v.type;
+    if (type == TP_NUMBER) { return v; }
+    if (type == TP_STRING) {
+        if (strchr(TP_CSTR(v),'.')) { return tp_number(atof(TP_CSTR(v))); }
+        return(tp_number(strtol(TP_CSTR(v),0,ord)));
+    }
+    tp_raise(tp_None,"tp_float(%s)",TP_CSTR(v));
+}
+tp_obj tp_save(TP) {
+    char const *fname = TP_STR();
+    tp_obj v = TP_OBJ();
+    FILE *f;
+    f = fopen(fname,"wb");
+    if (!f) { tp_raise(tp_None,"tp_save(%s,...)",fname); }
+    fwrite(v.string.val,v.string.len,1,f);
+    fclose(f);
+    return tp_None;
+}
+#define READ_BLK 1024
+tp_obj tp_load(TP) {
+    FILE *f;
+    long l = 0;
+    tp_obj r;
+    char *s;
+    char const *fname = TP_STR();
+    long rd = 0;
+    long allocated = 32 * READ_BLK;
+    if (!(f = fopen(fname, "rb"))) {
+        tp_raise(tp_None,"tp_load(%s)",fname);
+    }
+    if (!(s = malloc(allocated)))
+      tp_raise(tp_None, "tp_load(%s): out of memory", fname);
+    rd = 0;
+    do {
+        if (l + READ_BLK < allocated) {
+            allocated += READ_BLK;
+            if (!(s = realloc(s, allocated))) {
+                tp_raise(tp_None, "tp_load(%s): out of memory", fname);
+            }
+        }
+        rd = fread(s + l, 1, READ_BLK, f);
+        l += rd;
+    } while (rd == READ_BLK);
+    r = tp_string_n(s, l);
+    fclose(f);
+    return tp_track(tp,r);
+}
+tp_obj tp_fpack(TP) {
+    tp_num v = TP_NUM();
+    tp_obj r = tp_string_t(tp,sizeof(tp_num));
+    *(tp_num*)r.string.val = v;
+    return tp_track(tp,r);
+}
+tp_obj tp_abs(TP) {
+    return tp_number(fabs(tp_float(tp).number.val));
+}
+tp_obj tp_int(TP) {
+    return tp_number((long)tp_float(tp).number.val);
+}
+tp_num _roundf(tp_num v) {
+    tp_num av = fabs(v); tp_num iv = (long)av;
+    av = (av-iv < 0.5?iv:iv+1);
+    return (v<0?-av:av);
+}
+tp_obj tp_round(TP) {
+    return tp_number(_roundf(tp_float(tp).number.val));
+}
+tp_obj tp_exists(TP) {
+    char const *s = TP_STR();
+    struct stat stbuf;
+    return tp_number(!stat(s,&stbuf));
+}
+tp_obj tp_mtime(TP) {
+    char const *s = TP_STR();
+    struct stat stbuf;
+    if (!stat(s,&stbuf)) { return tp_number(stbuf.st_mtime); }
+    tp_raise(tp_None,"tp_mtime(%s)",s);
+}

 /programs/develop/tinypy/tinypy/vm.c
 ,0 → 1,380
+tp_vm *_tp_init(void) {
+    int i;
+    tp_vm *tp = (tp_vm*)tp_malloc(sizeof(tp_vm));
+    tp->cur = 0;
+    tp->jmp = 0;
+    tp->ex = tp_None;
+    tp->root = tp_list(0);
+    for (i=0; i<256; i++) { tp->chars[i][0]=i; }
+    tp_gc_init(tp);
+    tp->_regs = tp_list(tp);
+    for (i=0; i<TP_REGS; i++) { tp_set(tp,tp->_regs,tp_None,tp_None); }
+    tp->builtins = tp_dict(tp);
+    tp->modules = tp_dict(tp);
+    tp->_params = tp_list(tp);
+    for (i=0; i<TP_FRAMES; i++) { tp_set(tp,tp->_params,tp_None,tp_list(tp)); }
+    tp_set(tp,tp->root,tp_None,tp->builtins);
+    tp_set(tp,tp->root,tp_None,tp->modules);
+    tp_set(tp,tp->root,tp_None,tp->_regs);
+    tp_set(tp,tp->root,tp_None,tp->_params);
+    tp_set(tp,tp->builtins,tp_string("MODULES"),tp->modules);
+    tp_set(tp,tp->modules,tp_string("BUILTINS"),tp->builtins);
+    tp_set(tp,tp->builtins,tp_string("BUILTINS"),tp->builtins);
+    tp->regs = tp->_regs.list.val->items;
+    tp_full(tp);
+    return tp;
+}
+void tp_deinit(TP) {
+    while (tp->root.list.val->len) {
+        _tp_list_pop(tp,tp->root.list.val,0,"tp_deinit");
+    }
+    tp_full(tp); tp_full(tp);
+    tp_delete(tp,tp->root);
+    tp_gc_deinit(tp);
+    tp_free(tp);
+}
+/* tp_frame_*/
+void tp_frame(TP,tp_obj globals,tp_code *codes,tp_obj *ret_dest) {
+    tp_frame_ f;
+    f.globals = globals;
+    f.codes = codes;
+    f.cur = f.codes;
+    f.jmp = 0;
+/*     fprintf(stderr,"tp->cur: %d\n",tp->cur);*/
+    f.regs = (tp->cur <= 0?tp->regs:tp->frames[tp->cur].regs+tp->frames[tp->cur].cregs);
+    f.ret_dest = ret_dest;
+    f.lineno = 0;
+    f.line = tp_string("");
+    f.name = tp_string("?");
+    f.fname = tp_string("?");
+    f.cregs = 0;
+/*     return f;*/
+    if (f.regs+256 >= tp->regs+TP_REGS || tp->cur >= TP_FRAMES-1) { tp_raise(,"tp_frame: stack overflow %d",tp->cur); }
+    tp->cur += 1;
+    tp->frames[tp->cur] = f;
+}
+void _tp_raise(TP,tp_obj e) {
+    if (!tp || !tp->jmp) {
+        con_printf("\nException:\n%s\n",TP_CSTR(e));
+        exit(-1);
+        return;
+    }
+    if (e.type != TP_NONE) { tp->ex = e; }
+    tp_grey(tp,e);
+    longjmp(tp->buf,1);
+}
+void tp_print_stack(TP) {
+    int i;
+    con_printf("\n");
+    for (i=0; i<=tp->cur; i++) {
+        if (!tp->frames[i].lineno) { continue; }
+        con_printf("File \"%s\", line %d, in %s\n  %s\n",
+            TP_CSTR(tp->frames[i].fname),tp->frames[i].lineno,
+            TP_CSTR(tp->frames[i].name),TP_CSTR(tp->frames[i].line));
+    }
+    con_printf("\nException:\n%s\n",TP_CSTR(tp->ex));
+}
+void tp_handle(TP) {
+    int i;
+    for (i=tp->cur; i>=0; i--) {
+        if (tp->frames[i].jmp) { break; }
+    }
+    if (i >= 0) {
+        tp->cur = i;
+        tp->frames[i].cur = tp->frames[i].jmp;
+        tp->frames[i].jmp = 0;
+        return;
+    }
+    tp_print_stack(tp);
+    exit(-1);
+}
+void _tp_call(TP,tp_obj *dest, tp_obj fnc, tp_obj params) {
+    /*con_printf("_tp_call %s %s\n",TP_CSTR(fnc), TP_CSTR(params));*/
+    if (fnc.type == TP_DICT) {
+        _tp_call(tp,dest,tp_get(tp,fnc,tp_string("__call__")),params);
+        return;
+    }
+    if (fnc.type == TP_FNC && !(fnc.fnc.ftype&1)) {
+        *dest = _tp_tcall(tp,fnc);
+        tp_grey(tp,*dest);
+        return;
+    }
+    if (fnc.type == TP_FNC) {
+        tp_frame(tp,fnc.fnc.info->globals,(tp_code*)fnc.fnc.val,dest);
+        if ((fnc.fnc.ftype&2)) {
+            tp->frames[tp->cur].regs[0] = params;
+            _tp_list_insert(tp,params.list.val,0,fnc.fnc.info->self);
+        } else {
+            tp->frames[tp->cur].regs[0] = params;
+        }
+        return;
+    }
+    tp_params_v(tp,1,fnc); tp_print(tp);
+    tp_raise(,"tp_call: %s is not callable",TP_CSTR(fnc));
+}
+void tp_return(TP, tp_obj v) {
+    tp_obj *dest = tp->frames[tp->cur].ret_dest;
+    if (dest) { *dest = v; tp_grey(tp,v); }
+/*     memset(tp->frames[tp->cur].regs,0,TP_REGS_PER_FRAME*sizeof(tp_obj));
+       fprintf(stderr,"regs:%d\n",(tp->frames[tp->cur].cregs+1));*/
+    memset(tp->frames[tp->cur].regs,0,tp->frames[tp->cur].cregs*sizeof(tp_obj));
+    tp->cur -= 1;
+}
+enum {
+    TP_IEOF,TP_IADD,TP_ISUB,TP_IMUL,TP_IDIV,TP_IPOW,TP_IAND,TP_IOR,TP_ICMP,TP_IGET,TP_ISET,
+    TP_INUMBER,TP_ISTRING,TP_IGGET,TP_IGSET,TP_IMOVE,TP_IDEF,TP_IPASS,TP_IJUMP,TP_ICALL,
+    TP_IRETURN,TP_IIF,TP_IDEBUG,TP_IEQ,TP_ILE,TP_ILT,TP_IDICT,TP_ILIST,TP_INONE,TP_ILEN,
+    TP_ILINE,TP_IPARAMS,TP_IIGET,TP_IFILE,TP_INAME,TP_INE,TP_IHAS,TP_IRAISE,TP_ISETJMP,
+    TP_IMOD,TP_ILSH,TP_IRSH,TP_IITER,TP_IDEL,TP_IREGS,
+    TP_ITOTAL
+};
+/* char *tp_strings[TP_ITOTAL] = {
+       "EOF","ADD","SUB","MUL","DIV","POW","AND","OR","CMP","GET","SET","NUM",
+       "STR","GGET","GSET","MOVE","DEF","PASS","JUMP","CALL","RETURN","IF","DEBUG",
+       "EQ","LE","LT","DICT","LIST","NONE","LEN","LINE","PARAMS","IGET","FILE",
+       "NAME","NE","HAS","RAISE","SETJMP","MOD","LSH","RSH","ITER","DEL","REGS",
+   };*/
+#define VA ((int)e.regs.a)
+#define VB ((int)e.regs.b)
+#define VC ((int)e.regs.c)
+#define RA regs[e.regs.a]
+#define RB regs[e.regs.b]
+#define RC regs[e.regs.c]
+#define UVBC (unsigned short)(((VB<<8)+VC))
+#define SVBC (short)(((VB<<8)+VC))
+#define GA tp_grey(tp,RA)
+#define SR(v) f->cur = cur; return(v);
+int tp_step(TP) {
+    tp_frame_ *f = &tp->frames[tp->cur];
+    tp_obj *regs = f->regs;
+    tp_code *cur = f->cur;
+    while(1) {
+    tp_code e = *cur;
+/*     fprintf(stderr,"%2d.%4d: %-6s %3d %3d %3d\n",tp->cur,cur-f->codes,tp_strings[e.i],VA,VB,VC);
+       int i; for(i=0;i<16;i++) { fprintf(stderr,"%d: %s\n",i,TP_CSTR(regs[i])); }*/
+    switch (e.i) {
+        case TP_IEOF: tp_return(tp,tp_None); SR(0); break;
+        case TP_IADD: RA = tp_add(tp,RB,RC); break;
+        case TP_ISUB: RA = tp_sub(tp,RB,RC); break;
+        case TP_IMUL: RA = tp_mul(tp,RB,RC); break;
+        case TP_IDIV: RA = tp_div(tp,RB,RC); break;
+        case TP_IPOW: RA = tp_pow(tp,RB,RC); break;
+        case TP_IAND: RA = tp_and(tp,RB,RC); break;
+        case TP_IOR:  RA = tp_or(tp,RB,RC); break;
+        case TP_IMOD:  RA = tp_mod(tp,RB,RC); break;
+        case TP_ILSH:  RA = tp_lsh(tp,RB,RC); break;
+        case TP_IRSH:  RA = tp_rsh(tp,RB,RC); break;
+        case TP_ICMP: RA = tp_number(tp_cmp(tp,RB,RC)); break;
+        case TP_INE: RA = tp_number(tp_cmp(tp,RB,RC)!=0); break;
+        case TP_IEQ: RA = tp_number(tp_cmp(tp,RB,RC)==0); break;
+        case TP_ILE: RA = tp_number(tp_cmp(tp,RB,RC)<=0); break;
+        case TP_ILT: RA = tp_number(tp_cmp(tp,RB,RC)<0); break;
+        case TP_IPASS: break;
+        case TP_IIF: if (tp_bool(tp,RA)) { cur += 1; } break;
+        case TP_IGET: RA = tp_get(tp,RB,RC); GA; break;
+        case TP_IITER:
+            if (RC.number.val < tp_len(tp,RB).number.val) {
+                RA = tp_iter(tp,RB,RC); GA;
+                RC.number.val += 1;
+                cur += 1;
+            }
+            break;
+        case TP_IHAS: RA = tp_has(tp,RB,RC); break;
+        case TP_IIGET: tp_iget(tp,&RA,RB,RC); break;
+        case TP_ISET: tp_set(tp,RA,RB,RC); break;
+        case TP_IDEL: tp_del(tp,RA,RB); break;
+        case TP_IMOVE: RA = RB; break;
+        case TP_INUMBER:
+            RA = tp_number(*(tp_num*)(*++cur).string.val);
+            cur += sizeof(tp_num)/4;
+            continue;
+        case TP_ISTRING:
+            RA = tp_string_n((*(cur+1)).string.val,UVBC);
+            cur += (UVBC/4)+1;
+            break;
+        case TP_IDICT: RA = tp_dict_n(tp,VC/2,&RB); break;
+        case TP_ILIST: RA = tp_list_n(tp,VC,&RB); break;
+        case TP_IPARAMS: RA = tp_params_n(tp,VC,&RB); break;
+        case TP_ILEN: RA = tp_len(tp,RB); break;
+        case TP_IJUMP: cur += SVBC; continue; break;
+        case TP_ISETJMP: f->jmp = cur+SVBC; break;
+        case TP_ICALL: _tp_call(tp,&RA,RB,RC); cur++; SR(0); break;
+        case TP_IGGET:
+            if (!tp_iget(tp,&RA,f->globals,RB)) {
+                RA = tp_get(tp,tp->builtins,RB); GA;
+            }
+            break;
+        case TP_IGSET: tp_set(tp,f->globals,RA,RB); break;
+        case TP_IDEF:
+            RA = tp_def(tp,(*(cur+1)).string.val,f->globals);
+            cur += SVBC; continue;
+            break;
+        case TP_IRETURN: tp_return(tp,RA); SR(0); break;
+        case TP_IRAISE: _tp_raise(tp,RA); SR(0); break;
+        case TP_IDEBUG:
+            tp_params_v(tp,3,tp_string("DEBUG:"),tp_number(VA),RA); tp_print(tp);
+            break;
+        case TP_INONE: RA = tp_None; break;
+        case TP_ILINE:
+            f->line = tp_string_n((*(cur+1)).string.val,VA*4-1);
+/*             fprintf(stderr,"%7d: %s\n",UVBC,f->line.string.val);*/
+            cur += VA; f->lineno = UVBC;
+            break;
+        case TP_IFILE: f->fname = RA; break;
+        case TP_INAME: f->name = RA; break;
+        case TP_IREGS: f->cregs = VA; break;
+        default: tp_raise(0,"tp_step: invalid instruction %d",e.i); break;
+    }
+    cur += 1;
+    }
+    SR(0);
+}
+void tp_run(TP,int cur) {
+    if (tp->jmp) {
+      tp_raise(,"tp_run(%d) called recusively",cur);
+    }
+    tp->jmp = 1;
+    if (setjmp(tp->buf))
+    {
+      tp_handle(tp);
+    }
+    while (tp->cur >= cur && tp_step(tp) != -1);
+    tp->cur = cur-1;
+    tp->jmp = 0;
+}
+tp_obj tp_call(TP, const char *mod, const char *fnc, tp_obj params) {
+    tp_obj tmp;
+    tp_obj r = tp_None;
+    tmp = tp_get(tp,tp->modules,tp_string(mod));
+    tmp = tp_get(tp,tmp,tp_string(fnc));
+    _tp_call(tp,&r,tmp,params);
+    tp_run(tp,tp->cur);
+    return r;
+}
+tp_obj tp_import(TP, char const *fname, char const *name, void *codes) {
+    tp_obj code = tp_None;
+    tp_obj g;
+    if (!((fname && strstr(fname,".tpc")) || codes)) {
+        return tp_call(tp,"py2bc","import_fname",tp_params_v(tp,2,tp_string(fname),tp_string(name)));
+    }
+    if (!codes) {
+        tp_params_v(tp,1,tp_string(fname));
+        code = tp_load(tp);
+        /* We cast away the constness. */
+        codes = (void *)code.string.val;
+    } else {
+        code = tp_data(tp,0,codes);
+    }
+    g = tp_dict(tp);
+    tp_set(tp,g,tp_string("__name__"),tp_string(name));
+    tp_set(tp,g,tp_string("__code__"),code);
+    tp_set(tp,g,tp_string("__dict__"),g);
+    tp_frame(tp,g,(tp_code*)codes,0);
+    tp_set(tp,tp->modules,tp_string(name),g);
+    if (!tp->jmp) {
+      tp_run(tp,tp->cur);
+    }
+    return g;
+}
+tp_obj tp_exec_(TP) {
+    tp_obj code = TP_OBJ();
+    tp_obj globals = TP_OBJ();
+    tp_frame(tp,globals,(tp_code*)code.string.val,0);
+    return tp_None;
+}
+tp_obj tp_import_(TP) {
+    tp_obj mod = TP_OBJ();
+    char const *s;
+    tp_obj r;
+    if (tp_has(tp,tp->modules,mod).number.val) {
+        return tp_get(tp,tp->modules,mod);
+    }
+    s = TP_CSTR(mod);
+    r = tp_import(tp,TP_CSTR(tp_add(tp,mod,tp_string(".tpc"))),s,0);
+    return r;
+}
+void tp_builtins(TP) {
+    struct {const char *s;void *f;} b[] = {
+    {"print",tp_print}, {"range",tp_range}, {"raw_input", tp_raw_input},
+    {"min",tp_min}, {"max",tp_max}, {"bind",tp_bind}, {"copy",tp_copy},
+    {"import",tp_import_}, {"len",tp_len_}, {"assert",tp_assert},
+    {"str",tp_str2}, {"float",tp_float}, {"system",tp_system},
+    {"istype",tp_istype}, {"chr",tp_chr}, {"save",tp_save},
+    {"load",tp_load}, {"fpack",tp_fpack}, {"abs",tp_abs},
+    {"int",tp_int}, {"exec",tp_exec_}, {"exists",tp_exists},
+    {"mtime",tp_mtime}, {"number",tp_float}, {"round",tp_round},
+    {"ord",tp_ord}, {"merge",tp_merge}, {"syscall", tp_syscall}, {0,0},
+    };
+    int i; for(i=0; b[i].s; i++) {
+        tp_set(tp,tp->builtins,tp_string(b[i].s),tp_fnc(tp,(tp_obj (*)(tp_vm *))b[i].f));
+    }
+}
+void tp_args(TP,int argc, char *argv[]) {
+    tp_obj self = tp_list(tp);
+    int i;
+    for (i=1; i<argc; i++) { _tp_list_append(tp,self.list.val,tp_string(argv[i])); }
+    tp_set(tp,tp->builtins,tp_string("ARGV"),self);
+}
+tp_obj tp_main(TP,char *fname, void *code) {
+    return tp_import(tp,fname,"__main__",code);
+}
+tp_obj tp_compile(TP, tp_obj text, tp_obj fname) {
+    return tp_call(tp,"BUILTINS","compile",tp_params_v(tp,2,text,fname));
+}
+tp_obj tp_exec(TP,tp_obj code, tp_obj globals) {
+    tp_obj r=tp_None;
+    tp_frame(tp,globals,(tp_code*)code.string.val,&r);
+    tp_run(tp,tp->cur);
+    return r;
+}
+tp_obj tp_eval(TP, char *text, tp_obj globals) {
+    tp_obj code = tp_compile(tp,tp_string(text),tp_string("<eval>"));
+    return tp_exec(tp,code,globals);
+}
+tp_vm *tp_init(int argc, char *argv[]) {
+    tp_vm *tp = _tp_init();
+    tp_builtins(tp);
+    tp_args(tp,argc,argv);
+    tp_compiler(tp);
+    return tp;
+}
+/**/

 /programs/develop/tinypy/tinypy/py2bc.py
 ,0 → 1,53
+print("Starting py2bc")
+if not (str(1.0) == "1"):
+    from boot import *
+import tokenize,parse,encode
+def _compile(s,fname):
+    tokens = tokenize.tokenize(s)
+    t = parse.parse(s,tokens)
+    r = encode.encode(fname,s,t)
+    return r
+def _import(name):
+    if name in MODULES:
+        return MODULES[name]
+    py = name+".py"
+    tpc = name+".tpc"
+    if exists(py):
+        if not exists(tpc) or mtime(py) > mtime(tpc):
+            s = load(py)
+            code = _compile(s,py)
+            save(tpc,code)
+    if not exists(tpc): raise
+    code = load(tpc)
+    g = {'__name__':name,'__code__':code}
+    g['__dict__'] = g
+    MODULES[name] = g
+    exec(code,g)
+    return g
+def _init():
+    BUILTINS['compile'] = _compile
+    BUILTINS['import'] = _import
+def import_fname(fname,name):
+    g = {}
+    g['__name__'] = name
+    MODULES[name] = g
+    s = load(fname)
+    code = _compile(s,fname)
+    g['__code__'] = code
+    exec(code,g)
+    return g
+def tinypy():
+    return import_fname(ARGV[0],'__main__')
+def main(src,dest):
+    s = load(src)
+    r = _compile(s,src)
+    save(dest,r)
+if __name__ == '__main__':
+    main(ARGV[1],ARGV[2])

 /programs/develop/tinypy/tinypy/ops.c
 ,0 → 1,274
+tp_obj tp_str(TP,tp_obj self) {
+    int type = self.type;
+    if (type == TP_STRING) {
+      return self;
+    }
+    if (type == TP_NUMBER) {
+        tp_num v = self.number.val;
+        if ((fabs(v)-fabs((long)v)) < 0.000001) { return tp_printf(tp,"%ld",(long)v); }
+        return tp_printf(tp,"%f",v);
+    } else if(type == TP_DICT) {
+        return tp_printf(tp,"<dict 0x%x>",self.dict.val);
+    } else if(type == TP_LIST) {
+        return tp_printf(tp,"<list 0x%x>",self.list.val);
+    } else if (type == TP_NONE) {
+        return tp_string("None");
+    } else if (type == TP_DATA) {
+        return tp_printf(tp,"<data 0x%x>",self.data.val);
+    } else if (type == TP_FNC) {
+        return tp_printf(tp,"<fnc 0x%x>",self.fnc.info);
+    }
+    return tp_string("<?>");
+}
+int tp_bool(TP,tp_obj v) {
+    switch(v.type) {
+        case TP_NUMBER: return v.number.val != 0;
+        case TP_NONE: return 0;
+        case TP_STRING: return v.string.len != 0;
+        case TP_LIST: return v.list.val->len != 0;
+        case TP_DICT: return v.dict.val->len != 0;
+    }
+    return 1;
+}
+tp_obj tp_has(TP,tp_obj self, tp_obj k) {
+    int type = self.type;
+    if (type == TP_DICT) {
+        if (_tp_dict_find(tp,self.dict.val,k) != -1) { return tp_True; }
+        return tp_False;
+    } else if (type == TP_STRING && k.type == TP_STRING) {
+        char *p = strstr(TP_CSTR(self),TP_CSTR(k));
+        return tp_number(p != 0);
+    } else if (type == TP_LIST) {
+        return tp_number(_tp_list_find(tp,self.list.val,k)!=-1);
+    }
+    tp_raise(tp_None,"tp_has(%s,%s)",TP_CSTR(self),TP_CSTR(k));
+}
+void tp_del(TP,tp_obj self, tp_obj k) {
+    int type = self.type;
+    if (type == TP_DICT) {
+        _tp_dict_del(tp,self.dict.val,k,"tp_del");
+        return;
+    }
+    tp_raise(,"tp_del(%s,%s)",TP_CSTR(self),TP_CSTR(k));
+}
+tp_obj tp_iter(TP,tp_obj self, tp_obj k) {
+    int type = self.type;
+    if (type == TP_LIST || type == TP_STRING) { return tp_get(tp,self,k); }
+    if (type == TP_DICT && k.type == TP_NUMBER) {
+        return self.dict.val->items[_tp_dict_next(tp,self.dict.val)].key;
+    }
+    tp_raise(tp_None,"tp_iter(%s,%s)",TP_CSTR(self),TP_CSTR(k));
+}
+tp_obj tp_get(TP,tp_obj self, tp_obj k) {
+    int type = self.type;
+    tp_obj r;
+    if (type == TP_DICT) {
+        return _tp_dict_get(tp,self.dict.val,k,"tp_get");
+    } else if (type == TP_LIST) {
+        if (k.type == TP_NUMBER) {
+            int l = tp_len(tp,self).number.val;
+            int n = k.number.val;
+            n = (n<0?l+n:n);
+            return _tp_list_get(tp,self.list.val,n,"tp_get");
+        } else if (k.type == TP_STRING) {
+            if (strcmp("append",TP_CSTR(k)) == 0) {
+                return tp_method(tp,self,tp_append);
+            } else if (strcmp("pop",TP_CSTR(k)) == 0) {
+                return tp_method(tp,self,tp_pop);
+            } else if (strcmp("index",TP_CSTR(k)) == 0) {
+                return tp_method(tp,self,tp_index);
+            } else if (strcmp("sort",TP_CSTR(k)) == 0) {
+                return tp_method(tp,self,tp_sort);
+            } else if (strcmp("extend",TP_CSTR(k)) == 0) {
+                return tp_method(tp,self,tp_extend);
+            } else if (strcmp("*",TP_CSTR(k)) == 0) {
+                tp_params_v(tp,1,self);
+                r = tp_copy(tp);
+                self.list.val->len=0;
+                return r;
+            }
+        } else if (k.type == TP_NONE) {
+            return _tp_list_pop(tp,self.list.val,0,"tp_get");
+        }
+    } else if (type == TP_STRING) {
+        if (k.type == TP_NUMBER) {
+            int l = self.string.len;
+            int n = k.number.val;
+            n = (n<0?l+n:n);
+            if (n >= 0 && n < l) { return tp_string_n(tp->chars[(unsigned char)self.string.val[n]],1); }
+        } else if (k.type == TP_STRING) {
+            if (strcmp("join",TP_CSTR(k)) == 0) {
+                return tp_method(tp,self,tp_join);
+            } else if (strcmp("split",TP_CSTR(k)) == 0) {
+                return tp_method(tp,self,tp_split);
+            } else if (strcmp("index",TP_CSTR(k)) == 0) {
+                return tp_method(tp,self,tp_str_index);
+            } else if (strcmp("strip",TP_CSTR(k)) == 0) {
+                return tp_method(tp,self,tp_strip);
+            } else if (strcmp("replace",TP_CSTR(k)) == 0) {
+                return tp_method(tp,self,tp_replace);
+            }
+        }
+    }
+    if (k.type == TP_LIST) {
+        int a,b,l;
+        tp_obj tmp;
+        l = tp_len(tp,self).number.val;
+        tmp = tp_get(tp,k,tp_number(0));
+        if (tmp.type == TP_NUMBER) { a = tmp.number.val; }
+        else if(tmp.type == TP_NONE) { a = 0; }
+        else { tp_raise(tp_None,"%s is not a number",TP_CSTR(tmp)); }
+        tmp = tp_get(tp,k,tp_number(1));
+        if (tmp.type == TP_NUMBER) { b = tmp.number.val; }
+        else if(tmp.type == TP_NONE) { b = l; }
+        else { tp_raise(tp_None,"%s is not a number",TP_CSTR(tmp)); }
+        a = _tp_max(0,(a<0?l+a:a)); b = _tp_min(l,(b<0?l+b:b));
+        if (type == TP_LIST) {
+            return tp_list_n(tp,b-a,&self.list.val->items[a]);
+        } else if (type == TP_STRING) {
+            tp_obj r = tp_string_t(tp,b-a);
+            char *ptr = r.string.info->s;
+            memcpy(ptr,self.string.val+a,b-a); ptr[b-a]=0;
+            return tp_track(tp,r);
+        }
+    }
+    tp_raise(tp_None,"tp_get(%s,%s)",TP_CSTR(self),TP_CSTR(k));
+}
+int tp_iget(TP,tp_obj *r, tp_obj self, tp_obj k) {
+    if (self.type == TP_DICT) {
+        int n = _tp_dict_find(tp,self.dict.val,k);
+        if (n == -1) { return 0; }
+        *r = self.dict.val->items[n].val;
+        tp_grey(tp,*r);
+        return 1;
+    }
+    if (self.type == TP_LIST && !self.list.val->len) { return 0; }
+    *r = tp_get(tp,self,k); tp_grey(tp,*r);
+    return 1;
+}
+void tp_set(TP,tp_obj self, tp_obj k, tp_obj v) {
+    int type;
+    type = self.type;
+    if (type == TP_DICT) {
+        _tp_dict_set(tp,self.dict.val,k,v);
+        return;
+    } else if (type == TP_LIST) {
+        if (k.type == TP_NUMBER) {
+            _tp_list_set(tp,self.list.val,k.number.val,v,"tp_set");
+            return;
+        } else if (k.type == TP_NONE) {
+            _tp_list_append(tp,self.list.val,v);
+            return;
+        } else if (k.type == TP_STRING) {
+            if (strcmp("*",TP_CSTR(k)) == 0) {
+                tp_params_v(tp,2,self,v); tp_extend(tp);
+                return;
+            }
+        }
+    }
+    tp_raise(,"tp_set(%s,%s,%s)",TP_CSTR(self),TP_CSTR(k),TP_CSTR(v));
+}
+tp_obj tp_add(TP,tp_obj a, tp_obj b) {
+    if (a.type == TP_NUMBER && a.type == b.type) {
+        return tp_number(a.number.val+b.number.val);
+    } else if (a.type == TP_STRING && a.type == b.type) {
+        int al = a.string.len, bl = b.string.len;
+        tp_obj r = tp_string_t(tp,al+bl);
+        char *s = r.string.info->s;
+        memcpy(s,a.string.val,al); memcpy(s+al,b.string.val,bl);
+        return tp_track(tp,r);
+    } else if (a.type == TP_LIST && a.type == b.type) {
+        tp_obj r;
+        tp_params_v(tp,1,a);
+        r = tp_copy(tp);
+        tp_params_v(tp,2,r,b);
+        tp_extend(tp);
+        return r;
+    }
+    tp_raise(tp_None,"tp_add(%s,%s)",TP_CSTR(a),TP_CSTR(b));
+}
+tp_obj tp_mul(TP,tp_obj a, tp_obj b) {
+    if (a.type == TP_NUMBER && a.type == b.type) {
+        return tp_number(a.number.val*b.number.val);
+    } else if (a.type == TP_STRING && b.type == TP_NUMBER) {
+        int al = a.string.len; int n = b.number.val;
+        tp_obj r = tp_string_t(tp,al*n);
+        char *s = r.string.info->s;
+        int i; for (i=0; i<n; i++) { memcpy(s+al*i,a.string.val,al); }
+        return tp_track(tp,r);
+    }
+    tp_raise(tp_None,"tp_mul(%s,%s)",TP_CSTR(a),TP_CSTR(b));
+}
+tp_obj tp_len(TP,tp_obj self) {
+    int type = self.type;
+    if (type == TP_STRING) {
+        return tp_number(self.string.len);
+    } else if (type == TP_DICT) {
+        return tp_number(self.dict.val->len);
+    } else if (type == TP_LIST) {
+        return tp_number(self.list.val->len);
+    }
+    tp_raise(tp_None,"tp_len(%s)",TP_CSTR(self));
+}
+int tp_cmp(TP,tp_obj a, tp_obj b) {
+    if (a.type != b.type) { return a.type-b.type; }
+    switch(a.type) {
+        case TP_NONE: return 0;
+        case TP_NUMBER: return _tp_sign(a.number.val-b.number.val);
+        case TP_STRING: {
+            int v = memcmp(a.string.val,b.string.val,_tp_min(a.string.len,b.string.len));
+            if (v == 0) { v = a.string.len-b.string.len; }
+            return v;
+        }
+        case TP_LIST: {
+            int n,v; for(n=0;n<_tp_min(a.list.val->len,b.list.val->len);n++) {
+        tp_obj aa = a.list.val->items[n]; tp_obj bb = b.list.val->items[n];
+            if (aa.type == TP_LIST && bb.type == TP_LIST) { v = aa.list.val-bb.list.val; } else { v = tp_cmp(tp,aa,bb); }
+            if (v) { return v; } }
+            return a.list.val->len-b.list.val->len;
+        }
+        case TP_DICT: return a.dict.val - b.dict.val;
+        case TP_FNC: return a.fnc.info - b.fnc.info;
+        case TP_DATA: return (char*)a.data.val - (char*)b.data.val;
+    }
+    tp_raise(0,"tp_cmp(%s,%s)",TP_CSTR(a),TP_CSTR(b));
+}
+#define TP_OP(name,expr) \
+    tp_obj name(TP,tp_obj _a,tp_obj _b) { \
+    if (_a.type == TP_NUMBER && _a.type == _b.type) { \
+        tp_num a = _a.number.val; tp_num b = _b.number.val; \
+        return tp_number(expr); \
+    } \
+    tp_raise(tp_None,"%s(%s,%s)",#name,TP_CSTR(_a),TP_CSTR(_b)); \
+}
+TP_OP(tp_and,((long)a)&((long)b));
+TP_OP(tp_or,((long)a)|((long)b));
+TP_OP(tp_mod,((long)a)%((long)b));
+TP_OP(tp_lsh,((long)a)<<((long)b));
+TP_OP(tp_rsh,((long)a)>>((long)b));
+TP_OP(tp_sub,a-b);
+TP_OP(tp_div,a/b);
+TP_OP(tp_pow,pow(a,b));
+/**/

 /programs/develop/tinypy/tinypy/bc.c
 ,594 → 1,365
 unsigned char tp_tokenize[] = {
-,67,0,0,30,4,0,1,99,108,97,115,115,32,84,111,
-,101,110,58,0,0,0,0,12,0,0,16,99,111,114,101,
-,116,111,107,101,110,105,122,101,46,112,121,0,0,0,0,
-,0,0,0,12,0,0,1,63,0,0,0,34,0,0,0,
-,0,0,0,12,1,0,5,84,111,107,101,110,0,0,0,
-,1,0,0,12,3,0,7,115,101,116,109,101,116,97,0,
-,2,3,0,15,3,0,0,12,5,0,6,111,98,106,101,
-,116,0,0,13,4,5,0,31,1,3,2,19,1,2,1,
-,1,0,91,44,11,0,0,30,17,0,2,32,32,32,32,
-,101,102,32,95,95,105,110,105,116,95,95,40,115,101,108,
-,44,112,111,115,61,40,48,44,48,41,44,116,121,112,101,
-,39,115,121,109,98,111,108,39,44,118,97,108,61,78,111,
-,101,44,105,116,101,109,115,61,78,111,110,101,41,58,0,
-,1,0,16,99,111,114,101,47,116,111,107,101,110,105,122,
-,46,112,121,0,0,0,0,33,1,0,0,12,1,0,8,
-,95,105,110,105,116,95,95,0,0,0,0,34,1,0,0,
+,65,0,0,26,0,0,0,12,1,0,5,84,111,107,101,
+,0,0,0,14,1,0,0,16,1,0,43,44,11,0,0,
 ,2,0,0,9,1,0,2,11,3,0,0,0,0,0,0,
 ,0,0,0,11,4,0,0,0,0,0,0,0,0,0,0,
 ,2,3,2,28,3,0,0,32,2,0,3,12,3,0,6,
 ,121,109,98,111,108,0,0,28,4,0,0,32,3,0,4,
 ,4,0,0,28,5,0,0,32,4,0,5,28,5,0,0,
-,6,0,0,32,5,0,6,30,17,0,3,32,32,32,32,
-,32,32,32,115,101,108,102,46,112,111,115,44,115,101,108,
-,46,116,121,112,101,44,115,101,108,102,46,118,97,108,44,
-,101,108,102,46,105,116,101,109,115,61,112,111,115,44,116,
-,112,101,44,118,97,108,44,105,116,101,109,115,0,0,0,
-,6,2,0,15,7,3,0,15,8,4,0,15,9,5,0,
-,10,0,3,112,111,115,0,10,1,10,6,12,6,0,4,
-,121,112,101,0,0,0,0,10,1,6,7,12,6,0,3,
-,97,108,0,10,1,6,8,12,6,0,5,105,116,101,109,
-,0,0,0,10,1,6,9,0,0,0,0,12,2,0,8,
-,95,105,110,105,116,95,95,0,0,0,0,10,0,2,1,
-,6,0,5,100,101,102,32,117,95,101,114,114,111,114,40,
-,116,120,44,115,44,105,41,58,0,0,0,16,0,0,177,
-,12,0,0,30,6,0,5,100,101,102,32,117,95,101,114,
-,111,114,40,99,116,120,44,115,44,105,41,58,0,0,0,
-,1,0,16,99,111,114,101,47,116,111,107,101,110,105,122,
-,46,112,121,0,0,0,0,33,1,0,0,12,1,0,7,
-,95,101,114,114,111,114,0,34,1,0,0,28,2,0,0,
-,1,0,2,28,3,0,0,9,2,0,3,28,4,0,0,
-,3,0,4,30,3,0,6,32,32,32,32,121,44,120,32,
-,32,105,0,11,6,0,0,0,0,0,0,0,0,0,0,
-,5,3,6,15,4,5,0,11,7,0,0,0,0,0,0,
-,0,240,63,9,6,3,7,15,5,6,0,30,8,0,7,
-,32,32,32,108,105,110,101,32,61,32,115,46,115,112,108,
-,116,40,39,92,110,39,41,91,121,45,49,93,0,0,0,
-,8,0,5,115,112,108,105,116,0,0,0,9,7,2,8,
-,8,0,1,10,0,0,0,31,6,8,1,19,6,7,6,
-,8,0,0,0,0,0,0,0,0,240,63,2,7,4,8,
-,6,6,7,15,3,6,0,30,3,0,8,32,32,32,32,
-,32,61,32,39,39,0,0,12,7,0,0,0,0,0,0,
-,6,7,0,30,6,0,9,32,32,32,32,105,102,32,121,
-,60,32,49,48,58,32,112,32,43,61,32,39,32,39,0,
-,8,0,0,0,0,0,0,0,0,36,64,25,7,4,8,
-,7,0,0,18,0,0,6,12,8,0,1,32,0,0,0,
-,7,6,8,15,6,7,0,18,0,0,1,30,7,0,10,
-,32,32,32,105,102,32,121,32,60,32,49,48,48,58,32,
-,32,43,61,32,39,32,32,39,0,0,0,11,8,0,0,
-,0,0,0,0,0,89,64,25,7,4,8,21,7,0,0,
-,0,0,6,12,8,0,2,32,32,0,0,1,7,6,8,
-,6,7,0,18,0,0,1,30,10,0,11,32,32,32,32,
-,32,61,32,112,32,43,32,115,116,114,40,121,41,32,43,
-,34,58,32,34,32,43,32,108,105,110,101,32,43,32,34,
-,110,34,0,12,11,0,3,115,116,114,0,13,10,11,0,
-,11,4,0,31,9,11,1,19,9,10,9,1,8,6,9,
-,9,0,2,58,32,0,0,1,8,8,9,1,8,8,3,
-,9,0,1,10,0,0,0,1,8,8,9,15,7,8,0,
-,9,0,12,32,32,32,32,114,32,43,61,32,34,32,32,
-,32,32,34,43,34,32,34,42,120,43,34,94,34,32,43,
-,92,110,39,0,0,0,0,12,9,0,5,32,32,32,32,
-,0,0,0,12,10,0,1,32,0,0,0,3,10,10,5,
-,9,9,10,12,10,0,1,94,0,0,0,1,9,9,10,
-,10,0,1,10,0,0,0,1,9,9,10,1,8,7,9,
-,7,8,0,30,8,0,13,32,32,32,32,114,97,105,115,
-,32,39,101,114,114,111,114,58,32,39,43,99,116,120,43,
-,92,110,39,43,114,0,0,12,8,0,7,101,114,114,111,
+,6,0,0,32,5,0,6,15,6,2,0,15,7,3,0,
+,8,4,0,15,9,5,0,12,10,0,3,112,111,115,0,
+,1,10,6,12,6,0,4,116,121,112,101,0,0,0,0,
+,1,6,7,12,6,0,3,118,97,108,0,10,1,6,8,
+,6,0,5,105,116,101,109,115,0,0,0,10,1,6,9,
+,0,0,0,12,2,0,8,95,95,105,110,105,116,95,95,
+,0,0,0,10,0,2,1,16,2,0,26,44,7,0,0,
+,2,0,0,9,1,0,2,12,4,0,4,98,105,110,100,
+,0,0,0,13,3,4,0,12,6,0,5,84,111,107,101,
+,0,0,0,13,4,6,0,12,6,0,8,95,95,105,110,
+,116,95,95,0,0,0,0,9,4,4,6,15,5,1,0,
+,2,4,2,19,2,3,2,12,3,0,8,95,95,105,110,
+,116,95,95,0,0,0,0,10,1,3,2,0,0,0,0,
+,3,0,7,95,95,110,101,119,95,95,0,10,0,3,2,
+,3,0,22,44,5,0,0,26,1,0,0,12,4,0,5,
+,111,107,101,110,0,0,0,13,3,4,0,12,4,0,7,
+,95,110,101,119,95,95,0,9,3,3,4,15,4,1,0,
+,2,4,1,19,2,3,2,12,3,0,8,95,95,105,110,
+,116,95,95,0,0,0,0,9,2,1,3,19,4,2,0,
+,1,0,0,0,0,0,0,12,4,0,8,95,95,99,97,
+,108,95,95,0,0,0,0,10,0,4,3,16,0,0,97,
+,12,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
+,2,0,3,28,4,0,0,9,3,0,4,11,6,0,0,
+,0,0,0,0,0,0,0,9,5,3,6,15,4,5,0,
+,7,0,0,0,0,0,0,0,0,240,63,9,6,3,7,
+,5,6,0,12,8,0,5,115,112,108,105,116,0,0,0,
+,7,2,8,12,8,0,1,10,0,0,0,31,6,8,1,
+,6,7,6,11,8,0,0,0,0,0,0,0,0,240,63,
+,7,4,8,9,6,6,7,15,3,6,0,12,7,0,0,
+,0,0,0,15,6,7,0,11,8,0,0,0,0,0,0,
+,0,36,64,25,7,4,8,21,7,0,0,18,0,0,6,
+,8,0,1,32,0,0,0,1,7,6,8,15,6,7,0,
+,0,0,1,11,8,0,0,0,0,0,0,0,0,89,64,
+,7,4,8,21,7,0,0,18,0,0,6,12,8,0,2,
+,32,0,0,1,7,6,8,15,6,7,0,18,0,0,1,
+,11,0,3,115,116,114,0,13,10,11,0,15,11,4,0,
+,9,11,1,19,9,10,9,1,8,6,9,12,9,0,2,
+,32,0,0,1,8,8,9,1,8,8,3,12,9,0,1,
+,0,0,0,1,8,8,9,15,7,8,0,12,9,0,5,
+,32,32,32,32,0,0,0,12,10,0,1,32,0,0,0,
+,10,10,5,1,9,9,10,12,10,0,1,94,0,0,0,
+,9,9,10,12,10,0,1,10,0,0,0,1,9,9,10,
+,8,7,9,15,7,8,0,12,8,0,7,101,114,114,111,
 ,58,32,0,1,8,8,1,12,9,0,1,10,0,0,0,
 ,8,8,9,1,8,8,7,37,8,0,0,0,0,0,0,
-,2,0,7,117,95,101,114,114,111,114,0,14,2,0,0,
-,11,0,15,73,83,89,77,66,79,76,83,32,61,32,39,
-,45,61,91,93,59,44,46,47,126,33,64,36,37,94,38,
-,40,41,43,123,125,58,60,62,63,124,39,0,0,0,0,
-,2,0,8,73,83,89,77,66,79,76,83,0,0,0,0,
-,3,0,27,96,45,61,91,93,59,44,46,47,126,33,64,
-,37,94,38,42,40,41,43,123,125,58,60,62,63,124,0,
-,2,3,0,30,3,0,16,83,89,77,66,79,76,83,32,
-,32,91,0,12,2,0,7,83,89,77,66,79,76,83,0,
-,19,0,17,32,32,32,32,39,100,101,102,39,44,39,99,
-,97,115,115,39,44,39,121,105,101,108,100,39,44,39,114,
-,116,117,114,110,39,44,39,112,97,115,115,39,44,39,97,
-,100,39,44,39,111,114,39,44,39,110,111,116,39,44,39,
-,110,39,44,39,105,109,112,111,114,116,39,44,0,0,0,
-,4,0,3,100,101,102,0,12,5,0,5,99,108,97,115,
-,0,0,0,12,6,0,5,121,105,101,108,100,0,0,0,
-,7,0,6,114,101,116,117,114,110,0,0,12,8,0,4,
-,97,115,115,0,0,0,0,12,9,0,3,97,110,100,0,
-,10,0,2,111,114,0,0,12,11,0,3,110,111,116,0,
-,12,0,2,105,110,0,0,12,13,0,6,105,109,112,111,
-,116,0,0,30,17,0,18,32,32,32,32,39,105,115,39,
-,39,119,104,105,108,101,39,44,39,98,114,101,97,107,39,
-,39,102,111,114,39,44,39,99,111,110,116,105,110,117,101,
-,44,39,105,102,39,44,39,101,108,115,101,39,44,39,101,
-,105,102,39,44,39,116,114,121,39,44,0,12,14,0,2,
-,115,0,0,12,15,0,5,119,104,105,108,101,0,0,0,
-,16,0,5,98,114,101,97,107,0,0,0,12,17,0,3,
-,111,114,0,12,18,0,8,99,111,110,116,105,110,117,101,
-,0,0,0,12,19,0,2,105,102,0,0,12,20,0,4,
-,108,115,101,0,0,0,0,12,21,0,4,101,108,105,102,
-,0,0,0,12,22,0,3,116,114,121,0,30,17,0,19,
-,32,32,32,39,101,120,99,101,112,116,39,44,39,114,97,
-,115,101,39,44,39,84,114,117,101,39,44,39,70,97,108,
-,101,39,44,39,78,111,110,101,39,44,39,103,108,111,98,
-,108,39,44,39,100,101,108,39,44,39,102,114,111,109,39,
-,0,0,0,12,23,0,6,101,120,99,101,112,116,0,0,
-,24,0,5,114,97,105,115,101,0,0,0,12,25,0,4,
-,114,117,101,0,0,0,0,12,26,0,5,70,97,108,115,
-,0,0,0,12,27,0,4,78,111,110,101,0,0,0,0,
-,28,0,6,103,108,111,98,97,108,0,0,12,29,0,3,
-,101,108,0,12,30,0,4,102,114,111,109,0,0,0,0,
-,10,0,20,32,32,32,32,39,45,39,44,39,43,39,44,
-,42,39,44,39,42,42,39,44,39,47,39,44,39,37,39,
-,39,60,60,39,44,39,62,62,39,44,0,12,31,0,1,
-,0,0,0,12,32,0,1,43,0,0,0,12,33,0,1,
-,0,0,0,12,34,0,2,42,42,0,0,12,35,0,1,
-,0,0,0,12,36,0,1,37,0,0,0,12,37,0,2,
-,60,0,0,12,38,0,2,62,62,0,0,30,17,0,21,
-,32,32,32,39,45,61,39,44,39,43,61,39,44,39,42,
-,39,44,39,47,61,39,44,39,61,39,44,39,61,61,39,
-,39,33,61,39,44,39,60,39,44,39,62,39,44,32,39,
-,61,39,44,32,39,38,61,39,44,32,39,94,61,39,44,
-,0,0,0,12,39,0,2,45,61,0,0,12,40,0,2,
-,61,0,0,12,41,0,2,42,61,0,0,12,42,0,2,
-,61,0,0,12,43,0,1,61,0,0,0,12,44,0,2,
-,61,0,0,12,45,0,2,33,61,0,0,12,46,0,1,
-,0,0,0,12,47,0,1,62,0,0,0,12,48,0,2,
-,61,0,0,12,49,0,2,38,61,0,0,12,50,0,2,
-,61,0,0,30,18,0,22,32,32,32,32,39,60,61,39,
-,39,62,61,39,44,39,91,39,44,39,93,39,44,39,123,
-,44,39,125,39,44,39,40,39,44,39,41,39,44,39,46,
-,44,39,58,39,44,39,44,39,44,39,59,39,44,39,38,
-,44,39,124,39,44,39,33,39,44,32,39,94,39,0,0,
-,51,0,2,60,61,0,0,12,52,0,2,62,61,0,0,
-,53,0,1,91,0,0,0,12,54,0,1,93,0,0,0,
-,55,0,1,123,0,0,0,12,56,0,1,125,0,0,0,
-,57,0,1,40,0,0,0,12,58,0,1,41,0,0,0,
-,59,0,1,46,0,0,0,12,60,0,1,58,0,0,0,
-,61,0,1,44,0,0,0,12,62,0,1,59,0,0,0,
-,63,0,1,38,0,0,0,12,64,0,1,124,0,0,0,
-,65,0,1,33,0,0,0,12,66,0,1,94,0,0,0,
-,3,4,63,14,2,3,0,30,11,0,24,66,95,66,69,
-,73,78,44,66,95,69,78,68,32,61,32,91,39,91,39,
-,39,40,39,44,39,123,39,93,44,91,39,93,39,44,39,
-,39,44,39,125,39,93,0,12,4,0,1,91,0,0,0,
-,5,0,1,40,0,0,0,12,6,0,1,123,0,0,0,
-,3,4,3,15,2,3,0,12,5,0,1,93,0,0,0,
-,6,0,1,41,0,0,0,12,7,0,1,125,0,0,0,
-,4,5,3,15,3,4,0,12,4,0,7,66,95,66,69,
-,73,78,0,14,4,2,0,12,2,0,5,66,95,69,78,
-,0,0,0,14,2,3,0,30,4,0,26,99,108,97,115,
-,32,84,68,97,116,97,58,0,0,0,0,26,2,0,0,
-,3,0,5,84,68,97,116,97,0,0,0,14,3,2,0,
-,5,0,7,115,101,116,109,101,116,97,0,13,4,5,0,
-,5,2,0,12,7,0,6,111,98,106,101,99,116,0,0,
-,6,7,0,31,3,5,2,19,3,4,3,16,3,0,93,
-,6,0,0,30,6,0,27,32,32,32,32,100,101,102,32,
-,95,105,110,105,116,95,95,40,115,101,108,102,41,58,0,
-,1,0,16,99,111,114,101,47,116,111,107,101,110,105,122,
-,46,112,121,0,0,0,0,33,1,0,0,12,1,0,8,
-,95,105,110,105,116,95,95,0,0,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,30,11,0,28,32,32,32,32,
-,32,32,32,115,101,108,102,46,121,44,115,101,108,102,46,
-,105,44,115,101,108,102,46,110,108,32,61,32,49,44,48,
-,84,114,117,101,0,0,0,11,3,0,0,0,0,0,0,
-,0,240,63,15,2,3,0,11,4,0,0,0,0,0,0,
-,0,0,0,15,3,4,0,11,5,0,0,0,0,0,0,
-,0,240,63,15,4,5,0,12,5,0,1,121,0,0,0,
-,1,5,2,12,2,0,2,121,105,0,0,10,1,2,3,
-,2,0,2,110,108,0,0,10,1,2,4,30,13,0,29,
-,32,32,32,32,32,32,32,115,101,108,102,46,114,101,115,
-,115,101,108,102,46,105,110,100,101,110,116,44,115,101,108,
-,46,98,114,97,99,101,115,32,61,32,91,93,44,91,48,
-,44,48,0,27,3,0,0,15,2,3,0,11,5,0,0,
-,0,0,0,0,0,0,0,27,4,5,1,15,3,4,0,
-,5,0,0,0,0,0,0,0,0,0,0,15,4,5,0,
-,5,0,3,114,101,115,0,10,1,5,2,12,2,0,6,
-,110,100,101,110,116,0,0,10,1,2,3,12,2,0,6,
-,114,97,99,101,115,0,0,10,1,2,4,0,0,0,0,
-,4,0,8,95,95,105,110,105,116,95,95,0,0,0,0,
-,2,4,3,16,4,0,55,44,12,0,0,30,15,0,30,
-,32,32,32,100,101,102,32,97,100,100,40,115,101,108,102,
-,116,44,118,41,58,32,115,101,108,102,46,114,101,115,46,
-,112,112,101,110,100,40,84,111,107,101,110,40,115,101,108,
-,46,102,44,116,44,118,41,41,0,0,0,12,1,0,16,
-,111,114,101,47,116,111,107,101,110,105,122,101,46,112,121,
-,0,0,0,33,1,0,0,12,1,0,3,97,100,100,0,
-,1,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
-,2,0,3,28,4,0,0,9,3,0,4,12,6,0,3,
-,101,115,0,9,5,1,6,12,6,0,6,97,112,112,101,
-,100,0,0,9,5,5,6,12,8,0,5,84,111,107,101,
-,0,0,0,13,7,8,0,12,11,0,1,102,0,0,0,
-,8,1,11,15,9,2,0,15,10,3,0,31,6,8,3,
-,6,7,6,31,4,6,1,19,4,5,4,0,0,0,0,
-,5,0,3,97,100,100,0,10,2,5,4,30,4,0,32,
-,101,102,32,99,108,101,97,110,40,115,41,58,0,0,0,
-,2,0,67,44,6,0,0,30,4,0,32,100,101,102,32,
-,108,101,97,110,40,115,41,58,0,0,0,12,1,0,16,
-,111,114,101,47,116,111,107,101,110,105,122,101,46,112,121,
-,0,0,0,33,1,0,0,12,1,0,5,99,108,101,97,
-,0,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,8,0,33,32,32,32,32,115,32,61,32,115,46,114,101,
-,108,97,99,101,40,39,92,114,92,110,39,44,39,92,110,
-,41,0,0,12,4,0,7,114,101,112,108,97,99,101,0,
-,3,1,4,12,4,0,2,13,10,0,0,12,5,0,1,
-,0,0,0,31,2,4,2,19,2,3,2,15,1,2,0,
-,8,0,34,32,32,32,32,115,32,61,32,115,46,114,101,
-,108,97,99,101,40,39,92,114,39,44,39,92,110,39,41,
-,0,0,0,12,4,0,7,114,101,112,108,97,99,101,0,
+,4,0,7,117,95,101,114,114,111,114,0,14,4,0,0,
+,4,0,8,73,83,89,77,66,79,76,83,0,0,0,0,
+,5,0,26,96,45,61,91,93,59,44,46,47,126,33,64,
+,37,94,38,42,40,41,43,123,125,58,60,62,63,0,0,
+,4,5,0,12,4,0,7,83,89,77,66,79,76,83,0,
+,6,0,3,100,101,102,0,12,7,0,5,99,108,97,115,
+,0,0,0,12,8,0,5,121,105,101,108,100,0,0,0,
+,9,0,6,114,101,116,117,114,110,0,0,12,10,0,4,
+,97,115,115,0,0,0,0,12,11,0,3,97,110,100,0,
+,12,0,2,111,114,0,0,12,13,0,3,110,111,116,0,
+,14,0,2,105,110,0,0,12,15,0,6,105,109,112,111,
+,116,0,0,12,16,0,2,105,115,0,0,12,17,0,5,
+,104,105,108,101,0,0,0,12,18,0,5,98,114,101,97,
+,0,0,0,12,19,0,3,102,111,114,0,12,20,0,8,
+,111,110,116,105,110,117,101,0,0,0,0,12,21,0,2,
+,102,0,0,12,22,0,4,101,108,115,101,0,0,0,0,
+,23,0,4,101,108,105,102,0,0,0,0,12,24,0,3,
+,114,121,0,12,25,0,6,101,120,99,101,112,116,0,0,
+,26,0,5,114,97,105,115,101,0,0,0,12,27,0,4,
+,114,117,101,0,0,0,0,12,28,0,5,70,97,108,115,
+,0,0,0,12,29,0,4,78,111,110,101,0,0,0,0,
+,30,0,6,103,108,111,98,97,108,0,0,12,31,0,3,
+,101,108,0,12,32,0,4,102,114,111,109,0,0,0,0,
+,33,0,1,45,0,0,0,12,34,0,1,43,0,0,0,
+,35,0,1,42,0,0,0,12,36,0,2,42,42,0,0,
+,37,0,1,47,0,0,0,12,38,0,1,37,0,0,0,
+,39,0,2,60,60,0,0,12,40,0,2,62,62,0,0,
+,41,0,2,45,61,0,0,12,42,0,2,43,61,0,0,
+,43,0,2,42,61,0,0,12,44,0,2,47,61,0,0,
+,45,0,1,61,0,0,0,12,46,0,2,61,61,0,0,
+,47,0,2,33,61,0,0,12,48,0,1,60,0,0,0,
+,49,0,1,62,0,0,0,12,50,0,2,60,61,0,0,
+,51,0,2,62,61,0,0,12,52,0,1,91,0,0,0,
+,53,0,1,93,0,0,0,12,54,0,1,123,0,0,0,
+,55,0,1,125,0,0,0,12,56,0,1,40,0,0,0,
+,57,0,1,41,0,0,0,12,58,0,1,46,0,0,0,
+,59,0,1,58,0,0,0,12,60,0,1,44,0,0,0,
+,61,0,1,59,0,0,0,12,62,0,1,38,0,0,0,
+,63,0,1,124,0,0,0,12,64,0,1,33,0,0,0,
+,5,6,59,14,4,5,0,12,6,0,1,91,0,0,0,
+,7,0,1,40,0,0,0,12,8,0,1,123,0,0,0,
+,5,6,3,15,4,5,0,12,7,0,1,93,0,0,0,
+,8,0,1,41,0,0,0,12,9,0,1,125,0,0,0,
+,6,7,3,15,5,6,0,12,6,0,7,66,95,66,69,
+,73,78,0,14,6,4,0,12,4,0,5,66,95,69,78,
+,0,0,0,14,4,5,0,26,4,0,0,12,5,0,5,
+,68,97,116,97,0,0,0,14,5,4,0,16,5,0,48,
+,6,0,0,28,2,0,0,9,1,0,2,11,3,0,0,
+,0,0,0,0,0,240,63,15,2,3,0,11,4,0,0,
+,0,0,0,0,0,0,0,15,3,4,0,11,5,0,0,
+,0,0,0,0,0,240,63,15,4,5,0,12,5,0,1,
+,0,0,0,10,1,5,2,12,2,0,2,121,105,0,0,
+,1,2,3,12,2,0,2,110,108,0,0,10,1,2,4,
+,3,0,0,15,2,3,0,11,5,0,0,0,0,0,0,
+,0,0,0,27,4,5,1,15,3,4,0,11,5,0,0,
+,0,0,0,0,0,0,0,15,4,5,0,12,5,0,3,
+,101,115,0,10,1,5,2,12,2,0,6,105,110,100,101,
+,116,0,0,10,1,2,3,12,2,0,6,98,114,97,99,
+,115,0,0,10,1,2,4,0,0,0,0,12,6,0,8,
+,95,105,110,105,116,95,95,0,0,0,0,10,4,6,5,
+,6,0,29,44,12,0,0,28,2,0,0,9,1,0,2,
+,3,0,0,9,2,0,3,28,4,0,0,9,3,0,4,
+,6,0,3,114,101,115,0,9,5,1,6,12,6,0,6,
+,112,112,101,110,100,0,0,9,5,5,6,12,8,0,5,
+,111,107,101,110,0,0,0,13,7,8,0,12,11,0,1,
+,0,0,0,9,8,1,11,15,9,2,0,15,10,3,0,
+,6,8,3,19,6,7,6,31,4,6,1,19,4,5,4,
+,0,0,0,12,7,0,3,97,100,100,0,10,4,7,6,
+,7,0,43,44,7,0,0,28,2,0,0,9,1,0,2,
+,4,0,4,98,105,110,100,0,0,0,0,13,3,4,0,
+,6,0,5,84,68,97,116,97,0,0,0,13,4,6,0,
+,6,0,8,95,95,105,110,105,116,95,95,0,0,0,0,
+,4,4,6,15,5,1,0,31,2,4,2,19,2,3,2,
+,3,0,8,95,95,105,110,105,116,95,95,0,0,0,0,
+,1,3,2,12,4,0,4,98,105,110,100,0,0,0,0,
+,3,4,0,12,6,0,5,84,68,97,116,97,0,0,0,
+,4,6,0,12,6,0,3,97,100,100,0,9,4,4,6,
+,5,1,0,31,2,4,2,19,2,3,2,12,3,0,3,
+,100,100,0,10,1,3,2,0,0,0,0,12,8,0,7,
+,95,110,101,119,95,95,0,10,4,8,7,16,8,0,22,
+,5,0,0,26,1,0,0,12,4,0,5,84,68,97,116,
+,0,0,0,13,3,4,0,12,4,0,7,95,95,110,101,
+,95,95,0,9,3,3,4,15,4,1,0,31,2,4,1,
+,2,3,2,12,3,0,8,95,95,105,110,105,116,95,95,
+,0,0,0,9,2,1,3,19,4,2,0,20,1,0,0,
+,0,0,0,12,9,0,8,95,95,99,97,108,108,95,95,
+,0,0,0,10,4,9,8,16,4,0,28,44,6,0,0,
+,2,0,0,9,1,0,2,12,4,0,7,114,101,112,108,
+,99,101,0,9,3,1,4,12,4,0,2,13,10,0,0,
+,5,0,1,10,0,0,0,31,2,4,2,19,2,3,2,
+,1,2,0,12,4,0,7,114,101,112,108,97,99,101,0,
 ,3,1,4,12,4,0,1,13,0,0,0,12,5,0,1,
 ,0,0,0,31,2,4,2,19,2,3,2,15,1,2,0,
-,4,0,35,32,32,32,32,114,101,116,117,114,110,32,115,
-,0,0,0,20,1,0,0,0,0,0,0,12,5,0,5,
-,108,101,97,110,0,0,0,14,5,2,0,30,5,0,37,
-,101,102,32,116,111,107,101,110,105,122,101,40,115,41,58,
-,0,0,0,16,5,0,126,44,10,0,0,30,5,0,37,
-,101,102,32,116,111,107,101,110,105,122,101,40,115,41,58,
-,0,0,0,12,1,0,16,99,111,114,101,47,116,111,107,
-,110,105,122,101,46,112,121,0,0,0,0,33,1,0,0,
-,1,0,8,116,111,107,101,110,105,122,101,0,0,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,30,4,0,38,
-,32,32,32,103,108,111,98,97,108,32,84,0,0,0,0,
-,5,0,39,32,32,32,32,115,32,61,32,99,108,101,97,
-,40,115,41,0,0,0,0,12,4,0,5,99,108,101,97,
+,1,0,0,0,0,0,0,12,9,0,5,99,108,101,97,
+,0,0,0,14,9,4,0,16,9,0,41,44,8,0,0,
+,2,0,0,9,1,0,2,12,4,0,5,99,108,101,97,
 ,0,0,0,13,3,4,0,15,4,1,0,31,2,4,1,
-,2,3,2,15,1,2,0,30,8,0,40,32,32,32,32,
-,44,105,44,108,32,61,32,84,68,97,116,97,40,41,44,
-,44,108,101,110,40,115,41,0,0,0,0,12,5,0,5,
-,68,97,116,97,0,0,0,13,4,5,0,31,3,0,0,
-,3,4,3,15,2,3,0,11,4,0,0,0,0,0,0,
-,0,0,0,15,3,4,0,12,7,0,3,108,101,110,0,
-,6,7,0,15,7,1,0,31,5,7,1,19,5,6,5,
-,4,5,0,12,5,0,1,84,0,0,0,14,5,2,0,
-,2,3,0,15,3,4,0,30,9,0,41,32,32,32,32,
-,114,121,58,32,114,101,116,117,114,110,32,100,111,95,116,
-,107,101,110,105,122,101,40,115,44,105,44,108,41,0,0,
-,0,0,14,12,6,0,11,100,111,95,116,111,107,101,110,
-,122,101,0,13,5,6,0,15,6,1,0,15,7,2,0,
-,8,3,0,31,4,6,3,19,4,5,4,20,4,0,0,
-,0,0,0,18,0,0,29,30,10,0,42,32,32,32,32,
-,120,99,101,112,116,58,32,117,95,101,114,114,111,114,40,
-,116,111,107,101,110,105,122,101,39,44,115,44,84,46,102,
-,0,0,0,12,6,0,7,117,95,101,114,114,111,114,0,
-,5,6,0,12,6,0,8,116,111,107,101,110,105,122,101,
-,0,0,0,15,7,1,0,12,9,0,1,84,0,0,0,
-,8,9,0,12,9,0,1,102,0,0,0,9,8,8,9,
-,4,6,3,19,4,5,4,0,0,0,0,12,6,0,8,
-,111,107,101,110,105,122,101,0,0,0,0,14,6,5,0,
-,6,0,44,100,101,102,32,100,111,95,116,111,107,101,110,
-,122,101,40,115,44,105,44,108,41,58,0,16,6,2,57,
-,11,0,0,30,6,0,44,100,101,102,32,100,111,95,116,
-,107,101,110,105,122,101,40,115,44,105,44,108,41,58,0,
-,1,0,16,99,111,114,101,47,116,111,107,101,110,105,122,
-,46,112,121,0,0,0,0,33,1,0,0,12,1,0,11,
-,111,95,116,111,107,101,110,105,122,101,0,34,1,0,0,
-,2,0,0,9,1,0,2,28,3,0,0,9,2,0,3,
-,4,0,0,9,3,0,4,30,4,0,45,32,32,32,32,
-,108,111,98,97,108,32,84,0,0,0,0,30,7,0,46,
-,32,32,32,84,46,102,32,61,32,40,84,46,121,44,105,
-,84,46,121,105,43,49,41,0,0,0,0,12,5,0,1,
+,2,3,2,15,1,2,0,38,0,0,11,12,4,0,11,
+,111,95,116,111,107,101,110,105,122,101,0,13,3,4,0,
+,4,1,0,31,2,4,1,19,2,3,2,20,2,0,0,
+,0,0,18,12,4,0,7,117,95,101,114,114,111,114,0,
+,3,4,0,12,4,0,8,116,111,107,101,110,105,122,101,
+,0,0,0,15,5,1,0,12,7,0,1,84,0,0,0,
+,6,7,0,12,7,0,1,102,0,0,0,9,6,6,7,
+,2,4,3,19,2,3,2,0,0,0,0,12,10,0,8,
+,111,107,101,110,105,122,101,0,0,0,0,14,10,9,0,
+,10,1,128,44,13,0,0,28,2,0,0,9,1,0,2,
+,5,0,5,84,68,97,116,97,0,0,0,13,4,5,0,
+,3,0,0,19,3,4,3,15,2,3,0,11,4,0,0,
+,0,0,0,0,0,0,0,15,3,4,0,12,7,0,3,
+,101,110,0,13,6,7,0,15,7,1,0,31,5,7,1,
+,5,6,5,15,4,5,0,12,5,0,1,84,0,0,0,
+,5,2,0,15,2,3,0,15,3,4,0,12,5,0,1,
 ,0,0,0,13,4,5,0,12,8,0,1,84,0,0,0,
 ,6,8,0,12,8,0,1,121,0,0,0,9,6,6,8,
 ,9,0,1,84,0,0,0,13,8,9,0,12,9,0,2,
 ,105,0,0,9,8,8,9,2,7,2,8,11,8,0,0,
 ,0,0,0,0,0,240,63,1,7,7,8,27,5,6,2,
-,6,0,1,102,0,0,0,10,4,6,5,30,5,0,47,
-,32,32,32,119,104,105,108,101,32,105,32,60,32,108,58,
-,0,0,0,25,4,2,3,21,4,0,0,18,0,1,202,
-,10,0,48,32,32,32,32,32,32,32,32,99,32,61,32,
-,91,105,93,59,32,84,46,102,32,61,32,40,84,46,121,
-,105,45,84,46,121,105,43,49,41,0,0,9,5,1,2,
-,4,5,0,12,6,0,1,84,0,0,0,13,5,6,0,
-,9,0,1,84,0,0,0,13,7,9,0,12,9,0,1,
-,0,0,0,9,7,7,9,12,10,0,1,84,0,0,0,
-,9,10,0,12,10,0,2,121,105,0,0,9,9,9,10,
-,8,2,9,11,9,0,0,0,0,0,0,0,0,240,63,
-,8,8,9,27,6,7,2,12,7,0,1,102,0,0,0,
-,5,7,6,30,13,0,49,32,32,32,32,32,32,32,32,
-,102,32,84,46,110,108,58,32,84,46,110,108,32,61,32,
-,97,108,115,101,59,32,105,32,61,32,100,111,95,105,110,
-,101,110,116,40,115,44,105,44,108,41,0,12,6,0,1,
-,0,0,0,13,5,6,0,12,6,0,2,110,108,0,0,
-,5,5,6,21,5,0,0,18,0,0,22,12,6,0,1,
-,0,0,0,13,5,6,0,11,6,0,0,0,0,0,0,
-,0,0,0,12,7,0,2,110,108,0,0,10,5,7,6,
-,7,0,9,100,111,95,105,110,100,101,110,116,0,0,0,
+,6,0,1,102,0,0,0,10,4,6,5,25,4,2,3,
+,4,0,0,18,0,1,53,9,5,1,2,15,4,5,0,
+,6,0,1,84,0,0,0,13,5,6,0,12,9,0,1,
+,0,0,0,13,7,9,0,12,9,0,1,121,0,0,0,
+,7,7,9,12,10,0,1,84,0,0,0,13,9,10,0,
+,10,0,2,121,105,0,0,9,9,9,10,2,8,2,9,
+,9,0,0,0,0,0,0,0,0,240,63,1,8,8,9,
+,6,7,2,12,7,0,1,102,0,0,0,10,5,7,6,
+,6,0,1,84,0,0,0,13,5,6,0,12,6,0,2,
+,108,0,0,9,5,5,6,21,5,0,0,18,0,0,22,
+,6,0,1,84,0,0,0,13,5,6,0,11,6,0,0,
+,0,0,0,0,0,0,0,12,7,0,2,110,108,0,0,
+,5,7,6,12,7,0,9,100,111,95,105,110,100,101,110,
+,0,0,0,13,6,7,0,15,7,1,0,15,8,2,0,
+,9,3,0,31,5,7,3,19,5,6,5,15,2,5,0,
+,0,0,253,12,6,0,1,10,0,0,0,23,5,4,6,
+,5,0,0,18,0,0,12,12,7,0,5,100,111,95,110,
+,0,0,0,13,6,7,0,15,7,1,0,15,8,2,0,
+,9,3,0,31,5,7,3,19,5,6,5,15,2,5,0,
+,0,0,237,12,6,0,8,73,83,89,77,66,79,76,83,
+,0,0,0,13,5,6,0,36,5,5,4,21,5,0,0,
+,0,0,13,12,7,0,9,100,111,95,115,121,109,98,111,
+,0,0,0,13,6,7,0,15,7,1,0,15,8,2,0,
+,9,3,0,31,5,7,3,19,5,6,5,15,2,5,0,
+,0,0,217,11,7,0,0,0,0,0,0,0,0,0,0,
+,5,0,1,48,0,0,0,24,5,5,4,23,6,5,7,
+,6,0,0,18,0,0,2,18,0,0,4,12,8,0,1,
+,0,0,0,24,5,4,8,21,5,0,0,18,0,0,13,
+,7,0,9,100,111,95,110,117,109,98,101,114,0,0,0,
 ,6,7,0,15,7,1,0,15,8,2,0,15,9,3,0,
-,5,7,3,19,5,6,5,15,2,5,0,18,0,1,121,
-,11,0,50,32,32,32,32,32,32,32,32,101,108,105,102,
-,99,32,61,61,32,39,92,110,39,58,32,105,32,61,32,
-,111,95,110,108,40,115,44,105,44,108,41,0,0,0,0,
-,6,0,1,10,0,0,0,23,5,4,6,21,5,0,0,
-,0,0,12,12,7,0,5,100,111,95,110,108,0,0,0,
+,5,7,3,19,5,6,5,15,2,5,0,18,0,0,190,
+,7,0,0,0,0,0,0,0,0,240,63,11,9,0,0,
+,0,0,0,0,0,240,63,11,11,0,0,0,0,0,0,
+,0,0,0,12,5,0,1,97,0,0,0,24,5,5,4,
+,10,5,11,21,10,0,0,18,0,0,2,18,0,0,4,
+,12,0,1,122,0,0,0,24,5,4,12,23,8,5,9,
+,8,0,0,18,0,0,2,18,0,0,14,11,11,0,0,
+,0,0,0,0,0,0,0,12,5,0,1,65,0,0,0,
+,5,5,4,23,10,5,11,21,10,0,0,18,0,0,2,
+,0,0,4,12,12,0,1,90,0,0,0,24,5,4,12,
+,6,5,7,21,6,0,0,18,0,0,2,18,0,0,4,
+,8,0,1,95,0,0,0,23,5,4,8,21,5,0,0,
+,0,0,12,12,7,0,7,100,111,95,110,97,109,101,0,
 ,6,7,0,15,7,1,0,15,8,2,0,15,9,3,0,
-,5,7,3,19,5,6,5,15,2,5,0,18,0,1,93,
-,13,0,51,32,32,32,32,32,32,32,32,101,108,105,102,
-,99,32,105,110,32,73,83,89,77,66,79,76,83,58,32,
-,32,61,32,100,111,95,115,121,109,98,111,108,40,115,44,
-,44,108,41,0,0,0,0,12,6,0,8,73,83,89,77,
-,79,76,83,0,0,0,0,13,5,6,0,36,5,5,4,
-,5,0,0,18,0,0,13,12,7,0,9,100,111,95,115,
-,109,98,111,108,0,0,0,13,6,7,0,15,7,1,0,
-,8,2,0,15,9,3,0,31,5,7,3,19,5,6,5,
-,2,5,0,18,0,1,59,30,15,0,52,32,32,32,32,
-,32,32,32,101,108,105,102,32,99,32,62,61,32,39,48,
-,32,97,110,100,32,99,32,60,61,32,39,57,39,58,32,
-,32,61,32,100,111,95,110,117,109,98,101,114,40,115,44,
-,44,108,41,0,0,0,0,12,5,0,1,48,0,0,0,
-,5,5,4,21,5,0,0,18,0,0,4,12,6,0,1,
-,0,0,0,24,5,4,6,21,5,0,0,18,0,0,13,
-,7,0,9,100,111,95,110,117,109,98,101,114,0,0,0,
+,5,7,3,19,5,6,5,15,2,5,0,18,0,0,134,
+,7,0,0,0,0,0,0,0,0,240,63,12,8,0,1,
+,0,0,0,23,5,4,8,23,6,5,7,21,6,0,0,
+,0,0,2,18,0,0,4,12,8,0,1,39,0,0,0,
+,5,4,8,21,5,0,0,18,0,0,13,12,7,0,9,
+,111,95,115,116,114,105,110,103,0,0,0,13,6,7,0,
+,7,1,0,15,8,2,0,15,9,3,0,31,5,7,3,
+,5,6,5,15,2,5,0,18,0,0,107,12,6,0,1,
+,0,0,0,23,5,4,6,21,5,0,0,18,0,0,13,
+,7,0,10,100,111,95,99,111,109,109,101,110,116,0,0,
 ,6,7,0,15,7,1,0,15,8,2,0,15,9,3,0,
-,5,7,3,19,5,6,5,15,2,5,0,18,0,1,21,
-,18,0,54,32,32,32,32,32,32,32,32,32,32,32,32,
-,99,32,62,61,32,39,65,39,32,97,110,100,32,99,32,
-,61,32,39,90,39,41,32,111,114,32,99,32,61,61,32,
-,95,39,58,32,32,105,32,61,32,100,111,95,110,97,109,
-,40,115,44,105,44,108,41,0,0,0,0,30,11,0,53,
-,32,32,32,32,32,32,32,101,108,105,102,32,40,99,32,
-,61,32,39,97,39,32,97,110,100,32,99,32,60,61,32,
-,122,39,41,32,111,114,32,92,0,0,0,12,5,0,1,
-,0,0,0,24,5,5,4,21,5,0,0,18,0,0,4,
-,6,0,1,122,0,0,0,24,5,4,6,46,5,0,0,
-,0,0,28,30,18,0,54,32,32,32,32,32,32,32,32,
-,32,32,32,40,99,32,62,61,32,39,65,39,32,97,110,
-,32,99,32,60,61,32,39,90,39,41,32,111,114,32,99,
-,61,61,32,39,95,39,58,32,32,105,32,61,32,100,111,
-,110,97,109,101,40,115,44,105,44,108,41,0,0,0,0,
-,5,0,1,65,0,0,0,24,5,5,4,21,5,0,0,
-,0,0,4,12,6,0,1,90,0,0,0,24,5,4,6,
-,5,0,0,18,0,0,4,12,6,0,1,95,0,0,0,
-,5,4,6,21,5,0,0,18,0,0,12,12,7,0,7,
-,111,95,110,97,109,101,0,13,6,7,0,15,7,1,0,
-,8,2,0,15,9,3,0,31,5,7,3,19,5,6,5,
-,2,5,0,18,0,0,191,30,13,0,55,32,32,32,32,
-,32,32,32,101,108,105,102,32,99,61,61,39,34,39,32,
-,114,32,99,61,61,34,39,34,58,32,105,32,61,32,100,
-,95,115,116,114,105,110,103,40,115,44,105,44,108,41,0,
-,6,0,1,34,0,0,0,23,5,4,6,46,5,0,0,
-,0,0,4,12,6,0,1,39,0,0,0,23,5,4,6,
-,5,0,0,18,0,0,13,12,7,0,9,100,111,95,115,
-,114,105,110,103,0,0,0,13,6,7,0,15,7,1,0,
-,8,2,0,15,9,3,0,31,5,7,3,19,5,6,5,
-,2,5,0,18,0,0,155,30,11,0,56,32,32,32,32,
-,32,32,32,101,108,105,102,32,99,61,61,39,35,39,58,
-,105,32,61,32,100,111,95,99,111,109,109,101,110,116,40,
-,44,105,44,108,41,0,0,12,6,0,1,35,0,0,0,
-,5,4,6,21,5,0,0,18,0,0,13,12,7,0,10,
-,111,95,99,111,109,109,101,110,116,0,0,13,6,7,0,
-,7,1,0,15,8,2,0,15,9,3,0,31,5,7,3,
-,5,6,5,15,2,5,0,18,0,0,126,30,11,0,57,
-,32,32,32,32,32,32,32,101,108,105,102,32,99,32,61,
-,32,39,92,92,39,32,97,110,100,32,115,91,105,43,49,
-,32,61,61,32,39,92,110,39,58,0,0,12,6,0,1,
-,0,0,0,23,5,4,6,21,5,0,0,18,0,0,9,
-,7,0,0,0,0,0,0,0,0,240,63,1,6,2,7,
-,5,1,6,12,6,0,1,10,0,0,0,23,5,5,6,
-,5,0,0,18,0,0,42,30,10,0,58,32,32,32,32,
-,32,32,32,32,32,32,32,105,32,43,61,32,50,59,32,
-,46,121,44,84,46,121,105,32,61,32,84,46,121,43,49,
-,105,0,0,11,6,0,0,0,0,0,0,0,0,0,64,
-,5,2,6,15,2,5,0,12,7,0,1,84,0,0,0,
-,6,7,0,12,7,0,1,121,0,0,0,9,6,6,7,
-,7,0,0,0,0,0,0,0,0,240,63,1,6,6,7,
-,5,6,0,15,6,2,0,12,8,0,1,84,0,0,0,
-,7,8,0,12,8,0,1,121,0,0,0,10,7,8,5,
-,7,0,1,84,0,0,0,13,5,7,0,12,7,0,2,
-,105,0,0,10,5,7,6,18,0,0,58,30,11,0,59,
-,32,32,32,32,32,32,32,101,108,105,102,32,99,32,61,
-,32,39,32,39,32,111,114,32,99,32,61,61,32,39,92,
-,39,58,32,105,32,43,61,32,49,0,0,12,6,0,1,
-,0,0,0,23,5,4,6,46,5,0,0,18,0,0,4,
-,6,0,1,9,0,0,0,23,5,4,6,21,5,0,0,
+,5,7,3,19,5,6,5,15,2,5,0,18,0,0,90,
+,7,0,0,0,0,0,0,0,0,0,0,12,8,0,1,
+,0,0,0,23,5,4,8,23,6,5,7,21,6,0,0,
+,0,0,2,18,0,0,9,11,9,0,0,0,0,0,0,
+,0,240,63,1,8,2,9,9,5,1,8,12,8,0,1,
+,0,0,0,23,5,5,8,21,5,0,0,18,0,0,31,
+,6,0,0,0,0,0,0,0,0,0,64,1,5,2,6,
+,2,5,0,12,7,0,1,84,0,0,0,13,6,7,0,
+,7,0,1,121,0,0,0,9,6,6,7,11,7,0,0,
+,0,0,0,0,0,240,63,1,6,6,7,15,5,6,0,
+,6,2,0,12,8,0,1,84,0,0,0,13,7,8,0,
+,8,0,1,121,0,0,0,10,7,8,5,12,7,0,1,
+,0,0,0,13,5,7,0,12,7,0,2,121,105,0,0,
+,5,7,6,18,0,0,40,11,7,0,0,0,0,0,0,
+,0,240,63,12,8,0,1,32,0,0,0,23,5,4,8,
+,6,5,7,21,6,0,0,18,0,0,2,18,0,0,4,
+,8,0,1,9,0,0,0,23,5,4,8,21,5,0,0,
 ,0,0,7,11,6,0,0,0,0,0,0,0,0,240,63,
-,5,2,6,15,2,5,0,18,0,0,30,30,10,0,60,
-,32,32,32,32,32,32,32,101,108,115,101,58,32,117,95,
-,114,114,111,114,40,39,116,111,107,101,110,105,122,101,39,
-,115,44,84,46,102,41,0,12,7,0,7,117,95,101,114,
-,111,114,0,13,6,7,0,12,7,0,8,116,111,107,101,
-,105,122,101,0,0,0,0,15,8,1,0,12,10,0,1,
-,0,0,0,13,9,10,0,12,10,0,1,102,0,0,0,
-,9,9,10,31,5,7,3,19,5,6,5,18,0,0,1,
-,0,254,53,30,4,0,61,32,32,32,32,105,110,100,101,
-,116,40,48,41,0,0,0,12,7,0,6,105,110,100,101,
+,5,2,6,15,2,5,0,18,0,0,19,12,7,0,7,
+,95,101,114,114,111,114,0,13,6,7,0,12,7,0,8,
+,111,107,101,110,105,122,101,0,0,0,0,15,8,1,0,
+,10,0,1,84,0,0,0,13,9,10,0,12,10,0,1,
+,0,0,0,9,9,9,10,31,5,7,3,19,5,6,5,
+,0,0,1,18,0,254,202,12,7,0,6,105,110,100,101,
 ,116,0,0,13,6,7,0,11,7,0,0,0,0,0,0,
-,0,0,0,31,5,7,1,19,5,6,5,30,6,0,62,
-,32,32,32,114,32,61,32,84,46,114,101,115,59,32,84,
-,61,32,78,111,110,101,0,12,7,0,1,84,0,0,0,
-,6,7,0,12,7,0,3,114,101,115,0,9,6,6,7,
-,5,6,0,12,6,0,1,84,0,0,0,28,7,0,0,
-,6,7,0,30,4,0,65,32,32,32,32,114,101,116,117,
-,110,32,114,0,0,0,0,20,5,0,0,0,0,0,0,
-,7,0,11,100,111,95,116,111,107,101,110,105,122,101,0,
-,7,6,0,30,5,0,67,100,101,102,32,100,111,95,110,
-,40,115,44,105,44,108,41,58,0,0,0,16,7,0,123,
-,8,0,0,30,5,0,67,100,101,102,32,100,111,95,110,
-,40,115,44,105,44,108,41,58,0,0,0,12,1,0,16,
-,111,114,101,47,116,111,107,101,110,105,122,101,46,112,121,
-,0,0,0,33,1,0,0,12,1,0,5,100,111,95,110,
-,0,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
+,0,0,0,31,5,7,1,19,5,6,5,12,7,0,1,
+,0,0,0,13,6,7,0,12,7,0,3,114,101,115,0,
+,6,6,7,15,5,6,0,12,6,0,1,84,0,0,0,
+,7,0,0,14,6,7,0,20,5,0,0,0,0,0,0,
+,11,0,11,100,111,95,116,111,107,101,110,105,122,101,0,
+,11,10,0,16,11,0,75,44,8,0,0,28,2,0,0,
+,1,0,2,28,3,0,0,9,2,0,3,28,4,0,0,
+,3,0,4,11,4,0,0,0,0,0,0,0,0,0,0,
+,6,0,1,84,0,0,0,13,5,6,0,12,6,0,6,
+,114,97,99,101,115,0,0,9,5,5,6,23,4,4,5,
+,4,0,0,18,0,0,13,12,6,0,1,84,0,0,0,
+,5,6,0,12,6,0,3,97,100,100,0,9,5,5,6,
+,6,0,2,110,108,0,0,28,7,0,0,31,4,6,2,
+,4,5,4,18,0,0,1,11,6,0,0,0,0,0,0,
+,0,240,63,1,5,2,6,15,4,5,0,11,6,0,0,
+,0,0,0,0,0,240,63,15,5,6,0,15,2,4,0,
+,6,0,1,84,0,0,0,13,4,6,0,12,6,0,2,
+,108,0,0,10,4,6,5,12,6,0,1,84,0,0,0,
+,5,6,0,12,6,0,1,121,0,0,0,9,5,5,6,
+,6,0,0,0,0,0,0,0,0,240,63,1,5,5,6,
+,4,5,0,15,5,2,0,12,7,0,1,84,0,0,0,
+,6,7,0,12,7,0,1,121,0,0,0,10,6,7,4,
+,6,0,1,84,0,0,0,13,4,6,0,12,6,0,2,
+,105,0,0,10,4,6,5,20,2,0,0,0,0,0,0,
+,12,0,5,100,111,95,110,108,0,0,0,14,12,11,0,
+,12,0,90,44,12,0,0,28,2,0,0,9,1,0,2,
 ,3,0,0,9,2,0,3,28,4,0,0,9,3,0,4,
-,6,0,68,32,32,32,32,105,102,32,110,111,116,32,84,
-,98,114,97,99,101,115,58,0,0,0,0,12,6,0,1,
-,0,0,0,13,5,6,0,12,6,0,6,98,114,97,99,
-,115,0,0,9,5,5,6,47,4,5,0,21,4,0,0,
-,0,0,21,30,7,0,69,32,32,32,32,32,32,32,32,
-,46,97,100,100,40,39,110,108,39,44,78,111,110,101,41,
-,0,0,0,12,6,0,1,84,0,0,0,13,5,6,0,
-,6,0,3,97,100,100,0,9,5,5,6,12,6,0,2,
-,108,0,0,28,7,0,0,31,4,6,2,19,4,5,4,
-,0,0,1,30,6,0,70,32,32,32,32,105,44,84,46,
-,108,32,61,32,105,43,49,44,84,114,117,101,0,0,0,
-,6,0,0,0,0,0,0,0,0,240,63,1,5,2,6,
-,4,5,0,11,6,0,0,0,0,0,0,0,0,240,63,
-,5,6,0,15,2,4,0,12,6,0,1,84,0,0,0,
-,4,6,0,12,6,0,2,110,108,0,0,10,4,6,5,
-,6,0,71,32,32,32,32,84,46,121,44,84,46,121,105,
-,61,32,84,46,121,43,49,44,105,0,0,12,6,0,1,
-,0,0,0,13,5,6,0,12,6,0,1,121,0,0,0,
-,5,5,6,11,6,0,0,0,0,0,0,0,0,240,63,
-,5,5,6,15,4,5,0,15,5,2,0,12,7,0,1,
-,0,0,0,13,6,7,0,12,7,0,1,121,0,0,0,
-,6,7,4,12,6,0,1,84,0,0,0,13,4,6,0,
-,6,0,2,121,105,0,0,10,4,6,5,30,4,0,72,
-,32,32,32,114,101,116,117,114,110,32,105,0,0,0,0,
-,2,0,0,0,0,0,0,12,8,0,5,100,111,95,110,
-,0,0,0,14,8,7,0,30,6,0,74,100,101,102,32,
-,111,95,105,110,100,101,110,116,40,115,44,105,44,108,41,
-,0,0,0,16,8,0,146,44,10,0,0,30,6,0,74,
-,101,102,32,100,111,95,105,110,100,101,110,116,40,115,44,
-,44,108,41,58,0,0,0,12,1,0,16,99,111,114,101,
-,116,111,107,101,110,105,122,101,46,112,121,0,0,0,0,
-,1,0,0,12,1,0,9,100,111,95,105,110,100,101,110,
-,0,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,3,0,0,9,2,0,3,28,4,0,0,9,3,0,4,
-,3,0,75,32,32,32,32,118,32,61,32,48,0,0,0,
 ,5,0,0,0,0,0,0,0,0,0,0,15,4,5,0,
-,4,0,76,32,32,32,32,119,104,105,108,101,32,105,60,
-,58,0,0,25,5,2,3,21,5,0,0,18,0,0,53,
-,5,0,77,32,32,32,32,32,32,32,32,99,32,61,32,
-,91,105,93,0,0,0,0,9,6,1,2,15,5,6,0,
-,11,0,78,32,32,32,32,32,32,32,32,105,102,32,99,
-,33,61,32,39,32,39,32,97,110,100,32,99,32,33,61,
-,39,92,116,39,58,32,98,114,101,97,107,0,0,0,0,
-,7,0,1,32,0,0,0,35,6,5,7,21,6,0,0,
-,0,0,4,12,7,0,1,9,0,0,0,35,6,5,7,
-,6,0,0,18,0,0,3,18,0,0,22,18,0,0,1,
-,6,0,79,32,32,32,32,32,32,32,32,105,44,118,32,
-,32,105,43,49,44,118,43,49,0,0,0,11,8,0,0,
-,0,0,0,0,0,240,63,1,7,2,8,15,6,7,0,
-,9,0,0,0,0,0,0,0,0,240,63,1,8,4,9,
-,7,8,0,15,2,6,0,15,4,7,0,18,0,255,202,
-,15,0,80,32,32,32,32,105,102,32,99,32,33,61,32,
-,92,110,39,32,97,110,100,32,99,32,33,61,32,39,35,
-,32,97,110,100,32,110,111,116,32,84,46,98,114,97,99,
-,115,58,32,105,110,100,101,110,116,40,118,41,0,0,0,
-,7,0,1,10,0,0,0,35,6,5,7,21,6,0,0,
-,0,0,4,12,7,0,1,35,0,0,0,35,6,5,7,
-,6,0,0,18,0,0,9,12,8,0,1,84,0,0,0,
-,7,8,0,12,8,0,6,98,114,97,99,101,115,0,0,
-,7,7,8,47,6,7,0,21,6,0,0,18,0,0,9,
+,5,2,3,21,5,0,0,18,0,0,33,9,6,1,2,
+,5,6,0,11,8,0,0,0,0,0,0,0,0,0,0,
+,9,0,1,32,0,0,0,35,6,5,9,23,7,6,8,
+,7,0,0,18,0,0,2,18,0,0,4,12,9,0,1,
+,0,0,0,35,6,5,9,21,6,0,0,18,0,0,3,
+,0,0,15,18,0,0,1,11,8,0,0,0,0,0,0,
+,0,240,63,1,7,2,8,15,6,7,0,11,9,0,0,
+,0,0,0,0,0,240,63,1,8,4,9,15,7,8,0,
+,2,6,0,15,4,7,0,18,0,255,222,11,8,0,0,
+,0,0,0,0,0,0,0,11,10,0,0,0,0,0,0,
+,0,0,0,12,11,0,1,10,0,0,0,35,6,5,11,
+,9,6,10,21,9,0,0,18,0,0,2,18,0,0,4,
+,11,0,1,35,0,0,0,35,6,5,11,23,7,6,8,
+,7,0,0,18,0,0,2,18,0,0,12,11,6,0,0,
+,0,0,0,0,0,0,0,12,10,0,1,84,0,0,0,
+,9,10,0,12,10,0,6,98,114,97,99,101,115,0,0,
+,9,9,10,23,6,6,9,21,6,0,0,18,0,0,9,
 ,8,0,6,105,110,100,101,110,116,0,0,13,7,8,0,
 ,8,4,0,31,6,8,1,19,6,7,6,18,0,0,1,
-,4,0,81,32,32,32,32,114,101,116,117,114,110,32,105,
-,0,0,0,20,2,0,0,0,0,0,0,12,9,0,9,
-,111,95,105,110,100,101,110,116,0,0,0,14,9,8,0,
-,4,0,83,100,101,102,32,105,110,100,101,110,116,40,118,
-,58,0,0,16,9,0,231,44,8,0,0,30,4,0,83,
-,101,102,32,105,110,100,101,110,116,40,118,41,58,0,0,
-,1,0,16,99,111,114,101,47,116,111,107,101,110,105,122,
-,46,112,121,0,0,0,0,33,1,0,0,12,1,0,6,
-,110,100,101,110,116,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,30,8,0,84,32,32,32,32,105,102,32,118,
-,61,61,32,84,46,105,110,100,101,110,116,91,45,49,93,
-,32,112,97,115,115,0,0,12,4,0,1,84,0,0,0,
-,3,4,0,12,4,0,6,105,110,100,101,110,116,0,0,
-,3,3,4,11,4,0,0,0,0,0,0,0,0,240,191,
-,3,3,4,23,2,1,3,21,2,0,0,18,0,0,3,
-,0,0,0,18,0,0,186,30,7,0,85,32,32,32,32,
-,108,105,102,32,118,32,62,32,84,46,105,110,100,101,110,
-,91,45,49,93,58,0,0,12,3,0,1,84,0,0,0,
-,2,3,0,12,3,0,6,105,110,100,101,110,116,0,0,
-,2,2,3,11,3,0,0,0,0,0,0,0,0,240,191,
-,2,2,3,25,2,2,1,21,2,0,0,18,0,0,44,
-,7,0,86,32,32,32,32,32,32,32,32,84,46,105,110,
-,101,110,116,46,97,112,112,101,110,100,40,118,41,0,0,
-,4,0,1,84,0,0,0,13,3,4,0,12,4,0,6,
-,110,100,101,110,116,0,0,9,3,3,4,12,4,0,6,
-,112,112,101,110,100,0,0,9,3,3,4,15,4,1,0,
-,2,4,1,19,2,3,2,30,7,0,87,32,32,32,32,
-,32,32,32,84,46,97,100,100,40,39,105,110,100,101,110,
-,39,44,118,41,0,0,0,12,4,0,1,84,0,0,0,
-,3,4,0,12,4,0,3,97,100,100,0,9,3,3,4,
-,4,0,6,105,110,100,101,110,116,0,0,15,5,1,0,
-,2,4,2,19,2,3,2,18,0,0,121,30,7,0,88,
-,32,32,32,101,108,105,102,32,118,32,60,32,84,46,105,
-,100,101,110,116,91,45,49,93,58,0,0,12,4,0,1,
+,2,0,0,0,0,0,0,12,13,0,9,100,111,95,105,
+,100,101,110,116,0,0,0,14,13,12,0,16,13,0,137,
+,8,0,0,28,2,0,0,9,1,0,2,12,4,0,1,
 ,0,0,0,13,3,4,0,12,4,0,6,105,110,100,101,
 ,116,0,0,9,3,3,4,11,4,0,0,0,0,0,0,
-,0,240,191,9,3,3,4,25,2,1,3,21,2,0,0,
-,0,0,99,30,8,0,89,32,32,32,32,32,32,32,32,
-,32,61,32,84,46,105,110,100,101,110,116,46,105,110,100,
-,120,40,118,41,0,0,0,12,5,0,1,84,0,0,0,
+,0,240,191,9,3,3,4,23,2,1,3,21,2,0,0,
+,0,0,3,17,0,0,0,18,0,0,117,12,3,0,1,
+,0,0,0,13,2,3,0,12,3,0,6,105,110,100,101,
+,116,0,0,9,2,2,3,11,3,0,0,0,0,0,0,
+,0,240,191,9,2,2,3,25,2,2,1,21,2,0,0,
+,0,0,28,12,4,0,1,84,0,0,0,13,3,4,0,
+,4,0,6,105,110,100,101,110,116,0,0,9,3,3,4,
+,4,0,6,97,112,112,101,110,100,0,0,9,3,3,4,
+,4,1,0,31,2,4,1,19,2,3,2,12,4,0,1,
+,0,0,0,13,3,4,0,12,4,0,3,97,100,100,0,
+,3,3,4,12,4,0,6,105,110,100,101,110,116,0,0,
+,5,1,0,31,2,4,2,19,2,3,2,18,0,0,76,
+,4,0,1,84,0,0,0,13,3,4,0,12,4,0,6,
+,110,100,101,110,116,0,0,9,3,3,4,11,4,0,0,
+,0,0,0,0,0,240,191,9,3,3,4,25,2,1,3,
+,2,0,0,18,0,0,62,12,5,0,1,84,0,0,0,
 ,4,5,0,12,5,0,6,105,110,100,101,110,116,0,0,
 ,4,4,5,12,5,0,5,105,110,100,101,120,0,0,0,
 ,4,4,5,15,5,1,0,31,3,5,1,19,3,4,3,
-,2,3,0,30,9,0,90,32,32,32,32,32,32,32,32,
-,104,105,108,101,32,108,101,110,40,84,46,105,110,100,101,
-,116,41,32,62,32,110,43,49,58,0,0,11,4,0,0,
-,0,0,0,0,0,240,63,1,3,2,4,12,6,0,3,
-,101,110,0,13,5,6,0,12,7,0,1,84,0,0,0,
-,6,7,0,12,7,0,6,105,110,100,101,110,116,0,0,
-,6,6,7,31,4,6,1,19,4,5,4,25,3,3,4,
-,3,0,0,18,0,0,45,30,8,0,91,32,32,32,32,
-,32,32,32,32,32,32,32,118,32,61,32,84,46,105,110,
-,101,110,116,46,112,111,112,40,41,0,0,12,5,0,1,
-,0,0,0,13,4,5,0,12,5,0,6,105,110,100,101,
-,116,0,0,9,4,4,5,12,5,0,3,112,111,112,0,
-,4,4,5,31,3,0,0,19,3,4,3,15,1,3,0,
-,8,0,92,32,32,32,32,32,32,32,32,32,32,32,32,
-,46,97,100,100,40,39,100,101,100,101,110,116,39,44,118,
-,0,0,0,12,5,0,1,84,0,0,0,13,4,5,0,
+,2,3,0,11,4,0,0,0,0,0,0,0,0,240,63,
+,3,2,4,12,6,0,3,108,101,110,0,13,5,6,0,
+,7,0,1,84,0,0,0,13,6,7,0,12,7,0,6,
+,110,100,101,110,116,0,0,9,6,6,7,31,4,6,1,
+,4,5,4,25,3,3,4,21,3,0,0,18,0,0,27,
+,5,0,1,84,0,0,0,13,4,5,0,12,5,0,6,
+,110,100,101,110,116,0,0,9,4,4,5,12,5,0,3,
+,111,112,0,9,4,4,5,31,3,0,0,19,3,4,3,
+,1,3,0,12,5,0,1,84,0,0,0,13,4,5,0,
 ,5,0,3,97,100,100,0,9,4,4,5,12,5,0,6,
 ,101,100,101,110,116,0,0,15,6,1,0,31,3,5,2,
-,3,4,3,18,0,255,194,18,0,0,1,0,0,0,0,
-,10,0,6,105,110,100,101,110,116,0,0,14,10,9,0,
-,6,0,94,100,101,102,32,100,111,95,115,121,109,98,111,
-,40,115,44,105,44,108,41,58,0,0,0,16,10,1,29,
-,13,0,0,30,6,0,94,100,101,102,32,100,111,95,115,
-,109,98,111,108,40,115,44,105,44,108,41,58,0,0,0,
-,1,0,16,99,111,114,101,47,116,111,107,101,110,105,122,
-,46,112,121,0,0,0,0,33,1,0,0,12,1,0,9,
-,111,95,115,121,109,98,111,108,0,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,28,3,0,0,9,2,0,3,
-,4,0,0,9,3,0,4,30,5,0,95,32,32,32,32,
-,121,109,98,111,108,115,32,61,32,91,93,0,0,0,0,
-,5,0,0,15,4,5,0,30,6,0,96,32,32,32,32,
-,44,102,44,105,32,61,32,115,91,105,93,44,105,44,105,
-,49,0,0,9,6,1,2,15,5,6,0,15,6,2,0,
-,9,0,0,0,0,0,0,0,0,240,63,1,8,2,9,
-,7,8,0,15,8,5,0,15,5,6,0,15,2,7,0,
-,10,0,97,32,32,32,32,105,102,32,118,32,105,110,32,
-,89,77,66,79,76,83,58,32,115,121,109,98,111,108,115,
-,97,112,112,101,110,100,40,118,41,0,0,12,7,0,7,
-,89,77,66,79,76,83,0,13,6,7,0,36,6,6,8,
-,6,0,0,18,0,0,9,12,9,0,6,97,112,112,101,
-,100,0,0,9,7,4,9,15,9,8,0,31,6,9,1,
-,6,7,6,18,0,0,1,30,4,0,98,32,32,32,32,
-,104,105,108,101,32,105,60,108,58,0,0,25,6,2,3,
-,6,0,0,18,0,0,74,30,5,0,99,32,32,32,32,
-,32,32,32,99,32,61,32,115,91,105,93,0,0,0,0,
-,7,1,2,15,6,7,0,30,9,0,100,32,32,32,32,
-,32,32,32,105,102,32,110,111,116,32,99,32,105,110,32,
-,83,89,77,66,79,76,83,58,32,98,114,101,97,107,0,
+,3,4,3,18,0,255,212,18,0,0,1,0,0,0,0,
+,14,0,6,105,110,100,101,110,116,0,0,14,14,13,0,
+,14,0,161,44,13,0,0,28,2,0,0,9,1,0,2,
+,3,0,0,9,2,0,3,28,4,0,0,9,3,0,4,
+,5,0,0,15,4,5,0,9,6,1,2,15,5,6,0,
+,6,2,0,11,9,0,0,0,0,0,0,0,0,240,63,
+,8,2,9,15,7,8,0,15,8,5,0,15,5,6,0,
+,2,7,0,12,7,0,7,83,89,77,66,79,76,83,0,
+,6,7,0,36,6,6,8,21,6,0,0,18,0,0,9,
+,9,0,6,97,112,112,101,110,100,0,0,9,7,4,9,
+,9,8,0,31,6,9,1,19,6,7,6,18,0,0,1,
+,6,2,3,21,6,0,0,18,0,0,42,9,7,1,2,
+,6,7,0,11,7,0,0,0,0,0,0,0,0,0,0,
 ,10,0,8,73,83,89,77,66,79,76,83,0,0,0,0,
-,9,10,0,36,9,9,6,47,7,9,0,21,7,0,0,
-,0,0,3,18,0,0,46,18,0,0,1,30,6,0,101,
-,32,32,32,32,32,32,32,118,44,105,32,61,32,118,43,
-,44,105,43,49,0,0,0,1,9,8,6,15,7,9,0,
-,11,0,0,0,0,0,0,0,0,240,63,1,10,2,11,
-,9,10,0,15,8,7,0,15,2,9,0,30,11,0,102,
-,32,32,32,32,32,32,32,105,102,32,118,32,105,110,32,
-,89,77,66,79,76,83,58,32,115,121,109,98,111,108,115,
-,97,112,112,101,110,100,40,118,41,0,0,12,9,0,7,
-,89,77,66,79,76,83,0,13,7,9,0,36,7,7,8,
-,7,0,0,18,0,0,9,12,10,0,6,97,112,112,101,
-,100,0,0,9,9,4,10,15,10,8,0,31,7,10,1,
-,7,9,7,18,0,0,1,18,0,255,181,30,11,0,103,
-,32,32,32,118,32,61,32,115,121,109,98,111,108,115,46,
-,111,112,40,41,59,32,110,32,61,32,108,101,110,40,118,
-,59,32,105,32,61,32,102,43,110,0,0,12,10,0,3,
-,111,112,0,9,9,4,10,31,7,0,0,19,7,9,7,
-,8,7,0,12,11,0,3,108,101,110,0,13,10,11,0,
-,11,8,0,31,9,11,1,19,9,10,9,15,7,9,0,
-,9,5,7,15,2,9,0,30,6,0,104,32,32,32,32,
-,46,97,100,100,40,39,115,121,109,98,111,108,39,44,118,
-,0,0,0,12,11,0,1,84,0,0,0,13,10,11,0,
-,11,0,3,97,100,100,0,9,10,10,11,12,11,0,6,
-,121,109,98,111,108,0,0,15,12,8,0,31,9,11,2,
-,9,10,9,30,9,0,105,32,32,32,32,105,102,32,118,
-,105,110,32,66,95,66,69,71,73,78,58,32,84,46,98,
-,97,99,101,115,32,43,61,32,49,0,0,12,10,0,7,
+,9,10,0,36,9,9,6,23,7,7,9,21,7,0,0,
+,0,0,3,18,0,0,27,18,0,0,1,1,9,8,6,
+,7,9,0,11,11,0,0,0,0,0,0,0,0,240,63,
+,10,2,11,15,9,10,0,15,8,7,0,15,2,9,0,
+,9,0,7,83,89,77,66,79,76,83,0,13,7,9,0,
+,7,7,8,21,7,0,0,18,0,0,9,12,10,0,6,
+,112,112,101,110,100,0,0,9,9,4,10,15,10,8,0,
+,7,10,1,19,7,9,7,18,0,0,1,18,0,255,213,
+,10,0,3,112,111,112,0,9,9,4,10,31,7,0,0,
+,7,9,7,15,8,7,0,12,11,0,3,108,101,110,0,
+,10,11,0,15,11,8,0,31,9,11,1,19,9,10,9,
+,7,9,0,1,9,5,7,15,2,9,0,12,11,0,1,
+,0,0,0,13,10,11,0,12,11,0,3,97,100,100,0,
+,10,10,11,12,11,0,6,115,121,109,98,111,108,0,0,
+,12,8,0,31,9,11,2,19,9,10,9,12,10,0,7,
 ,95,66,69,71,73,78,0,13,9,10,0,36,9,9,8,
 ,9,0,0,18,0,0,20,12,10,0,1,84,0,0,0,
 ,9,10,0,12,11,0,1,84,0,0,0,13,10,11,0,
 ,193 → 366,117
 ,11,0,6,98,114,97,99,101,115,0,0,9,10,10,11,
 ,11,0,0,0,0,0,0,0,0,240,63,1,10,10,11,
 ,11,0,6,98,114,97,99,101,115,0,0,10,9,11,10,
-,0,0,1,30,9,0,106,32,32,32,32,105,102,32,118,
-,105,110,32,66,95,69,78,68,58,32,84,46,98,114,97,
-,101,115,32,45,61,32,49,0,0,0,0,12,10,0,5,
-,95,69,78,68,0,0,0,13,9,10,0,36,9,9,8,
-,9,0,0,18,0,0,20,12,10,0,1,84,0,0,0,
-,9,10,0,12,11,0,1,84,0,0,0,13,10,11,0,
-,11,0,6,98,114,97,99,101,115,0,0,9,10,10,11,
-,11,0,0,0,0,0,0,0,0,240,63,2,10,10,11,
-,11,0,6,98,114,97,99,101,115,0,0,10,9,11,10,
-,0,0,1,30,4,0,107,32,32,32,32,114,101,116,117,
-,110,32,105,0,0,0,0,20,2,0,0,0,0,0,0,
-,11,0,9,100,111,95,115,121,109,98,111,108,0,0,0,
-,11,10,0,30,6,0,109,100,101,102,32,100,111,95,110,
-,109,98,101,114,40,115,44,105,44,108,41,58,0,0,0,
-,11,0,242,44,10,0,0,30,6,0,109,100,101,102,32,
-,111,95,110,117,109,98,101,114,40,115,44,105,44,108,41,
-,0,0,0,12,1,0,16,99,111,114,101,47,116,111,107,
-,110,105,122,101,46,112,121,0,0,0,0,33,1,0,0,
-,1,0,9,100,111,95,110,117,109,98,101,114,0,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
-,2,0,3,28,4,0,0,9,3,0,4,30,7,0,110,
-,32,32,32,118,44,105,44,99,32,61,115,91,105,93,44,
-,43,49,44,115,91,105,93,0,0,0,0,9,5,1,2,
-,4,5,0,11,7,0,0,0,0,0,0,0,0,240,63,
-,6,2,7,15,5,6,0,9,7,1,2,15,6,7,0,
-,7,4,0,15,2,5,0,15,4,6,0,30,4,0,111,
-,32,32,32,119,104,105,108,101,32,105,60,108,58,0,0,
-,5,2,3,21,5,0,0,18,0,0,74,30,5,0,112,
-,32,32,32,32,32,32,32,99,32,61,32,115,91,105,93,
-,0,0,0,9,5,1,2,15,4,5,0,30,20,0,113,
-,32,32,32,32,32,32,32,105,102,32,40,99,32,60,32,
-,48,39,32,111,114,32,99,32,62,32,39,57,39,41,32,
-,110,100,32,40,99,32,60,32,39,97,39,32,111,114,32,
-,32,62,32,39,102,39,41,32,97,110,100,32,99,32,33,
-,32,39,120,39,58,32,98,114,101,97,107,0,0,0,0,
-,6,0,1,48,0,0,0,25,5,4,6,46,5,0,0,
-,0,0,4,12,5,0,1,57,0,0,0,25,5,5,4,
-,5,0,0,18,0,0,9,12,6,0,1,97,0,0,0,
-,5,4,6,46,5,0,0,18,0,0,4,12,5,0,1,
-,0,0,0,25,5,5,4,21,5,0,0,18,0,0,4,
-,6,0,1,120,0,0,0,35,5,4,6,21,5,0,0,
-,0,0,3,18,0,0,19,18,0,0,1,30,6,0,114,
-,32,32,32,32,32,32,32,118,44,105,32,61,32,118,43,
-,44,105,43,49,0,0,0,1,6,7,4,15,5,6,0,
+,0,0,1,12,10,0,5,66,95,69,78,68,0,0,0,
+,9,10,0,36,9,9,8,21,9,0,0,18,0,0,20,
+,10,0,1,84,0,0,0,13,9,10,0,12,11,0,1,
+,0,0,0,13,10,11,0,12,11,0,6,98,114,97,99,
+,115,0,0,9,10,10,11,11,11,0,0,0,0,0,0,
+,0,240,63,2,10,10,11,12,11,0,6,98,114,97,99,
+,115,0,0,10,9,11,10,18,0,0,1,20,2,0,0,
+,0,0,0,12,15,0,9,100,111,95,115,121,109,98,111,
+,0,0,0,14,15,14,0,16,15,0,143,44,14,0,0,
+,2,0,0,9,1,0,2,28,3,0,0,9,2,0,3,
+,4,0,0,9,3,0,4,9,5,1,2,15,4,5,0,
+,7,0,0,0,0,0,0,0,0,240,63,1,6,2,7,
+,5,6,0,9,7,1,2,15,6,7,0,15,7,4,0,
+,2,5,0,15,4,6,0,25,5,2,3,21,5,0,0,
+,0,0,60,9,5,1,2,15,4,5,0,11,8,0,0,
+,0,0,0,0,0,0,0,11,10,0,0,0,0,0,0,
+,0,0,0,11,12,0,0,0,0,0,0,0,0,240,63,
+,13,0,1,48,0,0,0,25,5,4,13,23,11,5,12,
+,11,0,0,18,0,0,2,18,0,0,4,12,5,0,1,
+,0,0,0,25,5,5,4,23,9,5,10,21,9,0,0,
+,0,0,2,18,0,0,14,11,12,0,0,0,0,0,0,
+,0,240,63,12,13,0,1,97,0,0,0,25,5,4,13,
+,11,5,12,21,11,0,0,18,0,0,2,18,0,0,4,
+,5,0,1,102,0,0,0,25,5,5,4,23,6,5,8,
+,6,0,0,18,0,0,2,18,0,0,4,12,9,0,1,
+,0,0,0,35,5,4,9,21,5,0,0,18,0,0,3,
+,0,0,12,18,0,0,1,1,6,7,4,15,5,6,0,
 ,9,0,0,0,0,0,0,0,0,240,63,1,8,2,9,
-,6,8,0,15,7,5,0,15,2,6,0,18,0,255,181,
-,5,0,115,32,32,32,32,105,102,32,99,32,61,61,32,
-,46,39,58,0,0,0,0,12,6,0,1,46,0,0,0,
-,5,4,6,21,5,0,0,18,0,0,78,30,6,0,116,
-,32,32,32,32,32,32,32,118,44,105,32,61,32,118,43,
-,44,105,43,49,0,0,0,1,6,7,4,15,5,6,0,
-,9,0,0,0,0,0,0,0,0,240,63,1,8,2,9,
-,6,8,0,15,7,5,0,15,2,6,0,30,5,0,117,
-,32,32,32,32,32,32,32,119,104,105,108,101,32,105,60,
-,58,0,0,25,5,2,3,21,5,0,0,18,0,0,52,
-,6,0,118,32,32,32,32,32,32,32,32,32,32,32,32,
-,32,61,32,115,91,105,93,0,0,0,0,9,5,1,2,
-,4,5,0,30,11,0,119,32,32,32,32,32,32,32,32,
-,32,32,32,105,102,32,99,32,60,32,39,48,39,32,111,
-,32,99,32,62,32,39,57,39,58,32,98,114,101,97,107,
-,0,0,0,12,6,0,1,48,0,0,0,25,5,4,6,
-,5,0,0,18,0,0,4,12,5,0,1,57,0,0,0,
-,5,5,4,21,5,0,0,18,0,0,3,18,0,0,20,
-,0,0,1,30,7,0,120,32,32,32,32,32,32,32,32,
-,32,32,32,118,44,105,32,61,32,118,43,99,44,105,43,
-,0,0,0,1,6,7,4,15,5,6,0,11,9,0,0,
+,6,8,0,15,7,5,0,15,2,6,0,18,0,255,195,
+,6,0,1,46,0,0,0,23,5,4,6,21,5,0,0,
+,0,0,43,1,6,7,4,15,5,6,0,11,9,0,0,
 ,0,0,0,0,0,240,63,1,8,2,9,15,6,8,0,
-,7,5,0,15,2,6,0,18,0,255,203,18,0,0,1,
-,6,0,121,32,32,32,32,84,46,97,100,100,40,39,110,
-,109,98,101,114,39,44,118,41,0,0,0,12,8,0,1,
+,7,5,0,15,2,6,0,25,5,2,3,21,5,0,0,
+,0,0,30,9,5,1,2,15,4,5,0,11,8,0,0,
+,0,0,0,0,0,240,63,12,9,0,1,48,0,0,0,
+,5,4,9,23,6,5,8,21,6,0,0,18,0,0,2,
+,0,0,4,12,5,0,1,57,0,0,0,25,5,5,4,
+,5,0,0,18,0,0,3,18,0,0,12,18,0,0,1,
+,6,7,4,15,5,6,0,11,9,0,0,0,0,0,0,
+,0,240,63,1,8,2,9,15,6,8,0,15,7,5,0,
+,2,6,0,18,0,255,225,18,0,0,1,12,8,0,1,
 ,0,0,0,13,6,8,0,12,8,0,3,97,100,100,0,
 ,6,6,8,12,8,0,6,110,117,109,98,101,114,0,0,
-,9,7,0,31,5,8,2,19,5,6,5,30,4,0,122,
-,32,32,32,114,101,116,117,114,110,32,105,0,0,0,0,
-,2,0,0,0,0,0,0,12,12,0,9,100,111,95,110,
-,109,98,101,114,0,0,0,14,12,11,0,30,5,0,124,
-,101,102,32,100,111,95,110,97,109,101,40,115,44,105,44,
-,41,58,0,16,12,0,196,44,10,0,0,30,5,0,124,
-,101,102,32,100,111,95,110,97,109,101,40,115,44,105,44,
-,41,58,0,12,1,0,16,99,111,114,101,47,116,111,107,
-,110,105,122,101,46,112,121,0,0,0,0,33,1,0,0,
-,1,0,7,100,111,95,110,97,109,101,0,34,1,0,0,
+,9,7,0,31,5,8,2,19,5,6,5,20,2,0,0,
+,0,0,0,12,16,0,9,100,111,95,110,117,109,98,101,
+,0,0,0,14,16,15,0,16,16,0,134,44,16,0,0,
 ,2,0,0,9,1,0,2,28,3,0,0,9,2,0,3,
-,4,0,0,9,3,0,4,30,5,0,125,32,32,32,32,
-,44,105,32,61,115,91,105,93,44,105,43,49,0,0,0,
-,5,1,2,15,4,5,0,11,7,0,0,0,0,0,0,
-,0,240,63,1,6,2,7,15,5,6,0,15,6,4,0,
-,2,5,0,30,4,0,126,32,32,32,32,119,104,105,108,
-,32,105,60,108,58,0,0,25,4,2,3,21,4,0,0,
-,0,0,90,30,5,0,127,32,32,32,32,32,32,32,32,
-,32,61,32,115,91,105,93,0,0,0,0,9,5,1,2,
-,4,5,0,30,26,0,128,32,32,32,32,32,32,32,32,
-,102,32,40,99,32,60,32,39,97,39,32,111,114,32,99,
-,62,32,39,122,39,41,32,97,110,100,32,40,99,32,60,
-,39,65,39,32,111,114,32,99,32,62,32,39,90,39,41,
-,97,110,100,32,40,99,32,60,32,39,48,39,32,111,114,
-,99,32,62,32,39,57,39,41,32,97,110,100,32,99,32,
-,61,32,39,95,39,58,32,98,114,101,97,107,0,0,0,
-,7,0,1,97,0,0,0,25,5,4,7,46,5,0,0,
-,0,0,4,12,5,0,1,122,0,0,0,25,5,5,4,
-,5,0,0,18,0,0,9,12,7,0,1,65,0,0,0,
-,5,4,7,46,5,0,0,18,0,0,4,12,5,0,1,
-,0,0,0,25,5,5,4,21,5,0,0,18,0,0,9,
-,7,0,1,48,0,0,0,25,5,4,7,46,5,0,0,
+,4,0,0,9,3,0,4,9,5,1,2,15,4,5,0,
+,7,0,0,0,0,0,0,0,0,240,63,1,6,2,7,
+,5,6,0,15,6,4,0,15,2,5,0,25,4,2,3,
+,4,0,0,18,0,0,80,9,5,1,2,15,4,5,0,
+,8,0,0,0,0,0,0,0,0,0,0,11,10,0,0,
+,0,0,0,0,0,0,0,11,12,0,0,0,0,0,0,
+,0,0,0,11,14,0,0,0,0,0,0,0,0,240,63,
+,15,0,1,97,0,0,0,25,5,4,15,23,13,5,14,
+,13,0,0,18,0,0,2,18,0,0,4,12,5,0,1,
+,0,0,0,25,5,5,4,23,11,5,12,21,11,0,0,
+,0,0,2,18,0,0,14,11,14,0,0,0,0,0,0,
+,0,240,63,12,15,0,1,65,0,0,0,25,5,4,15,
+,13,5,14,21,13,0,0,18,0,0,2,18,0,0,4,
+,5,0,1,90,0,0,0,25,5,5,4,23,9,5,10,
+,9,0,0,18,0,0,2,18,0,0,14,11,12,0,0,
+,0,0,0,0,0,240,63,12,13,0,1,48,0,0,0,
+,5,4,13,23,11,5,12,21,11,0,0,18,0,0,2,
 ,0,0,4,12,5,0,1,57,0,0,0,25,5,5,4,
-,5,0,0,18,0,0,4,12,7,0,1,95,0,0,0,
-,5,4,7,21,5,0,0,18,0,0,3,18,0,0,19,
-,0,0,1,30,6,0,129,32,32,32,32,32,32,32,32,
-,44,105,32,61,32,118,43,99,44,105,43,49,0,0,0,
-,7,6,4,15,5,7,0,11,9,0,0,0,0,0,0,
-,0,240,63,1,8,2,9,15,7,8,0,15,6,5,0,
-,2,7,0,18,0,255,165,30,10,0,130,32,32,32,32,
-,102,32,118,32,105,110,32,83,89,77,66,79,76,83,58,
-,84,46,97,100,100,40,39,115,121,109,98,111,108,39,44,
-,41,0,0,12,7,0,7,83,89,77,66,79,76,83,0,
+,7,5,8,21,7,0,0,18,0,0,2,18,0,0,4,
+,9,0,1,95,0,0,0,35,5,4,9,21,5,0,0,
+,0,0,3,18,0,0,12,18,0,0,1,1,7,6,4,
+,5,7,0,11,9,0,0,0,0,0,0,0,0,240,63,
+,8,2,9,15,7,8,0,15,6,5,0,15,2,7,0,
+,0,255,175,12,7,0,7,83,89,77,66,79,76,83,0,
 ,5,7,0,36,5,5,6,21,5,0,0,18,0,0,14,
 ,8,0,1,84,0,0,0,13,7,8,0,12,8,0,3,
 ,100,100,0,9,7,7,8,12,8,0,6,115,121,109,98,
 ,108,0,0,15,9,6,0,31,5,8,2,19,5,7,5,
-,0,0,22,30,7,0,131,32,32,32,32,101,108,115,101,
-,32,84,46,97,100,100,40,39,110,97,109,101,39,44,118,
-,0,0,0,12,8,0,1,84,0,0,0,13,7,8,0,
+,0,0,14,12,8,0,1,84,0,0,0,13,7,8,0,
 ,8,0,3,97,100,100,0,9,7,7,8,12,8,0,4,
 ,97,109,101,0,0,0,0,15,9,6,0,31,5,8,2,
-,5,7,5,18,0,0,1,30,4,0,132,32,32,32,32,
-,101,116,117,114,110,32,105,0,0,0,0,20,2,0,0,
-,0,0,0,12,13,0,7,100,111,95,110,97,109,101,0,
-,13,12,0,30,6,0,134,100,101,102,32,100,111,95,115,
-,114,105,110,103,40,115,44,105,44,108,41,58,0,0,0,
-,13,1,242,44,11,0,0,30,6,0,134,100,101,102,32,
-,111,95,115,116,114,105,110,103,40,115,44,105,44,108,41,
-,0,0,0,12,1,0,16,99,111,114,101,47,116,111,107,
-,110,105,122,101,46,112,121,0,0,0,0,33,1,0,0,
-,1,0,9,100,111,95,115,116,114,105,110,103,0,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
-,2,0,3,28,4,0,0,9,3,0,4,30,6,0,135,
-,32,32,32,118,44,113,44,105,32,61,32,39,39,44,115,
-,105,93,44,105,43,49,0,12,5,0,0,0,0,0,0,
-,4,5,0,9,6,1,2,15,5,6,0,11,8,0,0,
-,0,0,0,0,0,240,63,1,7,2,8,15,6,7,0,
-,7,4,0,15,4,5,0,15,2,6,0,30,14,0,136,
-,32,32,32,105,102,32,40,108,45,105,41,32,62,61,32,
-,32,97,110,100,32,115,91,105,93,32,61,61,32,113,32,
-,110,100,32,115,91,105,43,49,93,32,61,61,32,113,58,
-,35,32,34,34,34,0,0,11,5,0,0,0,0,0,0,
-,0,20,64,2,6,3,2,24,5,5,6,21,5,0,0,
-,0,0,3,9,5,1,2,23,5,5,4,21,5,0,0,
-,0,0,7,11,8,0,0,0,0,0,0,0,0,240,63,
-,6,2,8,9,5,1,6,23,5,5,4,21,5,0,0,
-,0,0,182,30,4,0,137,32,32,32,32,32,32,32,32,
-,32,43,61,32,50,0,0,11,6,0,0,0,0,0,0,
-,0,0,64,1,5,2,6,15,2,5,0,30,6,0,138,
-,32,32,32,32,32,32,32,119,104,105,108,101,32,105,60,
-,45,50,58,0,0,0,0,11,8,0,0,0,0,0,0,
-,0,0,64,2,6,3,8,25,5,2,6,21,5,0,0,
-,0,0,157,30,6,0,139,32,32,32,32,32,32,32,32,
-,32,32,32,99,32,61,32,115,91,105,93,0,0,0,0,
-,6,1,2,15,5,6,0,30,14,0,140,32,32,32,32,
-,32,32,32,32,32,32,32,105,102,32,99,32,61,61,32,
-,32,97,110,100,32,115,91,105,43,49,93,32,61,61,32,
-,32,97,110,100,32,115,91,105,43,50,93,32,61,61,32,
-,58,0,0,23,6,5,4,21,6,0,0,18,0,0,7,
-,9,0,0,0,0,0,0,0,0,240,63,1,8,2,9,
-,6,1,8,23,6,6,4,21,6,0,0,18,0,0,7,
-,9,0,0,0,0,0,0,0,0,0,64,1,8,2,9,
-,6,1,8,23,6,6,4,21,6,0,0,18,0,0,44,
-,6,0,141,32,32,32,32,32,32,32,32,32,32,32,32,
-,32,32,32,105,32,43,61,32,51,0,0,11,8,0,0,
-,0,0,0,0,0,8,64,1,6,2,8,15,2,6,0,
-,9,0,142,32,32,32,32,32,32,32,32,32,32,32,32,
-,32,32,32,84,46,97,100,100,40,39,115,116,114,105,110,
-,39,44,118,41,0,0,0,12,9,0,1,84,0,0,0,
+,5,7,5,18,0,0,1,20,2,0,0,0,0,0,0,
+,17,0,7,100,111,95,110,97,109,101,0,14,17,16,0,
+,17,1,3,44,14,0,0,28,2,0,0,9,1,0,2,
+,3,0,0,9,2,0,3,28,4,0,0,9,3,0,4,
+,5,0,0,0,0,0,0,15,4,5,0,9,6,1,2,
+,5,6,0,11,8,0,0,0,0,0,0,0,0,240,63,
+,7,2,8,15,6,7,0,15,7,4,0,15,4,5,0,
+,2,6,0,11,8,0,0,0,0,0,0,0,0,0,0,
+,10,0,0,0,0,0,0,0,0,0,0,11,5,0,0,
+,0,0,0,0,0,20,64,2,11,3,2,24,5,5,11,
+,9,5,10,21,9,0,0,18,0,0,2,18,0,0,3,
+,5,1,2,23,5,5,4,23,6,5,8,21,6,0,0,
+,0,0,2,18,0,0,7,11,10,0,0,0,0,0,0,
+,0,240,63,1,9,2,10,9,5,1,9,23,5,5,4,
+,5,0,0,18,0,0,105,11,6,0,0,0,0,0,0,
+,0,0,64,1,5,2,6,15,2,5,0,11,8,0,0,
+,0,0,0,0,0,0,64,2,6,3,8,25,5,2,6,
+,5,0,0,18,0,0,92,9,6,1,2,15,5,6,0,
+,9,0,0,0,0,0,0,0,0,0,0,11,11,0,0,
+,0,0,0,0,0,0,0,23,6,5,4,23,10,6,11,
+,10,0,0,18,0,0,2,18,0,0,7,11,13,0,0,
+,0,0,0,0,0,240,63,1,12,2,13,9,6,1,12,
+,6,6,4,23,8,6,9,21,8,0,0,18,0,0,2,
+,0,0,7,11,11,0,0,0,0,0,0,0,0,0,64,
+,10,2,11,9,6,1,10,23,6,6,4,21,6,0,0,
+,0,0,20,11,8,0,0,0,0,0,0,0,0,8,64,
+,6,2,8,15,2,6,0,12,9,0,1,84,0,0,0,
 ,8,9,0,12,9,0,3,97,100,100,0,9,8,8,9,
 ,9,0,6,115,116,114,105,110,103,0,0,15,10,7,0,
-,6,9,2,19,6,8,6,30,6,0,143,32,32,32,32,
-,32,32,32,32,32,32,32,32,32,32,32,98,114,101,97,
-,0,0,0,18,0,0,72,18,0,0,70,30,5,0,144,
-,32,32,32,32,32,32,32,32,32,32,32,101,108,115,101,
-,0,0,0,30,8,0,145,32,32,32,32,32,32,32,32,
-,32,32,32,32,32,32,32,118,44,105,32,61,32,118,43,
-,44,105,43,49,0,0,0,1,8,7,5,15,6,8,0,
-,10,0,0,0,0,0,0,0,0,240,63,1,9,2,10,
-,8,9,0,15,7,6,0,15,2,8,0,30,13,0,146,
-,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,
-,102,32,99,32,61,61,32,39,92,110,39,58,32,84,46,
-,44,84,46,121,105,32,61,32,84,46,121,43,49,44,105,
-,0,0,0,12,8,0,1,10,0,0,0,23,6,5,8,
+,6,9,2,19,6,8,6,18,0,0,43,18,0,0,41,
+,8,7,5,15,6,8,0,11,10,0,0,0,0,0,0,
+,0,240,63,1,9,2,10,15,8,9,0,15,7,6,0,
+,2,8,0,12,8,0,1,10,0,0,0,23,6,5,8,
 ,6,0,0,18,0,0,26,12,9,0,1,84,0,0,0,
 ,8,9,0,12,9,0,1,121,0,0,0,9,8,8,9,
 ,9,0,0,0,0,0,0,0,0,240,63,1,8,8,9,
 ,728 → 484,340
 ,9,10,0,12,10,0,1,121,0,0,0,10,9,10,6,
 ,9,0,1,84,0,0,0,13,6,9,0,12,9,0,2,
 ,105,0,0,10,6,9,8,18,0,0,1,18,0,0,1,
-,0,255,94,18,0,0,230,30,5,0,148,32,32,32,32,
-,32,32,32,119,104,105,108,101,32,105,60,108,58,0,0,
-,6,2,3,21,6,0,0,18,0,0,220,30,6,0,149,
-,32,32,32,32,32,32,32,32,32,32,32,99,32,61,32,
-,91,105,93,0,0,0,0,9,6,1,2,15,5,6,0,
-,7,0,150,32,32,32,32,32,32,32,32,32,32,32,32,
-,102,32,99,32,61,61,32,34,92,92,34,58,0,0,0,
-,8,0,1,92,0,0,0,23,6,5,8,21,6,0,0,
-,0,0,124,30,9,0,151,32,32,32,32,32,32,32,32,
-,32,32,32,32,32,32,32,105,32,61,32,105,43,49,59,
-,99,32,61,32,115,91,105,93,0,0,0,11,8,0,0,
-,0,0,0,0,0,240,63,1,6,2,8,15,2,6,0,
-,6,1,2,15,5,6,0,30,10,0,152,32,32,32,32,
-,32,32,32,32,32,32,32,32,32,32,32,105,102,32,99,
-,61,61,32,34,110,34,58,32,99,32,61,32,39,92,110,
-,0,0,0,12,8,0,1,110,0,0,0,23,6,5,8,
-,6,0,0,18,0,0,5,12,6,0,1,10,0,0,0,
-,5,6,0,18,0,0,1,30,11,0,153,32,32,32,32,
-,32,32,32,32,32,32,32,32,32,32,32,105,102,32,99,
-,61,61,32,34,114,34,58,32,99,32,61,32,99,104,114,
-,49,51,41,0,0,0,0,12,8,0,1,114,0,0,0,
-,6,5,8,21,6,0,0,18,0,0,11,12,9,0,3,
-,104,114,0,13,8,9,0,11,9,0,0,0,0,0,0,
-,0,42,64,31,6,9,1,19,6,8,6,15,5,6,0,
-,0,0,1,30,10,0,154,32,32,32,32,32,32,32,32,
-,32,32,32,32,32,32,32,105,102,32,99,32,61,61,32,
-,116,34,58,32,99,32,61,32,34,92,116,34,0,0,0,
-,8,0,1,116,0,0,0,23,6,5,8,21,6,0,0,
-,0,0,5,12,6,0,1,9,0,0,0,15,5,6,0,
-,0,0,1,30,10,0,155,32,32,32,32,32,32,32,32,
-,32,32,32,32,32,32,32,105,102,32,99,32,61,61,32,
-,48,34,58,32,99,32,61,32,34,92,48,34,0,0,0,
+,0,255,159,18,0,0,104,25,6,2,3,21,6,0,0,
+,0,0,100,9,6,1,2,15,5,6,0,12,8,0,1,
+,0,0,0,23,6,5,8,21,6,0,0,18,0,0,60,
+,8,0,0,0,0,0,0,0,0,240,63,1,6,2,8,
+,2,6,0,9,6,1,2,15,5,6,0,12,8,0,1,
+,0,0,0,23,6,5,8,21,6,0,0,18,0,0,5,
+,6,0,1,10,0,0,0,15,5,6,0,18,0,0,1,
+,8,0,1,114,0,0,0,23,6,5,8,21,6,0,0,
+,0,0,11,12,9,0,3,99,104,114,0,13,8,9,0,
+,9,0,0,0,0,0,0,0,0,42,64,31,6,9,1,
+,6,8,6,15,5,6,0,18,0,0,1,12,8,0,1,
+,0,0,0,23,6,5,8,21,6,0,0,18,0,0,5,
+,6,0,1,9,0,0,0,15,5,6,0,18,0,0,1,
 ,8,0,1,48,0,0,0,23,6,5,8,21,6,0,0,
 ,0,0,5,12,6,0,1,0,0,0,0,15,5,6,0,
-,0,0,1,30,8,0,156,32,32,32,32,32,32,32,32,
-,32,32,32,32,32,32,32,118,44,105,32,61,32,118,43,
-,44,105,43,49,0,0,0,1,8,7,5,15,6,8,0,
-,10,0,0,0,0,0,0,0,0,240,63,1,9,2,10,
-,8,9,0,15,7,6,0,15,2,8,0,18,0,0,74,
-,7,0,157,32,32,32,32,32,32,32,32,32,32,32,32,
-,108,105,102,32,99,32,61,61,32,113,58,0,0,0,0,
-,6,5,4,21,6,0,0,18,0,0,44,30,6,0,158,
-,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,
-,32,43,61,32,49,0,0,11,8,0,0,0,0,0,0,
-,0,240,63,1,6,2,8,15,2,6,0,30,9,0,159,
-,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,
-,46,97,100,100,40,39,115,116,114,105,110,103,39,44,118,
-,0,0,0,12,9,0,1,84,0,0,0,13,8,9,0,
-,9,0,3,97,100,100,0,9,8,8,9,12,9,0,6,
-,116,114,105,110,103,0,0,15,10,7,0,31,6,9,2,
-,6,8,6,30,6,0,160,32,32,32,32,32,32,32,32,
-,32,32,32,32,32,32,32,98,114,101,97,107,0,0,0,
-,0,0,22,18,0,0,20,30,8,0,162,32,32,32,32,
-,32,32,32,32,32,32,32,32,32,32,32,118,44,105,32,
-,32,118,43,99,44,105,43,49,0,0,0,1,8,7,5,
-,6,8,0,11,10,0,0,0,0,0,0,0,0,240,63,
-,9,2,10,15,8,9,0,15,7,6,0,15,2,8,0,
-,0,0,1,18,0,255,35,18,0,0,1,30,4,0,163,
-,32,32,32,114,101,116,117,114,110,32,105,0,0,0,0,
-,2,0,0,0,0,0,0,12,14,0,9,100,111,95,115,
-,114,105,110,103,0,0,0,14,14,13,0,30,6,0,165,
-,101,102,32,100,111,95,99,111,109,109,101,110,116,40,115,
-,105,44,108,41,58,0,0,16,14,0,85,44,7,0,0,
-,6,0,165,100,101,102,32,100,111,95,99,111,109,109,101,
-,116,40,115,44,105,44,108,41,58,0,0,12,1,0,16,
-,111,114,101,47,116,111,107,101,110,105,122,101,46,112,121,
-,0,0,0,33,1,0,0,12,1,0,10,100,111,95,99,
-,109,109,101,110,116,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,28,3,0,0,9,2,0,3,28,4,0,0,
-,3,0,4,30,3,0,166,32,32,32,32,105,32,43,61,
-,49,0,0,11,5,0,0,0,0,0,0,0,0,240,63,
-,4,2,5,15,2,4,0,30,4,0,167,32,32,32,32,
-,104,105,108,101,32,105,60,108,58,0,0,25,4,2,3,
-,4,0,0,18,0,0,35,30,5,0,168,32,32,32,32,
-,32,32,32,99,32,61,32,115,91,105,93,0,0,0,0,
-,5,1,2,15,4,5,0,30,7,0,169,32,32,32,32,
-,32,32,32,105,102,32,99,32,61,61,32,39,92,110,39,
-,32,98,114,101,97,107,0,12,6,0,1,10,0,0,0,
-,5,4,6,21,5,0,0,18,0,0,3,18,0,0,13,
-,0,0,1,30,4,0,170,32,32,32,32,32,32,32,32,
-,32,43,61,32,49,0,0,11,6,0,0,0,0,0,0,
-,0,240,63,1,5,2,6,15,2,5,0,18,0,255,220,
-,4,0,171,32,32,32,32,114,101,116,117,114,110,32,105,
-,0,0,0,20,2,0,0,0,0,0,0,12,15,0,10,
-,111,95,99,111,109,109,101,110,116,0,0,14,15,14,0,
-,0,0,0,
+,0,0,1,1,8,7,5,15,6,8,0,11,10,0,0,
+,0,0,0,0,0,240,63,1,9,2,10,15,8,9,0,
+,7,6,0,15,2,8,0,18,0,0,33,23,6,5,4,
+,6,0,0,18,0,0,20,11,8,0,0,0,0,0,0,
+,0,240,63,1,6,2,8,15,2,6,0,12,9,0,1,
+,0,0,0,13,8,9,0,12,9,0,3,97,100,100,0,
+,8,8,9,12,9,0,6,115,116,114,105,110,103,0,0,
+,10,7,0,31,6,9,2,19,6,8,6,18,0,0,13,
+,0,0,11,1,8,7,5,15,6,8,0,11,10,0,0,
+,0,0,0,0,0,240,63,1,9,2,10,15,8,9,0,
+,7,6,0,15,2,8,0,18,0,0,1,18,0,255,155,
+,0,0,1,20,2,0,0,0,0,0,0,12,18,0,9,
+,111,95,115,116,114,105,110,103,0,0,0,14,18,17,0,
+,18,0,33,44,7,0,0,28,2,0,0,9,1,0,2,
+,3,0,0,9,2,0,3,28,4,0,0,9,3,0,4,
+,5,0,0,0,0,0,0,0,0,240,63,1,4,2,5,
+,2,4,0,25,4,2,3,21,4,0,0,18,0,0,16,
+,5,1,2,15,4,5,0,12,6,0,1,10,0,0,0,
+,5,4,6,21,5,0,0,18,0,0,3,18,0,0,8,
+,0,0,1,11,6,0,0,0,0,0,0,0,0,240,63,
+,5,2,6,15,2,5,0,18,0,255,239,20,2,0,0,
+,0,0,0,12,19,0,10,100,111,95,99,111,109,109,101,
+,116,0,0,14,19,18,0,0,0,0,0,
 };
 unsigned char tp_parse[] = {
-,114,0,0,30,6,0,1,105,109,112,111,114,116,32,116,
-,107,101,110,105,122,101,44,32,115,121,115,0,0,0,0,
-,0,0,13,99,111,114,101,47,112,97,114,115,101,46,112,
-,0,0,0,33,0,0,0,12,0,0,1,63,0,0,0,
-,0,0,0,12,2,0,6,105,109,112,111,114,116,0,0,
+,114,0,0,12,2,0,6,105,109,112,111,114,116,0,0,
 ,1,2,0,12,2,0,8,116,111,107,101,110,105,122,101,
 ,0,0,0,31,0,2,1,19,0,1,0,12,1,0,8,
 ,111,107,101,110,105,122,101,0,0,0,0,14,1,0,0,
 ,2,0,6,105,109,112,111,114,116,0,0,13,1,2,0,
-,2,0,3,115,121,115,0,31,0,2,1,19,0,1,0,
-,1,0,3,115,121,115,0,14,1,0,0,30,7,0,2,
-,114,111,109,32,116,111,107,101,110,105,122,101,32,105,109,
-,111,114,116,32,84,111,107,101,110,0,0,12,2,0,6,
-,109,112,111,114,116,0,0,13,1,2,0,12,2,0,8,
-,111,107,101,110,105,122,101,0,0,0,0,31,0,2,1,
-,0,1,0,12,2,0,8,95,95,100,105,99,116,95,95,
-,0,0,0,13,1,2,0,12,3,0,5,84,111,107,101,
-,0,0,0,9,2,0,3,12,0,0,5,84,111,107,101,
-,0,0,0,10,1,0,2,30,8,0,3,105,102,32,110,
-,116,32,34,116,105,110,121,112,121,34,32,105,110,32,115,
-,115,46,118,101,114,115,105,111,110,58,0,12,2,0,3,
-,121,115,0,13,1,2,0,12,2,0,7,118,101,114,115,
-,111,110,0,9,1,1,2,12,2,0,6,116,105,110,121,
-,121,0,0,36,1,1,2,47,0,1,0,21,0,0,0,
-,0,0,30,30,6,0,4,32,32,32,32,102,114,111,109,
-,98,111,111,116,32,105,109,112,111,114,116,32,42,0,0,
+,2,0,8,116,111,107,101,110,105,122,101,0,0,0,0,
+,0,2,1,19,0,1,0,12,2,0,8,95,95,100,105,
+,116,95,95,0,0,0,0,13,1,2,0,12,3,0,5,
+,111,107,101,110,0,0,0,9,2,0,3,12,0,0,5,
+,111,107,101,110,0,0,0,10,1,0,2,12,2,0,3,
+,116,114,0,13,1,2,0,11,2,0,0,0,0,0,0,
+,0,240,63,31,0,2,1,19,0,1,0,12,1,0,1,
+,0,0,0,36,0,0,1,21,0,0,0,18,0,0,23,
 ,2,0,6,105,109,112,111,114,116,0,0,13,1,2,0,
 ,2,0,4,98,111,111,116,0,0,0,0,31,0,2,1,
 ,0,1,0,12,3,0,5,109,101,114,103,101,0,0,0,
 ,2,3,0,12,5,0,8,95,95,100,105,99,116,95,95,
 ,0,0,0,13,3,5,0,15,4,0,0,31,1,3,2,
-,1,2,1,18,0,0,1,30,5,0,6,100,101,102,32,
-,104,101,99,107,40,116,44,42,118,115,41,58,0,0,0,
-,0,0,115,44,6,0,0,30,5,0,6,100,101,102,32,
-,104,101,99,107,40,116,44,42,118,115,41,58,0,0,0,
-,1,0,13,99,111,114,101,47,112,97,114,115,101,46,112,
-,0,0,0,33,1,0,0,12,1,0,5,99,104,101,99,
-,0,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,3,0,1,42,0,0,0,9,2,0,3,30,9,0,7,
-,32,32,32,105,102,32,118,115,91,48,93,32,61,61,32,
-,111,110,101,58,32,114,101,116,117,114,110,32,84,114,117,
-,0,0,0,11,4,0,0,0,0,0,0,0,0,0,0,
+,1,2,1,18,0,0,1,16,0,0,63,44,8,0,0,
+,2,0,0,9,1,0,2,12,3,0,1,42,0,0,0,
+,2,0,3,11,4,0,0,0,0,0,0,0,0,0,0,
 ,3,2,4,28,4,0,0,23,3,3,4,21,3,0,0,
 ,0,0,6,11,3,0,0,0,0,0,0,0,0,240,63,
-,3,0,0,18,0,0,1,30,9,0,8,32,32,32,32,
-,102,32,116,46,116,121,112,101,32,105,110,32,118,115,58,
-,114,101,116,117,114,110,32,84,114,117,101,0,0,0,0,
-,5,0,4,116,121,112,101,0,0,0,0,9,4,1,5,
-,3,2,4,21,3,0,0,18,0,0,6,11,3,0,0,
+,3,0,0,18,0,0,1,12,5,0,4,116,121,112,101,
+,0,0,0,9,4,1,5,36,3,2,4,21,3,0,0,
+,0,0,6,11,3,0,0,0,0,0,0,0,0,240,63,
+,3,0,0,18,0,0,1,11,5,0,0,0,0,0,0,
+,0,0,0,12,6,0,4,116,121,112,101,0,0,0,0,
+,3,1,6,12,6,0,6,115,121,109,98,111,108,0,0,
+,3,3,6,23,4,3,5,21,4,0,0,18,0,0,2,
+,0,0,5,12,7,0,3,118,97,108,0,9,6,1,7,
+,3,2,6,21,3,0,0,18,0,0,6,11,3,0,0,
 ,0,0,0,0,0,240,63,20,3,0,0,18,0,0,1,
-,14,0,9,32,32,32,32,105,102,32,116,46,116,121,112,
-,32,61,61,32,39,115,121,109,98,111,108,39,32,97,110,
-,32,116,46,118,97,108,32,105,110,32,118,115,58,32,114,
-,116,117,114,110,32,84,114,117,101,0,0,12,4,0,4,
-,121,112,101,0,0,0,0,9,3,1,4,12,4,0,6,
-,121,109,98,111,108,0,0,23,3,3,4,21,3,0,0,
-,0,0,5,12,5,0,3,118,97,108,0,9,4,1,5,
-,3,2,4,21,3,0,0,18,0,0,6,11,3,0,0,
-,0,0,0,0,0,240,63,20,3,0,0,18,0,0,1,
-,5,0,10,32,32,32,32,114,101,116,117,114,110,32,70,
-,108,115,101,0,0,0,0,11,3,0,0,0,0,0,0,
-,0,0,0,20,3,0,0,0,0,0,0,12,1,0,5,
-,104,101,99,107,0,0,0,14,1,0,0,30,4,0,12,
-,101,102,32,116,119,101,97,107,40,107,44,118,41,58,0,
-,1,0,102,44,10,0,0,30,4,0,12,100,101,102,32,
-,119,101,97,107,40,107,44,118,41,58,0,12,1,0,13,
-,111,114,101,47,112,97,114,115,101,46,112,121,0,0,0,
-,1,0,0,12,1,0,5,116,119,101,97,107,0,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
-,2,0,3,30,8,0,13,32,32,32,32,80,46,115,116,
-,99,107,46,97,112,112,101,110,100,40,40,107,44,100,109,
-,112,91,107,93,41,41,0,12,5,0,1,80,0,0,0,
-,4,5,0,12,5,0,5,115,116,97,99,107,0,0,0,
-,4,4,5,12,5,0,6,97,112,112,101,110,100,0,0,
-,4,4,5,15,6,1,0,12,8,0,4,100,109,97,112,
-,0,0,0,13,7,8,0,9,7,7,1,27,5,6,2,
-,3,5,1,19,3,4,3,30,7,0,14,32,32,32,32,
-,102,32,118,58,32,100,109,97,112,91,107,93,32,61,32,
-,109,97,112,91,107,93,0,21,2,0,0,18,0,0,12,
+,3,0,0,0,0,0,0,0,0,0,0,20,3,0,0,
+,0,0,0,12,1,0,5,99,104,101,99,107,0,0,0,
+,1,0,0,16,1,0,58,44,10,0,0,28,2,0,0,
+,1,0,2,28,3,0,0,9,2,0,3,12,5,0,1,
+,0,0,0,13,4,5,0,12,5,0,5,115,116,97,99,
+,0,0,0,9,4,4,5,12,5,0,6,97,112,112,101,
+,100,0,0,9,4,4,5,15,6,1,0,12,8,0,4,
+,109,97,112,0,0,0,0,13,7,8,0,9,7,7,1,
+,5,6,2,31,3,5,1,19,3,4,3,21,2,0,0,
+,0,0,12,12,4,0,4,100,109,97,112,0,0,0,0,
+,3,4,0,12,5,0,4,111,109,97,112,0,0,0,0,
+,4,5,0,9,4,4,1,10,3,1,4,18,0,0,19,
 ,4,0,4,100,109,97,112,0,0,0,0,13,3,4,0,
-,5,0,4,111,109,97,112,0,0,0,0,13,4,5,0,
-,4,4,1,10,3,1,4,18,0,0,31,30,11,0,15,
-,32,32,32,101,108,115,101,58,32,100,109,97,112,91,107,
-,32,61,32,123,39,108,98,112,39,58,48,44,39,110,117,
-,39,58,105,116,115,101,108,102,125,0,0,12,4,0,4,
-,109,97,112,0,0,0,0,13,3,4,0,12,5,0,3,
-,98,112,0,11,6,0,0,0,0,0,0,0,0,0,0,
-,7,0,3,110,117,100,0,12,9,0,6,105,116,115,101,
-,102,0,0,13,8,9,0,26,4,5,4,10,3,1,4,
-,0,0,1,0,0,0,0,12,2,0,5,116,119,101,97,
-,0,0,0,14,2,1,0,30,4,0,16,100,101,102,32,
-,101,115,116,111,114,101,40,41,58,0,0,16,2,0,57,
-,6,0,0,30,4,0,16,100,101,102,32,114,101,115,116,
-,114,101,40,41,58,0,0,12,1,0,13,99,111,114,101,
-,112,97,114,115,101,46,112,121,0,0,0,33,1,0,0,
-,1,0,7,114,101,115,116,111,114,101,0,34,1,0,0,
-,6,0,17,32,32,32,32,107,44,118,32,61,32,80,46,
-,116,97,99,107,46,112,111,112,40,41,0,12,3,0,1,
-,0,0,0,13,2,3,0,12,3,0,5,115,116,97,99,
-,0,0,0,9,2,2,3,12,3,0,3,112,111,112,0,
-,2,2,3,31,1,0,0,19,1,2,1,11,4,0,0,
-,0,0,0,0,0,0,0,9,3,1,4,15,2,3,0,
-,5,0,0,0,0,0,0,0,0,240,63,9,4,1,5,
-,3,4,0,30,4,0,18,32,32,32,32,100,109,97,112,
-,107,93,32,61,32,118,0,12,4,0,4,100,109,97,112,
-,0,0,0,13,1,4,0,10,1,2,3,0,0,0,0,
-,3,0,7,114,101,115,116,111,114,101,0,14,3,2,0,
-,3,0,20,100,101,102,32,99,112,121,40,100,41,58,0,
-,3,0,46,44,6,0,0,30,3,0,20,100,101,102,32,
-,112,121,40,100,41,58,0,12,1,0,13,99,111,114,101,
-,112,97,114,115,101,46,112,121,0,0,0,33,1,0,0,
-,1,0,3,99,112,121,0,34,1,0,0,28,2,0,0,
-,1,0,2,30,3,0,21,32,32,32,32,114,32,61,32,
-,125,0,0,26,3,0,0,15,2,3,0,30,7,0,22,
-,32,32,32,102,111,114,32,107,32,105,110,32,100,58,32,
-,91,107,93,32,61,32,100,91,107,93,0,11,4,0,0,
+,5,0,3,108,98,112,0,11,6,0,0,0,0,0,0,
+,0,0,0,12,7,0,3,110,117,100,0,12,9,0,6,
+,116,115,101,108,102,0,0,13,8,9,0,26,4,5,4,
+,3,1,4,18,0,0,1,0,0,0,0,12,2,0,5,
+,119,101,97,107,0,0,0,14,2,1,0,16,2,0,30,
+,6,0,0,12,3,0,1,80,0,0,0,13,2,3,0,
+,3,0,5,115,116,97,99,107,0,0,0,9,2,2,3,
+,3,0,3,112,111,112,0,9,2,2,3,31,1,0,0,
+,1,2,1,11,4,0,0,0,0,0,0,0,0,0,0,
+,3,1,4,15,2,3,0,11,5,0,0,0,0,0,0,
+,0,240,63,9,4,1,5,15,3,4,0,12,4,0,4,
+,109,97,112,0,0,0,0,13,1,4,0,10,1,2,3,
+,0,0,0,12,3,0,7,114,101,115,116,111,114,101,0,
+,3,2,0,16,3,0,16,44,6,0,0,28,2,0,0,
+,1,0,2,26,3,0,0,15,2,3,0,11,4,0,0,
 ,0,0,0,0,0,0,0,42,3,1,4,18,0,0,4,
-,5,1,3,10,2,3,5,18,0,255,252,30,4,0,23,
-,32,32,32,114,101,116,117,114,110,32,114,0,0,0,0,
-,2,0,0,0,0,0,0,12,4,0,3,99,112,121,0,
-,4,3,0,30,4,0,25,99,108,97,115,115,32,80,68,
-,116,97,58,0,0,0,0,26,4,0,0,12,5,0,5,
-,68,97,116,97,0,0,0,14,5,4,0,12,7,0,7,
-,101,116,109,101,116,97,0,13,6,7,0,15,7,4,0,
-,9,0,6,111,98,106,101,99,116,0,0,13,8,9,0,
-,5,7,2,19,5,6,5,16,5,0,106,44,6,0,0,
-,9,0,26,32,32,32,32,100,101,102,32,95,95,105,110,
-,116,95,95,40,115,101,108,102,44,115,44,116,111,107,101,
-,115,41,58,0,0,0,0,12,1,0,13,99,111,114,101,
-,112,97,114,115,101,46,112,121,0,0,0,33,1,0,0,
-,1,0,8,95,95,105,110,105,116,95,95,0,0,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
-,2,0,3,28,4,0,0,9,3,0,4,30,5,0,27,
-,32,32,32,32,32,32,32,115,101,108,102,46,115,32,61,
-,115,0,0,12,4,0,1,115,0,0,0,10,1,4,2,
-,8,0,28,32,32,32,32,32,32,32,32,115,101,108,102,
-,116,111,107,101,110,115,32,61,32,116,111,107,101,110,115,
-,0,0,0,12,4,0,6,116,111,107,101,110,115,0,0,
-,1,4,3,30,6,0,29,32,32,32,32,32,32,32,32,
-,101,108,102,46,112,111,115,32,61,32,48,0,0,0,0,
+,5,1,3,10,2,3,5,18,0,255,252,20,2,0,0,
+,0,0,0,12,4,0,3,99,112,121,0,14,4,3,0,
+,4,0,0,12,5,0,5,80,68,97,116,97,0,0,0,
+,5,4,0,16,5,0,32,44,6,0,0,28,2,0,0,
+,1,0,2,28,3,0,0,9,2,0,3,28,4,0,0,
+,3,0,4,12,4,0,1,115,0,0,0,10,1,4,2,
+,4,0,6,116,111,107,101,110,115,0,0,10,1,4,3,
 ,4,0,0,0,0,0,0,0,0,0,0,12,5,0,3,
-,111,115,0,10,1,5,4,30,7,0,30,32,32,32,32,
-,32,32,32,115,101,108,102,46,116,111,107,101,110,32,61,
-,78,111,110,101,0,0,0,28,4,0,0,12,5,0,5,
-,111,107,101,110,0,0,0,10,1,5,4,30,6,0,31,
-,32,32,32,32,32,32,32,115,101,108,102,46,115,116,97,
-,107,32,61,32,91,93,0,27,4,0,0,12,5,0,5,
-,116,97,99,107,0,0,0,10,1,5,4,30,7,0,32,
-,32,32,32,32,32,32,32,115,101,108,102,46,95,116,101,
-,109,105,110,97,108,32,61,32,48,0,0,11,4,0,0,
-,0,0,0,0,0,0,0,12,5,0,9,95,116,101,114,
-,105,110,97,108,0,0,0,10,1,5,4,0,0,0,0,
-,6,0,8,95,95,105,110,105,116,95,95,0,0,0,0,
-,4,6,5,16,6,0,88,44,7,0,0,30,5,0,33,
-,32,32,32,100,101,102,32,105,110,105,116,40,115,101,108,
-,41,58,0,12,1,0,13,99,111,114,101,47,112,97,114,
-,101,46,112,121,0,0,0,33,1,0,0,12,1,0,4,
-,110,105,116,0,0,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,30,7,0,34,32,32,32,32,32,32,32,32,
-,108,111,98,97,108,32,111,109,97,112,44,100,109,97,112,
-,0,0,0,30,8,0,35,32,32,32,32,32,32,32,32,
-,109,97,112,32,61,32,99,112,121,40,98,97,115,101,95,
-,109,97,112,41,0,0,0,12,2,0,4,111,109,97,112,
+,111,115,0,10,1,5,4,28,4,0,0,12,5,0,5,
+,111,107,101,110,0,0,0,10,1,5,4,27,4,0,0,
+,5,0,5,115,116,97,99,107,0,0,0,10,1,5,4,
+,0,0,0,12,6,0,8,95,95,105,110,105,116,95,95,
+,0,0,0,10,4,6,5,16,6,0,39,44,7,0,0,
+,2,0,0,9,1,0,2,12,2,0,4,111,109,97,112,
 ,0,0,0,12,5,0,3,99,112,121,0,13,4,5,0,
 ,6,0,9,98,97,115,101,95,100,109,97,112,0,0,0,
 ,5,6,0,31,3,5,1,19,3,4,3,14,2,3,0,
-,8,0,36,32,32,32,32,32,32,32,32,100,109,97,112,
-,61,32,99,112,121,40,98,97,115,101,95,100,109,97,112,
-,0,0,0,12,2,0,4,100,109,97,112,0,0,0,0,
-,5,0,3,99,112,121,0,13,4,5,0,12,6,0,9,
-,97,115,101,95,100,109,97,112,0,0,0,13,5,6,0,
-,3,5,1,19,3,4,3,14,2,3,0,30,6,0,37,
-,32,32,32,32,32,32,32,115,101,108,102,46,97,100,118,
-,110,99,101,40,41,0,0,12,4,0,7,97,100,118,97,
+,2,0,4,100,109,97,112,0,0,0,0,12,5,0,3,
+,112,121,0,13,4,5,0,12,6,0,9,98,97,115,101,
+,100,109,97,112,0,0,0,13,5,6,0,31,3,5,1,
+,3,4,3,14,2,3,0,12,4,0,7,97,100,118,97,
 ,99,101,0,9,3,1,4,31,2,0,0,19,2,3,2,
 ,0,0,0,12,7,0,4,105,110,105,116,0,0,0,0,
-,4,7,6,16,7,1,22,44,12,0,0,30,8,0,38,
-,32,32,32,100,101,102,32,97,100,118,97,110,99,101,40,
-,101,108,102,44,118,97,108,61,78,111,110,101,41,58,0,
-,1,0,13,99,111,114,101,47,112,97,114,115,101,46,112,
-,0,0,0,33,1,0,0,12,1,0,7,97,100,118,97,
-,99,101,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,2,0,0,28,3,0,0,32,2,0,3,30,10,0,39,
-,32,32,32,32,32,32,32,105,102,32,110,111,116,32,99,
-,101,99,107,40,115,101,108,102,46,116,111,107,101,110,44,
-,97,108,41,58,0,0,0,12,6,0,5,99,104,101,99,
-,0,0,0,13,5,6,0,12,8,0,5,116,111,107,101,
-,0,0,0,9,6,1,8,15,7,2,0,31,4,6,2,
-,4,5,4,47,3,4,0,21,3,0,0,18,0,0,30,
-,12,0,40,32,32,32,32,32,32,32,32,32,32,32,32,
-,114,114,111,114,40,39,101,120,112,101,99,116,101,100,32,
-,43,118,97,108,44,115,101,108,102,46,116,111,107,101,110,
-,0,0,0,12,5,0,5,101,114,114,111,114,0,0,0,
+,4,7,6,16,7,0,106,44,11,0,0,28,2,0,0,
+,1,0,2,28,2,0,0,28,3,0,0,32,2,0,3,
+,3,0,0,0,0,0,0,0,0,0,0,12,6,0,5,
+,104,101,99,107,0,0,0,13,5,6,0,12,8,0,5,
+,111,107,101,110,0,0,0,9,6,1,8,15,7,2,0,
+,4,6,2,19,4,5,4,23,3,3,4,21,3,0,0,
+,0,0,17,12,5,0,5,101,114,114,111,114,0,0,0,
 ,4,5,0,12,5,0,9,101,120,112,101,99,116,101,100,
 ,0,0,0,1,5,5,2,12,7,0,5,116,111,107,101,
 ,0,0,0,9,6,1,7,31,3,5,2,19,3,4,3,
-,0,0,1,30,10,0,41,32,32,32,32,32,32,32,32,
-,102,32,115,101,108,102,46,112,111,115,32,60,32,108,101,
-,40,115,101,108,102,46,116,111,107,101,110,115,41,58,0,
-,4,0,3,112,111,115,0,9,3,1,4,12,6,0,3,
-,101,110,0,13,5,6,0,12,7,0,6,116,111,107,101,
-,115,0,0,9,6,1,7,31,4,6,1,19,4,5,4,
-,3,3,4,21,3,0,0,18,0,0,40,30,10,0,42,
-,32,32,32,32,32,32,32,32,32,32,32,116,32,61,32,
-,101,108,102,46,116,111,107,101,110,115,91,115,101,108,102,
-,112,111,115,93,0,0,0,12,5,0,6,116,111,107,101,
-,115,0,0,9,4,1,5,12,6,0,3,112,111,115,0,
-,5,1,6,9,4,4,5,15,3,4,0,30,7,0,43,
-,32,32,32,32,32,32,32,32,32,32,32,115,101,108,102,
-,112,111,115,32,43,61,32,49,0,0,0,12,5,0,3,
-,111,115,0,9,4,1,5,11,5,0,0,0,0,0,0,
-,0,240,63,1,4,4,5,12,5,0,3,112,111,115,0,
-,1,5,4,18,0,0,32,30,11,0,45,32,32,32,32,
-,32,32,32,32,32,32,32,116,32,61,32,84,111,107,101,
-,40,40,48,44,48,41,44,39,101,111,102,39,44,39,101,
-,102,39,41,0,0,0,0,12,6,0,5,84,111,107,101,
-,0,0,0,13,5,6,0,11,9,0,0,0,0,0,0,
-,0,0,0,11,10,0,0,0,0,0,0,0,0,0,0,
-,6,9,2,12,7,0,3,101,111,102,0,12,8,0,3,
-,111,102,0,31,4,6,3,19,4,5,4,15,3,4,0,
-,0,0,1,30,7,0,46,32,32,32,32,32,32,32,32,
-,101,108,102,46,116,111,107,101,110,32,61,32,100,111,40,
-,41,0,0,12,6,0,2,100,111,0,0,13,5,6,0,
-,6,3,0,31,4,6,1,19,4,5,4,12,5,0,5,
-,111,107,101,110,0,0,0,10,1,5,4,30,7,0,48,
-,32,32,32,32,32,32,32,115,101,108,102,46,95,116,101,
-,109,105,110,97,108,32,43,61,32,49,0,12,5,0,9,
-,116,101,114,109,105,110,97,108,0,0,0,9,4,1,5,
+,0,0,1,12,4,0,3,112,111,115,0,9,3,1,4,
+,6,0,3,108,101,110,0,13,5,6,0,12,7,0,6,
+,111,107,101,110,115,0,0,9,6,1,7,31,4,6,1,
+,4,5,4,25,3,3,4,21,3,0,0,18,0,0,21,
+,5,0,6,116,111,107,101,110,115,0,0,9,4,1,5,
+,6,0,3,112,111,115,0,9,5,1,6,9,4,4,5,
+,3,4,0,12,5,0,3,112,111,115,0,9,4,1,5,
 ,5,0,0,0,0,0,0,0,0,240,63,1,4,4,5,
-,5,0,9,95,116,101,114,109,105,110,97,108,0,0,0,
-,1,5,4,30,14,0,49,32,32,32,32,32,32,32,32,
-,102,32,99,104,101,99,107,40,115,101,108,102,46,116,111,
-,101,110,44,39,110,108,39,44,39,101,111,102,39,44,39,
-,39,44,39,100,101,100,101,110,116,39,41,58,0,0,0,
-,6,0,5,99,104,101,99,107,0,0,0,13,5,6,0,
-,11,0,5,116,111,107,101,110,0,0,0,9,6,1,11,
-,7,0,2,110,108,0,0,12,8,0,3,101,111,102,0,
-,9,0,1,59,0,0,0,12,10,0,6,100,101,100,101,
-,116,0,0,31,4,6,5,19,4,5,4,21,4,0,0,
-,0,0,19,30,8,0,50,32,32,32,32,32,32,32,32,
-,32,32,32,115,101,108,102,46,95,116,101,114,109,105,110,
-,108,32,61,32,48,0,0,11,4,0,0,0,0,0,0,
-,0,0,0,12,5,0,9,95,116,101,114,109,105,110,97,
-,0,0,0,10,1,5,4,18,0,0,1,30,5,0,51,
-,32,32,32,32,32,32,32,114,101,116,117,114,110,32,116,
-,0,0,0,20,3,0,0,0,0,0,0,12,8,0,7,
-,100,118,97,110,99,101,0,10,4,8,7,16,8,0,74,
-,7,0,0,30,6,0,53,32,32,32,32,100,101,102,32,
-,101,114,109,105,110,97,108,40,115,101,108,102,41,58,0,
-,1,0,13,99,111,114,101,47,112,97,114,115,101,46,112,
-,0,0,0,33,1,0,0,12,1,0,8,116,101,114,109,
-,110,97,108,0,0,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,30,8,0,54,32,32,32,32,32,32,32,32,
-,102,32,115,101,108,102,46,95,116,101,114,109,105,110,97,
-,32,62,32,49,58,0,0,11,2,0,0,0,0,0,0,
-,0,240,63,12,4,0,9,95,116,101,114,109,105,110,97,
-,0,0,0,9,3,1,4,25,2,2,3,21,2,0,0,
-,0,0,32,30,13,0,55,32,32,32,32,32,32,32,32,
-,32,32,32,101,114,114,111,114,40,39,105,110,118,97,108,
-,100,32,115,116,97,116,101,109,101,110,116,39,44,115,101,
-,102,46,116,111,107,101,110,41,0,0,0,12,4,0,5,
-,114,114,111,114,0,0,0,13,3,4,0,12,4,0,17,
-,110,118,97,108,105,100,32,115,116,97,116,101,109,101,110,
-,0,0,0,12,6,0,5,116,111,107,101,110,0,0,0,
-,5,1,6,31,2,4,2,19,2,3,2,18,0,0,1,
-,0,0,0,12,9,0,8,116,101,114,109,105,110,97,108,
-,0,0,0,10,4,9,8,30,5,0,57,100,101,102,32,
-,114,114,111,114,40,99,116,120,44,116,41,58,0,0,0,
-,4,0,54,44,9,0,0,30,5,0,57,100,101,102,32,
-,114,114,111,114,40,99,116,120,44,116,41,58,0,0,0,
-,1,0,13,99,111,114,101,47,112,97,114,115,101,46,112,
-,0,0,0,33,1,0,0,12,1,0,5,101,114,114,111,
-,0,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,3,0,0,9,2,0,3,30,9,0,58,32,32,32,32,
-,111,107,101,110,105,122,101,46,117,95,101,114,114,111,114,
-,99,116,120,44,80,46,115,44,116,46,112,111,115,41,0,
+,5,0,3,112,111,115,0,10,1,5,4,18,0,0,20,
+,6,0,5,84,111,107,101,110,0,0,0,13,5,6,0,
+,9,0,0,0,0,0,0,0,0,0,0,11,10,0,0,
+,0,0,0,0,0,0,0,27,6,9,2,12,7,0,3,
+,111,102,0,12,8,0,3,101,111,102,0,31,4,6,3,
+,4,5,4,15,3,4,0,18,0,0,1,12,6,0,2,
+,111,0,0,13,5,6,0,15,6,3,0,31,4,6,1,
+,4,5,4,12,5,0,5,116,111,107,101,110,0,0,0,
+,1,5,4,20,3,0,0,0,0,0,0,12,8,0,7,
+,100,118,97,110,99,101,0,10,4,8,7,16,8,0,64,
+,7,0,0,28,2,0,0,9,1,0,2,12,4,0,4,
+,105,110,100,0,0,0,0,13,3,4,0,12,6,0,5,
+,68,97,116,97,0,0,0,13,4,6,0,12,6,0,8,
+,95,105,110,105,116,95,95,0,0,0,0,9,4,4,6,
+,5,1,0,31,2,4,2,19,2,3,2,12,3,0,8,
+,95,105,110,105,116,95,95,0,0,0,0,10,1,3,2,
+,4,0,4,98,105,110,100,0,0,0,0,13,3,4,0,
+,6,0,5,80,68,97,116,97,0,0,0,13,4,6,0,
+,6,0,4,105,110,105,116,0,0,0,0,9,4,4,6,
+,5,1,0,31,2,4,2,19,2,3,2,12,3,0,4,
+,110,105,116,0,0,0,0,10,1,3,2,12,4,0,4,
+,105,110,100,0,0,0,0,13,3,4,0,12,6,0,5,
+,68,97,116,97,0,0,0,13,4,6,0,12,6,0,7,
+,100,118,97,110,99,101,0,9,4,4,6,15,5,1,0,
+,2,4,2,19,2,3,2,12,3,0,7,97,100,118,97,
+,99,101,0,10,1,3,2,0,0,0,0,12,9,0,7,
+,95,110,101,119,95,95,0,10,4,9,8,16,9,0,22,
+,5,0,0,26,1,0,0,12,4,0,5,80,68,97,116,
+,0,0,0,13,3,4,0,12,4,0,7,95,95,110,101,
+,95,95,0,9,3,3,4,15,4,1,0,31,2,4,1,
+,2,3,2,12,3,0,8,95,95,105,110,105,116,95,95,
+,0,0,0,9,2,1,3,19,4,2,0,20,1,0,0,
+,0,0,0,12,10,0,8,95,95,99,97,108,108,95,95,
+,0,0,0,10,4,10,9,16,4,0,32,44,9,0,0,
+,2,0,0,9,1,0,2,28,3,0,0,9,2,0,3,
+,4,0,5,112,114,105,110,116,0,0,0,13,3,4,0,
 ,5,0,8,116,111,107,101,110,105,122,101,0,0,0,0,
 ,4,5,0,12,5,0,7,117,95,101,114,114,111,114,0,
 ,4,4,5,15,5,1,0,12,8,0,1,80,0,0,0,
 ,6,8,0,12,8,0,1,115,0,0,0,9,6,6,8,
 ,8,0,3,112,111,115,0,9,7,2,8,31,3,5,3,
-,3,4,3,0,0,0,0,12,9,0,5,101,114,114,111,
-,0,0,0,14,9,4,0,30,3,0,60,100,101,102,32,
-,117,100,40,116,41,58,0,16,9,0,31,44,5,0,0,
-,3,0,60,100,101,102,32,110,117,100,40,116,41,58,0,
-,1,0,13,99,111,114,101,47,112,97,114,115,101,46,112,
-,0,0,0,33,1,0,0,12,1,0,3,110,117,100,0,
-,1,0,0,28,2,0,0,9,1,0,2,30,5,0,63,
-,32,32,32,114,101,116,117,114,110,32,116,46,110,117,100,
-,116,41,0,12,4,0,3,110,117,100,0,9,3,1,4,
-,4,1,0,31,2,4,1,19,2,3,2,20,2,0,0,
-,0,0,0,12,10,0,3,110,117,100,0,14,10,9,0,
-,5,0,64,100,101,102,32,108,101,100,40,116,44,108,101,
-,116,41,58,0,0,0,0,16,10,0,38,44,7,0,0,
-,5,0,64,100,101,102,32,108,101,100,40,116,44,108,101,
-,116,41,58,0,0,0,0,12,1,0,13,99,111,114,101,
-,112,97,114,115,101,46,112,121,0,0,0,33,1,0,0,
-,1,0,3,108,101,100,0,34,1,0,0,28,2,0,0,
-,1,0,2,28,3,0,0,9,2,0,3,30,7,0,67,
-,32,32,32,114,101,116,117,114,110,32,116,46,108,101,100,
-,116,44,108,101,102,116,41,0,0,0,0,12,5,0,3,
+,3,4,3,0,0,0,0,12,10,0,5,101,114,114,111,
+,0,0,0,14,10,4,0,16,10,0,12,44,5,0,0,
+,2,0,0,9,1,0,2,12,4,0,3,110,117,100,0,
+,3,1,4,15,4,1,0,31,2,4,1,19,2,3,2,
+,2,0,0,0,0,0,0,12,11,0,3,110,117,100,0,
+,11,10,0,16,11,0,15,44,7,0,0,28,2,0,0,
+,1,0,2,28,3,0,0,9,2,0,3,12,5,0,3,
 ,101,100,0,9,4,1,5,15,5,1,0,15,6,2,0,
 ,3,5,2,19,3,4,3,20,3,0,0,0,0,0,0,
-,11,0,3,108,101,100,0,14,11,10,0,30,4,0,68,
-,101,102,32,103,101,116,95,108,98,112,40,116,41,58,0,
-,11,0,30,44,4,0,0,30,4,0,68,100,101,102,32,
-,101,116,95,108,98,112,40,116,41,58,0,12,1,0,13,
-,111,114,101,47,112,97,114,115,101,46,112,121,0,0,0,
-,1,0,0,12,1,0,7,103,101,116,95,108,98,112,0,
-,1,0,0,28,2,0,0,9,1,0,2,30,5,0,71,
-,32,32,32,114,101,116,117,114,110,32,116,46,108,98,112,
-,0,0,0,12,3,0,3,108,98,112,0,9,2,1,3,
-,2,0,0,0,0,0,0,12,12,0,7,103,101,116,95,
-,98,112,0,14,12,11,0,30,5,0,72,100,101,102,32,
-,101,116,95,105,116,101,109,115,40,116,41,58,0,0,0,
-,12,0,33,44,4,0,0,30,5,0,72,100,101,102,32,
-,101,116,95,105,116,101,109,115,40,116,41,58,0,0,0,
-,1,0,13,99,111,114,101,47,112,97,114,115,101,46,112,
-,0,0,0,33,1,0,0,12,1,0,9,103,101,116,95,
-,116,101,109,115,0,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,30,5,0,75,32,32,32,32,114,101,116,117,
-,110,32,116,46,105,116,101,109,115,0,0,12,3,0,5,
-,116,101,109,115,0,0,0,9,2,1,3,20,2,0,0,
-,0,0,0,12,13,0,9,103,101,116,95,105,116,101,109,
-,0,0,0,14,13,12,0,30,6,0,77,100,101,102,32,
-,120,112,114,101,115,115,105,111,110,40,114,98,112,41,58,
-,0,0,0,16,13,0,135,44,9,0,0,30,6,0,77,
-,101,102,32,101,120,112,114,101,115,115,105,111,110,40,114,
-,112,41,58,0,0,0,0,12,1,0,13,99,111,114,101,
-,112,97,114,115,101,46,112,121,0,0,0,33,1,0,0,
-,1,0,10,101,120,112,114,101,115,115,105,111,110,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,30,4,0,78,
-,32,32,32,116,32,61,32,80,46,116,111,107,101,110,0,
-,4,0,1,80,0,0,0,13,3,4,0,12,4,0,5,
-,111,107,101,110,0,0,0,9,3,3,4,15,2,3,0,
-,4,0,79,32,32,32,32,97,100,118,97,110,99,101,40,
-,0,0,0,12,5,0,7,97,100,118,97,110,99,101,0,
-,4,5,0,31,3,0,0,19,3,4,3,30,5,0,80,
-,32,32,32,108,101,102,116,32,61,32,110,117,100,40,116,
-,0,0,0,12,6,0,3,110,117,100,0,13,5,6,0,
+,12,0,3,108,101,100,0,14,12,11,0,16,12,0,9,
+,4,0,0,28,2,0,0,9,1,0,2,12,3,0,3,
+,98,112,0,9,2,1,3,20,2,0,0,0,0,0,0,
+,13,0,7,103,101,116,95,108,98,112,0,14,13,12,0,
+,13,0,10,44,4,0,0,28,2,0,0,9,1,0,2,
+,3,0,5,105,116,101,109,115,0,0,0,9,2,1,3,
+,2,0,0,0,0,0,0,12,14,0,9,103,101,116,95,
+,116,101,109,115,0,0,0,14,14,13,0,16,14,0,66,
+,9,0,0,28,2,0,0,9,1,0,2,12,4,0,1,
+,0,0,0,13,3,4,0,12,4,0,5,116,111,107,101,
+,0,0,0,9,3,3,4,15,2,3,0,12,5,0,7,
+,100,118,97,110,99,101,0,13,4,5,0,31,3,0,0,
+,3,4,3,12,6,0,3,110,117,100,0,13,5,6,0,
 ,6,2,0,31,4,6,1,19,4,5,4,15,3,4,0,
-,9,0,81,32,32,32,32,119,104,105,108,101,32,114,98,
-,32,60,32,103,101,116,95,108,98,112,40,80,46,116,111,
-,101,110,41,58,0,0,0,12,7,0,7,103,101,116,95,
-,98,112,0,13,6,7,0,12,8,0,1,80,0,0,0,
-,7,8,0,12,8,0,5,116,111,107,101,110,0,0,0,
-,7,7,8,31,5,7,1,19,5,6,5,25,4,1,5,
-,4,0,0,18,0,0,44,30,5,0,82,32,32,32,32,
-,32,32,32,116,32,61,32,80,46,116,111,107,101,110,0,
+,7,0,7,103,101,116,95,108,98,112,0,13,6,7,0,
+,8,0,1,80,0,0,0,13,7,8,0,12,8,0,5,
+,111,107,101,110,0,0,0,9,7,7,8,31,5,7,1,
+,5,6,5,25,4,1,5,21,4,0,0,18,0,0,24,
 ,5,0,1,80,0,0,0,13,4,5,0,12,5,0,5,
 ,111,107,101,110,0,0,0,9,4,4,5,15,2,4,0,
-,5,0,83,32,32,32,32,32,32,32,32,97,100,118,97,
-,99,101,40,41,0,0,0,12,6,0,7,97,100,118,97,
-,99,101,0,13,5,6,0,31,4,0,0,19,4,5,4,
-,7,0,84,32,32,32,32,32,32,32,32,108,101,102,116,
-,61,32,108,101,100,40,116,44,108,101,102,116,41,0,0,
-,6,0,3,108,101,100,0,13,5,6,0,15,6,2,0,
-,7,3,0,31,4,6,2,19,4,5,4,15,3,4,0,
-,0,255,198,30,4,0,85,32,32,32,32,114,101,116,117,
-,110,32,108,101,102,116,0,20,3,0,0,0,0,0,0,
-,14,0,10,101,120,112,114,101,115,115,105,111,110,0,0,
-,14,13,0,30,6,0,87,100,101,102,32,105,110,102,105,
-,95,108,101,100,40,116,44,108,101,102,116,41,58,0,0,
-,14,0,58,44,9,0,0,30,6,0,87,100,101,102,32,
-,110,102,105,120,95,108,101,100,40,116,44,108,101,102,116,
-,58,0,0,12,1,0,13,99,111,114,101,47,112,97,114,
-,101,46,112,121,0,0,0,33,1,0,0,12,1,0,9,
-,110,102,105,120,95,108,101,100,0,0,0,34,1,0,0,
+,6,0,7,97,100,118,97,110,99,101,0,13,5,6,0,
+,4,0,0,19,4,5,4,12,6,0,3,108,101,100,0,
+,5,6,0,15,6,2,0,15,7,3,0,31,4,6,2,
+,4,5,4,15,3,4,0,18,0,255,218,20,3,0,0,
+,0,0,0,12,15,0,10,101,120,112,114,101,115,115,105,
+,110,0,0,14,15,14,0,16,15,0,24,44,9,0,0,
 ,2,0,0,9,1,0,2,28,3,0,0,9,2,0,3,
-,10,0,88,32,32,32,32,116,46,105,116,101,109,115,32,
-,32,91,108,101,102,116,44,101,120,112,114,101,115,115,105,
-,110,40,116,46,98,112,41,93,0,0,0,15,4,2,0,
-,7,0,10,101,120,112,114,101,115,115,105,111,110,0,0,
-,6,7,0,12,8,0,2,98,112,0,0,9,7,1,8,
-,5,7,1,19,5,6,5,27,3,4,2,12,4,0,5,
-,116,101,109,115,0,0,0,10,1,4,3,30,4,0,89,
-,32,32,32,114,101,116,117,114,110,32,116,0,0,0,0,
-,1,0,0,0,0,0,0,12,15,0,9,105,110,102,105,
-,95,108,101,100,0,0,0,14,15,14,0,30,6,0,90,
-,101,102,32,105,110,102,105,120,95,105,115,40,116,44,108,
-,102,116,41,58,0,0,0,16,15,0,113,44,9,0,0,
-,6,0,90,100,101,102,32,105,110,102,105,120,95,105,115,
-,116,44,108,101,102,116,41,58,0,0,0,12,1,0,13,
-,111,114,101,47,112,97,114,115,101,46,112,121,0,0,0,
-,1,0,0,12,1,0,8,105,110,102,105,120,95,105,115,
-,0,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,3,0,0,9,2,0,3,30,8,0,91,32,32,32,32,
-,102,32,99,104,101,99,107,40,80,46,116,111,107,101,110,
-,39,110,111,116,39,41,58,0,0,0,0,12,5,0,5,
-,104,101,99,107,0,0,0,13,4,5,0,12,7,0,1,
-,0,0,0,13,5,7,0,12,7,0,5,116,111,107,101,
-,0,0,0,9,5,5,7,12,6,0,3,110,111,116,0,
-,3,5,2,19,3,4,3,21,3,0,0,18,0,0,30,
-,6,0,92,32,32,32,32,32,32,32,32,116,46,118,97,
-,32,61,32,39,105,115,110,111,116,39,0,12,3,0,5,
-,115,110,111,116,0,0,0,12,4,0,3,118,97,108,0,
-,1,4,3,30,6,0,93,32,32,32,32,32,32,32,32,
-,100,118,97,110,99,101,40,39,110,111,116,39,41,0,0,
-,5,0,7,97,100,118,97,110,99,101,0,13,4,5,0,
-,5,0,3,110,111,116,0,31,3,5,1,19,3,4,3,
-,0,0,1,30,10,0,94,32,32,32,32,116,46,105,116,
-,109,115,32,61,32,91,108,101,102,116,44,101,120,112,114,
-,115,115,105,111,110,40,116,46,98,112,41,93,0,0,0,
 ,4,2,0,12,7,0,10,101,120,112,114,101,115,115,105,
 ,110,0,0,13,6,7,0,12,8,0,2,98,112,0,0,
 ,7,1,8,31,5,7,1,19,5,6,5,27,3,4,2,
 ,4,0,5,105,116,101,109,115,0,0,0,10,1,4,3,
-,4,0,95,32,32,32,32,114,101,116,117,114,110,32,116,
-,0,0,0,20,1,0,0,0,0,0,0,12,16,0,8,
-,110,102,105,120,95,105,115,0,0,0,0,14,16,15,0,
-,6,0,96,100,101,102,32,105,110,102,105,120,95,110,111,
-,40,116,44,108,101,102,116,41,58,0,0,16,16,0,84,
-,9,0,0,30,6,0,96,100,101,102,32,105,110,102,105,
-,95,110,111,116,40,116,44,108,101,102,116,41,58,0,0,
-,1,0,13,99,111,114,101,47,112,97,114,115,101,46,112,
-,0,0,0,33,1,0,0,12,1,0,9,105,110,102,105,
-,95,110,111,116,0,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,28,3,0,0,9,2,0,3,30,5,0,97,
-,32,32,32,97,100,118,97,110,99,101,40,39,105,110,39,
-,0,0,0,12,5,0,7,97,100,118,97,110,99,101,0,
-,4,5,0,12,5,0,2,105,110,0,0,31,3,5,1,
-,3,4,3,30,5,0,98,32,32,32,32,116,46,118,97,
-,32,61,32,39,110,111,116,105,110,39,0,12,3,0,5,
-,111,116,105,110,0,0,0,12,4,0,3,118,97,108,0,
-,1,4,3,30,10,0,99,32,32,32,32,116,46,105,116,
-,109,115,32,61,32,91,108,101,102,116,44,101,120,112,114,
-,115,115,105,111,110,40,116,46,98,112,41,93,0,0,0,
+,1,0,0,0,0,0,0,12,16,0,9,105,110,102,105,
+,95,108,101,100,0,0,0,14,16,15,0,16,16,0,56,
+,9,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
+,2,0,3,12,5,0,5,99,104,101,99,107,0,0,0,
+,4,5,0,12,7,0,1,80,0,0,0,13,5,7,0,
+,7,0,5,116,111,107,101,110,0,0,0,9,5,5,7,
+,6,0,3,110,111,116,0,31,3,5,2,19,3,4,3,
+,3,0,0,18,0,0,16,12,3,0,5,105,115,110,111,
+,0,0,0,12,4,0,3,118,97,108,0,10,1,4,3,
+,5,0,7,97,100,118,97,110,99,101,0,13,4,5,0,
+,5,0,3,110,111,116,0,31,3,5,1,19,3,4,3,
+,0,0,1,15,4,2,0,12,7,0,10,101,120,112,114,
+,115,115,105,111,110,0,0,13,6,7,0,12,8,0,2,
+,112,0,0,9,7,1,8,31,5,7,1,19,5,6,5,
+,3,4,2,12,4,0,5,105,116,101,109,115,0,0,0,
+,1,4,3,20,1,0,0,0,0,0,0,12,17,0,8,
+,110,102,105,120,95,105,115,0,0,0,0,14,17,16,0,
+,17,0,38,44,9,0,0,28,2,0,0,9,1,0,2,
+,3,0,0,9,2,0,3,12,5,0,7,97,100,118,97,
+,99,101,0,13,4,5,0,12,5,0,2,105,110,0,0,
+,3,5,1,19,3,4,3,12,3,0,5,110,111,116,105,
+,0,0,0,12,4,0,3,118,97,108,0,10,1,4,3,
 ,4,2,0,12,7,0,10,101,120,112,114,101,115,115,105,
 ,110,0,0,13,6,7,0,12,8,0,2,98,112,0,0,
 ,7,1,8,31,5,7,1,19,5,6,5,27,3,4,2,
 ,4,0,5,105,116,101,109,115,0,0,0,10,1,4,3,
-,4,0,100,32,32,32,32,114,101,116,117,114,110,32,116,
-,0,0,0,20,1,0,0,0,0,0,0,12,17,0,9,
-,110,102,105,120,95,110,111,116,0,0,0,14,17,16,0,
-,7,0,101,100,101,102,32,105,110,102,105,120,95,116,117,
-,108,101,40,116,44,108,101,102,116,41,58,0,0,0,0,
-,17,0,122,44,8,0,0,30,7,0,101,100,101,102,32,
-,110,102,105,120,95,116,117,112,108,101,40,116,44,108,101,
-,116,41,58,0,0,0,0,12,1,0,13,99,111,114,101,
-,112,97,114,115,101,46,112,121,0,0,0,33,1,0,0,
-,1,0,11,105,110,102,105,120,95,116,117,112,108,101,0,
-,1,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
-,2,0,3,30,7,0,102,32,32,32,32,114,32,61,32,
-,120,112,114,101,115,115,105,111,110,40,116,46,98,112,41,
-,0,0,0,12,6,0,10,101,120,112,114,101,115,115,105,
+,1,0,0,0,0,0,0,12,18,0,9,105,110,102,105,
+,95,110,111,116,0,0,0,14,18,17,0,16,18,0,54,
+,8,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
+,2,0,3,12,6,0,10,101,120,112,114,101,115,115,105,
 ,110,0,0,13,5,6,0,12,7,0,2,98,112,0,0,
 ,6,1,7,31,4,6,1,19,4,5,4,15,3,4,0,
-,6,0,103,32,32,32,32,105,102,32,108,101,102,116,46,
-,97,108,32,61,61,32,39,44,39,58,0,12,5,0,3,
-,97,108,0,9,4,2,5,12,5,0,1,44,0,0,0,
-,4,4,5,21,4,0,0,18,0,0,29,30,8,0,104,
-,32,32,32,32,32,32,32,108,101,102,116,46,105,116,101,
-,115,46,97,112,112,101,110,100,40,114,41,0,0,0,0,
+,5,0,3,118,97,108,0,9,4,2,5,12,5,0,1,
+,0,0,0,23,4,4,5,21,4,0,0,18,0,0,14,
 ,6,0,5,105,116,101,109,115,0,0,0,9,5,2,6,
 ,6,0,6,97,112,112,101,110,100,0,0,9,5,5,6,
-,6,3,0,31,4,6,1,19,4,5,4,30,5,0,105,
-,32,32,32,32,32,32,32,114,101,116,117,114,110,32,108,
-,102,116,0,20,2,0,0,18,0,0,1,30,6,0,106,
-,32,32,32,116,46,105,116,101,109,115,32,61,32,91,108,
-,102,116,44,114,93,0,0,15,5,2,0,15,6,3,0,
-,4,5,2,12,5,0,5,105,116,101,109,115,0,0,0,
-,1,5,4,30,6,0,107,32,32,32,32,116,46,116,121,
-,101,32,61,32,39,116,117,112,108,101,39,0,0,0,0,
+,6,3,0,31,4,6,1,19,4,5,4,20,2,0,0,
+,0,0,1,15,5,2,0,15,6,3,0,27,4,5,2,
+,5,0,5,105,116,101,109,115,0,0,0,10,1,5,4,
 ,4,0,5,116,117,112,108,101,0,0,0,12,5,0,4,
-,121,112,101,0,0,0,0,10,1,5,4,30,4,0,108,
-,32,32,32,114,101,116,117,114,110,32,116,0,0,0,0,
-,1,0,0,0,0,0,0,12,18,0,11,105,110,102,105,
-,95,116,117,112,108,101,0,14,18,17,0,30,3,0,109,
-,101,102,32,108,115,116,40,116,41,58,0,16,18,0,89,
-,8,0,0,30,3,0,109,100,101,102,32,108,115,116,40,
-,41,58,0,12,1,0,13,99,111,114,101,47,112,97,114,
-,101,46,112,121,0,0,0,33,1,0,0,12,1,0,3,
-,115,116,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,7,0,110,32,32,32,32,105,102,32,116,32,61,61,32,
-,111,110,101,58,32,114,101,116,117,114,110,32,91,93,0,
-,3,0,0,23,2,1,3,21,2,0,0,18,0,0,4,
-,2,0,0,20,2,0,0,18,0,0,1,30,11,0,111,
-,32,32,32,105,102,32,99,104,101,99,107,40,116,44,39,
-,39,44,39,116,117,112,108,101,39,44,39,115,116,97,116,
-,109,101,110,116,115,39,41,58,0,0,0,12,4,0,5,
-,104,101,99,107,0,0,0,13,3,4,0,15,4,1,0,
-,5,0,1,44,0,0,0,12,6,0,5,116,117,112,108,
-,0,0,0,12,7,0,10,115,116,97,116,101,109,101,110,
-,115,0,0,31,2,4,4,19,2,3,2,21,2,0,0,
-,0,0,19,30,7,0,112,32,32,32,32,32,32,32,32,
-,101,116,117,114,110,32,103,101,116,95,105,116,101,109,115,
-,116,41,0,12,4,0,9,103,101,116,95,105,116,101,109,
-,0,0,0,13,3,4,0,15,4,1,0,31,2,4,1,
-,2,3,2,20,2,0,0,18,0,0,1,30,4,0,113,
-,32,32,32,114,101,116,117,114,110,32,91,116,93,0,0,
-,3,1,0,27,2,3,1,20,2,0,0,0,0,0,0,
-,19,0,3,108,115,116,0,14,19,18,0,30,5,0,114,
-,101,102,32,105,108,115,116,40,116,121,112,44,116,41,58,
-,0,0,0,16,19,0,52,44,11,0,0,30,5,0,114,
-,101,102,32,105,108,115,116,40,116,121,112,44,116,41,58,
-,0,0,0,12,1,0,13,99,111,114,101,47,112,97,114,
-,101,46,112,121,0,0,0,33,1,0,0,12,1,0,4,
-,108,115,116,0,0,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,28,3,0,0,9,2,0,3,30,10,0,115,
-,32,32,32,114,101,116,117,114,110,32,84,111,107,101,110,
-,116,46,112,111,115,44,116,121,112,44,116,121,112,44,108,
-,116,40,116,41,41,0,0,12,5,0,5,84,111,107,101,
+,121,112,101,0,0,0,0,10,1,5,4,20,1,0,0,
+,0,0,0,12,19,0,11,105,110,102,105,120,95,116,117,
+,108,101,0,14,19,18,0,16,19,0,43,44,8,0,0,
+,2,0,0,9,1,0,2,28,3,0,0,23,2,1,3,
+,2,0,0,18,0,0,4,27,2,0,0,20,2,0,0,
+,0,0,1,12,4,0,5,99,104,101,99,107,0,0,0,
+,3,4,0,15,4,1,0,12,5,0,1,44,0,0,0,
+,6,0,5,116,117,112,108,101,0,0,0,12,7,0,10,
+,116,97,116,101,109,101,110,116,115,0,0,31,2,4,4,
+,2,3,2,21,2,0,0,18,0,0,11,12,4,0,9,
+,101,116,95,105,116,101,109,115,0,0,0,13,3,4,0,
+,4,1,0,31,2,4,1,19,2,3,2,20,2,0,0,
+,0,0,1,15,3,1,0,27,2,3,1,20,2,0,0,
+,0,0,0,12,20,0,3,108,115,116,0,14,20,19,0,
+,20,0,25,44,11,0,0,28,2,0,0,9,1,0,2,
+,3,0,0,9,2,0,3,12,5,0,5,84,111,107,101,
 ,0,0,0,13,4,5,0,12,9,0,3,112,111,115,0,
 ,5,2,9,15,6,1,0,15,7,1,0,12,10,0,3,
 ,115,116,0,13,9,10,0,15,10,2,0,31,8,10,1,
 ,8,9,8,31,3,5,4,19,3,4,3,20,3,0,0,
-,0,0,0,12,20,0,4,105,108,115,116,0,0,0,0,
-,20,19,0,30,6,0,117,100,101,102,32,99,97,108,108,
-,108,101,100,40,116,44,108,101,102,116,41,58,0,0,0,
-,20,0,199,44,11,0,0,30,6,0,117,100,101,102,32,
-,97,108,108,95,108,101,100,40,116,44,108,101,102,116,41,
-,0,0,0,12,1,0,13,99,111,114,101,47,112,97,114,
-,101,46,112,121,0,0,0,33,1,0,0,12,1,0,8,
-,97,108,108,95,108,101,100,0,0,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,28,3,0,0,9,2,0,3,
-,10,0,118,32,32,32,32,114,32,61,32,84,111,107,101,
-,40,116,46,112,111,115,44,39,99,97,108,108,39,44,39,
-,39,44,91,108,101,102,116,93,41,0,0,12,6,0,5,
+,0,0,0,12,21,0,4,105,108,115,116,0,0,0,0,
+,21,20,0,16,21,0,116,44,11,0,0,28,2,0,0,
+,1,0,2,28,3,0,0,9,2,0,3,12,6,0,5,
 ,111,107,101,110,0,0,0,13,5,6,0,12,10,0,3,
 ,111,115,0,9,6,1,10,12,7,0,4,99,97,108,108,
 ,0,0,0,12,8,0,1,36,0,0,0,15,10,2,0,
 ,9,10,1,31,4,6,4,19,4,5,4,15,3,4,0,
-,9,0,119,32,32,32,32,119,104,105,108,101,32,110,111,
-,32,99,104,101,99,107,40,80,46,116,111,107,101,110,44,
-,41,39,41,58,0,0,0,12,7,0,5,99,104,101,99,
-,0,0,0,13,6,7,0,12,9,0,1,80,0,0,0,
-,7,9,0,12,9,0,5,116,111,107,101,110,0,0,0,
-,7,7,9,12,8,0,1,41,0,0,0,31,5,7,2,
-,5,6,5,47,4,5,0,21,4,0,0,18,0,0,99,
-,6,0,120,32,32,32,32,32,32,32,32,116,119,101,97,
-,40,39,44,39,44,48,41,0,0,0,0,12,6,0,5,
-,119,101,97,107,0,0,0,13,5,6,0,12,6,0,1,
-,0,0,0,11,7,0,0,0,0,0,0,0,0,0,0,
-,4,6,2,19,4,5,4,30,10,0,121,32,32,32,32,
-,32,32,32,114,46,105,116,101,109,115,46,97,112,112,101,
-,100,40,101,120,112,114,101,115,115,105,111,110,40,48,41,
-,0,0,0,12,6,0,5,105,116,101,109,115,0,0,0,
-,5,3,6,12,6,0,6,97,112,112,101,110,100,0,0,
-,5,5,6,12,8,0,10,101,120,112,114,101,115,115,105,
-,110,0,0,13,7,8,0,11,8,0,0,0,0,0,0,
-,0,0,0,31,6,8,1,19,6,7,6,31,4,6,1,
-,4,5,4,30,11,0,122,32,32,32,32,32,32,32,32,
-,102,32,80,46,116,111,107,101,110,46,118,97,108,32,61,
-,32,39,44,39,58,32,97,100,118,97,110,99,101,40,39,
-,39,41,0,12,5,0,1,80,0,0,0,13,4,5,0,
-,5,0,5,116,111,107,101,110,0,0,0,9,4,4,5,
-,5,0,3,118,97,108,0,9,4,4,5,12,5,0,1,
-,0,0,0,23,4,4,5,21,4,0,0,18,0,0,10,
-,6,0,7,97,100,118,97,110,99,101,0,13,5,6,0,
-,6,0,1,44,0,0,0,31,4,6,1,19,4,5,4,
-,0,0,1,30,5,0,123,32,32,32,32,32,32,32,32,
-,101,115,116,111,114,101,40,41,0,0,0,12,6,0,7,
-,101,115,116,111,114,101,0,13,5,6,0,31,4,0,0,
-,4,5,4,18,0,255,141,30,5,0,124,32,32,32,32,
-,100,118,97,110,99,101,40,34,41,34,41,0,0,0,0,
-,6,0,7,97,100,118,97,110,99,101,0,13,5,6,0,
-,6,0,1,41,0,0,0,31,4,6,1,19,4,5,4,
-,4,0,125,32,32,32,32,114,101,116,117,114,110,32,114,
-,0,0,0,20,3,0,0,0,0,0,0,12,21,0,8,
-,97,108,108,95,108,101,100,0,0,0,0,14,21,20,0,
-,6,0,126,100,101,102,32,103,101,116,95,108,101,100,40,
-,44,108,101,102,116,41,58,0,0,0,0,16,21,1,149,
-,17,0,0,30,6,0,126,100,101,102,32,103,101,116,95,
-,101,100,40,116,44,108,101,102,116,41,58,0,0,0,0,
-,1,0,13,99,111,114,101,47,112,97,114,115,101,46,112,
-,0,0,0,33,1,0,0,12,1,0,7,103,101,116,95,
-,101,100,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,3,0,0,9,2,0,3,30,10,0,127,32,32,32,32,
-,32,61,32,84,111,107,101,110,40,116,46,112,111,115,44,
-,103,101,116,39,44,39,46,39,44,91,108,101,102,116,93,
-,0,0,0,12,6,0,5,84,111,107,101,110,0,0,0,
-,5,6,0,12,10,0,3,112,111,115,0,9,6,1,10,
-,7,0,3,103,101,116,0,12,8,0,1,46,0,0,0,
-,10,2,0,27,9,10,1,31,4,6,4,19,4,5,4,
-,3,4,0,30,5,0,128,32,32,32,32,105,116,101,109,
-,32,61,32,32,91,108,101,102,116,93,0,15,6,2,0,
-,5,6,1,15,4,5,0,30,5,0,129,32,32,32,32,
-,111,114,101,32,61,32,70,97,108,115,101,0,0,0,0,
-,6,0,0,0,0,0,0,0,0,0,0,15,5,6,0,
-,9,0,130,32,32,32,32,119,104,105,108,101,32,110,111,
-,32,99,104,101,99,107,40,80,46,116,111,107,101,110,44,
-,93,39,41,58,0,0,0,12,9,0,5,99,104,101,99,
+,4,0,0,0,0,0,0,0,0,0,0,12,7,0,5,
+,104,101,99,107,0,0,0,13,6,7,0,12,9,0,1,
+,0,0,0,13,7,9,0,12,9,0,5,116,111,107,101,
+,0,0,0,9,7,7,9,12,8,0,1,41,0,0,0,
+,5,7,2,19,5,6,5,23,4,4,5,21,4,0,0,
+,0,0,63,12,6,0,5,116,119,101,97,107,0,0,0,
+,5,6,0,12,6,0,1,44,0,0,0,11,7,0,0,
+,0,0,0,0,0,0,0,31,4,6,2,19,4,5,4,
+,6,0,5,105,116,101,109,115,0,0,0,9,5,3,6,
+,6,0,6,97,112,112,101,110,100,0,0,9,5,5,6,
+,8,0,10,101,120,112,114,101,115,115,105,111,110,0,0,
+,7,8,0,11,8,0,0,0,0,0,0,0,0,0,0,
+,6,8,1,19,6,7,6,31,4,6,1,19,4,5,4,
+,5,0,1,80,0,0,0,13,4,5,0,12,5,0,5,
+,111,107,101,110,0,0,0,9,4,4,5,12,5,0,3,
+,97,108,0,9,4,4,5,12,5,0,1,44,0,0,0,
+,4,4,5,21,4,0,0,18,0,0,10,12,6,0,7,
+,100,118,97,110,99,101,0,13,5,6,0,12,6,0,1,
+,0,0,0,31,4,6,1,19,4,5,4,18,0,0,1,
+,6,0,7,114,101,115,116,111,114,101,0,13,5,6,0,
+,4,0,0,19,4,5,4,18,0,255,174,12,6,0,7,
+,100,118,97,110,99,101,0,13,5,6,0,12,6,0,1,
+,0,0,0,31,4,6,1,19,4,5,4,20,3,0,0,
+,0,0,0,12,22,0,8,99,97,108,108,95,108,101,100,
+,0,0,0,14,22,21,0,16,22,0,229,44,17,0,0,
+,2,0,0,9,1,0,2,28,3,0,0,9,2,0,3,
+,6,0,5,84,111,107,101,110,0,0,0,13,5,6,0,
+,10,0,3,112,111,115,0,9,6,1,10,12,7,0,3,
+,101,116,0,12,8,0,1,46,0,0,0,15,10,2,0,
+,9,10,1,31,4,6,4,19,4,5,4,15,3,4,0,
+,6,2,0,27,5,6,1,15,4,5,0,11,6,0,0,
+,0,0,0,0,0,0,0,15,5,6,0,11,6,0,0,
+,0,0,0,0,0,0,0,12,9,0,5,99,104,101,99,
 ,0,0,0,13,8,9,0,12,11,0,1,80,0,0,0,
 ,9,11,0,12,11,0,5,116,111,107,101,110,0,0,0,
 ,9,9,11,12,10,0,1,93,0,0,0,31,7,9,2,
-,7,8,7,47,6,7,0,21,6,0,0,18,0,0,167,
-,6,0,131,32,32,32,32,32,32,32,32,109,111,114,101,
-,61,32,70,97,108,115,101,0,0,0,0,11,6,0,0,
-,0,0,0,0,0,0,0,15,5,6,0,30,8,0,132,
-,32,32,32,32,32,32,32,105,102,32,99,104,101,99,107,
-,80,46,116,111,107,101,110,44,39,58,39,41,58,0,0,
+,7,8,7,23,6,6,7,21,6,0,0,18,0,0,99,
+,6,0,0,0,0,0,0,0,0,0,0,15,5,6,0,
 ,8,0,5,99,104,101,99,107,0,0,0,13,7,8,0,
 ,10,0,1,80,0,0,0,13,8,10,0,12,10,0,5,
 ,111,107,101,110,0,0,0,9,8,8,10,12,9,0,1,
 ,0,0,0,31,6,8,2,19,6,7,6,21,6,0,0,
-,0,0,47,30,16,0,133,32,32,32,32,32,32,32,32,
-,32,32,32,105,116,101,109,115,46,97,112,112,101,110,100,
-,84,111,107,101,110,40,80,46,116,111,107,101,110,46,112,
-,115,44,39,115,121,109,98,111,108,39,44,39,78,111,110,
-,39,41,41,0,0,0,0,12,8,0,6,97,112,112,101,
-,100,0,0,9,7,4,8,12,10,0,5,84,111,107,101,
-,0,0,0,13,9,10,0,12,13,0,1,80,0,0,0,
-,10,13,0,12,13,0,5,116,111,107,101,110,0,0,0,
-,10,10,13,12,13,0,3,112,111,115,0,9,10,10,13,
-,11,0,6,115,121,109,98,111,108,0,0,12,12,0,4,
-,111,110,101,0,0,0,0,31,8,10,3,19,8,9,8,
-,6,8,1,19,6,7,6,18,0,0,29,30,10,0,135,
-,32,32,32,32,32,32,32,32,32,32,32,105,116,101,109,
-,46,97,112,112,101,110,100,40,101,120,112,114,101,115,115,
-,111,110,40,48,41,41,0,12,8,0,6,97,112,112,101,
-,100,0,0,9,7,4,8,12,10,0,10,101,120,112,114,
-,115,115,105,111,110,0,0,13,9,10,0,11,10,0,0,
-,0,0,0,0,0,0,0,31,8,10,1,19,8,9,8,
-,6,8,1,19,6,7,6,18,0,0,1,30,8,0,136,
-,32,32,32,32,32,32,32,105,102,32,99,104,101,99,107,
-,80,46,116,111,107,101,110,44,39,58,39,41,58,0,0,
-,8,0,5,99,104,101,99,107,0,0,0,13,7,8,0,
-,10,0,1,80,0,0,0,13,8,10,0,12,10,0,5,
-,111,107,101,110,0,0,0,9,8,8,10,12,9,0,1,
-,0,0,0,31,6,8,2,19,6,7,6,21,6,0,0,
-,0,0,29,30,7,0,137,32,32,32,32,32,32,32,32,
-,32,32,32,97,100,118,97,110,99,101,40,39,58,39,41,
-,0,0,0,12,8,0,7,97,100,118,97,110,99,101,0,
-,7,8,0,12,8,0,1,58,0,0,0,31,6,8,1,
-,6,7,6,30,6,0,138,32,32,32,32,32,32,32,32,
-,32,32,32,109,111,114,101,32,61,32,84,114,117,101,0,
-,6,0,0,0,0,0,0,0,0,240,63,15,5,6,0,
-,0,0,1,18,0,255,73,30,4,0,139,32,32,32,32,
-,102,32,109,111,114,101,58,0,0,0,0,21,5,0,0,
-,0,0,46,30,15,0,140,32,32,32,32,32,32,32,32,
-,116,101,109,115,46,97,112,112,101,110,100,40,84,111,107,
-,110,40,80,46,116,111,107,101,110,46,112,111,115,44,39,
-,121,109,98,111,108,39,44,39,78,111,110,101,39,41,41,
-,0,0,0,12,8,0,6,97,112,112,101,110,100,0,0,
+,0,0,30,12,8,0,6,97,112,112,101,110,100,0,0,
 ,7,4,8,12,10,0,5,84,111,107,101,110,0,0,0,
 ,9,10,0,12,13,0,1,80,0,0,0,13,10,13,0,
 ,13,0,5,116,111,107,101,110,0,0,0,9,10,10,13,
 ,322 → 824,159
 ,13,0,3,112,111,115,0,9,10,10,13,12,11,0,6,
 ,121,109,98,111,108,0,0,12,12,0,4,78,111,110,101,
 ,0,0,0,31,8,10,3,19,8,9,8,31,6,8,1,
-,6,7,6,18,0,0,1,30,6,0,141,32,32,32,32,
-,102,32,108,101,110,40,105,116,101,109,115,41,32,62,32,
-,58,0,0,11,6,0,0,0,0,0,0,0,0,0,64,
+,6,7,6,18,0,0,18,12,8,0,6,97,112,112,101,
+,100,0,0,9,7,4,8,12,10,0,10,101,120,112,114,
+,115,115,105,111,110,0,0,13,9,10,0,11,10,0,0,
+,0,0,0,0,0,0,0,31,8,10,1,19,8,9,8,
+,6,8,1,19,6,7,6,18,0,0,1,12,8,0,5,
+,104,101,99,107,0,0,0,13,7,8,0,12,10,0,1,
+,0,0,0,13,8,10,0,12,10,0,5,116,111,107,101,
+,0,0,0,9,8,8,10,12,9,0,1,58,0,0,0,
+,6,8,2,19,6,7,6,21,6,0,0,18,0,0,14,
+,8,0,7,97,100,118,97,110,99,101,0,13,7,8,0,
+,8,0,1,58,0,0,0,31,6,8,1,19,6,7,6,
+,6,0,0,0,0,0,0,0,0,240,63,15,5,6,0,
+,0,0,1,18,0,255,138,21,5,0,0,18,0,0,30,
+,8,0,6,97,112,112,101,110,100,0,0,9,7,4,8,
+,10,0,5,84,111,107,101,110,0,0,0,13,9,10,0,
+,13,0,1,80,0,0,0,13,10,13,0,12,13,0,5,
+,111,107,101,110,0,0,0,9,10,10,13,12,13,0,3,
+,111,115,0,9,10,10,13,12,11,0,6,115,121,109,98,
+,108,0,0,12,12,0,4,78,111,110,101,0,0,0,0,
+,8,10,3,19,8,9,8,31,6,8,1,19,6,7,6,
+,0,0,1,11,6,0,0,0,0,0,0,0,0,0,64,
 ,9,0,3,108,101,110,0,13,8,9,0,15,9,4,0,
 ,7,9,1,19,7,8,7,25,6,6,7,21,6,0,0,
-,0,0,41,30,15,0,142,32,32,32,32,32,32,32,32,
-,116,101,109,115,32,61,32,91,108,101,102,116,44,84,111,
-,101,110,40,116,46,112,111,115,44,39,115,108,105,99,101,
-,44,39,58,39,44,105,116,101,109,115,91,49,58,93,41,
-,0,0,0,15,7,2,0,12,10,0,5,84,111,107,101,
+,0,0,25,15,7,2,0,12,10,0,5,84,111,107,101,
 ,0,0,0,13,9,10,0,12,14,0,3,112,111,115,0,
 ,10,1,14,12,11,0,5,115,108,105,99,101,0,0,0,
 ,12,0,1,58,0,0,0,11,15,0,0,0,0,0,0,
 ,0,240,63,28,16,0,0,27,14,15,2,9,13,4,14,
 ,8,10,4,19,8,9,8,27,6,7,2,15,4,6,0,
-,0,0,1,30,5,0,143,32,32,32,32,114,46,105,116,
-,109,115,32,61,32,105,116,101,109,115,0,12,6,0,5,
-,116,101,109,115,0,0,0,10,3,6,4,30,5,0,144,
-,32,32,32,97,100,118,97,110,99,101,40,34,93,34,41,
-,0,0,0,12,8,0,7,97,100,118,97,110,99,101,0,
+,0,0,1,12,6,0,5,105,116,101,109,115,0,0,0,
+,3,6,4,12,8,0,7,97,100,118,97,110,99,101,0,
 ,7,8,0,12,8,0,1,93,0,0,0,31,6,8,1,
-,6,7,6,30,4,0,145,32,32,32,32,114,101,116,117,
-,110,32,114,0,0,0,0,20,3,0,0,0,0,0,0,
-,22,0,7,103,101,116,95,108,101,100,0,14,22,21,0,
-,6,0,146,100,101,102,32,100,111,116,95,108,101,100,40,
-,44,108,101,102,116,41,58,0,0,0,0,16,22,0,77,
-,8,0,0,30,6,0,146,100,101,102,32,100,111,116,95,
-,101,100,40,116,44,108,101,102,116,41,58,0,0,0,0,
-,1,0,13,99,111,114,101,47,112,97,114,115,101,46,112,
-,0,0,0,33,1,0,0,12,1,0,7,100,111,116,95,
-,101,100,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,3,0,0,9,2,0,3,30,7,0,147,32,32,32,32,
-,32,61,32,101,120,112,114,101,115,115,105,111,110,40,116,
-,98,112,41,0,0,0,0,12,6,0,10,101,120,112,114,
-,115,115,105,111,110,0,0,13,5,6,0,12,7,0,2,
-,112,0,0,9,6,1,7,31,4,6,1,19,4,5,4,
-,3,4,0,30,6,0,148,32,32,32,32,114,46,116,121,
-,101,32,61,32,39,115,116,114,105,110,103,39,0,0,0,
+,6,7,6,20,3,0,0,0,0,0,0,12,23,0,7,
+,101,116,95,108,101,100,0,14,23,22,0,16,23,0,33,
+,8,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
+,2,0,3,12,6,0,10,101,120,112,114,101,115,115,105,
+,110,0,0,13,5,6,0,12,7,0,2,98,112,0,0,
+,6,1,7,31,4,6,1,19,4,5,4,15,3,4,0,
 ,4,0,6,115,116,114,105,110,103,0,0,12,5,0,4,
-,121,112,101,0,0,0,0,10,3,5,4,30,6,0,149,
-,32,32,32,116,46,105,116,101,109,115,32,61,32,91,108,
-,102,116,44,114,93,0,0,15,5,2,0,15,6,3,0,
-,4,5,2,12,5,0,5,105,116,101,109,115,0,0,0,
-,1,5,4,30,4,0,150,32,32,32,32,114,101,116,117,
-,110,32,116,0,0,0,0,20,1,0,0,0,0,0,0,
-,23,0,7,100,111,116,95,108,101,100,0,14,23,22,0,
-,4,0,152,100,101,102,32,105,116,115,101,108,102,40,116,
-,58,0,0,16,23,0,26,44,3,0,0,30,4,0,152,
-,101,102,32,105,116,115,101,108,102,40,116,41,58,0,0,
-,1,0,13,99,111,114,101,47,112,97,114,115,101,46,112,
-,0,0,0,33,1,0,0,12,1,0,6,105,116,115,101,
-,102,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,4,0,153,32,32,32,32,114,101,116,117,114,110,32,116,
-,0,0,0,20,1,0,0,0,0,0,0,12,24,0,6,
-,116,115,101,108,102,0,0,14,24,23,0,30,5,0,154,
-,101,102,32,112,97,114,101,110,95,110,117,100,40,116,41,
-,0,0,0,16,24,0,88,44,6,0,0,30,5,0,154,
-,101,102,32,112,97,114,101,110,95,110,117,100,40,116,41,
-,0,0,0,12,1,0,13,99,111,114,101,47,112,97,114,
-,101,46,112,121,0,0,0,33,1,0,0,12,1,0,9,
-,97,114,101,110,95,110,117,100,0,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,30,5,0,155,32,32,32,32,
-,119,101,97,107,40,39,44,39,44,49,41,0,0,0,0,
-,4,0,5,116,119,101,97,107,0,0,0,13,3,4,0,
-,4,0,1,44,0,0,0,11,5,0,0,0,0,0,0,
-,0,240,63,31,2,4,2,19,2,3,2,30,6,0,156,
-,32,32,32,114,32,61,32,101,120,112,114,101,115,115,105,
-,110,40,48,41,0,0,0,12,5,0,10,101,120,112,114,
-,115,115,105,111,110,0,0,13,4,5,0,11,5,0,0,
-,0,0,0,0,0,0,0,31,3,5,1,19,3,4,3,
-,2,3,0,30,4,0,157,32,32,32,32,114,101,115,116,
-,114,101,40,41,0,0,0,12,5,0,7,114,101,115,116,
-,114,101,0,13,4,5,0,31,3,0,0,19,3,4,3,
-,5,0,158,32,32,32,32,97,100,118,97,110,99,101,40,
-,41,39,41,0,0,0,0,12,5,0,7,97,100,118,97,
+,121,112,101,0,0,0,0,10,3,5,4,15,5,2,0,
+,6,3,0,27,4,5,2,12,5,0,5,105,116,101,109,
+,0,0,0,10,1,5,4,20,1,0,0,0,0,0,0,
+,24,0,7,100,111,116,95,108,101,100,0,14,24,23,0,
+,24,0,6,44,3,0,0,28,2,0,0,9,1,0,2,
+,1,0,0,0,0,0,0,12,25,0,6,105,116,115,101,
+,102,0,0,14,25,24,0,16,25,0,42,44,6,0,0,
+,2,0,0,9,1,0,2,12,4,0,5,116,119,101,97,
+,0,0,0,13,3,4,0,12,4,0,1,44,0,0,0,
+,5,0,0,0,0,0,0,0,0,240,63,31,2,4,2,
+,2,3,2,12,5,0,10,101,120,112,114,101,115,115,105,
+,110,0,0,13,4,5,0,11,5,0,0,0,0,0,0,
+,0,0,0,31,3,5,1,19,3,4,3,15,2,3,0,
+,5,0,7,114,101,115,116,111,114,101,0,13,4,5,0,
+,3,0,0,19,3,4,3,12,5,0,7,97,100,118,97,
 ,99,101,0,13,4,5,0,12,5,0,1,41,0,0,0,
-,3,5,1,19,3,4,3,30,4,0,159,32,32,32,32,
-,101,116,117,114,110,32,114,0,0,0,0,20,2,0,0,
-,0,0,0,12,25,0,9,112,97,114,101,110,95,110,117,
-,0,0,0,14,25,24,0,30,5,0,160,100,101,102,32,
-,105,115,116,95,110,117,100,40,116,41,58,0,0,0,0,
-,25,1,132,44,10,0,0,30,5,0,160,100,101,102,32,
-,105,115,116,95,110,117,100,40,116,41,58,0,0,0,0,
-,1,0,13,99,111,114,101,47,112,97,114,115,101,46,112,
-,0,0,0,33,1,0,0,12,1,0,8,108,105,115,116,
-,110,117,100,0,0,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,30,5,0,161,32,32,32,32,116,46,116,121,
-,101,32,61,32,39,108,105,115,116,39,0,12,2,0,4,
-,105,115,116,0,0,0,0,12,3,0,4,116,121,112,101,
-,0,0,0,10,1,3,2,30,5,0,162,32,32,32,32,
-,46,118,97,108,32,61,32,39,91,93,39,0,0,0,0,
+,3,5,1,19,3,4,3,20,2,0,0,0,0,0,0,
+,26,0,9,112,97,114,101,110,95,110,117,100,0,0,0,
+,26,25,0,16,26,0,224,44,10,0,0,28,2,0,0,
+,1,0,2,12,2,0,4,108,105,115,116,0,0,0,0,
+,3,0,4,116,121,112,101,0,0,0,0,10,1,3,2,
 ,2,0,2,91,93,0,0,12,3,0,3,118,97,108,0,
-,1,3,2,30,5,0,163,32,32,32,32,116,46,105,116,
-,109,115,32,61,32,91,93,0,0,0,0,27,2,0,0,
-,3,0,5,105,116,101,109,115,0,0,0,10,1,3,2,
-,5,0,164,32,32,32,32,110,101,120,116,32,61,32,80,
-,116,111,107,101,110,0,0,12,4,0,1,80,0,0,0,
+,1,3,2,27,2,0,0,12,3,0,5,105,116,101,109,
+,0,0,0,10,1,3,2,12,4,0,1,80,0,0,0,
 ,3,4,0,12,4,0,5,116,111,107,101,110,0,0,0,
-,3,3,4,15,2,3,0,30,5,0,165,32,32,32,32,
-,119,101,97,107,40,39,44,39,44,48,41,0,0,0,0,
-,5,0,5,116,119,101,97,107,0,0,0,13,4,5,0,
-,5,0,1,44,0,0,0,11,6,0,0,0,0,0,0,
-,0,0,0,31,3,5,2,19,3,4,3,30,10,0,166,
-,32,32,32,119,104,105,108,101,32,110,111,116,32,99,104,
-,99,107,40,80,46,116,111,107,101,110,44,39,102,111,114,
-,44,39,93,39,41,58,0,12,6,0,5,99,104,101,99,
-,0,0,0,13,5,6,0,12,9,0,1,80,0,0,0,
-,6,9,0,12,9,0,5,116,111,107,101,110,0,0,0,
-,6,6,9,12,7,0,3,102,111,114,0,12,8,0,1,
-,0,0,0,31,4,6,3,19,4,5,4,47,3,4,0,
-,3,0,0,18,0,0,76,30,7,0,167,32,32,32,32,
-,32,32,32,114,32,61,32,101,120,112,114,101,115,115,105,
-,110,40,48,41,0,0,0,12,6,0,10,101,120,112,114,
-,115,115,105,111,110,0,0,13,5,6,0,11,6,0,0,
-,0,0,0,0,0,0,0,31,4,6,1,19,4,5,4,
-,3,4,0,30,7,0,168,32,32,32,32,32,32,32,32,
-,46,105,116,101,109,115,46,97,112,112,101,110,100,40,114,
-,0,0,0,12,6,0,5,105,116,101,109,115,0,0,0,
-,5,1,6,12,6,0,6,97,112,112,101,110,100,0,0,
-,5,5,6,15,6,3,0,31,4,6,1,19,4,5,4,
-,11,0,169,32,32,32,32,32,32,32,32,105,102,32,80,
-,116,111,107,101,110,46,118,97,108,32,61,61,32,39,44,
-,58,32,97,100,118,97,110,99,101,40,39,44,39,41,0,
-,5,0,1,80,0,0,0,13,4,5,0,12,5,0,5,
-,111,107,101,110,0,0,0,9,4,4,5,12,5,0,3,
-,97,108,0,9,4,4,5,12,5,0,1,44,0,0,0,
-,4,4,5,21,4,0,0,18,0,0,10,12,6,0,7,
-,100,118,97,110,99,101,0,13,5,6,0,12,6,0,1,
-,0,0,0,31,4,6,1,19,4,5,4,18,0,0,1,
-,0,255,162,30,8,0,170,32,32,32,32,105,102,32,99,
-,101,99,107,40,80,46,116,111,107,101,110,44,39,102,111,
-,39,41,58,0,0,0,0,12,6,0,5,99,104,101,99,
-,0,0,0,13,5,6,0,12,8,0,1,80,0,0,0,
-,6,8,0,12,8,0,5,116,111,107,101,110,0,0,0,
-,6,6,8,12,7,0,3,102,111,114,0,31,4,6,2,
-,4,5,4,21,4,0,0,18,0,0,138,30,6,0,171,
-,32,32,32,32,32,32,32,116,46,116,121,112,101,32,61,
-,39,99,111,109,112,39,0,12,4,0,4,99,111,109,112,
-,0,0,0,12,5,0,4,116,121,112,101,0,0,0,0,
-,1,5,4,30,6,0,172,32,32,32,32,32,32,32,32,
-,100,118,97,110,99,101,40,39,102,111,114,39,41,0,0,
-,6,0,7,97,100,118,97,110,99,101,0,13,5,6,0,
-,6,0,3,102,111,114,0,31,4,6,1,19,4,5,4,
-,6,0,173,32,32,32,32,32,32,32,32,116,119,101,97,
-,40,39,105,110,39,44,48,41,0,0,0,12,6,0,5,
+,3,3,4,15,2,3,0,12,5,0,5,116,119,101,97,
+,0,0,0,13,4,5,0,12,5,0,1,44,0,0,0,
+,6,0,0,0,0,0,0,0,0,0,0,31,3,5,2,
+,3,4,3,11,3,0,0,0,0,0,0,0,0,0,0,
+,6,0,5,99,104,101,99,107,0,0,0,13,5,6,0,
+,9,0,1,80,0,0,0,13,6,9,0,12,9,0,5,
+,111,107,101,110,0,0,0,9,6,6,9,12,7,0,3,
+,111,114,0,12,8,0,1,93,0,0,0,31,4,6,3,
+,4,5,4,23,3,3,4,21,3,0,0,18,0,0,48,
+,6,0,10,101,120,112,114,101,115,115,105,111,110,0,0,
+,5,6,0,11,6,0,0,0,0,0,0,0,0,0,0,
+,4,6,1,19,4,5,4,15,3,4,0,12,6,0,5,
+,116,101,109,115,0,0,0,9,5,1,6,12,6,0,6,
+,112,112,101,110,100,0,0,9,5,5,6,15,6,3,0,
+,4,6,1,19,4,5,4,12,5,0,1,80,0,0,0,
+,4,5,0,12,5,0,5,116,111,107,101,110,0,0,0,
+,4,4,5,12,5,0,3,118,97,108,0,9,4,4,5,
+,5,0,1,44,0,0,0,23,4,4,5,21,4,0,0,
+,0,0,10,12,6,0,7,97,100,118,97,110,99,101,0,
+,5,6,0,12,6,0,1,44,0,0,0,31,4,6,1,
+,4,5,4,18,0,0,1,18,0,255,187,12,6,0,5,
+,104,101,99,107,0,0,0,13,5,6,0,12,8,0,1,
+,0,0,0,13,6,8,0,12,8,0,5,116,111,107,101,
+,0,0,0,9,6,6,8,12,7,0,3,102,111,114,0,
+,4,6,2,19,4,5,4,21,4,0,0,18,0,0,82,
+,4,0,4,99,111,109,112,0,0,0,0,12,5,0,4,
+,121,112,101,0,0,0,0,10,1,5,4,12,6,0,7,
+,100,118,97,110,99,101,0,13,5,6,0,12,6,0,3,
+,111,114,0,31,4,6,1,19,4,5,4,12,6,0,5,
 ,119,101,97,107,0,0,0,13,5,6,0,12,6,0,2,
 ,110,0,0,11,7,0,0,0,0,0,0,0,0,0,0,
-,4,6,2,19,4,5,4,30,10,0,174,32,32,32,32,
-,32,32,32,116,46,105,116,101,109,115,46,97,112,112,101,
-,100,40,101,120,112,114,101,115,115,105,111,110,40,48,41,
-,0,0,0,12,6,0,5,105,116,101,109,115,0,0,0,
-,5,1,6,12,6,0,6,97,112,112,101,110,100,0,0,
-,5,5,6,12,8,0,10,101,120,112,114,101,115,115,105,
-,110,0,0,13,7,8,0,11,8,0,0,0,0,0,0,
-,0,0,0,31,6,8,1,19,6,7,6,31,4,6,1,
-,4,5,4,30,6,0,175,32,32,32,32,32,32,32,32,
-,100,118,97,110,99,101,40,39,105,110,39,41,0,0,0,
-,6,0,7,97,100,118,97,110,99,101,0,13,5,6,0,
-,6,0,2,105,110,0,0,31,4,6,1,19,4,5,4,
-,10,0,176,32,32,32,32,32,32,32,32,116,46,105,116,
-,109,115,46,97,112,112,101,110,100,40,101,120,112,114,101,
-,115,105,111,110,40,48,41,41,0,0,0,12,6,0,5,
-,116,101,109,115,0,0,0,9,5,1,6,12,6,0,6,
-,112,112,101,110,100,0,0,9,5,5,6,12,8,0,10,
-,120,112,114,101,115,115,105,111,110,0,0,13,7,8,0,
-,8,0,0,0,0,0,0,0,0,0,0,31,6,8,1,
-,6,7,6,31,4,6,1,19,4,5,4,30,5,0,177,
-,32,32,32,32,32,32,32,114,101,115,116,111,114,101,40,
-,0,0,0,12,6,0,7,114,101,115,116,111,114,101,0,
-,5,6,0,31,4,0,0,19,4,5,4,18,0,0,1,
-,4,0,178,32,32,32,32,114,101,115,116,111,114,101,40,
-,0,0,0,12,6,0,7,114,101,115,116,111,114,101,0,
-,5,6,0,31,4,0,0,19,4,5,4,30,5,0,179,
-,32,32,32,97,100,118,97,110,99,101,40,39,93,39,41,
-,0,0,0,12,6,0,7,97,100,118,97,110,99,101,0,
-,5,6,0,12,6,0,1,93,0,0,0,31,4,6,1,
-,4,5,4,30,4,0,180,32,32,32,32,114,101,116,117,
-,110,32,116,0,0,0,0,20,1,0,0,0,0,0,0,
-,26,0,8,108,105,115,116,95,110,117,100,0,0,0,0,
-,26,25,0,30,5,0,181,100,101,102,32,100,105,99,116,
-,110,117,100,40,116,41,58,0,0,0,0,16,26,0,204,
-,8,0,0,30,5,0,181,100,101,102,32,100,105,99,116,
-,110,117,100,40,116,41,58,0,0,0,0,12,1,0,13,
-,111,114,101,47,112,97,114,115,101,46,112,121,0,0,0,
-,1,0,0,12,1,0,8,100,105,99,116,95,110,117,100,
-,0,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,5,0,182,32,32,32,32,116,46,116,121,112,101,61,39,
-,105,99,116,39,0,0,0,12,2,0,4,100,105,99,116,
+,4,6,2,19,4,5,4,12,6,0,5,105,116,101,109,
+,0,0,0,9,5,1,6,12,6,0,6,97,112,112,101,
+,100,0,0,9,5,5,6,12,8,0,10,101,120,112,114,
+,115,115,105,111,110,0,0,13,7,8,0,11,8,0,0,
+,0,0,0,0,0,0,0,31,6,8,1,19,6,7,6,
+,4,6,1,19,4,5,4,12,6,0,7,97,100,118,97,
+,99,101,0,13,5,6,0,12,6,0,2,105,110,0,0,
+,4,6,1,19,4,5,4,12,6,0,5,105,116,101,109,
+,0,0,0,9,5,1,6,12,6,0,6,97,112,112,101,
+,100,0,0,9,5,5,6,12,8,0,10,101,120,112,114,
+,115,115,105,111,110,0,0,13,7,8,0,11,8,0,0,
+,0,0,0,0,0,0,0,31,6,8,1,19,6,7,6,
+,4,6,1,19,4,5,4,12,6,0,7,114,101,115,116,
+,114,101,0,13,5,6,0,31,4,0,0,19,4,5,4,
+,0,0,1,12,6,0,7,114,101,115,116,111,114,101,0,
+,5,6,0,31,4,0,0,19,4,5,4,12,6,0,7,
+,100,118,97,110,99,101,0,13,5,6,0,12,6,0,1,
+,0,0,0,31,4,6,1,19,4,5,4,20,1,0,0,
+,0,0,0,12,27,0,8,108,105,115,116,95,110,117,100,
+,0,0,0,14,27,26,0,16,27,0,116,44,8,0,0,
+,2,0,0,9,1,0,2,12,2,0,4,100,105,99,116,
 ,0,0,0,12,3,0,4,116,121,112,101,0,0,0,0,
-,1,3,2,30,5,0,183,32,32,32,32,116,46,118,97,
-,32,61,32,39,123,125,39,0,0,0,0,12,2,0,2,
-,125,0,0,12,3,0,3,118,97,108,0,10,1,3,2,
-,5,0,184,32,32,32,32,116,46,105,116,101,109,115,32,
-,32,91,93,0,0,0,0,27,2,0,0,12,3,0,5,
-,116,101,109,115,0,0,0,10,1,3,2,30,5,0,185,
-,32,32,32,116,119,101,97,107,40,39,44,39,44,48,41,
-,0,0,0,12,4,0,5,116,119,101,97,107,0,0,0,
-,3,4,0,12,4,0,1,44,0,0,0,11,5,0,0,
-,0,0,0,0,0,0,0,31,2,4,2,19,2,3,2,
-,9,0,186,32,32,32,32,119,104,105,108,101,32,110,111,
-,32,99,104,101,99,107,40,80,46,116,111,107,101,110,44,
-,125,39,41,58,0,0,0,12,5,0,5,99,104,101,99,
-,0,0,0,13,4,5,0,12,7,0,1,80,0,0,0,
-,5,7,0,12,7,0,5,116,111,107,101,110,0,0,0,
-,5,5,7,12,6,0,1,125,0,0,0,31,3,5,2,
-,3,4,3,47,2,3,0,21,2,0,0,18,0,0,72,
-,10,0,187,32,32,32,32,32,32,32,32,116,46,105,116,
-,109,115,46,97,112,112,101,110,100,40,101,120,112,114,101,
-,115,105,111,110,40,48,41,41,0,0,0,12,4,0,5,
+,1,3,2,12,2,0,2,123,125,0,0,12,3,0,3,
+,97,108,0,10,1,3,2,27,2,0,0,12,3,0,5,
+,116,101,109,115,0,0,0,10,1,3,2,12,4,0,5,
+,119,101,97,107,0,0,0,13,3,4,0,12,4,0,1,
+,0,0,0,11,5,0,0,0,0,0,0,0,0,0,0,
+,2,4,2,19,2,3,2,11,2,0,0,0,0,0,0,
+,0,0,0,12,5,0,5,99,104,101,99,107,0,0,0,
+,4,5,0,12,7,0,1,80,0,0,0,13,5,7,0,
+,7,0,5,116,111,107,101,110,0,0,0,9,5,5,7,
+,6,0,1,125,0,0,0,31,3,5,2,19,3,4,3,
+,2,2,3,21,2,0,0,18,0,0,48,12,4,0,5,
 ,116,101,109,115,0,0,0,9,3,1,4,12,4,0,6,
 ,112,112,101,110,100,0,0,9,3,3,4,12,6,0,10,
 ,120,112,114,101,115,115,105,111,110,0,0,13,5,6,0,
 ,6,0,0,0,0,0,0,0,0,0,0,31,4,6,1,
-,4,5,4,31,2,4,1,19,2,3,2,30,12,0,188,
-,32,32,32,32,32,32,32,105,102,32,99,104,101,99,107,
-,80,46,116,111,107,101,110,44,39,58,39,44,39,44,39,
-,58,32,97,100,118,97,110,99,101,40,41,0,0,0,0,
-,4,0,5,99,104,101,99,107,0,0,0,13,3,4,0,
-,7,0,1,80,0,0,0,13,4,7,0,12,7,0,5,
-,111,107,101,110,0,0,0,9,4,4,7,12,5,0,1,
-,0,0,0,12,6,0,1,44,0,0,0,31,2,4,3,
-,2,3,2,21,2,0,0,18,0,0,8,12,4,0,7,
-,100,118,97,110,99,101,0,13,3,4,0,31,2,0,0,
-,2,3,2,18,0,0,1,18,0,255,168,30,4,0,189,
-,32,32,32,114,101,115,116,111,114,101,40,41,0,0,0,
-,4,0,7,114,101,115,116,111,114,101,0,13,3,4,0,
-,2,0,0,19,2,3,2,30,5,0,190,32,32,32,32,
-,100,118,97,110,99,101,40,39,125,39,41,0,0,0,0,
+,4,5,4,31,2,4,1,19,2,3,2,12,4,0,5,
+,104,101,99,107,0,0,0,13,3,4,0,12,7,0,1,
+,0,0,0,13,4,7,0,12,7,0,5,116,111,107,101,
+,0,0,0,9,4,4,7,12,5,0,1,58,0,0,0,
+,6,0,1,44,0,0,0,31,2,4,3,19,2,3,2,
+,2,0,0,18,0,0,8,12,4,0,7,97,100,118,97,
+,99,101,0,13,3,4,0,31,2,0,0,19,2,3,2,
+,0,0,1,18,0,255,189,12,4,0,7,114,101,115,116,
+,114,101,0,13,3,4,0,31,2,0,0,19,2,3,2,
 ,4,0,7,97,100,118,97,110,99,101,0,13,3,4,0,
 ,4,0,1,125,0,0,0,31,2,4,1,19,2,3,2,
-,4,0,191,32,32,32,32,114,101,116,117,114,110,32,116,
-,0,0,0,20,1,0,0,0,0,0,0,12,27,0,8,
-,105,99,116,95,110,117,100,0,0,0,0,14,27,26,0,
-,6,0,193,100,101,102,32,97,100,118,97,110,99,101,40,
-,61,78,111,110,101,41,58,0,0,0,0,16,27,0,41,
-,5,0,0,30,6,0,193,100,101,102,32,97,100,118,97,
-,99,101,40,116,61,78,111,110,101,41,58,0,0,0,0,
-,1,0,13,99,111,114,101,47,112,97,114,115,101,46,112,
-,0,0,0,33,1,0,0,12,1,0,7,97,100,118,97,
-,99,101,0,34,1,0,0,28,1,0,0,28,2,0,0,
-,1,0,2,30,6,0,194,32,32,32,32,114,101,116,117,
-,110,32,80,46,97,100,118,97,110,99,101,40,116,41,0,
+,1,0,0,0,0,0,0,12,28,0,8,100,105,99,116,
+,110,117,100,0,0,0,0,14,28,27,0,16,28,0,17,
+,5,0,0,28,1,0,0,28,2,0,0,32,1,0,2,
 ,4,0,1,80,0,0,0,13,3,4,0,12,4,0,7,
 ,100,118,97,110,99,101,0,9,3,3,4,15,4,1,0,
 ,2,4,1,19,2,3,2,20,2,0,0,0,0,0,0,
-,28,0,7,97,100,118,97,110,99,101,0,14,28,27,0,
-,5,0,196,100,101,102,32,105,98,108,111,99,107,40,105,
-,101,109,115,41,58,0,0,16,28,0,189,44,8,0,0,
-,5,0,196,100,101,102,32,105,98,108,111,99,107,40,105,
-,101,109,115,41,58,0,0,12,1,0,13,99,111,114,101,
-,112,97,114,115,101,46,112,121,0,0,0,33,1,0,0,
-,1,0,6,105,98,108,111,99,107,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,30,12,0,197,32,32,32,32,
-,104,105,108,101,32,99,104,101,99,107,40,80,46,116,111,
-,101,110,44,39,110,108,39,44,39,59,39,41,58,32,97,
-,118,97,110,99,101,40,41,0,0,0,0,12,4,0,5,
-,104,101,99,107,0,0,0,13,3,4,0,12,7,0,1,
-,0,0,0,13,4,7,0,12,7,0,5,116,111,107,101,
-,0,0,0,9,4,4,7,12,5,0,2,110,108,0,0,
-,6,0,1,59,0,0,0,31,2,4,3,19,2,3,2,
-,2,0,0,18,0,0,8,12,4,0,7,97,100,118,97,
-,99,101,0,13,3,4,0,31,2,0,0,19,2,3,2,
-,0,255,231,30,4,0,198,32,32,32,32,119,104,105,108,
-,32,84,114,117,101,58,0,11,2,0,0,0,0,0,0,
-,0,240,63,21,2,0,0,18,0,0,120,30,9,0,199,
-,32,32,32,32,32,32,32,105,116,101,109,115,46,97,112,
-,101,110,100,40,101,120,112,114,101,115,115,105,111,110,40,
-,41,41,0,12,4,0,6,97,112,112,101,110,100,0,0,
-,3,1,4,12,6,0,10,101,120,112,114,101,115,115,105,
-,110,0,0,13,5,6,0,11,6,0,0,0,0,0,0,
-,0,0,0,31,4,6,1,19,4,5,4,31,2,4,1,
-,2,3,2,30,6,0,200,32,32,32,32,32,32,32,32,
-,46,116,101,114,109,105,110,97,108,40,41,0,0,0,0,
-,4,0,1,80,0,0,0,13,3,4,0,12,4,0,8,
-,101,114,109,105,110,97,108,0,0,0,0,9,3,3,4,
-,2,0,0,19,2,3,2,30,13,0,201,32,32,32,32,
-,32,32,32,119,104,105,108,101,32,99,104,101,99,107,40,
-,46,116,111,107,101,110,44,39,110,108,39,44,39,59,39,
-,58,32,97,100,118,97,110,99,101,40,41,0,0,0,0,
-,4,0,5,99,104,101,99,107,0,0,0,13,3,4,0,
-,7,0,1,80,0,0,0,13,4,7,0,12,7,0,5,
-,111,107,101,110,0,0,0,9,4,4,7,12,5,0,2,
-,108,0,0,12,6,0,1,59,0,0,0,31,2,4,3,
-,2,3,2,21,2,0,0,18,0,0,8,12,4,0,7,
-,100,118,97,110,99,101,0,13,3,4,0,31,2,0,0,
-,2,3,2,18,0,255,231,30,12,0,202,32,32,32,32,
-,32,32,32,105,102,32,99,104,101,99,107,40,80,46,116,
-,107,101,110,44,39,100,101,100,101,110,116,39,44,39,101,
-,102,39,41,58,32,98,114,101,97,107,0,12,4,0,5,
-,104,101,99,107,0,0,0,13,3,4,0,12,7,0,1,
-,0,0,0,13,4,7,0,12,7,0,5,116,111,107,101,
-,0,0,0,9,4,4,7,12,5,0,6,100,101,100,101,
-,116,0,0,12,6,0,3,101,111,102,0,31,2,4,3,
-,2,3,2,21,2,0,0,18,0,0,3,18,0,0,3,
-,0,0,1,18,0,255,133,0,0,0,0,12,29,0,6,
-,98,108,111,99,107,0,0,14,29,28,0,30,4,0,204,
-,101,102,32,98,108,111,99,107,40,41,58,0,0,0,0,
-,29,1,114,44,10,0,0,30,4,0,204,100,101,102,32,
-,108,111,99,107,40,41,58,0,0,0,0,12,1,0,13,
-,111,114,101,47,112,97,114,115,101,46,112,121,0,0,0,
-,1,0,0,12,1,0,5,98,108,111,99,107,0,0,0,
-,1,0,0,30,4,0,205,32,32,32,32,105,116,101,109,
-,32,61,32,91,93,0,0,27,2,0,0,15,1,2,0,
-,5,0,206,32,32,32,32,116,111,107,32,61,32,80,46,
-,111,107,101,110,0,0,0,12,4,0,1,80,0,0,0,
-,3,4,0,12,4,0,5,116,111,107,101,110,0,0,0,
-,3,3,4,15,2,3,0,30,7,0,208,32,32,32,32,
-,102,32,99,104,101,99,107,40,80,46,116,111,107,101,110,
-,39,110,108,39,41,58,0,12,5,0,5,99,104,101,99,
-,0,0,0,13,4,5,0,12,7,0,1,80,0,0,0,
-,5,7,0,12,7,0,5,116,111,107,101,110,0,0,0,
-,5,5,7,12,6,0,2,110,108,0,0,31,3,5,2,
-,3,4,3,21,3,0,0,18,0,0,87,30,12,0,209,
-,32,32,32,32,32,32,32,119,104,105,108,101,32,99,104,
-,99,107,40,80,46,116,111,107,101,110,44,39,110,108,39,
-,58,32,97,100,118,97,110,99,101,40,41,0,0,0,0,
+,29,0,7,97,100,118,97,110,99,101,0,14,29,28,0,
+,29,1,2,44,10,0,0,27,2,0,0,15,1,2,0,
+,4,0,1,80,0,0,0,13,3,4,0,12,4,0,5,
+,111,107,101,110,0,0,0,9,3,3,4,15,2,3,0,
 ,5,0,5,99,104,101,99,107,0,0,0,13,4,5,0,
 ,7,0,1,80,0,0,0,13,5,7,0,12,7,0,5,
 ,111,107,101,110,0,0,0,9,5,5,7,12,6,0,2,
 ,345 → 983,204
 ,108,0,0,31,3,5,2,19,3,4,3,21,3,0,0,
 ,0,0,8,12,5,0,7,97,100,118,97,110,99,101,0,
 ,4,5,0,31,3,0,0,19,3,4,3,18,0,255,233,
-,7,0,210,32,32,32,32,32,32,32,32,97,100,118,97,
-,99,101,40,39,105,110,100,101,110,116,39,41,0,0,0,
+,5,0,5,99,104,101,99,107,0,0,0,13,4,5,0,
+,7,0,1,80,0,0,0,13,5,7,0,12,7,0,5,
+,111,107,101,110,0,0,0,9,5,5,7,12,6,0,6,
+,110,100,101,110,116,0,0,31,3,5,2,19,3,4,3,
+,3,0,0,18,0,0,85,12,5,0,7,97,100,118,97,
+,99,101,0,13,4,5,0,12,5,0,6,105,110,100,101,
+,116,0,0,31,3,5,1,19,3,4,3,11,3,0,0,
+,0,0,0,0,0,0,0,12,6,0,5,99,104,101,99,
+,0,0,0,13,5,6,0,12,8,0,1,80,0,0,0,
+,6,8,0,12,8,0,5,116,111,107,101,110,0,0,0,
+,6,6,8,12,7,0,6,100,101,100,101,110,116,0,0,
+,4,6,2,19,4,5,4,23,3,3,4,21,3,0,0,
+,0,0,44,12,5,0,6,97,112,112,101,110,100,0,0,
+,4,1,5,12,7,0,10,101,120,112,114,101,115,115,105,
+,110,0,0,13,6,7,0,11,7,0,0,0,0,0,0,
+,0,0,0,31,5,7,1,19,5,6,5,31,3,5,1,
+,3,4,3,12,5,0,5,99,104,101,99,107,0,0,0,
+,4,5,0,12,8,0,1,80,0,0,0,13,5,8,0,
+,8,0,5,116,111,107,101,110,0,0,0,9,5,5,8,
+,6,0,1,59,0,0,0,12,7,0,2,110,108,0,0,
+,3,5,3,19,3,4,3,21,3,0,0,18,0,0,8,
 ,5,0,7,97,100,118,97,110,99,101,0,13,4,5,0,
-,5,0,6,105,110,100,101,110,116,0,0,31,3,5,1,
-,3,4,3,30,6,0,211,32,32,32,32,32,32,32,32,
-,98,108,111,99,107,40,105,116,101,109,115,41,0,0,0,
-,5,0,6,105,98,108,111,99,107,0,0,13,4,5,0,
-,5,1,0,31,3,5,1,19,3,4,3,30,7,0,212,
-,32,32,32,32,32,32,32,97,100,118,97,110,99,101,40,
-,100,101,100,101,110,116,39,41,0,0,0,12,5,0,7,
-,100,118,97,110,99,101,0,13,4,5,0,12,5,0,6,
-,101,100,101,110,116,0,0,31,3,5,1,19,3,4,3,
-,0,0,120,30,3,0,213,32,32,32,32,101,108,115,101,
-,0,0,0,30,9,0,214,32,32,32,32,32,32,32,32,
-,116,101,109,115,46,97,112,112,101,110,100,40,101,120,112,
-,101,115,115,105,111,110,40,48,41,41,0,12,5,0,6,
+,3,0,0,19,3,4,3,18,0,255,231,18,0,255,192,
+,5,0,7,97,100,118,97,110,99,101,0,13,4,5,0,
+,5,0,6,100,101,100,101,110,116,0,0,31,3,5,1,
+,3,4,3,18,0,0,60,12,5,0,6,97,112,112,101,
+,100,0,0,9,4,1,5,12,7,0,10,101,120,112,114,
+,115,115,105,111,110,0,0,13,6,7,0,11,7,0,0,
+,0,0,0,0,0,0,0,31,5,7,1,19,5,6,5,
+,3,5,1,19,3,4,3,12,5,0,5,99,104,101,99,
+,0,0,0,13,4,5,0,12,7,0,1,80,0,0,0,
+,5,7,0,12,7,0,5,116,111,107,101,110,0,0,0,
+,5,5,7,12,6,0,1,59,0,0,0,31,3,5,2,
+,3,4,3,21,3,0,0,18,0,0,26,12,5,0,7,
+,100,118,97,110,99,101,0,13,4,5,0,12,5,0,1,
+,0,0,0,31,3,5,1,19,3,4,3,12,5,0,6,
 ,112,112,101,110,100,0,0,9,4,1,5,12,7,0,10,
 ,120,112,114,101,115,115,105,111,110,0,0,13,6,7,0,
 ,7,0,0,0,0,0,0,0,0,0,0,31,5,7,1,
-,5,6,5,31,3,5,1,19,3,4,3,30,9,0,215,
-,32,32,32,32,32,32,32,119,104,105,108,101,32,99,104,
-,99,107,40,80,46,116,111,107,101,110,44,39,59,39,41,
-,0,0,0,12,5,0,5,99,104,101,99,107,0,0,0,
+,5,6,5,31,3,5,1,19,3,4,3,18,0,255,215,
+,0,0,1,12,5,0,5,99,104,101,99,107,0,0,0,
 ,4,5,0,12,7,0,1,80,0,0,0,13,5,7,0,
 ,7,0,5,116,111,107,101,110,0,0,0,9,5,5,7,
-,6,0,1,59,0,0,0,31,3,5,2,19,3,4,3,
-,3,0,0,18,0,0,45,30,7,0,216,32,32,32,32,
-,32,32,32,32,32,32,32,97,100,118,97,110,99,101,40,
-,59,39,41,0,0,0,0,12,5,0,7,97,100,118,97,
-,99,101,0,13,4,5,0,12,5,0,1,59,0,0,0,
-,3,5,1,19,3,4,3,30,10,0,217,32,32,32,32,
-,32,32,32,32,32,32,32,105,116,101,109,115,46,97,112,
-,101,110,100,40,101,120,112,114,101,115,115,105,111,110,40,
-,41,41,0,12,5,0,6,97,112,112,101,110,100,0,0,
-,4,1,5,12,7,0,10,101,120,112,114,101,115,115,105,
-,110,0,0,13,6,7,0,11,7,0,0,0,0,0,0,
-,0,0,0,31,5,7,1,19,5,6,5,31,3,5,1,
-,3,4,3,18,0,255,196,30,6,0,218,32,32,32,32,
-,32,32,32,80,46,116,101,114,109,105,110,97,108,40,41,
-,0,0,0,12,5,0,1,80,0,0,0,13,4,5,0,
-,5,0,8,116,101,114,109,105,110,97,108,0,0,0,0,
-,4,4,5,31,3,0,0,19,3,4,3,18,0,0,1,
-,11,0,219,32,32,32,32,119,104,105,108,101,32,99,104,
-,99,107,40,80,46,116,111,107,101,110,44,39,110,108,39,
-,58,32,97,100,118,97,110,99,101,40,41,0,0,0,0,
-,5,0,5,99,104,101,99,107,0,0,0,13,4,5,0,
-,7,0,1,80,0,0,0,13,5,7,0,12,7,0,5,
-,111,107,101,110,0,0,0,9,5,5,7,12,6,0,2,
-,108,0,0,31,3,5,2,19,3,4,3,21,3,0,0,
-,0,0,8,12,5,0,7,97,100,118,97,110,99,101,0,
-,4,5,0,31,3,0,0,19,3,4,3,18,0,255,233,
-,6,0,221,32,32,32,32,105,102,32,108,101,110,40,105,
-,101,109,115,41,32,62,32,49,58,0,0,11,3,0,0,
-,0,0,0,0,0,240,63,12,6,0,3,108,101,110,0,
-,5,6,0,15,6,1,0,31,4,6,1,19,4,5,4,
-,3,3,4,21,3,0,0,18,0,0,34,30,14,0,222,
-,32,32,32,32,32,32,32,114,101,116,117,114,110,32,84,
-,107,101,110,40,116,111,107,46,112,111,115,44,39,115,116,
-,116,101,109,101,110,116,115,39,44,39,59,39,44,105,116,
-,109,115,41,0,0,0,0,12,5,0,5,84,111,107,101,
-,0,0,0,13,4,5,0,12,9,0,3,112,111,115,0,
-,5,2,9,12,6,0,10,115,116,97,116,101,109,101,110,
-,115,0,0,12,7,0,1,59,0,0,0,15,8,1,0,
-,3,5,4,19,3,4,3,20,3,0,0,18,0,0,1,
-,6,0,223,32,32,32,32,114,101,116,117,114,110,32,105,
-,101,109,115,46,112,111,112,40,41,0,0,12,5,0,3,
+,6,0,2,110,108,0,0,31,3,5,2,19,3,4,3,
+,3,0,0,18,0,0,8,12,5,0,7,97,100,118,97,
+,99,101,0,13,4,5,0,31,3,0,0,19,3,4,3,
+,0,255,233,11,3,0,0,0,0,0,0,0,0,240,63,
+,6,0,3,108,101,110,0,13,5,6,0,15,6,1,0,
+,4,6,1,19,4,5,4,25,3,3,4,21,3,0,0,
+,0,0,19,12,5,0,5,84,111,107,101,110,0,0,0,
+,4,5,0,12,9,0,3,112,111,115,0,9,5,2,9,
+,6,0,10,115,116,97,116,101,109,101,110,116,115,0,0,
+,7,0,1,59,0,0,0,15,8,1,0,31,3,5,4,
+,3,4,3,20,3,0,0,18,0,0,1,12,5,0,3,
 ,111,112,0,9,4,1,5,31,3,0,0,19,3,4,3,
 ,3,0,0,0,0,0,0,12,30,0,5,98,108,111,99,
-,0,0,0,14,30,29,0,30,4,0,225,100,101,102,32,
-,101,102,95,110,117,100,40,116,41,58,0,16,30,1,44,
-,11,0,0,30,4,0,225,100,101,102,32,100,101,102,95,
-,117,100,40,116,41,58,0,12,1,0,13,99,111,114,101,
-,112,97,114,115,101,46,112,121,0,0,0,33,1,0,0,
-,1,0,7,100,101,102,95,110,117,100,0,34,1,0,0,
-,2,0,0,9,1,0,2,30,7,0,226,32,32,32,32,
-,116,101,109,115,32,61,32,116,46,105,116,101,109,115,32,
-,32,91,93,0,0,0,0,27,3,0,0,12,4,0,5,
+,0,0,0,14,30,29,0,16,30,0,175,44,11,0,0,
+,2,0,0,9,1,0,2,27,3,0,0,12,4,0,5,
 ,116,101,109,115,0,0,0,10,1,4,3,15,2,3,0,
-,10,0,227,32,32,32,32,105,116,101,109,115,46,97,112,
-,101,110,100,40,80,46,116,111,107,101,110,41,59,32,97,
-,118,97,110,99,101,40,41,0,0,0,0,12,5,0,6,
-,112,112,101,110,100,0,0,9,4,2,5,12,6,0,1,
-,0,0,0,13,5,6,0,12,6,0,5,116,111,107,101,
-,0,0,0,9,5,5,6,31,3,5,1,19,3,4,3,
-,5,0,7,97,100,118,97,110,99,101,0,13,4,5,0,
-,3,0,0,19,3,4,3,30,5,0,228,32,32,32,32,
-,100,118,97,110,99,101,40,39,40,39,41,0,0,0,0,
-,5,0,7,97,100,118,97,110,99,101,0,13,4,5,0,
-,5,0,1,40,0,0,0,31,3,5,1,19,3,4,3,
-,10,0,229,32,32,32,32,114,32,61,32,84,111,107,101,
-,40,116,46,112,111,115,44,39,115,121,109,98,111,108,39,
-,39,40,41,58,39,44,91,93,41,0,0,12,6,0,5,
+,5,0,6,97,112,112,101,110,100,0,0,9,4,2,5,
+,6,0,1,80,0,0,0,13,5,6,0,12,6,0,5,
+,111,107,101,110,0,0,0,9,5,5,6,31,3,5,1,
+,3,4,3,12,5,0,7,97,100,118,97,110,99,101,0,
+,4,5,0,31,3,0,0,19,3,4,3,12,5,0,7,
+,100,118,97,110,99,101,0,13,4,5,0,12,5,0,1,
+,0,0,0,31,3,5,1,19,3,4,3,12,6,0,5,
 ,111,107,101,110,0,0,0,13,5,6,0,12,10,0,3,
 ,111,115,0,9,6,1,10,12,7,0,6,115,121,109,98,
 ,108,0,0,12,8,0,3,40,41,58,0,27,9,0,0,
-,4,6,4,19,4,5,4,15,3,4,0,30,5,0,230,
-,32,32,32,105,116,101,109,115,46,97,112,112,101,110,100,
-,114,41,0,12,6,0,6,97,112,112,101,110,100,0,0,
-,5,2,6,15,6,3,0,31,4,6,1,19,4,5,4,
-,9,0,231,32,32,32,32,119,104,105,108,101,32,110,111,
-,32,99,104,101,99,107,40,80,46,116,111,107,101,110,44,
-,41,39,41,58,0,0,0,12,7,0,5,99,104,101,99,
-,0,0,0,13,6,7,0,12,9,0,1,80,0,0,0,
-,7,9,0,12,9,0,5,116,111,107,101,110,0,0,0,
-,7,7,9,12,8,0,1,41,0,0,0,31,5,7,2,
-,5,6,5,47,4,5,0,21,4,0,0,18,0,0,101,
-,6,0,232,32,32,32,32,32,32,32,32,116,119,101,97,
-,40,39,44,39,44,48,41,0,0,0,0,12,6,0,5,
+,4,6,4,19,4,5,4,15,3,4,0,12,6,0,6,
+,112,112,101,110,100,0,0,9,5,2,6,15,6,3,0,
+,4,6,1,19,4,5,4,11,4,0,0,0,0,0,0,
+,0,0,0,12,7,0,5,99,104,101,99,107,0,0,0,
+,6,7,0,12,9,0,1,80,0,0,0,13,7,9,0,
+,9,0,5,116,111,107,101,110,0,0,0,9,7,7,9,
+,8,0,1,41,0,0,0,31,5,7,2,19,5,6,5,
+,4,4,5,21,4,0,0,18,0,0,65,12,6,0,5,
 ,119,101,97,107,0,0,0,13,5,6,0,12,6,0,1,
 ,0,0,0,11,7,0,0,0,0,0,0,0,0,0,0,
-,4,6,2,19,4,5,4,30,10,0,233,32,32,32,32,
-,32,32,32,114,46,105,116,101,109,115,46,97,112,112,101,
-,100,40,101,120,112,114,101,115,115,105,111,110,40,48,41,
-,0,0,0,12,6,0,5,105,116,101,109,115,0,0,0,
-,5,3,6,12,6,0,6,97,112,112,101,110,100,0,0,
-,5,5,6,12,8,0,10,101,120,112,114,101,115,115,105,
-,110,0,0,13,7,8,0,11,8,0,0,0,0,0,0,
-,0,0,0,31,6,8,1,19,6,7,6,31,4,6,1,
-,4,5,4,30,11,0,234,32,32,32,32,32,32,32,32,
-,102,32,99,104,101,99,107,40,80,46,116,111,107,101,110,
-,39,44,39,41,58,32,97,100,118,97,110,99,101,40,39,
-,39,41,0,12,6,0,5,99,104,101,99,107,0,0,0,
-,5,6,0,12,8,0,1,80,0,0,0,13,6,8,0,
-,8,0,5,116,111,107,101,110,0,0,0,9,6,6,8,
-,7,0,1,44,0,0,0,31,4,6,2,19,4,5,4,
-,4,0,0,18,0,0,10,12,6,0,7,97,100,118,97,
-,99,101,0,13,5,6,0,12,6,0,1,44,0,0,0,
-,4,6,1,19,4,5,4,18,0,0,1,30,5,0,235,
-,32,32,32,32,32,32,32,114,101,115,116,111,114,101,40,
-,0,0,0,12,6,0,7,114,101,115,116,111,114,101,0,
-,5,6,0,31,4,0,0,19,4,5,4,18,0,255,139,
-,5,0,236,32,32,32,32,97,100,118,97,110,99,101,40,
-,41,39,41,0,0,0,0,12,6,0,7,97,100,118,97,
-,99,101,0,13,5,6,0,12,6,0,1,41,0,0,0,
-,4,6,1,19,4,5,4,30,5,0,237,32,32,32,32,
-,100,118,97,110,99,101,40,39,58,39,41,0,0,0,0,
-,6,0,7,97,100,118,97,110,99,101,0,13,5,6,0,
-,6,0,1,58,0,0,0,31,4,6,1,19,4,5,4,
-,7,0,238,32,32,32,32,105,116,101,109,115,46,97,112,
-,101,110,100,40,98,108,111,99,107,40,41,41,0,0,0,
-,6,0,6,97,112,112,101,110,100,0,0,9,5,2,6,
-,8,0,5,98,108,111,99,107,0,0,0,13,7,8,0,
-,6,0,0,19,6,7,6,31,4,6,1,19,4,5,4,
-,4,0,239,32,32,32,32,114,101,116,117,114,110,32,116,
-,0,0,0,20,1,0,0,0,0,0,0,12,31,0,7,
-,101,102,95,110,117,100,0,14,31,30,0,30,5,0,242,
-,101,102,32,119,104,105,108,101,95,110,117,100,40,116,41,
-,0,0,0,16,31,0,101,44,8,0,0,30,5,0,242,
-,101,102,32,119,104,105,108,101,95,110,117,100,40,116,41,
-,0,0,0,12,1,0,13,99,111,114,101,47,112,97,114,
-,101,46,112,121,0,0,0,33,1,0,0,12,1,0,9,
-,104,105,108,101,95,110,117,100,0,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,30,7,0,243,32,32,32,32,
-,116,101,109,115,32,61,32,116,46,105,116,101,109,115,32,
-,32,91,93,0,0,0,0,27,3,0,0,12,4,0,5,
-,116,101,109,115,0,0,0,10,1,4,3,15,2,3,0,
-,8,0,244,32,32,32,32,105,116,101,109,115,46,97,112,
-,101,110,100,40,101,120,112,114,101,115,115,105,111,110,40,
-,41,41,0,12,5,0,6,97,112,112,101,110,100,0,0,
-,4,2,5,12,7,0,10,101,120,112,114,101,115,115,105,
-,110,0,0,13,6,7,0,11,7,0,0,0,0,0,0,
-,0,0,0,31,5,7,1,19,5,6,5,31,3,5,1,
-,3,4,3,30,5,0,245,32,32,32,32,97,100,118,97,
-,99,101,40,39,58,39,41,0,0,0,0,12,5,0,7,
+,4,6,2,19,4,5,4,12,6,0,5,105,116,101,109,
+,0,0,0,9,5,3,6,12,6,0,6,97,112,112,101,
+,100,0,0,9,5,5,6,12,8,0,10,101,120,112,114,
+,115,115,105,111,110,0,0,13,7,8,0,11,8,0,0,
+,0,0,0,0,0,0,0,31,6,8,1,19,6,7,6,
+,4,6,1,19,4,5,4,12,6,0,5,99,104,101,99,
+,0,0,0,13,5,6,0,12,8,0,1,80,0,0,0,
+,6,8,0,12,8,0,5,116,111,107,101,110,0,0,0,
+,6,6,8,12,7,0,1,44,0,0,0,31,4,6,2,
+,4,5,4,21,4,0,0,18,0,0,10,12,6,0,7,
+,100,118,97,110,99,101,0,13,5,6,0,12,6,0,1,
+,0,0,0,31,4,6,1,19,4,5,4,18,0,0,1,
+,6,0,7,114,101,115,116,111,114,101,0,13,5,6,0,
+,4,0,0,19,4,5,4,18,0,255,172,12,6,0,7,
+,100,118,97,110,99,101,0,13,5,6,0,12,6,0,1,
+,0,0,0,31,4,6,1,19,4,5,4,12,6,0,7,
+,100,118,97,110,99,101,0,13,5,6,0,12,6,0,1,
+,0,0,0,31,4,6,1,19,4,5,4,12,6,0,6,
+,112,112,101,110,100,0,0,9,5,2,6,12,8,0,5,
+,108,111,99,107,0,0,0,13,7,8,0,31,6,0,0,
+,6,7,6,31,4,6,1,19,4,5,4,20,1,0,0,
+,0,0,0,12,31,0,7,100,101,102,95,110,117,100,0,
+,31,30,0,16,31,0,48,44,8,0,0,28,2,0,0,
+,1,0,2,27,3,0,0,12,4,0,5,105,116,101,109,
+,0,0,0,10,1,4,3,15,2,3,0,12,5,0,6,
+,112,112,101,110,100,0,0,9,4,2,5,12,7,0,10,
+,120,112,114,101,115,115,105,111,110,0,0,13,6,7,0,
+,7,0,0,0,0,0,0,0,0,0,0,31,5,7,1,
+,5,6,5,31,3,5,1,19,3,4,3,12,5,0,7,
 ,100,118,97,110,99,101,0,13,4,5,0,12,5,0,1,
-,0,0,0,31,3,5,1,19,3,4,3,30,7,0,246,
-,32,32,32,105,116,101,109,115,46,97,112,112,101,110,100,
-,98,108,111,99,107,40,41,41,0,0,0,12,5,0,6,
+,0,0,0,31,3,5,1,19,3,4,3,12,5,0,6,
 ,112,112,101,110,100,0,0,9,4,2,5,12,7,0,5,
 ,108,111,99,107,0,0,0,13,6,7,0,31,5,0,0,
-,5,6,5,31,3,5,1,19,3,4,3,30,4,0,247,
-,32,32,32,114,101,116,117,114,110,32,116,0,0,0,0,
-,1,0,0,0,0,0,0,12,32,0,9,119,104,105,108,
-,95,110,117,100,0,0,0,14,32,31,0,30,5,0,248,
-,101,102,32,99,108,97,115,115,95,110,117,100,40,116,41,
-,0,0,0,16,32,0,114,44,11,0,0,30,5,0,248,
-,101,102,32,99,108,97,115,115,95,110,117,100,40,116,41,
-,0,0,0,12,1,0,13,99,111,114,101,47,112,97,114,
-,101,46,112,121,0,0,0,33,1,0,0,12,1,0,9,
-,108,97,115,115,95,110,117,100,0,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,30,7,0,249,32,32,32,32,
-,116,101,109,115,32,61,32,116,46,105,116,101,109,115,32,
-,32,91,93,0,0,0,0,27,3,0,0,12,4,0,5,
+,5,6,5,31,3,5,1,19,3,4,3,20,1,0,0,
+,0,0,0,12,32,0,9,119,104,105,108,101,95,110,117,
+,0,0,0,14,32,31,0,16,32,0,57,44,11,0,0,
+,2,0,0,9,1,0,2,27,3,0,0,12,4,0,5,
 ,116,101,109,115,0,0,0,10,1,4,3,15,2,3,0,
-,8,0,250,32,32,32,32,105,116,101,109,115,46,97,112,
-,101,110,100,40,101,120,112,114,101,115,115,105,111,110,40,
-,41,41,0,12,5,0,6,97,112,112,101,110,100,0,0,
-,4,2,5,12,7,0,10,101,120,112,114,101,115,115,105,
-,110,0,0,13,6,7,0,11,7,0,0,0,0,0,0,
-,0,0,0,31,5,7,1,19,5,6,5,31,3,5,1,
-,3,4,3,30,5,0,251,32,32,32,32,97,100,118,97,
-,99,101,40,39,58,39,41,0,0,0,0,12,5,0,7,
-,100,118,97,110,99,101,0,13,4,5,0,12,5,0,1,
-,0,0,0,31,3,5,1,19,3,4,3,30,11,0,252,
-,32,32,32,105,116,101,109,115,46,97,112,112,101,110,100,
-,105,108,115,116,40,39,109,101,116,104,111,100,115,39,44,
-,108,111,99,107,40,41,41,41,0,0,0,12,5,0,6,
-,112,112,101,110,100,0,0,9,4,2,5,12,7,0,4,
-,108,115,116,0,0,0,0,13,6,7,0,12,7,0,7,
-,101,116,104,111,100,115,0,12,10,0,5,98,108,111,99,
-,0,0,0,13,9,10,0,31,8,0,0,19,8,9,8,
-,5,7,2,19,5,6,5,31,3,5,1,19,3,4,3,
-,4,0,253,32,32,32,32,114,101,116,117,114,110,32,116,
-,0,0,0,20,1,0,0,0,0,0,0,12,33,0,9,
+,5,0,6,97,112,112,101,110,100,0,0,9,4,2,5,
+,7,0,10,101,120,112,114,101,115,115,105,111,110,0,0,
+,6,7,0,11,7,0,0,0,0,0,0,0,0,0,0,
+,5,7,1,19,5,6,5,31,3,5,1,19,3,4,3,
+,5,0,7,97,100,118,97,110,99,101,0,13,4,5,0,
+,5,0,1,58,0,0,0,31,3,5,1,19,3,4,3,
+,5,0,6,97,112,112,101,110,100,0,0,9,4,2,5,
+,7,0,4,105,108,115,116,0,0,0,0,13,6,7,0,
+,7,0,7,109,101,116,104,111,100,115,0,12,10,0,5,
+,108,111,99,107,0,0,0,13,9,10,0,31,8,0,0,
+,8,9,8,31,5,7,2,19,5,6,5,31,3,5,1,
+,3,4,3,20,1,0,0,0,0,0,0,12,33,0,9,
 ,108,97,115,115,95,110,117,100,0,0,0,14,33,32,0,
-,5,0,255,100,101,102,32,102,114,111,109,95,110,117,100,
-,116,41,58,0,0,0,0,16,33,0,108,44,8,0,0,
-,5,0,255,100,101,102,32,102,114,111,109,95,110,117,100,
-,116,41,58,0,0,0,0,12,1,0,13,99,111,114,101,
-,112,97,114,115,101,46,112,121,0,0,0,33,1,0,0,
-,1,0,8,102,114,111,109,95,110,117,100,0,0,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,30,7,1,0,
-,32,32,32,105,116,101,109,115,32,61,32,116,46,105,116,
-,109,115,32,61,32,91,93,0,0,0,0,27,3,0,0,
-,4,0,5,105,116,101,109,115,0,0,0,10,1,4,3,
-,2,3,0,30,8,1,1,32,32,32,32,105,116,101,109,
-,46,97,112,112,101,110,100,40,101,120,112,114,101,115,115,
-,111,110,40,48,41,41,0,12,5,0,6,97,112,112,101,
+,33,0,53,44,8,0,0,28,2,0,0,9,1,0,2,
+,3,0,0,12,4,0,5,105,116,101,109,115,0,0,0,
+,1,4,3,15,2,3,0,12,5,0,6,97,112,112,101,
 ,100,0,0,9,4,2,5,12,7,0,10,101,120,112,114,
 ,115,115,105,111,110,0,0,13,6,7,0,11,7,0,0,
 ,0,0,0,0,0,0,0,31,5,7,1,19,5,6,5,
-,3,5,1,19,3,4,3,30,6,1,2,32,32,32,32,
-,100,118,97,110,99,101,40,39,105,109,112,111,114,116,39,
-,0,0,0,12,5,0,7,97,100,118,97,110,99,101,0,
-,4,5,0,12,5,0,6,105,109,112,111,114,116,0,0,
-,3,5,1,19,3,4,3,30,8,1,3,32,32,32,32,
-,116,101,109,115,46,97,112,112,101,110,100,40,101,120,112,
-,101,115,115,105,111,110,40,48,41,41,0,12,5,0,6,
+,3,5,1,19,3,4,3,12,5,0,7,97,100,118,97,
+,99,101,0,13,4,5,0,12,5,0,6,105,109,112,111,
+,116,0,0,31,3,5,1,19,3,4,3,12,5,0,6,
 ,112,112,101,110,100,0,0,9,4,2,5,12,7,0,10,
 ,120,112,114,101,115,115,105,111,110,0,0,13,6,7,0,
 ,7,0,0,0,0,0,0,0,0,0,0,31,5,7,1,
-,5,6,5,31,3,5,1,19,3,4,3,30,4,1,4,
-,32,32,32,114,101,116,117,114,110,32,116,0,0,0,0,
-,1,0,0,0,0,0,0,12,34,0,8,102,114,111,109,
-,110,117,100,0,0,0,0,14,34,33,0,30,4,1,6,
-,101,102,32,102,111,114,95,110,117,100,40,116,41,58,0,
-,34,0,166,44,8,0,0,30,4,1,6,100,101,102,32,
-,111,114,95,110,117,100,40,116,41,58,0,12,1,0,13,
-,111,114,101,47,112,97,114,115,101,46,112,121,0,0,0,
-,1,0,0,12,1,0,7,102,111,114,95,110,117,100,0,
-,1,0,0,28,2,0,0,9,1,0,2,30,7,1,7,
-,32,32,32,105,116,101,109,115,32,61,32,116,46,105,116,
-,109,115,32,61,32,91,93,0,0,0,0,27,3,0,0,
-,4,0,5,105,116,101,109,115,0,0,0,10,1,4,3,
-,2,3,0,30,5,1,8,32,32,32,32,116,119,101,97,
-,40,39,105,110,39,44,48,41,0,0,0,12,5,0,5,
-,119,101,97,107,0,0,0,13,4,5,0,12,5,0,2,
-,110,0,0,11,6,0,0,0,0,0,0,0,0,0,0,
-,3,5,2,19,3,4,3,30,8,1,9,32,32,32,32,
-,116,101,109,115,46,97,112,112,101,110,100,40,101,120,112,
-,101,115,115,105,111,110,40,48,41,41,0,12,5,0,6,
+,5,6,5,31,3,5,1,19,3,4,3,20,1,0,0,
+,0,0,0,12,34,0,8,102,114,111,109,95,110,117,100,
+,0,0,0,14,34,33,0,16,34,0,89,44,8,0,0,
+,2,0,0,9,1,0,2,27,3,0,0,12,4,0,5,
+,116,101,109,115,0,0,0,10,1,4,3,15,2,3,0,
+,5,0,5,116,119,101,97,107,0,0,0,13,4,5,0,
+,5,0,2,105,110,0,0,11,6,0,0,0,0,0,0,
+,0,0,0,31,3,5,2,19,3,4,3,12,5,0,6,
 ,112,112,101,110,100,0,0,9,4,2,5,12,7,0,10,
 ,120,112,114,101,115,115,105,111,110,0,0,13,6,7,0,
 ,7,0,0,0,0,0,0,0,0,0,0,31,5,7,1,
-,5,6,5,31,3,5,1,19,3,4,3,30,5,1,10,
-,32,32,32,97,100,118,97,110,99,101,40,39,105,110,39,
-,0,0,0,12,5,0,7,97,100,118,97,110,99,101,0,
-,4,5,0,12,5,0,2,105,110,0,0,31,3,5,1,
-,3,4,3,30,8,1,11,32,32,32,32,105,116,101,109,
-,46,97,112,112,101,110,100,40,101,120,112,114,101,115,115,
-,111,110,40,48,41,41,0,12,5,0,6,97,112,112,101,
-,100,0,0,9,4,2,5,12,7,0,10,101,120,112,114,
-,115,115,105,111,110,0,0,13,6,7,0,11,7,0,0,
-,0,0,0,0,0,0,0,31,5,7,1,19,5,6,5,
-,3,5,1,19,3,4,3,30,4,1,12,32,32,32,32,
-,101,115,116,111,114,101,40,41,0,0,0,12,5,0,7,
+,5,6,5,31,3,5,1,19,3,4,3,12,5,0,7,
+,100,118,97,110,99,101,0,13,4,5,0,12,5,0,2,
+,110,0,0,31,3,5,1,19,3,4,3,12,5,0,6,
+,112,112,101,110,100,0,0,9,4,2,5,12,7,0,10,
+,120,112,114,101,115,115,105,111,110,0,0,13,6,7,0,
+,7,0,0,0,0,0,0,0,0,0,0,31,5,7,1,
+,5,6,5,31,3,5,1,19,3,4,3,12,5,0,7,
 ,101,115,116,111,114,101,0,13,4,5,0,31,3,0,0,
-,3,4,3,30,5,1,13,32,32,32,32,97,100,118,97,
-,99,101,40,39,58,39,41,0,0,0,0,12,5,0,7,
-,100,118,97,110,99,101,0,13,4,5,0,12,5,0,1,
-,0,0,0,31,3,5,1,19,3,4,3,30,7,1,14,
-,32,32,32,105,116,101,109,115,46,97,112,112,101,110,100,
-,98,108,111,99,107,40,41,41,0,0,0,12,5,0,6,
-,112,112,101,110,100,0,0,9,4,2,5,12,7,0,5,
-,108,111,99,107,0,0,0,13,6,7,0,31,5,0,0,
-,5,6,5,31,3,5,1,19,3,4,3,30,4,1,15,
-,32,32,32,114,101,116,117,114,110,32,116,0,0,0,0,
-,1,0,0,0,0,0,0,12,35,0,7,102,111,114,95,
-,117,100,0,14,35,34,0,30,4,1,16,100,101,102,32,
-,102,95,110,117,100,40,116,41,58,0,0,16,35,1,138,
-,16,0,0,30,4,1,16,100,101,102,32,105,102,95,110,
-,100,40,116,41,58,0,0,12,1,0,13,99,111,114,101,
-,112,97,114,115,101,46,112,121,0,0,0,33,1,0,0,
-,1,0,6,105,102,95,110,117,100,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,30,7,1,17,32,32,32,32,
-,116,101,109,115,32,61,32,116,46,105,116,101,109,115,32,
-,32,91,93,0,0,0,0,27,3,0,0,12,4,0,5,
-,116,101,109,115,0,0,0,10,1,4,3,15,2,3,0,
-,6,1,18,32,32,32,32,97,32,61,32,101,120,112,114,
-,115,115,105,111,110,40,48,41,0,0,0,12,6,0,10,
-,120,112,114,101,115,115,105,111,110,0,0,13,5,6,0,
-,6,0,0,0,0,0,0,0,0,0,0,31,4,6,1,
-,4,5,4,15,3,4,0,30,5,1,19,32,32,32,32,
-,100,118,97,110,99,101,40,39,58,39,41,0,0,0,0,
+,3,4,3,12,5,0,7,97,100,118,97,110,99,101,0,
+,4,5,0,12,5,0,1,58,0,0,0,31,3,5,1,
+,3,4,3,12,5,0,6,97,112,112,101,110,100,0,0,
+,4,2,5,12,7,0,5,98,108,111,99,107,0,0,0,
+,6,7,0,31,5,0,0,19,5,6,5,31,3,5,1,
+,3,4,3,20,1,0,0,0,0,0,0,12,35,0,7,
+,111,114,95,110,117,100,0,14,35,34,0,16,35,0,222,
+,16,0,0,28,2,0,0,9,1,0,2,27,3,0,0,
+,4,0,5,105,116,101,109,115,0,0,0,10,1,4,3,
+,2,3,0,12,6,0,10,101,120,112,114,101,115,115,105,
+,110,0,0,13,5,6,0,11,6,0,0,0,0,0,0,
+,0,0,0,31,4,6,1,19,4,5,4,15,3,4,0,
 ,6,0,7,97,100,118,97,110,99,101,0,13,5,6,0,
 ,6,0,1,58,0,0,0,31,4,6,1,19,4,5,4,
-,4,1,20,32,32,32,32,98,32,61,32,98,108,111,99,
-,40,41,0,12,7,0,5,98,108,111,99,107,0,0,0,
-,6,7,0,31,5,0,0,19,5,6,5,15,4,5,0,
-,13,1,21,32,32,32,32,105,116,101,109,115,46,97,112,
-,101,110,100,40,84,111,107,101,110,40,116,46,112,111,115,
-,39,101,108,105,102,39,44,39,101,108,105,102,39,44,91,
-,44,98,93,41,41,0,0,12,7,0,6,97,112,112,101,
-,100,0,0,9,6,2,7,12,9,0,5,84,111,107,101,
-,0,0,0,13,8,9,0,12,13,0,3,112,111,115,0,
-,9,1,13,12,10,0,4,101,108,105,102,0,0,0,0,
-,11,0,4,101,108,105,102,0,0,0,0,15,13,3,0,
-,14,4,0,27,12,13,2,31,7,9,4,19,7,8,7,
-,5,7,1,19,5,6,5,30,9,1,22,32,32,32,32,
-,104,105,108,101,32,99,104,101,99,107,40,80,46,116,111,
-,101,110,44,39,101,108,105,102,39,41,58,0,0,0,0,
-,7,0,5,99,104,101,99,107,0,0,0,13,6,7,0,
-,9,0,1,80,0,0,0,13,7,9,0,12,9,0,5,
-,111,107,101,110,0,0,0,9,7,7,9,12,8,0,4,
-,108,105,102,0,0,0,0,31,5,7,2,19,5,6,5,
-,5,0,0,18,0,0,120,30,6,1,23,32,32,32,32,
-,32,32,32,116,111,107,32,61,32,80,46,116,111,107,101,
-,0,0,0,12,7,0,1,80,0,0,0,13,6,7,0,
+,7,0,5,98,108,111,99,107,0,0,0,13,6,7,0,
+,5,0,0,19,5,6,5,15,4,5,0,12,7,0,6,
+,112,112,101,110,100,0,0,9,6,2,7,12,9,0,5,
+,111,107,101,110,0,0,0,13,8,9,0,12,13,0,3,
+,111,115,0,9,9,1,13,12,10,0,4,101,108,105,102,
+,0,0,0,12,11,0,4,101,108,105,102,0,0,0,0,
+,13,3,0,15,14,4,0,27,12,13,2,31,7,9,4,
+,7,8,7,31,5,7,1,19,5,6,5,12,7,0,5,
+,104,101,99,107,0,0,0,13,6,7,0,12,9,0,1,
+,0,0,0,13,7,9,0,12,9,0,5,116,111,107,101,
+,0,0,0,9,7,7,9,12,8,0,4,101,108,105,102,
+,0,0,0,31,5,7,2,19,5,6,5,21,5,0,0,
+,0,0,69,12,7,0,1,80,0,0,0,13,6,7,0,
 ,7,0,5,116,111,107,101,110,0,0,0,9,6,6,7,
-,5,6,0,30,6,1,24,32,32,32,32,32,32,32,32,
-,100,118,97,110,99,101,40,39,101,108,105,102,39,41,0,
-,8,0,7,97,100,118,97,110,99,101,0,13,7,8,0,
-,8,0,4,101,108,105,102,0,0,0,0,31,6,8,1,
-,6,7,6,30,7,1,25,32,32,32,32,32,32,32,32,
-,32,61,32,101,120,112,114,101,115,115,105,111,110,40,48,
-,0,0,0,12,8,0,10,101,120,112,114,101,115,115,105,
-,110,0,0,13,7,8,0,11,8,0,0,0,0,0,0,
-,0,0,0,31,6,8,1,19,6,7,6,15,3,6,0,
-,6,1,26,32,32,32,32,32,32,32,32,97,100,118,97,
-,99,101,40,39,58,39,41,0,0,0,0,12,8,0,7,
-,100,118,97,110,99,101,0,13,7,8,0,12,8,0,1,
-,0,0,0,31,6,8,1,19,6,7,6,30,5,1,27,
-,32,32,32,32,32,32,32,98,32,61,32,98,108,111,99,
-,40,41,0,12,8,0,5,98,108,111,99,107,0,0,0,
+,5,6,0,12,8,0,7,97,100,118,97,110,99,101,0,
+,7,8,0,12,8,0,4,101,108,105,102,0,0,0,0,
+,6,8,1,19,6,7,6,12,8,0,10,101,120,112,114,
+,115,115,105,111,110,0,0,13,7,8,0,11,8,0,0,
+,0,0,0,0,0,0,0,31,6,8,1,19,6,7,6,
+,3,6,0,12,8,0,7,97,100,118,97,110,99,101,0,
+,7,8,0,12,8,0,1,58,0,0,0,31,6,8,1,
+,6,7,6,12,8,0,5,98,108,111,99,107,0,0,0,
 ,7,8,0,31,6,0,0,19,6,7,6,15,4,6,0,
-,15,1,28,32,32,32,32,32,32,32,32,105,116,101,109,
-,46,97,112,112,101,110,100,40,84,111,107,101,110,40,116,
-,107,46,112,111,115,44,39,101,108,105,102,39,44,39,101,
-,105,102,39,44,91,97,44,98,93,41,41,0,0,0,0,
 ,8,0,6,97,112,112,101,110,100,0,0,9,7,2,8,
 ,10,0,5,84,111,107,101,110,0,0,0,13,9,10,0,
 ,14,0,3,112,111,115,0,9,10,5,14,12,11,0,4,
 ,947 → 1187,555
 ,108,105,102,0,0,0,0,12,12,0,4,101,108,105,102,
 ,0,0,0,15,14,3,0,15,15,4,0,27,13,14,2,
 ,8,10,4,19,8,9,8,31,6,8,1,19,6,7,6,
-,0,255,120,30,8,1,29,32,32,32,32,105,102,32,99,
-,101,99,107,40,80,46,116,111,107,101,110,44,39,101,108,
-,101,39,41,58,0,0,0,12,8,0,5,99,104,101,99,
-,0,0,0,13,7,8,0,12,10,0,1,80,0,0,0,
-,8,10,0,12,10,0,5,116,111,107,101,110,0,0,0,
-,8,8,10,12,9,0,4,101,108,115,101,0,0,0,0,
-,6,8,2,19,6,7,6,21,6,0,0,18,0,0,99,
-,6,1,30,32,32,32,32,32,32,32,32,116,111,107,32,
-,32,80,46,116,111,107,101,110,0,0,0,12,7,0,1,
+,0,255,171,12,8,0,5,99,104,101,99,107,0,0,0,
+,7,8,0,12,10,0,1,80,0,0,0,13,8,10,0,
+,10,0,5,116,111,107,101,110,0,0,0,9,8,8,10,
+,9,0,4,101,108,115,101,0,0,0,0,31,6,8,2,
+,6,7,6,21,6,0,0,18,0,0,57,12,7,0,1,
 ,0,0,0,13,6,7,0,12,7,0,5,116,111,107,101,
-,0,0,0,9,6,6,7,15,5,6,0,30,6,1,31,
-,32,32,32,32,32,32,32,97,100,118,97,110,99,101,40,
-,101,108,115,101,39,41,0,12,8,0,7,97,100,118,97,
-,99,101,0,13,7,8,0,12,8,0,4,101,108,115,101,
-,0,0,0,31,6,8,1,19,6,7,6,30,6,1,32,
-,32,32,32,32,32,32,32,97,100,118,97,110,99,101,40,
-,58,39,41,0,0,0,0,12,8,0,7,97,100,118,97,
-,99,101,0,13,7,8,0,12,8,0,1,58,0,0,0,
-,6,8,1,19,6,7,6,30,5,1,33,32,32,32,32,
-,32,32,32,98,32,61,32,98,108,111,99,107,40,41,0,
+,0,0,0,9,6,6,7,15,5,6,0,12,8,0,7,
+,100,118,97,110,99,101,0,13,7,8,0,12,8,0,4,
+,108,115,101,0,0,0,0,31,6,8,1,19,6,7,6,
+,8,0,7,97,100,118,97,110,99,101,0,13,7,8,0,
+,8,0,1,58,0,0,0,31,6,8,1,19,6,7,6,
 ,8,0,5,98,108,111,99,107,0,0,0,13,7,8,0,
-,6,0,0,19,6,7,6,15,4,6,0,30,14,1,34,
-,32,32,32,32,32,32,32,105,116,101,109,115,46,97,112,
-,101,110,100,40,84,111,107,101,110,40,116,111,107,46,112,
-,115,44,39,101,108,115,101,39,44,39,101,108,115,101,39,
-,91,98,93,41,41,0,0,12,8,0,6,97,112,112,101,
-,100,0,0,9,7,2,8,12,10,0,5,84,111,107,101,
-,0,0,0,13,9,10,0,12,14,0,3,112,111,115,0,
-,10,5,14,12,11,0,4,101,108,115,101,0,0,0,0,
-,12,0,4,101,108,115,101,0,0,0,0,15,14,4,0,
-,13,14,1,31,8,10,4,19,8,9,8,31,6,8,1,
-,6,7,6,18,0,0,1,30,4,1,35,32,32,32,32,
-,101,116,117,114,110,32,116,0,0,0,0,20,1,0,0,
+,6,0,0,19,6,7,6,15,4,6,0,12,8,0,6,
+,112,112,101,110,100,0,0,9,7,2,8,12,10,0,5,
+,111,107,101,110,0,0,0,13,9,10,0,12,14,0,3,
+,111,115,0,9,10,5,14,12,11,0,4,101,108,115,101,
+,0,0,0,12,12,0,4,101,108,115,101,0,0,0,0,
+,14,4,0,27,13,14,1,31,8,10,4,19,8,9,8,
+,6,8,1,19,6,7,6,18,0,0,1,20,1,0,0,
 ,0,0,0,12,36,0,6,105,102,95,110,117,100,0,0,
-,36,35,0,30,4,1,36,100,101,102,32,116,114,121,95,
-,117,100,40,116,41,58,0,16,36,1,29,44,16,0,0,
-,4,1,36,100,101,102,32,116,114,121,95,110,117,100,40,
-,41,58,0,12,1,0,13,99,111,114,101,47,112,97,114,
-,101,46,112,121,0,0,0,33,1,0,0,12,1,0,7,
-,114,121,95,110,117,100,0,34,1,0,0,28,2,0,0,
-,1,0,2,30,7,1,37,32,32,32,32,105,116,101,109,
-,32,61,32,116,46,105,116,101,109,115,32,61,32,91,93,
-,0,0,0,27,3,0,0,12,4,0,5,105,116,101,109,
-,0,0,0,10,1,4,3,15,2,3,0,30,5,1,38,
-,32,32,32,97,100,118,97,110,99,101,40,39,58,39,41,
-,0,0,0,12,5,0,7,97,100,118,97,110,99,101,0,
-,4,5,0,12,5,0,1,58,0,0,0,31,3,5,1,
-,3,4,3,30,4,1,39,32,32,32,32,98,32,61,32,
-,108,111,99,107,40,41,0,12,6,0,5,98,108,111,99,
-,0,0,0,13,5,6,0,31,4,0,0,19,4,5,4,
-,3,4,0,30,5,1,40,32,32,32,32,105,116,101,109,
-,46,97,112,112,101,110,100,40,98,41,0,12,6,0,6,
-,112,112,101,110,100,0,0,9,5,2,6,15,6,3,0,
-,4,6,1,19,4,5,4,30,9,1,41,32,32,32,32,
-,104,105,108,101,32,99,104,101,99,107,40,80,46,116,111,
-,101,110,44,39,101,120,99,101,112,116,39,41,58,0,0,
-,6,0,5,99,104,101,99,107,0,0,0,13,5,6,0,
-,8,0,1,80,0,0,0,13,6,8,0,12,8,0,5,
-,111,107,101,110,0,0,0,9,6,6,8,12,7,0,6,
-,120,99,101,112,116,0,0,31,4,6,2,19,4,5,4,
-,4,0,0,18,0,0,179,30,6,1,42,32,32,32,32,
-,32,32,32,116,111,107,32,61,32,80,46,116,111,107,101,
-,0,0,0,12,6,0,1,80,0,0,0,13,5,6,0,
-,6,0,5,116,111,107,101,110,0,0,0,9,5,5,6,
-,4,5,0,30,7,1,43,32,32,32,32,32,32,32,32,
-,100,118,97,110,99,101,40,39,101,120,99,101,112,116,39,
-,0,0,0,12,7,0,7,97,100,118,97,110,99,101,0,
-,6,7,0,12,7,0,6,101,120,99,101,112,116,0,0,
-,5,7,1,19,5,6,5,30,14,1,44,32,32,32,32,
-,32,32,32,105,102,32,110,111,116,32,99,104,101,99,107,
-,80,46,116,111,107,101,110,44,39,58,39,41,58,32,97,
-,61,32,101,120,112,114,101,115,115,105,111,110,40,48,41,
-,0,0,0,12,8,0,5,99,104,101,99,107,0,0,0,
-,7,8,0,12,10,0,1,80,0,0,0,13,8,10,0,
-,10,0,5,116,111,107,101,110,0,0,0,9,8,8,10,
-,9,0,1,58,0,0,0,31,6,8,2,19,6,7,6,
-,5,6,0,21,5,0,0,18,0,0,13,12,8,0,10,
-,120,112,114,101,115,115,105,111,110,0,0,13,7,8,0,
-,8,0,0,0,0,0,0,0,0,0,0,31,6,8,1,
-,6,7,6,15,5,6,0,18,0,0,32,30,13,1,45,
-,32,32,32,32,32,32,32,101,108,115,101,58,32,97,32,
-,32,84,111,107,101,110,40,116,111,107,46,112,111,115,44,
-,115,121,109,98,111,108,39,44,39,78,111,110,101,39,41,
-,0,0,0,12,8,0,5,84,111,107,101,110,0,0,0,
+,36,35,0,16,36,0,233,44,16,0,0,28,2,0,0,
+,1,0,2,27,3,0,0,12,4,0,5,105,116,101,109,
+,0,0,0,10,1,4,3,15,2,3,0,12,5,0,7,
+,100,118,97,110,99,101,0,13,4,5,0,12,5,0,1,
+,0,0,0,31,3,5,1,19,3,4,3,12,6,0,5,
+,108,111,99,107,0,0,0,13,5,6,0,31,4,0,0,
+,4,5,4,15,3,4,0,12,6,0,6,97,112,112,101,
+,100,0,0,9,5,2,6,15,6,3,0,31,4,6,1,
+,4,5,4,12,6,0,5,99,104,101,99,107,0,0,0,
+,5,6,0,12,8,0,1,80,0,0,0,13,6,8,0,
+,8,0,5,116,111,107,101,110,0,0,0,9,6,6,8,
+,7,0,6,101,120,99,101,112,116,0,0,31,4,6,2,
+,4,5,4,21,4,0,0,18,0,0,108,12,6,0,1,
+,0,0,0,13,5,6,0,12,6,0,5,116,111,107,101,
+,0,0,0,9,5,5,6,15,4,5,0,12,7,0,7,
+,100,118,97,110,99,101,0,13,6,7,0,12,7,0,6,
+,120,99,101,112,116,0,0,31,5,7,1,19,5,6,5,
+,5,0,0,0,0,0,0,0,0,0,0,12,8,0,5,
+,104,101,99,107,0,0,0,13,7,8,0,12,10,0,1,
+,0,0,0,13,8,10,0,12,10,0,5,116,111,107,101,
+,0,0,0,9,8,8,10,12,9,0,1,58,0,0,0,
+,6,8,2,19,6,7,6,23,5,5,6,21,5,0,0,
+,0,0,13,12,8,0,10,101,120,112,114,101,115,115,105,
+,110,0,0,13,7,8,0,11,8,0,0,0,0,0,0,
+,0,0,0,31,6,8,1,19,6,7,6,15,5,6,0,
+,0,0,18,12,8,0,5,84,111,107,101,110,0,0,0,
 ,7,8,0,12,11,0,3,112,111,115,0,9,8,4,11,
 ,9,0,6,115,121,109,98,111,108,0,0,12,10,0,4,
 ,111,110,101,0,0,0,0,31,6,8,3,19,6,7,6,
-,5,6,0,18,0,0,1,30,6,1,46,32,32,32,32,
-,32,32,32,97,100,118,97,110,99,101,40,39,58,39,41,
-,0,0,0,12,8,0,7,97,100,118,97,110,99,101,0,
+,5,6,0,18,0,0,1,12,8,0,7,97,100,118,97,
+,99,101,0,13,7,8,0,12,8,0,1,58,0,0,0,
+,6,8,1,19,6,7,6,12,8,0,5,98,108,111,99,
+,0,0,0,13,7,8,0,31,6,0,0,19,6,7,6,
+,3,6,0,12,8,0,6,97,112,112,101,110,100,0,0,
+,7,2,8,12,10,0,5,84,111,107,101,110,0,0,0,
+,9,10,0,12,14,0,3,112,111,115,0,9,10,4,14,
+,11,0,6,101,120,99,101,112,116,0,0,12,12,0,6,
+,120,99,101,112,116,0,0,15,14,5,0,15,15,3,0,
+,13,14,2,31,8,10,4,19,8,9,8,31,6,8,1,
+,6,7,6,18,0,255,132,12,8,0,5,99,104,101,99,
+,0,0,0,13,7,8,0,12,10,0,1,80,0,0,0,
+,8,10,0,12,10,0,5,116,111,107,101,110,0,0,0,
+,8,8,10,12,9,0,4,101,108,115,101,0,0,0,0,
+,6,8,2,19,6,7,6,21,6,0,0,18,0,0,57,
+,7,0,1,80,0,0,0,13,6,7,0,12,7,0,5,
+,111,107,101,110,0,0,0,9,6,6,7,15,4,6,0,
+,8,0,7,97,100,118,97,110,99,101,0,13,7,8,0,
+,8,0,4,101,108,115,101,0,0,0,0,31,6,8,1,
+,6,7,6,12,8,0,7,97,100,118,97,110,99,101,0,
 ,7,8,0,12,8,0,1,58,0,0,0,31,6,8,1,
-,6,7,6,30,5,1,47,32,32,32,32,32,32,32,32,
-,32,61,32,98,108,111,99,107,40,41,0,12,8,0,5,
-,108,111,99,107,0,0,0,13,7,8,0,31,6,0,0,
-,6,7,6,15,3,6,0,30,16,1,48,32,32,32,32,
-,32,32,32,105,116,101,109,115,46,97,112,112,101,110,100,
-,84,111,107,101,110,40,116,111,107,46,112,111,115,44,39,
-,120,99,101,112,116,39,44,39,101,120,99,101,112,116,39,
-,91,97,44,98,93,41,41,0,0,0,0,12,8,0,6,
-,112,112,101,110,100,0,0,9,7,2,8,12,10,0,5,
-,111,107,101,110,0,0,0,13,9,10,0,12,14,0,3,
-,111,115,0,9,10,4,14,12,11,0,6,101,120,99,101,
-,116,0,0,12,12,0,6,101,120,99,101,112,116,0,0,
-,14,5,0,15,15,3,0,27,13,14,2,31,8,10,4,
-,8,9,8,31,6,8,1,19,6,7,6,18,0,255,61,
-,4,1,56,32,32,32,32,114,101,116,117,114,110,32,116,
-,0,0,0,20,1,0,0,0,0,0,0,12,37,0,7,
-,114,121,95,110,117,100,0,14,37,36,0,30,5,1,57,
-,101,102,32,112,114,101,102,105,120,95,110,117,100,40,116,
-,58,0,0,16,37,0,59,44,7,0,0,30,5,1,57,
-,101,102,32,112,114,101,102,105,120,95,110,117,100,40,116,
-,58,0,0,12,1,0,13,99,111,114,101,47,112,97,114,
-,101,46,112,121,0,0,0,33,1,0,0,12,1,0,10,
-,114,101,102,105,120,95,110,117,100,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,30,4,1,60,32,32,32,32,
-,112,32,61,32,116,46,98,112,0,0,0,12,4,0,2,
-,112,0,0,9,3,1,4,15,2,3,0,30,8,1,61,
-,32,32,32,116,46,105,116,101,109,115,32,61,32,91,101,
-,112,114,101,115,115,105,111,110,40,98,112,41,93,0,0,
-,6,0,10,101,120,112,114,101,115,115,105,111,110,0,0,
-,5,6,0,15,6,2,0,31,4,6,1,19,4,5,4,
-,3,4,1,12,4,0,5,105,116,101,109,115,0,0,0,
-,1,4,3,30,4,1,62,32,32,32,32,114,101,116,117,
-,110,32,116,0,0,0,0,20,1,0,0,0,0,0,0,
-,38,0,10,112,114,101,102,105,120,95,110,117,100,0,0,
-,38,37,0,30,5,1,63,100,101,102,32,112,114,101,102,
-,120,95,110,117,100,48,40,116,41,58,0,16,38,0,80,
-,10,0,0,30,5,1,63,100,101,102,32,112,114,101,102,
-,120,95,110,117,100,48,40,116,41,58,0,12,1,0,13,
-,111,114,101,47,112,97,114,115,101,46,112,121,0,0,0,
-,1,0,0,12,1,0,11,112,114,101,102,105,120,95,110,
-,100,48,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,14,1,64,32,32,32,32,105,102,32,99,104,101,99,107,
-,80,46,116,111,107,101,110,44,39,110,108,39,44,39,59,
-,44,39,101,111,102,39,44,39,100,101,100,101,110,116,39,
-,58,32,114,101,116,117,114,110,32,116,0,12,4,0,5,
-,104,101,99,107,0,0,0,13,3,4,0,12,9,0,1,
-,0,0,0,13,4,9,0,12,9,0,5,116,111,107,101,
-,0,0,0,9,4,4,9,12,5,0,2,110,108,0,0,
-,6,0,1,59,0,0,0,12,7,0,3,101,111,102,0,
-,8,0,6,100,101,100,101,110,116,0,0,31,2,4,5,
-,2,3,2,21,2,0,0,18,0,0,3,20,1,0,0,
-,0,0,1,30,7,1,65,32,32,32,32,114,101,116,117,
-,110,32,112,114,101,102,105,120,95,110,117,100,40,116,41,
-,0,0,0,12,4,0,10,112,114,101,102,105,120,95,110,
-,100,0,0,13,3,4,0,15,4,1,0,31,2,4,1,
-,2,3,2,20,2,0,0,0,0,0,0,12,39,0,11,
-,114,101,102,105,120,95,110,117,100,48,0,14,39,38,0,
-,5,1,66,100,101,102,32,112,114,101,102,105,120,95,110,
-,100,115,40,116,41,58,0,16,39,0,60,44,8,0,0,
-,5,1,66,100,101,102,32,112,114,101,102,105,120,95,110,
-,100,115,40,116,41,58,0,12,1,0,13,99,111,114,101,
-,112,97,114,115,101,46,112,121,0,0,0,33,1,0,0,
-,1,0,11,112,114,101,102,105,120,95,110,117,100,115,0,
-,1,0,0,28,2,0,0,9,1,0,2,30,6,1,67,
-,32,32,32,114,32,61,32,101,120,112,114,101,115,115,105,
-,110,40,48,41,0,0,0,12,5,0,10,101,120,112,114,
-,115,115,105,111,110,0,0,13,4,5,0,11,5,0,0,
-,0,0,0,0,0,0,0,31,3,5,1,19,3,4,3,
-,2,3,0,30,7,1,68,32,32,32,32,114,101,116,117,
-,110,32,105,108,115,116,40,116,46,116,121,112,101,44,114,
-,0,0,0,12,5,0,4,105,108,115,116,0,0,0,0,
-,4,5,0,12,7,0,4,116,121,112,101,0,0,0,0,
-,5,1,7,15,6,2,0,31,3,5,2,19,3,4,3,
-,3,0,0,0,0,0,0,12,40,0,11,112,114,101,102,
-,120,95,110,117,100,115,0,14,40,39,0,30,5,1,70,
-,101,102,32,112,114,101,102,105,120,95,110,101,103,40,116,
-,58,0,0,16,40,0,135,44,11,0,0,30,5,1,70,
-,101,102,32,112,114,101,102,105,120,95,110,101,103,40,116,
-,58,0,0,12,1,0,13,99,111,114,101,47,112,97,114,
-,101,46,112,121,0,0,0,33,1,0,0,12,1,0,10,
-,114,101,102,105,120,95,110,101,103,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,30,6,1,71,32,32,32,32,
-,32,61,32,101,120,112,114,101,115,115,105,111,110,40,53,
-,41,0,0,12,5,0,10,101,120,112,114,101,115,115,105,
-,110,0,0,13,4,5,0,11,5,0,0,0,0,0,0,
-,0,73,64,31,3,5,1,19,3,4,3,15,2,3,0,
-,7,1,72,32,32,32,32,105,102,32,114,46,116,121,112,
-,32,61,61,32,39,110,117,109,98,101,114,39,58,0,0,
-,4,0,4,116,121,112,101,0,0,0,0,9,3,2,4,
-,4,0,6,110,117,109,98,101,114,0,0,23,3,3,4,
-,3,0,0,18,0,0,40,30,9,1,73,32,32,32,32,
-,32,32,32,114,46,118,97,108,32,61,32,115,116,114,40,
-,102,108,111,97,116,40,114,46,118,97,108,41,41,0,0,
-,5,0,3,115,116,114,0,13,4,5,0,11,5,0,0,
-,0,0,0,0,0,0,0,12,8,0,5,102,108,111,97,
-,0,0,0,13,7,8,0,12,9,0,3,118,97,108,0,
-,8,2,9,31,6,8,1,19,6,7,6,2,5,5,6,
-,3,5,1,19,3,4,3,12,4,0,3,118,97,108,0,
-,2,4,3,30,5,1,74,32,32,32,32,32,32,32,32,
-,101,116,117,114,110,32,114,0,0,0,0,20,2,0,0,
-,0,0,1,30,11,1,75,32,32,32,32,116,46,105,116,
-,109,115,32,61,32,91,84,111,107,101,110,40,116,46,112,
-,115,44,39,110,117,109,98,101,114,39,44,39,48,39,41,
-,114,93,0,12,7,0,5,84,111,107,101,110,0,0,0,
-,6,7,0,12,10,0,3,112,111,115,0,9,7,1,10,
-,8,0,6,110,117,109,98,101,114,0,0,12,9,0,1,
-,0,0,0,31,4,7,3,19,4,6,4,15,5,2,0,
-,3,4,2,12,4,0,5,105,116,101,109,115,0,0,0,
-,1,4,3,30,4,1,76,32,32,32,32,114,101,116,117,
-,110,32,116,0,0,0,0,20,1,0,0,0,0,0,0,
-,41,0,10,112,114,101,102,105,120,95,110,101,103,0,0,
-,41,40,0,30,5,1,77,100,101,102,32,118,97,114,103,
-,95,110,117,100,40,116,41,58,0,0,0,16,41,0,67,
-,6,0,0,30,5,1,77,100,101,102,32,118,97,114,103,
-,95,110,117,100,40,116,41,58,0,0,0,12,1,0,13,
-,111,114,101,47,112,97,114,115,101,46,112,121,0,0,0,
-,1,0,0,12,1,0,9,118,97,114,103,115,95,110,117,
-,0,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,6,1,78,32,32,32,32,114,32,61,32,112,114,101,102,
-,120,95,110,117,100,40,116,41,0,0,0,12,5,0,10,
+,6,7,6,12,8,0,5,98,108,111,99,107,0,0,0,
+,7,8,0,31,6,0,0,19,6,7,6,15,3,6,0,
+,8,0,6,97,112,112,101,110,100,0,0,9,7,2,8,
+,10,0,5,84,111,107,101,110,0,0,0,13,9,10,0,
+,14,0,3,112,111,115,0,9,10,4,14,12,11,0,4,
+,108,115,101,0,0,0,0,12,12,0,4,101,108,115,101,
+,0,0,0,15,14,3,0,27,13,14,1,31,8,10,4,
+,8,9,8,31,6,8,1,19,6,7,6,18,0,0,1,
+,1,0,0,0,0,0,0,12,37,0,7,116,114,121,95,
+,117,100,0,14,37,36,0,16,37,0,23,44,7,0,0,
+,2,0,0,9,1,0,2,12,4,0,2,98,112,0,0,
+,3,1,4,15,2,3,0,12,6,0,10,101,120,112,114,
+,115,115,105,111,110,0,0,13,5,6,0,15,6,2,0,
+,4,6,1,19,4,5,4,27,3,4,1,12,4,0,5,
+,116,101,109,115,0,0,0,10,1,4,3,20,1,0,0,
+,0,0,0,12,38,0,10,112,114,101,102,105,120,95,110,
+,100,0,0,14,38,37,0,16,38,0,40,44,10,0,0,
+,2,0,0,9,1,0,2,12,4,0,5,99,104,101,99,
+,0,0,0,13,3,4,0,12,9,0,1,80,0,0,0,
+,4,9,0,12,9,0,5,116,111,107,101,110,0,0,0,
+,4,4,9,12,5,0,2,110,108,0,0,12,6,0,1,
+,0,0,0,12,7,0,3,101,111,102,0,12,8,0,6,
+,101,100,101,110,116,0,0,31,2,4,5,19,2,3,2,
+,2,0,0,18,0,0,3,20,1,0,0,18,0,0,1,
+,4,0,10,112,114,101,102,105,120,95,110,117,100,0,0,
+,3,4,0,15,4,1,0,31,2,4,1,19,2,3,2,
+,2,0,0,0,0,0,0,12,39,0,11,112,114,101,102,
+,120,95,110,117,100,48,0,14,39,38,0,16,39,0,28,
+,8,0,0,28,2,0,0,9,1,0,2,12,5,0,10,
+,120,112,114,101,115,115,105,111,110,0,0,13,4,5,0,
+,5,0,0,0,0,0,0,0,0,0,0,31,3,5,1,
+,3,4,3,15,2,3,0,12,5,0,4,105,108,115,116,
+,0,0,0,13,4,5,0,12,7,0,4,116,121,112,101,
+,0,0,0,9,5,1,7,15,6,2,0,31,3,5,2,
+,3,4,3,20,3,0,0,0,0,0,0,12,40,0,11,
+,114,101,102,105,120,95,110,117,100,115,0,14,40,39,0,
+,40,0,70,44,11,0,0,28,2,0,0,9,1,0,2,
+,5,0,10,101,120,112,114,101,115,115,105,111,110,0,0,
+,4,5,0,11,5,0,0,0,0,0,0,0,0,73,64,
+,3,5,1,19,3,4,3,15,2,3,0,12,4,0,4,
+,121,112,101,0,0,0,0,9,3,2,4,12,4,0,6,
+,117,109,98,101,114,0,0,23,3,3,4,21,3,0,0,
+,0,0,24,12,5,0,3,115,116,114,0,13,4,5,0,
+,5,0,0,0,0,0,0,0,0,0,0,12,8,0,5,
+,108,111,97,116,0,0,0,13,7,8,0,12,9,0,3,
+,97,108,0,9,8,2,9,31,6,8,1,19,6,7,6,
+,5,5,6,31,3,5,1,19,3,4,3,12,4,0,3,
+,97,108,0,10,2,4,3,20,2,0,0,18,0,0,1,
+,7,0,5,84,111,107,101,110,0,0,0,13,6,7,0,
+,10,0,3,112,111,115,0,9,7,1,10,12,8,0,6,
+,117,109,98,101,114,0,0,12,9,0,1,48,0,0,0,
+,4,7,3,19,4,6,4,15,5,2,0,27,3,4,2,
+,4,0,5,105,116,101,109,115,0,0,0,10,1,4,3,
+,1,0,0,0,0,0,0,12,41,0,10,112,114,101,102,
+,120,95,110,101,103,0,0,14,41,40,0,16,41,0,27,
+,6,0,0,28,2,0,0,9,1,0,2,12,5,0,10,
 ,114,101,102,105,120,95,110,117,100,0,0,13,4,5,0,
 ,5,1,0,31,3,5,1,19,3,4,3,15,2,3,0,
-,5,1,79,32,32,32,32,116,46,116,121,112,101,32,61,
-,39,97,114,103,115,39,0,12,3,0,4,97,114,103,115,
-,0,0,0,12,4,0,4,116,121,112,101,0,0,0,0,
-,1,4,3,30,4,1,80,32,32,32,32,116,46,118,97,
-,32,61,32,39,42,39,0,12,3,0,1,42,0,0,0,
-,4,0,3,118,97,108,0,10,1,4,3,30,4,1,81,
-,32,32,32,114,101,116,117,114,110,32,116,0,0,0,0,
+,3,0,4,97,114,103,115,0,0,0,0,12,4,0,4,
+,121,112,101,0,0,0,0,10,1,4,3,12,3,0,1,
+,0,0,0,12,4,0,3,118,97,108,0,10,1,4,3,
 ,1,0,0,0,0,0,0,12,42,0,9,118,97,114,103,
-,95,110,117,100,0,0,0,14,42,41,0,30,5,1,82,
-,101,102,32,110,97,114,103,115,95,110,117,100,40,116,41,
-,0,0,0,16,42,0,69,44,6,0,0,30,5,1,82,
-,101,102,32,110,97,114,103,115,95,110,117,100,40,116,41,
-,0,0,0,12,1,0,13,99,111,114,101,47,112,97,114,
-,101,46,112,121,0,0,0,33,1,0,0,12,1,0,9,
-,97,114,103,115,95,110,117,100,0,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,30,6,1,83,32,32,32,32,
-,32,61,32,112,114,101,102,105,120,95,110,117,100,40,116,
-,0,0,0,12,5,0,10,112,114,101,102,105,120,95,110,
-,100,0,0,13,4,5,0,15,5,1,0,31,3,5,1,
-,3,4,3,15,2,3,0,30,6,1,84,32,32,32,32,
-,46,116,121,112,101,32,61,32,39,110,97,114,103,115,39,
-,0,0,0,12,3,0,5,110,97,114,103,115,0,0,0,
-,4,0,4,116,121,112,101,0,0,0,0,10,1,4,3,
-,5,1,85,32,32,32,32,116,46,118,97,108,32,61,32,
-,42,42,39,0,0,0,0,12,3,0,2,42,42,0,0,
-,4,0,3,118,97,108,0,10,1,4,3,30,4,1,86,
-,32,32,32,114,101,116,117,114,110,32,116,0,0,0,0,
+,95,110,117,100,0,0,0,14,42,41,0,16,42,0,27,
+,6,0,0,28,2,0,0,9,1,0,2,12,5,0,10,
+,114,101,102,105,120,95,110,117,100,0,0,13,4,5,0,
+,5,1,0,31,3,5,1,19,3,4,3,15,2,3,0,
+,3,0,5,110,97,114,103,115,0,0,0,12,4,0,4,
+,121,112,101,0,0,0,0,10,1,4,3,12,3,0,2,
+,42,0,0,12,4,0,3,118,97,108,0,10,1,4,3,
 ,1,0,0,0,0,0,0,12,43,0,9,110,97,114,103,
-,95,110,117,100,0,0,0,14,43,42,0,30,4,1,89,
-,97,115,101,95,100,109,97,112,32,61,32,123,0,0,0,
-,43,0,9,98,97,115,101,95,100,109,97,112,0,0,0,
-,12,1,90,32,32,32,32,39,44,39,58,123,39,108,98,
-,39,58,50,48,44,39,98,112,39,58,50,48,44,39,108,
-,100,39,58,105,110,102,105,120,95,116,117,112,108,101,125,
-,0,0,0,12,45,0,1,44,0,0,0,12,103,0,3,
-,98,112,0,11,104,0,0,0,0,0,0,0,0,52,64,
-,105,0,2,98,112,0,0,11,106,0,0,0,0,0,0,
-,0,52,64,12,107,0,3,108,101,100,0,12,109,0,11,
-,110,102,105,120,95,116,117,112,108,101,0,13,108,109,0,
-,46,103,6,30,11,1,91,32,32,32,32,39,43,39,58,
-,39,108,98,112,39,58,53,48,44,39,98,112,39,58,53,
-,44,39,108,101,100,39,58,105,110,102,105,120,95,108,101,
-,125,44,0,12,47,0,1,43,0,0,0,12,103,0,3,
-,98,112,0,11,104,0,0,0,0,0,0,0,0,73,64,
-,105,0,2,98,112,0,0,11,106,0,0,0,0,0,0,
-,0,73,64,12,107,0,3,108,101,100,0,12,109,0,9,
-,110,102,105,120,95,108,101,100,0,0,0,13,108,109,0,
-,48,103,6,30,9,1,92,32,32,32,32,39,45,39,58,
-,39,108,98,112,39,58,53,48,44,39,110,117,100,39,58,
-,114,101,102,105,120,95,110,101,103,44,0,12,49,0,1,
+,95,110,117,100,0,0,0,14,43,42,0,12,43,0,9,
+,97,115,101,95,100,109,97,112,0,0,0,12,45,0,1,
+,0,0,0,12,103,0,3,108,98,112,0,11,104,0,0,
+,0,0,0,0,0,52,64,12,105,0,2,98,112,0,0,
+,106,0,0,0,0,0,0,0,0,52,64,12,107,0,3,
+,101,100,0,12,109,0,11,105,110,102,105,120,95,116,117,
+,108,101,0,13,108,109,0,26,46,103,6,12,47,0,1,
+,0,0,0,12,103,0,3,108,98,112,0,11,104,0,0,
+,0,0,0,0,0,73,64,12,105,0,2,98,112,0,0,
+,106,0,0,0,0,0,0,0,0,73,64,12,107,0,3,
+,101,100,0,12,109,0,9,105,110,102,105,120,95,108,101,
+,0,0,0,13,108,109,0,26,48,103,6,12,49,0,1,
 ,0,0,0,12,103,0,3,108,98,112,0,11,104,0,0,
 ,0,0,0,0,0,73,64,12,105,0,3,110,117,100,0,
 ,111,0,10,112,114,101,102,105,120,95,110,101,103,0,0,
-,106,111,0,30,9,1,93,32,32,32,32,32,32,32,32,
-,98,112,39,58,53,48,44,39,108,101,100,39,58,105,110,
-,105,120,95,108,101,100,125,44,0,0,0,12,107,0,2,
-,112,0,0,11,108,0,0,0,0,0,0,0,0,73,64,
-,109,0,3,108,101,100,0,12,111,0,9,105,110,102,105,
-,95,108,101,100,0,0,0,13,110,111,0,26,50,103,8,
-,12,1,94,32,32,32,32,39,110,111,116,39,58,123,39,
-,98,112,39,58,51,53,44,39,110,117,100,39,58,112,114,
-,102,105,120,95,110,117,100,44,39,98,112,39,58,51,53,
-,0,0,0,12,51,0,3,110,111,116,0,12,103,0,3,
-,98,112,0,11,104,0,0,0,0,0,0,0,128,65,64,
-,105,0,3,110,117,100,0,12,113,0,10,112,114,101,102,
-,120,95,110,117,100,0,0,13,106,113,0,12,107,0,2,
-,112,0,0,11,108,0,0,0,0,0,0,0,128,65,64,
-,9,1,95,32,32,32,32,32,32,32,32,39,98,112,39,
-,51,53,44,39,108,101,100,39,58,105,110,102,105,120,95,
-,111,116,32,125,44,0,0,12,109,0,2,98,112,0,0,
-,110,0,0,0,0,0,0,0,128,65,64,12,111,0,3,
-,101,100,0,12,113,0,9,105,110,102,105,120,95,110,111,
-,0,0,0,13,112,113,0,26,52,103,10,30,11,1,96,
-,32,32,32,39,37,39,58,123,39,108,98,112,39,58,54,
-,44,39,98,112,39,58,54,48,44,39,108,101,100,39,58,
-,110,102,105,120,95,108,101,100,125,44,0,12,53,0,1,
-,0,0,0,12,103,0,3,108,98,112,0,11,104,0,0,
-,0,0,0,0,0,78,64,12,105,0,2,98,112,0,0,
-,106,0,0,0,0,0,0,0,0,78,64,12,107,0,3,
-,101,100,0,12,109,0,9,105,110,102,105,120,95,108,101,
-,0,0,0,13,108,109,0,26,54,103,6,30,9,1,97,
-,32,32,32,39,42,39,58,123,39,108,98,112,39,58,54,
-,44,39,110,117,100,39,58,118,97,114,103,115,95,110,117,
-,44,0,0,12,55,0,1,42,0,0,0,12,103,0,3,
-,98,112,0,11,104,0,0,0,0,0,0,0,0,78,64,
-,105,0,3,110,117,100,0,12,111,0,9,118,97,114,103,
-,95,110,117,100,0,0,0,13,106,111,0,30,9,1,98,
-,32,32,32,32,32,32,32,39,98,112,39,58,54,48,44,
-,108,101,100,39,58,105,110,102,105,120,95,108,101,100,44,
-,44,0,0,12,107,0,2,98,112,0,0,11,108,0,0,
-,0,0,0,0,0,78,64,12,109,0,3,108,101,100,0,
+,106,111,0,12,107,0,2,98,112,0,0,11,108,0,0,
+,0,0,0,0,0,73,64,12,109,0,3,108,101,100,0,
 ,111,0,9,105,110,102,105,120,95,108,101,100,0,0,0,
-,110,111,0,26,56,103,8,30,10,1,99,32,32,32,32,
-,42,42,39,58,32,123,39,108,98,112,39,58,54,53,44,
-,110,117,100,39,58,110,97,114,103,115,95,110,117,100,44,
-,0,0,0,12,57,0,2,42,42,0,0,12,103,0,3,
-,98,112,0,11,104,0,0,0,0,0,0,0,64,80,64,
-,105,0,3,110,117,100,0,12,111,0,9,110,97,114,103,
-,95,110,117,100,0,0,0,13,106,111,0,30,9,1,100,
-,32,32,32,32,32,32,32,39,98,112,39,58,54,53,44,
-,108,101,100,39,58,105,110,102,105,120,95,108,101,100,44,
-,44,0,0,12,107,0,2,98,112,0,0,11,108,0,0,
-,0,0,0,0,64,80,64,12,109,0,3,108,101,100,0,
-,111,0,9,105,110,102,105,120,95,108,101,100,0,0,0,
-,110,111,0,26,58,103,8,30,11,1,101,32,32,32,32,
-,47,39,58,123,39,108,98,112,39,58,54,48,44,39,98,
-,39,58,54,48,44,39,108,101,100,39,58,105,110,102,105,
-,95,108,101,100,125,44,0,12,59,0,1,47,0,0,0,
+,110,111,0,26,50,103,8,12,51,0,3,110,111,116,0,
 ,103,0,3,108,98,112,0,11,104,0,0,0,0,0,0,
+,128,65,64,12,105,0,3,110,117,100,0,12,113,0,10,
+,114,101,102,105,120,95,110,117,100,0,0,13,106,113,0,
+,107,0,2,98,112,0,0,11,108,0,0,0,0,0,0,
+,128,65,64,12,109,0,2,98,112,0,0,11,110,0,0,
+,0,0,0,0,128,65,64,12,111,0,3,108,101,100,0,
+,113,0,9,105,110,102,105,120,95,110,111,116,0,0,0,
+,112,113,0,26,52,103,10,12,53,0,1,37,0,0,0,
+,103,0,3,108,98,112,0,11,104,0,0,0,0,0,0,
 ,0,78,64,12,105,0,2,98,112,0,0,11,106,0,0,
 ,0,0,0,0,0,78,64,12,107,0,3,108,101,100,0,
 ,109,0,9,105,110,102,105,120,95,108,101,100,0,0,0,
-,108,109,0,26,60,103,6,30,9,1,102,32,32,32,32,
-,40,39,58,123,39,108,98,112,39,58,55,48,44,39,110,
-,100,39,58,112,97,114,101,110,95,110,117,100,44,0,0,
+,108,109,0,26,54,103,6,12,55,0,1,42,0,0,0,
+,103,0,3,108,98,112,0,11,104,0,0,0,0,0,0,
+,0,78,64,12,105,0,3,110,117,100,0,12,111,0,9,
+,97,114,103,115,95,110,117,100,0,0,0,13,106,111,0,
+,107,0,2,98,112,0,0,11,108,0,0,0,0,0,0,
+,0,78,64,12,109,0,3,108,101,100,0,12,111,0,9,
+,110,102,105,120,95,108,101,100,0,0,0,13,110,111,0,
+,56,103,8,12,57,0,2,42,42,0,0,12,103,0,3,
+,98,112,0,11,104,0,0,0,0,0,0,0,64,80,64,
+,105,0,3,110,117,100,0,12,111,0,9,110,97,114,103,
+,95,110,117,100,0,0,0,13,106,111,0,12,107,0,2,
+,112,0,0,11,108,0,0,0,0,0,0,0,64,80,64,
+,109,0,3,108,101,100,0,12,111,0,9,105,110,102,105,
+,95,108,101,100,0,0,0,13,110,111,0,26,58,103,8,
+,59,0,1,47,0,0,0,12,103,0,3,108,98,112,0,
+,104,0,0,0,0,0,0,0,0,78,64,12,105,0,2,
+,112,0,0,11,106,0,0,0,0,0,0,0,0,78,64,
+,107,0,3,108,101,100,0,12,109,0,9,105,110,102,105,
+,95,108,101,100,0,0,0,13,108,109,0,26,60,103,6,
 ,61,0,1,40,0,0,0,12,103,0,3,108,98,112,0,
 ,104,0,0,0,0,0,0,0,128,81,64,12,105,0,3,
 ,117,100,0,12,111,0,9,112,97,114,101,110,95,110,117,
-,0,0,0,13,106,111,0,30,9,1,103,32,32,32,32,
-,32,32,32,39,98,112,39,58,56,48,44,39,108,101,100,
-,58,99,97,108,108,95,108,101,100,44,125,44,0,0,0,
-,107,0,2,98,112,0,0,11,108,0,0,0,0,0,0,
-,0,84,64,12,109,0,3,108,101,100,0,12,111,0,8,
-,97,108,108,95,108,101,100,0,0,0,0,13,110,111,0,
-,62,103,8,30,9,1,104,32,32,32,32,39,91,39,58,
-,39,108,98,112,39,58,55,48,44,39,110,117,100,39,58,
-,105,115,116,95,110,117,100,44,0,0,0,12,63,0,1,
+,0,0,0,13,106,111,0,12,107,0,2,98,112,0,0,
+,108,0,0,0,0,0,0,0,0,84,64,12,109,0,3,
+,101,100,0,12,111,0,8,99,97,108,108,95,108,101,100,
+,0,0,0,13,110,111,0,26,62,103,8,12,63,0,1,
 ,0,0,0,12,103,0,3,108,98,112,0,11,104,0,0,
 ,0,0,0,0,128,81,64,12,105,0,3,110,117,100,0,
 ,111,0,8,108,105,115,116,95,110,117,100,0,0,0,0,
-,106,111,0,30,9,1,105,32,32,32,32,32,32,32,32,
-,98,112,39,58,56,48,44,39,108,101,100,39,58,103,101,
-,95,108,101,100,44,125,44,0,0,0,0,12,107,0,2,
-,112,0,0,11,108,0,0,0,0,0,0,0,0,84,64,
-,109,0,3,108,101,100,0,12,111,0,7,103,101,116,95,
-,101,100,0,13,110,111,0,26,64,103,8,30,9,1,106,
-,32,32,32,39,123,39,58,123,39,108,98,112,39,58,48,
-,39,110,117,100,39,58,100,105,99,116,95,110,117,100,44,
-,44,0,0,12,65,0,1,123,0,0,0,12,103,0,3,
+,106,111,0,12,107,0,2,98,112,0,0,11,108,0,0,
+,0,0,0,0,0,84,64,12,109,0,3,108,101,100,0,
+,111,0,7,103,101,116,95,108,101,100,0,13,110,111,0,
+,64,103,8,12,65,0,1,123,0,0,0,12,103,0,3,
 ,98,112,0,11,104,0,0,0,0,0,0,0,0,0,0,
 ,105,0,3,110,117,100,0,12,107,0,8,100,105,99,116,
 ,110,117,100,0,0,0,0,13,106,107,0,26,66,103,4,
-,14,1,107,32,32,32,32,39,46,39,58,123,39,108,98,
-,39,58,56,48,44,39,98,112,39,58,56,48,44,39,108,
-,100,39,58,100,111,116,95,108,101,100,44,39,116,121,112,
-,39,58,39,103,101,116,39,44,125,44,0,12,67,0,1,
-,0,0,0,12,103,0,3,108,98,112,0,11,104,0,0,
-,0,0,0,0,0,84,64,12,105,0,2,98,112,0,0,
-,106,0,0,0,0,0,0,0,0,84,64,12,107,0,3,
-,101,100,0,12,111,0,7,100,111,116,95,108,101,100,0,
-,108,111,0,12,109,0,4,116,121,112,101,0,0,0,0,
-,110,0,3,103,101,116,0,26,68,103,8,30,13,1,108,
-,32,32,32,39,98,114,101,97,107,39,58,123,39,108,98,
-,39,58,48,44,39,110,117,100,39,58,105,116,115,101,108,
-,44,39,116,121,112,101,39,58,39,98,114,101,97,107,39,
-,44,0,0,12,69,0,5,98,114,101,97,107,0,0,0,
+,67,0,1,46,0,0,0,12,103,0,3,108,98,112,0,
+,104,0,0,0,0,0,0,0,0,84,64,12,105,0,2,
+,112,0,0,11,106,0,0,0,0,0,0,0,0,84,64,
+,107,0,3,108,101,100,0,12,111,0,7,100,111,116,95,
+,101,100,0,13,108,111,0,12,109,0,4,116,121,112,101,
+,0,0,0,12,110,0,3,103,101,116,0,26,68,103,8,
+,69,0,5,98,114,101,97,107,0,0,0,12,103,0,3,
+,98,112,0,11,104,0,0,0,0,0,0,0,0,0,0,
+,105,0,3,110,117,100,0,12,109,0,6,105,116,115,101,
+,102,0,0,13,106,109,0,12,107,0,4,116,121,112,101,
+,0,0,0,12,108,0,5,98,114,101,97,107,0,0,0,
+,70,103,6,12,71,0,4,112,97,115,115,0,0,0,0,
 ,103,0,3,108,98,112,0,11,104,0,0,0,0,0,0,
 ,0,0,0,12,105,0,3,110,117,100,0,12,109,0,6,
 ,116,115,101,108,102,0,0,13,106,109,0,12,107,0,4,
-,121,112,101,0,0,0,0,12,108,0,5,98,114,101,97,
-,0,0,0,26,70,103,6,30,13,1,109,32,32,32,32,
-,112,97,115,115,39,58,123,39,108,98,112,39,58,48,44,
-,110,117,100,39,58,105,116,115,101,108,102,44,39,116,121,
-,101,39,58,39,112,97,115,115,39,125,44,0,0,0,0,
-,71,0,4,112,97,115,115,0,0,0,0,12,103,0,3,
+,121,112,101,0,0,0,0,12,108,0,4,112,97,115,115,
+,0,0,0,26,72,103,6,12,73,0,8,99,111,110,116,
+,110,117,101,0,0,0,0,12,103,0,3,108,98,112,0,
+,104,0,0,0,0,0,0,0,0,0,0,12,105,0,3,
+,117,100,0,12,109,0,6,105,116,115,101,108,102,0,0,
+,106,109,0,12,107,0,4,116,121,112,101,0,0,0,0,
+,108,0,8,99,111,110,116,105,110,117,101,0,0,0,0,
+,74,103,6,12,75,0,3,101,111,102,0,12,103,0,3,
 ,98,112,0,11,104,0,0,0,0,0,0,0,0,0,0,
-,105,0,3,110,117,100,0,12,109,0,6,105,116,115,101,
-,102,0,0,13,106,109,0,12,107,0,4,116,121,112,101,
-,0,0,0,12,108,0,4,112,97,115,115,0,0,0,0,
-,72,103,6,30,15,1,110,32,32,32,32,39,99,111,110,
-,105,110,117,101,39,58,123,39,108,98,112,39,58,48,44,
-,110,117,100,39,58,105,116,115,101,108,102,44,39,116,121,
-,101,39,58,39,99,111,110,116,105,110,117,101,39,125,44,
-,0,0,0,12,73,0,8,99,111,110,116,105,110,117,101,
-,0,0,0,12,103,0,3,108,98,112,0,11,104,0,0,
-,0,0,0,0,0,0,0,12,105,0,3,110,117,100,0,
-,109,0,6,105,116,115,101,108,102,0,0,13,106,109,0,
-,107,0,4,116,121,112,101,0,0,0,0,12,108,0,8,
-,111,110,116,105,110,117,101,0,0,0,0,26,74,103,6,
-,12,1,111,32,32,32,32,39,101,111,102,39,58,123,39,
-,98,112,39,58,48,44,39,116,121,112,101,39,58,39,101,
-,102,39,44,39,118,97,108,39,58,39,101,111,102,39,125,
-,0,0,0,12,75,0,3,101,111,102,0,12,103,0,3,
-,98,112,0,11,104,0,0,0,0,0,0,0,0,0,0,
 ,105,0,4,116,121,112,101,0,0,0,0,12,106,0,3,
 ,111,102,0,12,107,0,3,118,97,108,0,12,108,0,3,
-,111,102,0,26,76,103,6,30,13,1,112,32,32,32,32,
-,100,101,102,39,58,123,39,108,98,112,39,58,48,44,39,
-,117,100,39,58,100,101,102,95,110,117,100,44,39,116,121,
-,101,39,58,39,100,101,102,39,44,125,44,0,0,0,0,
-,77,0,3,100,101,102,0,12,103,0,3,108,98,112,0,
-,104,0,0,0,0,0,0,0,0,0,0,12,105,0,3,
-,117,100,0,12,109,0,7,100,101,102,95,110,117,100,0,
-,106,109,0,12,107,0,4,116,121,112,101,0,0,0,0,
-,108,0,3,100,101,102,0,26,78,103,6,30,14,1,113,
-,32,32,32,39,119,104,105,108,101,39,58,123,39,108,98,
-,39,58,48,44,39,110,117,100,39,58,119,104,105,108,101,
-,110,117,100,44,39,116,121,112,101,39,58,39,119,104,105,
-,101,39,44,125,44,0,0,12,79,0,5,119,104,105,108,
-,0,0,0,12,103,0,3,108,98,112,0,11,104,0,0,
-,0,0,0,0,0,0,0,12,105,0,3,110,117,100,0,
-,109,0,9,119,104,105,108,101,95,110,117,100,0,0,0,
-,106,109,0,12,107,0,4,116,121,112,101,0,0,0,0,
-,108,0,5,119,104,105,108,101,0,0,0,26,80,103,6,
-,13,1,114,32,32,32,32,39,102,111,114,39,58,123,39,
-,98,112,39,58,48,44,39,110,117,100,39,58,102,111,114,
-,110,117,100,44,39,116,121,112,101,39,58,39,102,111,114,
-,44,125,44,0,0,0,0,12,81,0,3,102,111,114,0,
+,111,102,0,26,76,103,6,12,77,0,3,100,101,102,0,
 ,103,0,3,108,98,112,0,11,104,0,0,0,0,0,0,
 ,0,0,0,12,105,0,3,110,117,100,0,12,109,0,7,
-,111,114,95,110,117,100,0,13,106,109,0,12,107,0,4,
-,121,112,101,0,0,0,0,12,108,0,3,102,111,114,0,
-,82,103,6,30,13,1,115,32,32,32,32,39,116,114,121,
-,58,123,39,108,98,112,39,58,48,44,39,110,117,100,39,
-,116,114,121,95,110,117,100,44,39,116,121,112,101,39,58,
-,116,114,121,39,44,125,44,0,0,0,0,12,83,0,3,
-,114,121,0,12,103,0,3,108,98,112,0,11,104,0,0,
-,0,0,0,0,0,0,0,12,105,0,3,110,117,100,0,
-,109,0,7,116,114,121,95,110,117,100,0,13,106,109,0,
-,107,0,4,116,121,112,101,0,0,0,0,12,108,0,3,
-,114,121,0,26,84,103,6,30,12,1,116,32,32,32,32,
-,105,102,39,58,123,39,108,98,112,39,58,48,44,39,110,
-,100,39,58,105,102,95,110,117,100,44,39,116,121,112,101,
-,58,39,105,102,39,44,125,44,0,0,0,12,85,0,2,
-,102,0,0,12,103,0,3,108,98,112,0,11,104,0,0,
-,0,0,0,0,0,0,0,12,105,0,3,110,117,100,0,
-,109,0,6,105,102,95,110,117,100,0,0,13,106,109,0,
-,107,0,4,116,121,112,101,0,0,0,0,12,108,0,2,
-,102,0,0,26,86,103,6,30,14,1,117,32,32,32,32,
-,99,108,97,115,115,39,58,123,39,108,98,112,39,58,48,
-,39,110,117,100,39,58,99,108,97,115,115,95,110,117,100,
-,39,116,121,112,101,39,58,39,99,108,97,115,115,39,44,
-,44,0,0,12,87,0,5,99,108,97,115,115,0,0,0,
+,101,102,95,110,117,100,0,13,106,109,0,12,107,0,4,
+,121,112,101,0,0,0,0,12,108,0,3,100,101,102,0,
+,78,103,6,12,79,0,5,119,104,105,108,101,0,0,0,
 ,103,0,3,108,98,112,0,11,104,0,0,0,0,0,0,
 ,0,0,0,12,105,0,3,110,117,100,0,12,109,0,9,
-,108,97,115,115,95,110,117,100,0,0,0,13,106,109,0,
+,104,105,108,101,95,110,117,100,0,0,0,13,106,109,0,
 ,107,0,4,116,121,112,101,0,0,0,0,12,108,0,5,
-,108,97,115,115,0,0,0,26,88,103,6,30,17,1,118,
-,32,32,32,39,114,97,105,115,101,39,58,123,39,108,98,
-,39,58,48,44,39,110,117,100,39,58,112,114,101,102,105,
-,95,110,117,100,48,44,39,116,121,112,101,39,58,39,114,
-,105,115,101,39,44,39,98,112,39,58,50,48,44,125,44,
-,0,0,0,12,89,0,5,114,97,105,115,101,0,0,0,
+,104,105,108,101,0,0,0,26,80,103,6,12,81,0,3,
+,111,114,0,12,103,0,3,108,98,112,0,11,104,0,0,
+,0,0,0,0,0,0,0,12,105,0,3,110,117,100,0,
+,109,0,7,102,111,114,95,110,117,100,0,13,106,109,0,
+,107,0,4,116,121,112,101,0,0,0,0,12,108,0,3,
+,111,114,0,26,82,103,6,12,83,0,3,116,114,121,0,
 ,103,0,3,108,98,112,0,11,104,0,0,0,0,0,0,
-,0,0,0,12,105,0,3,110,117,100,0,12,111,0,11,
-,114,101,102,105,120,95,110,117,100,48,0,13,106,111,0,
-,107,0,4,116,121,112,101,0,0,0,0,12,108,0,5,
-,97,105,115,101,0,0,0,12,109,0,2,98,112,0,0,
-,110,0,0,0,0,0,0,0,0,52,64,26,90,103,8,
-,17,1,119,32,32,32,32,39,114,101,116,117,114,110,39,
-,123,39,108,98,112,39,58,48,44,39,110,117,100,39,58,
-,114,101,102,105,120,95,110,117,100,48,44,39,116,121,112,
-,39,58,39,114,101,116,117,114,110,39,44,39,98,112,39,
-,49,48,44,125,44,0,0,12,91,0,6,114,101,116,117,
-,110,0,0,12,103,0,3,108,98,112,0,11,104,0,0,
+,0,0,0,12,105,0,3,110,117,100,0,12,109,0,7,
+,114,121,95,110,117,100,0,13,106,109,0,12,107,0,4,
+,121,112,101,0,0,0,0,12,108,0,3,116,114,121,0,
+,84,103,6,12,85,0,2,105,102,0,0,12,103,0,3,
+,98,112,0,11,104,0,0,0,0,0,0,0,0,0,0,
+,105,0,3,110,117,100,0,12,109,0,6,105,102,95,110,
+,100,0,0,13,106,109,0,12,107,0,4,116,121,112,101,
+,0,0,0,12,108,0,2,105,102,0,0,26,86,103,6,
+,87,0,5,99,108,97,115,115,0,0,0,12,103,0,3,
+,98,112,0,11,104,0,0,0,0,0,0,0,0,0,0,
+,105,0,3,110,117,100,0,12,109,0,9,99,108,97,115,
+,95,110,117,100,0,0,0,13,106,109,0,12,107,0,4,
+,121,112,101,0,0,0,0,12,108,0,5,99,108,97,115,
+,0,0,0,26,88,103,6,12,89,0,5,114,97,105,115,
+,0,0,0,12,103,0,3,108,98,112,0,11,104,0,0,
 ,0,0,0,0,0,0,0,12,105,0,3,110,117,100,0,
 ,111,0,11,112,114,101,102,105,120,95,110,117,100,48,0,
 ,106,111,0,12,107,0,4,116,121,112,101,0,0,0,0,
-,108,0,6,114,101,116,117,114,110,0,0,12,109,0,2,
-,112,0,0,11,110,0,0,0,0,0,0,0,0,36,64,
-,92,103,8,30,17,1,120,32,32,32,32,39,105,109,112,
-,114,116,39,58,123,39,108,98,112,39,58,48,44,39,110,
-,100,39,58,112,114,101,102,105,120,95,110,117,100,115,44,
-,116,121,112,101,39,58,39,105,109,112,111,114,116,39,44,
-,98,112,39,58,50,48,44,125,44,0,0,12,93,0,6,
-,109,112,111,114,116,0,0,12,103,0,3,108,98,112,0,
+,108,0,5,114,97,105,115,101,0,0,0,12,109,0,2,
+,112,0,0,11,110,0,0,0,0,0,0,0,0,52,64,
+,90,103,8,12,91,0,6,114,101,116,117,114,110,0,0,
+,103,0,3,108,98,112,0,11,104,0,0,0,0,0,0,
+,0,0,0,12,105,0,3,110,117,100,0,12,111,0,11,
+,114,101,102,105,120,95,110,117,100,48,0,13,106,111,0,
+,107,0,4,116,121,112,101,0,0,0,0,12,108,0,6,
+,101,116,117,114,110,0,0,12,109,0,2,98,112,0,0,
+,110,0,0,0,0,0,0,0,0,36,64,26,92,103,8,
+,93,0,6,105,109,112,111,114,116,0,0,12,103,0,3,
+,98,112,0,11,104,0,0,0,0,0,0,0,0,0,0,
+,105,0,3,110,117,100,0,12,111,0,11,112,114,101,102,
+,120,95,110,117,100,115,0,13,106,111,0,12,107,0,4,
+,121,112,101,0,0,0,0,12,108,0,6,105,109,112,111,
+,116,0,0,12,109,0,2,98,112,0,0,11,110,0,0,
+,0,0,0,0,0,52,64,26,94,103,8,12,95,0,4,
+,114,111,109,0,0,0,0,12,103,0,3,108,98,112,0,
 ,104,0,0,0,0,0,0,0,0,0,0,12,105,0,3,
-,117,100,0,12,111,0,11,112,114,101,102,105,120,95,110,
-,100,115,0,13,106,111,0,12,107,0,4,116,121,112,101,
-,0,0,0,12,108,0,6,105,109,112,111,114,116,0,0,
+,117,100,0,12,111,0,8,102,114,111,109,95,110,117,100,
+,0,0,0,13,106,111,0,12,107,0,4,116,121,112,101,
+,0,0,0,12,108,0,4,102,114,111,109,0,0,0,0,
 ,109,0,2,98,112,0,0,11,110,0,0,0,0,0,0,
-,0,52,64,26,94,103,8,30,15,1,121,32,32,32,32,
-,102,114,111,109,39,58,123,39,108,98,112,39,58,48,44,
-,110,117,100,39,58,102,114,111,109,95,110,117,100,44,39,
-,121,112,101,39,58,39,102,114,111,109,39,44,39,98,112,
-,58,50,48,44,125,44,0,12,95,0,4,102,114,111,109,
-,0,0,0,12,103,0,3,108,98,112,0,11,104,0,0,
-,0,0,0,0,0,0,0,12,105,0,3,110,117,100,0,
-,111,0,8,102,114,111,109,95,110,117,100,0,0,0,0,
-,106,111,0,12,107,0,4,116,121,112,101,0,0,0,0,
-,108,0,4,102,114,111,109,0,0,0,0,12,109,0,2,
-,112,0,0,11,110,0,0,0,0,0,0,0,0,52,64,
-,96,103,8,30,16,1,122,32,32,32,32,39,100,101,108,
-,58,123,39,108,98,112,39,58,48,44,39,110,117,100,39,
-,112,114,101,102,105,120,95,110,117,100,115,44,39,116,121,
-,101,39,58,39,100,101,108,39,44,39,98,112,39,58,49,
-,44,125,44,0,0,0,0,12,97,0,3,100,101,108,0,
+,0,52,64,26,96,103,8,12,97,0,3,100,101,108,0,
 ,103,0,3,108,98,112,0,11,104,0,0,0,0,0,0,
 ,0,0,0,12,105,0,3,110,117,100,0,12,111,0,11,
 ,114,101,102,105,120,95,110,117,100,115,0,13,106,111,0,
 ,107,0,4,116,121,112,101,0,0,0,0,12,108,0,3,
 ,101,108,0,12,109,0,2,98,112,0,0,11,110,0,0,
-,0,0,0,0,0,36,64,26,98,103,8,30,17,1,123,
-,32,32,32,39,103,108,111,98,97,108,39,58,123,39,108,
-,112,39,58,48,44,39,110,117,100,39,58,112,114,101,102,
-,120,95,110,117,100,115,44,39,116,121,112,101,39,58,39,
-,108,111,98,97,108,115,39,44,39,98,112,39,58,50,48,
-,125,44,0,12,99,0,6,103,108,111,98,97,108,0,0,
+,0,0,0,0,0,36,64,26,98,103,8,12,99,0,6,
+,108,111,98,97,108,0,0,12,103,0,3,108,98,112,0,
+,104,0,0,0,0,0,0,0,0,0,0,12,105,0,3,
+,117,100,0,12,111,0,11,112,114,101,102,105,120,95,110,
+,100,115,0,13,106,111,0,12,107,0,4,116,121,112,101,
+,0,0,0,12,108,0,7,103,108,111,98,97,108,115,0,
+,109,0,2,98,112,0,0,11,110,0,0,0,0,0,0,
+,0,52,64,26,100,103,8,12,101,0,1,61,0,0,0,
 ,103,0,3,108,98,112,0,11,104,0,0,0,0,0,0,
-,0,0,0,12,105,0,3,110,117,100,0,12,111,0,11,
-,114,101,102,105,120,95,110,117,100,115,0,13,106,111,0,
-,107,0,4,116,121,112,101,0,0,0,0,12,108,0,7,
-,108,111,98,97,108,115,0,12,109,0,2,98,112,0,0,
-,110,0,0,0,0,0,0,0,0,52,64,26,100,103,8,
-,3,1,125,32,32,32,32,39,61,39,58,123,0,0,0,
-,101,0,1,61,0,0,0,30,11,1,126,32,32,32,32,
-,32,32,32,39,108,98,112,39,58,49,48,44,39,98,112,
-,58,57,44,39,108,101,100,39,58,105,110,102,105,120,95,
-,101,100,44,0,0,0,0,12,103,0,3,108,98,112,0,
-,104,0,0,0,0,0,0,0,0,36,64,12,105,0,2,
-,112,0,0,11,106,0,0,0,0,0,0,0,0,34,64,
-,107,0,3,108,101,100,0,12,109,0,9,105,110,102,105,
-,95,108,101,100,0,0,0,13,108,109,0,26,102,103,6,
-,44,45,58,14,43,44,0,30,7,1,130,100,101,102,32,
-,95,105,110,102,105,120,40,98,112,44,108,101,100,44,42,
-,115,41,58,0,0,0,0,16,43,0,67,44,14,0,0,
-,7,1,130,100,101,102,32,105,95,105,110,102,105,120,40,
-,112,44,108,101,100,44,42,118,115,41,58,0,0,0,0,
-,1,0,13,99,111,114,101,47,112,97,114,115,101,46,112,
-,0,0,0,33,1,0,0,12,1,0,7,105,95,105,110,
-,105,120,0,34,1,0,0,28,2,0,0,9,1,0,2,
+,0,36,64,12,105,0,2,98,112,0,0,11,106,0,0,
+,0,0,0,0,0,34,64,12,107,0,3,108,101,100,0,
+,109,0,9,105,110,102,105,120,95,108,101,100,0,0,0,
+,108,109,0,26,102,103,6,26,44,45,58,14,43,44,0,
+,43,0,32,44,14,0,0,28,2,0,0,9,1,0,2,
 ,3,0,0,9,2,0,3,12,4,0,1,42,0,0,0,
-,3,0,4,30,16,1,131,32,32,32,32,102,111,114,32,
-,32,105,110,32,118,115,58,32,98,97,115,101,95,100,109,
-,112,91,118,93,32,61,32,123,39,108,98,112,39,58,98,
-,44,39,98,112,39,58,98,112,44,39,108,101,100,39,58,
-,101,100,125,0,0,0,0,11,5,0,0,0,0,0,0,
-,0,0,0,42,4,3,5,18,0,0,18,12,7,0,9,
-,97,115,101,95,100,109,97,112,0,0,0,13,6,7,0,
-,8,0,3,108,98,112,0,15,9,1,0,12,10,0,2,
-,112,0,0,15,11,1,0,12,12,0,3,108,101,100,0,
-,13,2,0,26,7,8,6,10,6,4,7,18,0,255,238,
-,0,0,0,12,44,0,7,105,95,105,110,102,105,120,0,
-,44,43,0,30,13,1,132,105,95,105,110,102,105,120,40,
-,48,44,105,110,102,105,120,95,108,101,100,44,39,60,39,
-,39,62,39,44,39,60,61,39,44,39,62,61,39,44,39,
-,61,39,44,39,61,61,39,41,0,0,0,12,46,0,7,
-,95,105,110,102,105,120,0,13,45,46,0,11,46,0,0,
-,0,0,0,0,0,68,64,12,54,0,9,105,110,102,105,
-,95,108,101,100,0,0,0,13,47,54,0,12,48,0,1,
-,0,0,0,12,49,0,1,62,0,0,0,12,50,0,2,
-,61,0,0,12,51,0,2,62,61,0,0,12,52,0,2,
-,61,0,0,12,53,0,2,61,61,0,0,31,44,46,8,
-,44,45,44,30,8,1,133,105,95,105,110,102,105,120,40,
-,48,44,105,110,102,105,120,95,105,115,44,39,105,115,39,
-,39,105,110,39,41,0,0,12,46,0,7,105,95,105,110,
+,3,0,4,11,5,0,0,0,0,0,0,0,0,0,0,
+,4,3,5,18,0,0,18,12,7,0,9,98,97,115,101,
+,100,109,97,112,0,0,0,13,6,7,0,12,8,0,3,
+,98,112,0,15,9,1,0,12,10,0,2,98,112,0,0,
+,11,1,0,12,12,0,3,108,101,100,0,15,13,2,0,
+,7,8,6,10,6,4,7,18,0,255,238,0,0,0,0,
+,44,0,7,105,95,105,110,102,105,120,0,14,44,43,0,
+,46,0,7,105,95,105,110,102,105,120,0,13,45,46,0,
+,46,0,0,0,0,0,0,0,0,68,64,12,54,0,9,
+,110,102,105,120,95,108,101,100,0,0,0,13,47,54,0,
+,48,0,1,60,0,0,0,12,49,0,1,62,0,0,0,
+,50,0,2,60,61,0,0,12,51,0,2,62,61,0,0,
+,52,0,2,33,61,0,0,12,53,0,2,61,61,0,0,
+,44,46,8,19,44,45,44,12,46,0,7,105,95,105,110,
 ,105,120,0,13,45,46,0,11,46,0,0,0,0,0,0,
 ,0,68,64,12,50,0,8,105,110,102,105,120,95,105,115,
 ,0,0,0,13,47,50,0,12,48,0,2,105,115,0,0,
 ,49,0,2,105,110,0,0,31,44,46,4,19,44,45,44,
-,15,1,134,105,95,105,110,102,105,120,40,49,48,44,105,
-,102,105,120,95,108,101,100,44,39,43,61,39,44,39,45,
-,39,44,39,42,61,39,44,39,47,61,39,44,32,39,38,
-,39,44,32,39,124,61,39,44,32,39,94,61,39,41,0,
 ,46,0,7,105,95,105,110,102,105,120,0,13,45,46,0,
-,46,0,0,0,0,0,0,0,0,36,64,12,55,0,9,
-,110,102,105,120,95,108,101,100,0,0,0,13,47,55,0,
+,46,0,0,0,0,0,0,0,0,36,64,12,52,0,9,
+,110,102,105,120,95,108,101,100,0,0,0,13,47,52,0,
 ,48,0,2,43,61,0,0,12,49,0,2,45,61,0,0,
 ,50,0,2,42,61,0,0,12,51,0,2,47,61,0,0,
-,52,0,2,38,61,0,0,12,53,0,2,124,61,0,0,
-,54,0,2,94,61,0,0,31,44,46,9,19,44,45,44,
-,8,1,135,105,95,105,110,102,105,120,40,51,50,44,105,
-,102,105,120,95,108,101,100,44,39,97,110,100,39,44,39,
-,39,41,0,12,46,0,7,105,95,105,110,102,105,120,0,
-,45,46,0,11,46,0,0,0,0,0,0,0,0,64,64,
-,50,0,9,105,110,102,105,120,95,108,101,100,0,0,0,
-,47,50,0,12,48,0,3,97,110,100,0,12,49,0,1,
-,0,0,0,31,44,46,4,19,44,45,44,30,7,1,136,
-,95,105,110,102,105,120,40,51,49,44,105,110,102,105,120,
-,108,101,100,44,39,94,39,41,0,0,0,12,46,0,7,
-,95,105,110,102,105,120,0,13,45,46,0,11,46,0,0,
-,0,0,0,0,0,63,64,12,49,0,9,105,110,102,105,
-,95,108,101,100,0,0,0,13,47,49,0,12,48,0,1,
-,0,0,0,31,44,46,3,19,44,45,44,30,8,1,137,
-,95,105,110,102,105,120,40,51,48,44,105,110,102,105,120,
-,108,101,100,44,39,111,114,39,44,39,124,39,41,0,0,
+,44,46,6,19,44,45,44,12,46,0,7,105,95,105,110,
+,105,120,0,13,45,46,0,11,46,0,0,0,0,0,0,
+,0,63,64,12,50,0,9,105,110,102,105,120,95,108,101,
+,0,0,0,13,47,50,0,12,48,0,3,97,110,100,0,
+,49,0,1,38,0,0,0,31,44,46,4,19,44,45,44,
 ,46,0,7,105,95,105,110,102,105,120,0,13,45,46,0,
 ,46,0,0,0,0,0,0,0,0,62,64,12,50,0,9,
 ,110,102,105,120,95,108,101,100,0,0,0,13,47,50,0,
 ,48,0,2,111,114,0,0,12,49,0,1,124,0,0,0,
-,44,46,4,19,44,45,44,30,8,1,138,105,95,105,110,
-,105,120,40,51,54,44,105,110,102,105,120,95,108,101,100,
-,39,60,60,39,44,39,62,62,39,41,0,12,46,0,7,
-,95,105,110,102,105,120,0,13,45,46,0,11,46,0,0,
-,0,0,0,0,0,66,64,12,50,0,9,105,110,102,105,
-,95,108,101,100,0,0,0,13,47,50,0,12,48,0,2,
-,60,0,0,12,49,0,2,62,62,0,0,31,44,46,4,
-,44,45,44,30,5,1,139,100,101,102,32,105,95,116,101,
-,109,115,40,42,118,115,41,58,0,0,0,16,44,0,61,
-,11,0,0,30,5,1,139,100,101,102,32,105,95,116,101,
-,109,115,40,42,118,115,41,58,0,0,0,12,1,0,13,
-,111,114,101,47,112,97,114,115,101,46,112,121,0,0,0,
-,1,0,0,12,1,0,7,105,95,116,101,114,109,115,0,
-,1,0,0,12,2,0,1,42,0,0,0,9,1,0,2,
-,14,1,140,32,32,32,32,102,111,114,32,118,32,105,110,
-,118,115,58,32,98,97,115,101,95,100,109,97,112,91,118,
-,32,61,32,123,39,108,98,112,39,58,48,44,39,110,117,
-,39,58,105,116,115,101,108,102,125,0,0,11,3,0,0,
-,0,0,0,0,0,0,0,42,2,1,3,18,0,0,20,
-,5,0,9,98,97,115,101,95,100,109,97,112,0,0,0,
-,4,5,0,12,6,0,3,108,98,112,0,11,7,0,0,
-,0,0,0,0,0,0,0,12,8,0,3,110,117,100,0,
-,10,0,6,105,116,115,101,108,102,0,0,13,9,10,0,
-,5,6,4,10,4,2,5,18,0,255,236,0,0,0,0,
-,45,0,7,105,95,116,101,114,109,115,0,14,45,44,0,
-,31,1,141,105,95,116,101,114,109,115,40,39,41,39,44,
-,125,39,44,39,93,39,44,39,59,39,44,39,58,39,44,
-,110,108,39,44,39,101,108,105,102,39,44,39,101,108,115,
-,39,44,39,84,114,117,101,39,44,39,70,97,108,115,101,
-,44,39,78,111,110,101,39,44,39,110,97,109,101,39,44,
-,115,116,114,105,110,103,39,44,39,110,117,109,98,101,114,
-,44,39,105,110,100,101,110,116,39,44,39,100,101,100,101,
-,116,39,44,39,101,120,99,101,112,116,39,41,0,0,0,
-,47,0,7,105,95,116,101,114,109,115,0,13,46,47,0,
-,47,0,1,41,0,0,0,12,48,0,1,125,0,0,0,
-,49,0,1,93,0,0,0,12,50,0,1,59,0,0,0,
-,51,0,1,58,0,0,0,12,52,0,2,110,108,0,0,
-,53,0,4,101,108,105,102,0,0,0,0,12,54,0,4,
-,108,115,101,0,0,0,0,12,55,0,4,84,114,117,101,
-,0,0,0,12,56,0,5,70,97,108,115,101,0,0,0,
-,57,0,4,78,111,110,101,0,0,0,0,12,58,0,4,
-,97,109,101,0,0,0,0,12,59,0,6,115,116,114,105,
-,103,0,0,12,60,0,6,110,117,109,98,101,114,0,0,
-,61,0,6,105,110,100,101,110,116,0,0,12,62,0,6,
-,101,100,101,110,116,0,0,12,63,0,6,101,120,99,101,
-,116,0,0,31,45,47,17,19,45,46,45,30,8,1,142,
-,97,115,101,95,100,109,97,112,91,39,110,108,39,93,91,
-,118,97,108,39,93,32,61,32,39,110,108,39,0,0,0,
-,46,0,9,98,97,115,101,95,100,109,97,112,0,0,0,
-,45,46,0,12,46,0,2,110,108,0,0,9,45,45,46,
-,46,0,2,110,108,0,0,12,47,0,3,118,97,108,0,
-,45,47,46,30,4,1,144,100,101,102,32,103,109,97,112,
-,116,44,118,41,58,0,0,16,45,0,76,44,7,0,0,
-,4,1,144,100,101,102,32,103,109,97,112,40,116,44,118,
-,58,0,0,12,1,0,13,99,111,114,101,47,112,97,114,
-,101,46,112,121,0,0,0,33,1,0,0,12,1,0,4,
-,109,97,112,0,0,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,28,3,0,0,9,2,0,3,30,6,1,145,
-,32,32,32,105,102,32,118,32,110,111,116,32,105,110,32,
-,109,97,112,58,0,0,0,12,4,0,4,100,109,97,112,
-,0,0,0,13,3,4,0,36,3,3,2,11,4,0,0,
-,0,0,0,0,0,0,0,23,3,3,4,21,3,0,0,
-,0,0,25,30,9,1,146,32,32,32,32,32,32,32,32,
-,114,114,111,114,40,39,117,110,107,110,111,119,110,32,34,
-,115,34,39,37,118,44,116,41,0,0,0,12,5,0,5,
+,44,46,4,19,44,45,44,12,46,0,7,105,95,105,110,
+,105,120,0,13,45,46,0,11,46,0,0,0,0,0,0,
+,0,66,64,12,50,0,9,105,110,102,105,120,95,108,101,
+,0,0,0,13,47,50,0,12,48,0,2,60,60,0,0,
+,49,0,2,62,62,0,0,31,44,46,4,19,44,45,44,
+,44,0,30,44,11,0,0,12,2,0,1,42,0,0,0,
+,1,0,2,11,3,0,0,0,0,0,0,0,0,0,0,
+,2,1,3,18,0,0,20,12,5,0,9,98,97,115,101,
+,100,109,97,112,0,0,0,13,4,5,0,12,6,0,3,
+,98,112,0,11,7,0,0,0,0,0,0,0,0,0,0,
+,8,0,3,110,117,100,0,12,10,0,6,105,116,115,101,
+,102,0,0,13,9,10,0,26,5,6,4,10,4,2,5,
+,0,255,236,0,0,0,0,12,45,0,7,105,95,116,101,
+,109,115,0,14,45,44,0,12,47,0,7,105,95,116,101,
+,109,115,0,13,46,47,0,12,47,0,1,41,0,0,0,
+,48,0,1,125,0,0,0,12,49,0,1,93,0,0,0,
+,50,0,1,59,0,0,0,12,51,0,1,58,0,0,0,
+,52,0,2,110,108,0,0,12,53,0,4,101,108,105,102,
+,0,0,0,12,54,0,4,101,108,115,101,0,0,0,0,
+,55,0,4,84,114,117,101,0,0,0,0,12,56,0,5,
+,97,108,115,101,0,0,0,12,57,0,4,78,111,110,101,
+,0,0,0,12,58,0,4,110,97,109,101,0,0,0,0,
+,59,0,6,115,116,114,105,110,103,0,0,12,60,0,6,
+,117,109,98,101,114,0,0,12,61,0,6,105,110,100,101,
+,116,0,0,12,62,0,6,100,101,100,101,110,116,0,0,
+,63,0,6,101,120,99,101,112,116,0,0,31,45,47,17,
+,45,46,45,12,46,0,9,98,97,115,101,95,100,109,97,
+,0,0,0,13,45,46,0,12,46,0,2,110,108,0,0,
+,45,45,46,12,46,0,2,110,108,0,0,12,47,0,3,
+,97,108,0,10,45,47,46,16,45,0,38,44,7,0,0,
+,2,0,0,9,1,0,2,28,3,0,0,9,2,0,3,
+,4,0,4,100,109,97,112,0,0,0,0,13,3,4,0,
+,3,3,2,11,4,0,0,0,0,0,0,0,0,0,0,
+,3,3,4,21,3,0,0,18,0,0,15,12,5,0,5,
 ,114,114,111,114,0,0,0,13,4,5,0,12,5,0,12,
 ,110,107,110,111,119,110,32,34,37,115,34,0,0,0,0,
 ,5,5,2,15,6,1,0,31,3,5,2,19,3,4,3,
-,0,0,1,30,5,1,147,32,32,32,32,114,101,116,117,
-,110,32,100,109,97,112,91,118,93,0,0,12,4,0,4,
-,109,97,112,0,0,0,0,13,3,4,0,9,3,3,2,
-,3,0,0,0,0,0,0,12,46,0,4,103,109,97,112,
-,0,0,0,14,46,45,0,30,3,1,149,100,101,102,32,
-,111,40,116,41,58,0,0,16,46,0,94,44,8,0,0,
-,3,1,149,100,101,102,32,100,111,40,116,41,58,0,0,
-,1,0,13,99,111,114,101,47,112,97,114,115,101,46,112,
-,0,0,0,33,1,0,0,12,1,0,2,100,111,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,30,12,1,150,
-,32,32,32,105,102,32,116,46,116,121,112,101,32,61,61,
-,39,115,121,109,98,111,108,39,58,32,114,32,61,32,103,
-,97,112,40,116,44,116,46,118,97,108,41,0,0,0,0,
+,0,0,1,12,4,0,4,100,109,97,112,0,0,0,0,
+,3,4,0,9,3,3,2,20,3,0,0,0,0,0,0,
+,46,0,4,103,109,97,112,0,0,0,0,14,46,45,0,
+,46,0,49,44,8,0,0,28,2,0,0,9,1,0,2,
 ,3,0,4,116,121,112,101,0,0,0,0,9,2,1,3,
 ,3,0,6,115,121,109,98,111,108,0,0,23,2,2,3,
 ,2,0,0,18,0,0,13,12,5,0,4,103,109,97,112,
 ,0,0,0,13,4,5,0,15,5,1,0,12,7,0,3,
 ,97,108,0,9,6,1,7,31,3,5,2,19,3,4,3,
-,2,3,0,18,0,0,23,30,8,1,151,32,32,32,32,
-,108,115,101,58,32,114,32,61,32,103,109,97,112,40,116,
-,116,46,116,121,112,101,41,0,0,0,0,12,5,0,4,
-,109,97,112,0,0,0,0,13,4,5,0,15,5,1,0,
-,7,0,4,116,121,112,101,0,0,0,0,9,6,1,7,
-,3,5,2,19,3,4,3,15,2,3,0,18,0,0,1,
-,4,1,152,32,32,32,32,109,101,114,103,101,40,116,44,
-,41,0,0,12,5,0,5,109,101,114,103,101,0,0,0,
-,4,5,0,15,5,1,0,15,6,2,0,31,3,5,2,
-,3,4,3,30,4,1,153,32,32,32,32,114,101,116,117,
-,110,32,116,0,0,0,0,20,1,0,0,0,0,0,0,
-,47,0,2,100,111,0,0,14,47,46,0,30,5,1,154,
-,101,102,32,100,111,95,109,111,100,117,108,101,40,41,58,
-,0,0,0,16,47,0,133,44,10,0,0,30,5,1,154,
-,101,102,32,100,111,95,109,111,100,117,108,101,40,41,58,
-,0,0,0,12,1,0,13,99,111,114,101,47,112,97,114,
-,101,46,112,121,0,0,0,33,1,0,0,12,1,0,9,
-,111,95,109,111,100,117,108,101,0,0,0,34,1,0,0,
-,5,1,155,32,32,32,32,116,111,107,32,61,32,80,46,
-,111,107,101,110,0,0,0,12,3,0,1,80,0,0,0,
+,2,3,0,18,0,0,14,12,5,0,4,103,109,97,112,
+,0,0,0,13,4,5,0,15,5,1,0,12,7,0,4,
+,121,112,101,0,0,0,0,9,6,1,7,31,3,5,2,
+,3,4,3,15,2,3,0,18,0,0,1,12,5,0,5,
+,101,114,103,101,0,0,0,13,4,5,0,15,5,1,0,
+,6,2,0,31,3,5,2,19,3,4,3,20,1,0,0,
+,0,0,0,12,47,0,2,100,111,0,0,14,47,46,0,
+,47,0,83,44,10,0,0,12,3,0,1,80,0,0,0,
 ,2,3,0,12,3,0,5,116,111,107,101,110,0,0,0,
-,2,2,3,15,1,2,0,30,4,1,156,32,32,32,32,
-,116,101,109,115,32,61,32,91,93,0,0,27,3,0,0,
-,2,3,0,30,5,1,157,32,32,32,32,105,98,108,111,
-,107,40,105,116,101,109,115,41,0,0,0,12,5,0,6,
-,98,108,111,99,107,0,0,13,4,5,0,15,5,2,0,
-,3,5,1,19,3,4,3,30,5,1,158,32,32,32,32,
-,100,118,97,110,99,101,40,39,101,111,102,39,41,0,0,
-,5,0,7,97,100,118,97,110,99,101,0,13,4,5,0,
-,5,0,3,101,111,102,0,31,3,5,1,19,3,4,3,
-,6,1,159,32,32,32,32,105,102,32,108,101,110,40,105,
-,101,109,115,41,32,62,32,49,58,0,0,11,3,0,0,
-,0,0,0,0,0,240,63,12,6,0,3,108,101,110,0,
-,5,6,0,15,6,2,0,31,4,6,1,19,4,5,4,
-,3,3,4,21,3,0,0,18,0,0,34,30,14,1,160,
-,32,32,32,32,32,32,32,114,101,116,117,114,110,32,84,
-,107,101,110,40,116,111,107,46,112,111,115,44,39,115,116,
-,116,101,109,101,110,116,115,39,44,39,59,39,44,105,116,
-,109,115,41,0,0,0,0,12,5,0,5,84,111,107,101,
+,2,2,3,15,1,2,0,27,3,0,0,15,2,3,0,
+,3,0,0,0,0,0,0,0,0,0,0,12,6,0,5,
+,104,101,99,107,0,0,0,13,5,6,0,12,8,0,1,
+,0,0,0,13,6,8,0,12,8,0,5,116,111,107,101,
+,0,0,0,9,6,6,8,12,7,0,3,101,111,102,0,
+,4,6,2,19,4,5,4,23,3,3,4,21,3,0,0,
+,0,0,14,12,5,0,6,97,112,112,101,110,100,0,0,
+,4,2,5,12,7,0,5,98,108,111,99,107,0,0,0,
+,6,7,0,31,5,0,0,19,5,6,5,31,3,5,1,
+,3,4,3,18,0,255,223,11,3,0,0,0,0,0,0,
+,0,240,63,12,6,0,3,108,101,110,0,13,5,6,0,
+,6,2,0,31,4,6,1,19,4,5,4,25,3,3,4,
+,3,0,0,18,0,0,19,12,5,0,5,84,111,107,101,
 ,0,0,0,13,4,5,0,12,9,0,3,112,111,115,0,
 ,5,1,9,12,6,0,10,115,116,97,116,101,109,101,110,
 ,115,0,0,12,7,0,1,59,0,0,0,15,8,2,0,
 ,3,5,4,19,3,4,3,20,3,0,0,18,0,0,1,
-,6,1,161,32,32,32,32,114,101,116,117,114,110,32,105,
-,101,109,115,46,112,111,112,40,41,0,0,12,5,0,3,
-,111,112,0,9,4,2,5,31,3,0,0,19,3,4,3,
-,3,0,0,0,0,0,0,12,48,0,9,100,111,95,109,
-,100,117,108,101,0,0,0,14,48,47,0,30,7,1,163,
-,101,102,32,112,97,114,115,101,40,115,44,116,111,107,101,
-,115,44,119,114,97,112,61,48,41,58,0,16,48,0,114,
-,9,0,0,30,7,1,163,100,101,102,32,112,97,114,115,
-,40,115,44,116,111,107,101,110,115,44,119,114,97,112,61,
-,41,58,0,12,1,0,13,99,111,114,101,47,112,97,114,
-,101,46,112,121,0,0,0,33,1,0,0,12,1,0,5,
-,97,114,115,101,0,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,28,3,0,0,9,2,0,3,11,3,0,0,
-,0,0,0,0,0,0,0,28,4,0,0,32,3,0,4,
-,4,1,164,32,32,32,32,103,108,111,98,97,108,32,80,
-,0,0,0,30,7,1,165,32,32,32,32,115,32,61,32,
-,111,107,101,110,105,122,101,46,99,108,101,97,110,40,115,
-,0,0,0,12,6,0,8,116,111,107,101,110,105,122,101,
-,0,0,0,13,5,6,0,12,6,0,5,99,108,101,97,
-,0,0,0,9,5,5,6,15,6,1,0,31,4,6,1,
-,4,5,4,15,1,4,0,30,8,1,166,32,32,32,32,
-,61,80,68,97,116,97,40,115,44,116,111,107,101,110,115,
-,59,32,80,46,105,110,105,116,40,41,0,12,4,0,1,
-,0,0,0,12,7,0,5,80,68,97,116,97,0,0,0,
-,6,7,0,15,7,1,0,15,8,2,0,31,5,7,2,
-,5,6,5,14,4,5,0,12,6,0,1,80,0,0,0,
-,5,6,0,12,6,0,4,105,110,105,116,0,0,0,0,
-,5,5,6,31,4,0,0,19,4,5,4,30,5,1,167,
-,32,32,32,114,32,61,32,100,111,95,109,111,100,117,108,
-,40,41,0,12,7,0,9,100,111,95,109,111,100,117,108,
-,0,0,0,13,6,7,0,31,5,0,0,19,5,6,5,
-,4,5,0,30,4,1,168,32,32,32,32,80,32,61,32,
-,111,110,101,0,0,0,0,12,5,0,1,80,0,0,0,
-,6,0,0,14,5,6,0,30,4,1,169,32,32,32,32,
-,101,116,117,114,110,32,114,0,0,0,0,20,4,0,0,
-,0,0,0,12,49,0,5,112,97,114,115,101,0,0,0,
-,49,48,0,0,0,0,0,
+,5,0,3,112,111,112,0,9,4,2,5,31,3,0,0,
+,3,4,3,20,3,0,0,0,0,0,0,12,48,0,9,
+,111,95,109,111,100,117,108,101,0,0,0,14,48,47,0,
+,48,0,58,44,9,0,0,28,2,0,0,9,1,0,2,
+,3,0,0,9,2,0,3,11,3,0,0,0,0,0,0,
+,0,0,0,28,4,0,0,32,3,0,4,12,6,0,8,
+,111,107,101,110,105,122,101,0,0,0,0,13,5,6,0,
+,6,0,5,99,108,101,97,110,0,0,0,9,5,5,6,
+,6,1,0,31,4,6,1,19,4,5,4,15,1,4,0,
+,4,0,1,80,0,0,0,12,7,0,5,80,68,97,116,
+,0,0,0,13,6,7,0,15,7,1,0,15,8,2,0,
+,5,7,2,19,5,6,5,14,4,5,0,12,6,0,1,
+,0,0,0,13,5,6,0,12,6,0,4,105,110,105,116,
+,0,0,0,9,5,5,6,31,4,0,0,19,4,5,4,
+,7,0,9,100,111,95,109,111,100,117,108,101,0,0,0,
+,6,7,0,31,5,0,0,19,5,6,5,15,4,5,0,
+,5,0,1,80,0,0,0,28,6,0,0,14,5,6,0,
+,4,0,0,0,0,0,0,12,49,0,5,112,97,114,115,
+,0,0,0,14,49,48,0,0,0,0,0,
 };
 unsigned char tp_encode[] = {
-,104,0,0,30,6,0,1,105,109,112,111,114,116,32,116,
-,107,101,110,105,122,101,44,32,115,121,115,0,0,0,0,
-,0,0,14,99,111,114,101,47,101,110,99,111,100,101,46,
-,121,0,0,33,0,0,0,12,0,0,1,63,0,0,0,
-,0,0,0,12,2,0,6,105,109,112,111,114,116,0,0,
+,104,0,0,12,2,0,6,105,109,112,111,114,116,0,0,
 ,1,2,0,12,2,0,8,116,111,107,101,110,105,122,101,
 ,0,0,0,31,0,2,1,19,0,1,0,12,1,0,8,
 ,111,107,101,110,105,122,101,0,0,0,0,14,1,0,0,
 ,2,0,6,105,109,112,111,114,116,0,0,13,1,2,0,
-,2,0,3,115,121,115,0,31,0,2,1,19,0,1,0,
-,1,0,3,115,121,115,0,14,1,0,0,30,7,0,2,
-,114,111,109,32,116,111,107,101,110,105,122,101,32,105,109,
-,111,114,116,32,84,111,107,101,110,0,0,12,2,0,6,
-,109,112,111,114,116,0,0,13,1,2,0,12,2,0,8,
-,111,107,101,110,105,122,101,0,0,0,0,31,0,2,1,
-,0,1,0,12,2,0,8,95,95,100,105,99,116,95,95,
-,0,0,0,13,1,2,0,12,3,0,5,84,111,107,101,
-,0,0,0,9,2,0,3,12,0,0,5,84,111,107,101,
-,0,0,0,10,1,0,2,30,8,0,3,105,102,32,110,
-,116,32,34,116,105,110,121,112,121,34,32,105,110,32,115,
-,115,46,118,101,114,115,105,111,110,58,0,12,2,0,3,
-,121,115,0,13,1,2,0,12,2,0,7,118,101,114,115,
-,111,110,0,9,1,1,2,12,2,0,6,116,105,110,121,
-,121,0,0,36,1,1,2,47,0,1,0,21,0,0,0,
-,0,0,30,30,6,0,4,32,32,32,32,102,114,111,109,
-,98,111,111,116,32,105,109,112,111,114,116,32,42,0,0,
+,2,0,8,116,111,107,101,110,105,122,101,0,0,0,0,
+,0,2,1,19,0,1,0,12,2,0,8,95,95,100,105,
+,116,95,95,0,0,0,0,13,1,2,0,12,3,0,5,
+,111,107,101,110,0,0,0,9,2,0,3,12,0,0,5,
+,111,107,101,110,0,0,0,10,1,0,2,12,2,0,3,
+,116,114,0,13,1,2,0,11,2,0,0,0,0,0,0,
+,0,240,63,31,0,2,1,19,0,1,0,12,1,0,1,
+,0,0,0,36,0,0,1,21,0,0,0,18,0,0,23,
 ,2,0,6,105,109,112,111,114,116,0,0,13,1,2,0,
 ,2,0,4,98,111,111,116,0,0,0,0,31,0,2,1,
 ,0,1,0,12,3,0,5,109,101,114,103,101,0,0,0,
 ,2,3,0,12,5,0,8,95,95,100,105,99,116,95,95,
 ,0,0,0,13,3,5,0,15,4,0,0,31,1,3,2,
-,1,2,1,18,0,0,1,30,94,0,6,69,79,70,44,
-,68,68,44,83,85,66,44,77,85,76,44,68,73,86,44,
-,79,87,44,66,73,84,65,78,68,44,66,73,84,79,82,
-,67,77,80,44,71,69,84,44,83,69,84,44,78,85,77,
-,69,82,44,83,84,82,73,78,71,44,71,71,69,84,44,
-,83,69,84,44,77,79,86,69,44,68,69,70,44,80,65,
-,83,44,74,85,77,80,44,67,65,76,76,44,82,69,84,
-,82,78,44,73,70,44,68,69,66,85,71,44,69,81,44,
-,69,44,76,84,44,68,73,67,84,44,76,73,83,84,44,
-,79,78,69,44,76,69,78,44,80,79,83,44,80,65,82,
-,77,83,44,73,71,69,84,44,70,73,76,69,44,78,65,
-,69,44,78,69,44,72,65,83,44,82,65,73,83,69,44,
-,69,84,74,77,80,44,77,79,68,44,76,83,72,44,82,
-,72,44,73,84,69,82,44,68,69,76,44,82,69,71,83,
-,66,73,84,88,79,82,44,73,70,78,44,78,79,84,44,
-,73,84,78,79,84,32,61,32,48,44,49,44,50,44,51,
-,52,44,53,44,54,44,55,44,56,44,57,44,49,48,44,
-,49,44,49,50,44,49,51,44,49,52,44,49,53,44,49,
-,44,49,55,44,49,56,44,49,57,44,50,48,44,50,49,
-,50,50,44,50,51,44,50,52,44,50,53,44,50,54,44,
-,55,44,50,56,44,50,57,44,51,48,44,51,49,44,51,
-,44,51,51,44,51,52,44,51,53,44,51,54,44,51,55,
-,51,56,44,51,57,44,52,48,44,52,49,44,52,50,44,
-,51,44,52,52,44,52,53,44,52,54,44,52,55,44,52,
-,0,0,0,11,1,0,0,0,0,0,0,0,0,0,0,
-,0,1,0,11,2,0,0,0,0,0,0,0,0,240,63,
-,1,2,0,11,3,0,0,0,0,0,0,0,0,0,64,
-,2,3,0,11,4,0,0,0,0,0,0,0,0,8,64,
-,3,4,0,11,5,0,0,0,0,0,0,0,0,16,64,
-,4,5,0,11,6,0,0,0,0,0,0,0,0,20,64,
-,5,6,0,11,7,0,0,0,0,0,0,0,0,24,64,
-,6,7,0,11,8,0,0,0,0,0,0,0,0,28,64,
-,7,8,0,11,9,0,0,0,0,0,0,0,0,32,64,
-,8,9,0,11,10,0,0,0,0,0,0,0,0,34,64,
-,9,10,0,11,11,0,0,0,0,0,0,0,0,36,64,
-,10,11,0,11,12,0,0,0,0,0,0,0,0,38,64,
-,11,12,0,11,13,0,0,0,0,0,0,0,0,40,64,
-,12,13,0,11,14,0,0,0,0,0,0,0,0,42,64,
-,13,14,0,11,15,0,0,0,0,0,0,0,0,44,64,
-,14,15,0,11,16,0,0,0,0,0,0,0,0,46,64,
-,15,16,0,11,17,0,0,0,0,0,0,0,0,48,64,
-,16,17,0,11,18,0,0,0,0,0,0,0,0,49,64,
-,17,18,0,11,19,0,0,0,0,0,0,0,0,50,64,
-,18,19,0,11,20,0,0,0,0,0,0,0,0,51,64,
-,19,20,0,11,21,0,0,0,0,0,0,0,0,52,64,
-,20,21,0,11,22,0,0,0,0,0,0,0,0,53,64,
-,21,22,0,11,23,0,0,0,0,0,0,0,0,54,64,
-,22,23,0,11,24,0,0,0,0,0,0,0,0,55,64,
-,23,24,0,11,25,0,0,0,0,0,0,0,0,56,64,
-,24,25,0,11,26,0,0,0,0,0,0,0,0,57,64,
-,25,26,0,11,27,0,0,0,0,0,0,0,0,58,64,
-,26,27,0,11,28,0,0,0,0,0,0,0,0,59,64,
-,27,28,0,11,29,0,0,0,0,0,0,0,0,60,64,
-,28,29,0,11,30,0,0,0,0,0,0,0,0,61,64,
-,29,30,0,11,31,0,0,0,0,0,0,0,0,62,64,
-,30,31,0,11,32,0,0,0,0,0,0,0,0,63,64,
-,31,32,0,11,33,0,0,0,0,0,0,0,0,64,64,
-,32,33,0,11,34,0,0,0,0,0,0,0,128,64,64,
-,33,34,0,11,35,0,0,0,0,0,0,0,0,65,64,
-,34,35,0,11,36,0,0,0,0,0,0,0,128,65,64,
-,35,36,0,11,37,0,0,0,0,0,0,0,0,66,64,
-,36,37,0,11,38,0,0,0,0,0,0,0,128,66,64,
-,37,38,0,11,39,0,0,0,0,0,0,0,0,67,64,
-,38,39,0,11,40,0,0,0,0,0,0,0,128,67,64,
-,39,40,0,11,41,0,0,0,0,0,0,0,0,68,64,
-,40,41,0,11,42,0,0,0,0,0,0,0,128,68,64,
-,41,42,0,11,43,0,0,0,0,0,0,0,0,69,64,
-,42,43,0,11,44,0,0,0,0,0,0,0,128,69,64,
-,43,44,0,11,45,0,0,0,0,0,0,0,0,70,64,
-,44,45,0,11,46,0,0,0,0,0,0,0,128,70,64,
-,45,46,0,11,47,0,0,0,0,0,0,0,0,71,64,
-,46,47,0,11,48,0,0,0,0,0,0,0,128,71,64,
-,47,48,0,11,49,0,0,0,0,0,0,0,0,72,64,
-,48,49,0,12,49,0,3,69,79,70,0,14,49,0,0,
-,0,0,3,65,68,68,0,14,0,1,0,12,0,0,3,
-,85,66,0,14,0,2,0,12,0,0,3,77,85,76,0,
-,0,3,0,12,0,0,3,68,73,86,0,14,0,4,0,
-,0,0,3,80,79,87,0,14,0,5,0,12,0,0,6,
-,73,84,65,78,68,0,0,14,0,6,0,12,0,0,5,
-,73,84,79,82,0,0,0,14,0,7,0,12,0,0,3,
-,77,80,0,14,0,8,0,12,0,0,3,71,69,84,0,
-,0,9,0,12,0,0,3,83,69,84,0,14,0,10,0,
-,0,0,6,78,85,77,66,69,82,0,0,14,0,11,0,
-,0,0,6,83,84,82,73,78,71,0,0,14,0,12,0,
-,0,0,4,71,71,69,84,0,0,0,0,14,0,13,0,
-,0,0,4,71,83,69,84,0,0,0,0,14,0,14,0,
-,0,0,4,77,79,86,69,0,0,0,0,14,0,15,0,
-,0,0,3,68,69,70,0,14,0,16,0,12,0,0,4,
-,65,83,83,0,0,0,0,14,0,17,0,12,0,0,4,
-,85,77,80,0,0,0,0,14,0,18,0,12,0,0,4,
-,65,76,76,0,0,0,0,14,0,19,0,12,0,0,6,
-,69,84,85,82,78,0,0,14,0,20,0,12,0,0,2,
-,70,0,0,14,0,21,0,12,0,0,5,68,69,66,85,
-,0,0,0,14,0,22,0,12,0,0,2,69,81,0,0,
-,0,23,0,12,0,0,2,76,69,0,0,14,0,24,0,
-,0,0,2,76,84,0,0,14,0,25,0,12,0,0,4,
-,73,67,84,0,0,0,0,14,0,26,0,12,0,0,4,
-,73,83,84,0,0,0,0,14,0,27,0,12,0,0,4,
-,79,78,69,0,0,0,0,14,0,28,0,12,0,0,3,
-,69,78,0,14,0,29,0,12,0,0,3,80,79,83,0,
-,0,30,0,12,0,0,6,80,65,82,65,77,83,0,0,
-,0,31,0,12,0,0,4,73,71,69,84,0,0,0,0,
-,0,32,0,12,0,0,4,70,73,76,69,0,0,0,0,
-,0,33,0,12,0,0,4,78,65,77,69,0,0,0,0,
-,0,34,0,12,0,0,2,78,69,0,0,14,0,35,0,
-,0,0,3,72,65,83,0,14,0,36,0,12,0,0,5,
-,65,73,83,69,0,0,0,14,0,37,0,12,0,0,6,
-,69,84,74,77,80,0,0,14,0,38,0,12,0,0,3,
-,79,68,0,14,0,39,0,12,0,0,3,76,83,72,0,
-,0,40,0,12,0,0,3,82,83,72,0,14,0,41,0,
-,0,0,4,73,84,69,82,0,0,0,0,14,0,42,0,
-,0,0,3,68,69,76,0,14,0,43,0,12,0,0,4,
-,69,71,83,0,0,0,0,14,0,44,0,12,0,0,6,
-,73,84,88,79,82,0,0,14,0,45,0,12,0,0,3,
-,70,78,0,14,0,46,0,12,0,0,3,78,79,84,0,
-,0,47,0,12,0,0,6,66,73,84,78,79,84,0,0,
-,0,48,0,30,4,0,8,99,108,97,115,115,32,68,83,
-,97,116,101,58,0,0,0,26,0,0,0,12,1,0,6,
-,83,116,97,116,101,0,0,14,1,0,0,12,3,0,7,
-,101,116,109,101,116,97,0,13,2,3,0,15,3,0,0,
-,5,0,6,111,98,106,101,99,116,0,0,13,4,5,0,
-,1,3,2,19,1,2,1,16,1,0,167,44,11,0,0,
-,9,0,9,32,32,32,32,100,101,102,32,95,95,105,110,
-,116,95,95,40,115,101,108,102,44,99,111,100,101,44,102,
-,97,109,101,41,58,0,0,12,1,0,14,99,111,114,101,
-,101,110,99,111,100,101,46,112,121,0,0,33,1,0,0,
-,1,0,8,95,95,105,110,105,116,95,95,0,0,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
-,2,0,3,28,4,0,0,9,3,0,4,30,11,0,10,
-,32,32,32,32,32,32,32,115,101,108,102,46,99,111,100,
-,44,32,115,101,108,102,46,102,110,97,109,101,32,61,32,
-,111,100,101,44,102,110,97,109,101,0,0,15,4,2,0,
+,1,2,1,18,0,0,1,11,1,0,0,0,0,0,0,
+,0,0,0,15,0,1,0,11,2,0,0,0,0,0,0,
+,0,240,63,15,1,2,0,11,3,0,0,0,0,0,0,
+,0,0,64,15,2,3,0,11,4,0,0,0,0,0,0,
+,0,8,64,15,3,4,0,11,5,0,0,0,0,0,0,
+,0,16,64,15,4,5,0,11,6,0,0,0,0,0,0,
+,0,20,64,15,5,6,0,11,7,0,0,0,0,0,0,
+,0,24,64,15,6,7,0,11,8,0,0,0,0,0,0,
+,0,28,64,15,7,8,0,11,9,0,0,0,0,0,0,
+,0,32,64,15,8,9,0,11,10,0,0,0,0,0,0,
+,0,34,64,15,9,10,0,11,11,0,0,0,0,0,0,
+,0,36,64,15,10,11,0,11,12,0,0,0,0,0,0,
+,0,38,64,15,11,12,0,11,13,0,0,0,0,0,0,
+,0,40,64,15,12,13,0,11,14,0,0,0,0,0,0,
+,0,42,64,15,13,14,0,11,15,0,0,0,0,0,0,
+,0,44,64,15,14,15,0,11,16,0,0,0,0,0,0,
+,0,46,64,15,15,16,0,11,17,0,0,0,0,0,0,
+,0,48,64,15,16,17,0,11,18,0,0,0,0,0,0,
+,0,49,64,15,17,18,0,11,19,0,0,0,0,0,0,
+,0,50,64,15,18,19,0,11,20,0,0,0,0,0,0,
+,0,51,64,15,19,20,0,11,21,0,0,0,0,0,0,
+,0,52,64,15,20,21,0,11,22,0,0,0,0,0,0,
+,0,53,64,15,21,22,0,11,23,0,0,0,0,0,0,
+,0,54,64,15,22,23,0,11,24,0,0,0,0,0,0,
+,0,55,64,15,23,24,0,11,25,0,0,0,0,0,0,
+,0,56,64,15,24,25,0,11,26,0,0,0,0,0,0,
+,0,57,64,15,25,26,0,11,27,0,0,0,0,0,0,
+,0,58,64,15,26,27,0,11,28,0,0,0,0,0,0,
+,0,59,64,15,27,28,0,11,29,0,0,0,0,0,0,
+,0,60,64,15,28,29,0,11,30,0,0,0,0,0,0,
+,0,61,64,15,29,30,0,11,31,0,0,0,0,0,0,
+,0,62,64,15,30,31,0,11,32,0,0,0,0,0,0,
+,0,63,64,15,31,32,0,11,33,0,0,0,0,0,0,
+,0,64,64,15,32,33,0,11,34,0,0,0,0,0,0,
+,128,64,64,15,33,34,0,11,35,0,0,0,0,0,0,
+,0,65,64,15,34,35,0,11,36,0,0,0,0,0,0,
+,128,65,64,15,35,36,0,11,37,0,0,0,0,0,0,
+,0,66,64,15,36,37,0,11,38,0,0,0,0,0,0,
+,128,66,64,15,37,38,0,11,39,0,0,0,0,0,0,
+,0,67,64,15,38,39,0,11,40,0,0,0,0,0,0,
+,128,67,64,15,39,40,0,11,41,0,0,0,0,0,0,
+,0,68,64,15,40,41,0,11,42,0,0,0,0,0,0,
+,128,68,64,15,41,42,0,11,43,0,0,0,0,0,0,
+,0,69,64,15,42,43,0,11,44,0,0,0,0,0,0,
+,128,69,64,15,43,44,0,11,45,0,0,0,0,0,0,
+,0,70,64,15,44,45,0,12,45,0,3,69,79,70,0,
+,45,0,0,12,0,0,3,65,68,68,0,14,0,1,0,
+,0,0,3,83,85,66,0,14,0,2,0,12,0,0,3,
+,85,76,0,14,0,3,0,12,0,0,3,68,73,86,0,
+,0,4,0,12,0,0,3,80,79,87,0,14,0,5,0,
+,0,0,3,65,78,68,0,14,0,6,0,12,0,0,2,
+,82,0,0,14,0,7,0,12,0,0,3,67,77,80,0,
+,0,8,0,12,0,0,3,71,69,84,0,14,0,9,0,
+,0,0,3,83,69,84,0,14,0,10,0,12,0,0,6,
+,85,77,66,69,82,0,0,14,0,11,0,12,0,0,6,
+,84,82,73,78,71,0,0,14,0,12,0,12,0,0,4,
+,71,69,84,0,0,0,0,14,0,13,0,12,0,0,4,
+,83,69,84,0,0,0,0,14,0,14,0,12,0,0,4,
+,79,86,69,0,0,0,0,14,0,15,0,12,0,0,3,
+,69,70,0,14,0,16,0,12,0,0,4,80,65,83,83,
+,0,0,0,14,0,17,0,12,0,0,4,74,85,77,80,
+,0,0,0,14,0,18,0,12,0,0,4,67,65,76,76,
+,0,0,0,14,0,19,0,12,0,0,6,82,69,84,85,
+,78,0,0,14,0,20,0,12,0,0,2,73,70,0,0,
+,0,21,0,12,0,0,5,68,69,66,85,71,0,0,0,
+,0,22,0,12,0,0,2,69,81,0,0,14,0,23,0,
+,0,0,2,76,69,0,0,14,0,24,0,12,0,0,2,
+,84,0,0,14,0,25,0,12,0,0,4,68,73,67,84,
+,0,0,0,14,0,26,0,12,0,0,4,76,73,83,84,
+,0,0,0,14,0,27,0,12,0,0,4,78,79,78,69,
+,0,0,0,14,0,28,0,12,0,0,3,76,69,78,0,
+,0,29,0,12,0,0,3,80,79,83,0,14,0,30,0,
+,0,0,6,80,65,82,65,77,83,0,0,14,0,31,0,
+,0,0,4,73,71,69,84,0,0,0,0,14,0,32,0,
+,0,0,4,70,73,76,69,0,0,0,0,14,0,33,0,
+,0,0,4,78,65,77,69,0,0,0,0,14,0,34,0,
+,0,0,2,78,69,0,0,14,0,35,0,12,0,0,3,
+,65,83,0,14,0,36,0,12,0,0,5,82,65,73,83,
+,0,0,0,14,0,37,0,12,0,0,6,83,69,84,74,
+,80,0,0,14,0,38,0,12,0,0,3,77,79,68,0,
+,0,39,0,12,0,0,3,76,83,72,0,14,0,40,0,
+,0,0,3,82,83,72,0,14,0,41,0,12,0,0,4,
+,84,69,82,0,0,0,0,14,0,42,0,12,0,0,3,
+,69,76,0,14,0,43,0,12,0,0,4,82,69,71,83,
+,0,0,0,14,0,44,0,26,0,0,0,12,1,0,6,
+,83,116,97,116,101,0,0,14,1,0,0,16,1,0,86,
+,11,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
+,2,0,3,28,4,0,0,9,3,0,4,15,4,2,0,
 ,5,3,0,12,6,0,4,99,111,100,101,0,0,0,0,
 ,1,6,4,12,4,0,5,102,110,97,109,101,0,0,0,
-,1,4,5,30,11,0,11,32,32,32,32,32,32,32,32,
-,101,108,102,46,108,105,110,101,115,32,61,32,115,101,108,
-,46,99,111,100,101,46,115,112,108,105,116,40,39,92,110,
-,41,0,0,12,6,0,4,99,111,100,101,0,0,0,0,
+,1,4,5,12,6,0,4,99,111,100,101,0,0,0,0,
 ,5,1,6,12,6,0,5,115,112,108,105,116,0,0,0,
 ,5,5,6,12,6,0,1,10,0,0,0,31,4,6,1,
 ,4,5,4,12,5,0,5,108,105,110,101,115,0,0,0,
-,1,5,4,30,27,0,13,32,32,32,32,32,32,32,32,
-,101,108,102,46,115,116,97,99,107,44,115,101,108,102,46,
-,117,116,44,115,101,108,102,46,95,115,99,111,112,101,105,
-,115,101,108,102,46,116,115,116,97,99,107,44,115,101,108,
-,46,95,116,97,103,105,44,115,101,108,102,46,100,97,116,
-,32,61,32,91,93,44,91,40,39,116,97,103,39,44,39,
-,79,70,39,41,93,44,48,44,91,93,44,48,44,123,125,
-,0,0,0,27,5,0,0,15,4,5,0,12,8,0,3,
+,1,5,4,27,5,0,0,15,4,5,0,12,8,0,3,
 ,97,103,0,12,9,0,3,69,79,70,0,27,7,8,2,
 ,6,7,1,15,5,6,0,11,7,0,0,0,0,0,0,
 ,0,0,0,15,6,7,0,27,8,0,0,15,7,8,0,
 ,554 → 1746,306
 ,1,4,6,12,4,0,6,116,115,116,97,99,107,0,0,
 ,1,4,7,12,4,0,5,95,116,97,103,105,0,0,0,
 ,1,4,8,12,4,0,4,100,97,116,97,0,0,0,0,
-,1,4,9,30,7,0,14,32,32,32,32,32,32,32,32,
-,101,108,102,46,101,114,114,111,114,32,61,32,70,97,108,
-,101,0,0,11,4,0,0,0,0,0,0,0,0,0,0,
+,1,4,9,11,4,0,0,0,0,0,0,0,0,0,0,
 ,5,0,5,101,114,114,111,114,0,0,0,10,1,5,4,
 ,0,0,0,12,2,0,8,95,95,105,110,105,116,95,95,
-,0,0,0,10,0,2,1,16,2,1,93,44,19,0,0,
-,8,0,15,32,32,32,32,100,101,102,32,98,101,103,105,
-,40,115,101,108,102,44,103,98,108,61,70,97,108,115,101,
-,58,0,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,5,
-,101,103,105,110,0,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,11,2,0,0,0,0,0,0,0,0,0,0,
-,3,0,0,32,2,0,3,30,46,0,16,32,32,32,32,
-,32,32,32,105,102,32,108,101,110,40,115,101,108,102,46,
-,116,97,99,107,41,58,32,115,101,108,102,46,115,116,97,
-,107,46,97,112,112,101,110,100,40,40,115,101,108,102,46,
-,97,114,115,44,115,101,108,102,46,114,50,110,44,115,101,
-,102,46,110,50,114,44,115,101,108,102,46,95,116,109,112,
-,44,115,101,108,102,46,109,114,101,103,44,115,101,108,102,
-,115,110,117,109,44,115,101,108,102,46,95,103,108,111,98,
-,108,115,44,115,101,108,102,46,108,105,110,101,110,111,44,
-,101,108,102,46,103,108,111,98,97,108,115,44,115,101,108,
-,46,114,103,108,111,98,97,108,115,44,115,101,108,102,46,
-,114,101,103,115,44,115,101,108,102,46,116,109,112,99,41,
-,0,0,0,12,5,0,3,108,101,110,0,13,4,5,0,
-,6,0,5,115,116,97,99,107,0,0,0,9,5,1,6,
-,3,5,1,19,3,4,3,21,3,0,0,18,0,0,61,
-,5,0,5,115,116,97,99,107,0,0,0,9,4,1,5,
-,5,0,6,97,112,112,101,110,100,0,0,9,4,4,5,
-,18,0,4,118,97,114,115,0,0,0,0,9,6,1,18,
-,18,0,3,114,50,110,0,9,7,1,18,12,18,0,3,
-,50,114,0,9,8,1,18,12,18,0,5,95,116,109,112,
-,0,0,0,9,9,1,18,12,18,0,4,109,114,101,103,
-,0,0,0,9,10,1,18,12,18,0,4,115,110,117,109,
-,0,0,0,9,11,1,18,12,18,0,8,95,103,108,111,
-,97,108,115,0,0,0,0,9,12,1,18,12,18,0,6,
-,105,110,101,110,111,0,0,9,13,1,18,12,18,0,7,
-,108,111,98,97,108,115,0,9,14,1,18,12,18,0,8,
-,103,108,111,98,97,108,115,0,0,0,0,9,15,1,18,
-,18,0,5,99,114,101,103,115,0,0,0,9,16,1,18,
-,18,0,4,116,109,112,99,0,0,0,0,9,17,1,18,
-,5,6,12,31,3,5,1,19,3,4,3,18,0,0,24,
-,10,0,17,32,32,32,32,32,32,32,32,101,108,115,101,
-,32,115,101,108,102,46,115,116,97,99,107,46,97,112,112,
-,110,100,40,78,111,110,101,41,0,0,0,12,5,0,5,
-,116,97,99,107,0,0,0,9,4,1,5,12,5,0,6,
-,112,112,101,110,100,0,0,9,4,4,5,28,5,0,0,
-,3,5,1,19,3,4,3,18,0,0,1,30,50,0,18,
-,32,32,32,32,32,32,32,115,101,108,102,46,118,97,114,
-,44,115,101,108,102,46,114,50,110,44,115,101,108,102,46,
-,50,114,44,115,101,108,102,46,95,116,109,112,105,44,115,
-,108,102,46,109,114,101,103,44,115,101,108,102,46,115,110,
-,109,44,115,101,108,102,46,95,103,108,111,98,97,108,115,
-,115,101,108,102,46,108,105,110,101,110,111,44,115,101,108,
-,46,103,108,111,98,97,108,115,44,115,101,108,102,46,114,
-,108,111,98,97,108,115,44,115,101,108,102,46,99,114,101,
-,115,44,115,101,108,102,46,116,109,112,99,32,61,32,91,
-,44,123,125,44,123,125,44,48,44,48,44,115,116,114,40,
-,101,108,102,46,95,115,99,111,112,101,105,41,44,103,98,
-,44,45,49,44,91,93,44,91,93,44,91,39,114,101,103,
-,39,93,44,48,0,0,0,27,4,0,0,15,3,4,0,
-,5,0,0,15,4,5,0,26,6,0,0,15,5,6,0,
-,7,0,0,0,0,0,0,0,0,0,0,15,6,7,0,
-,8,0,0,0,0,0,0,0,0,0,0,15,7,8,0,
-,11,0,3,115,116,114,0,13,10,11,0,12,12,0,7,
-,115,99,111,112,101,105,0,9,11,1,12,31,9,11,1,
-,9,10,9,15,8,9,0,15,9,2,0,11,11,0,0,
-,0,0,0,0,0,240,191,15,10,11,0,27,12,0,0,
-,11,12,0,27,13,0,0,15,12,13,0,12,15,0,4,
-,101,103,115,0,0,0,0,27,14,15,1,15,13,14,0,
-,15,0,0,0,0,0,0,0,0,0,0,15,14,15,0,
-,15,0,4,118,97,114,115,0,0,0,0,10,1,15,3,
-,3,0,3,114,50,110,0,10,1,3,4,12,3,0,3,
-,50,114,0,10,1,3,5,12,3,0,5,95,116,109,112,
-,0,0,0,10,1,3,6,12,3,0,4,109,114,101,103,
-,0,0,0,10,1,3,7,12,3,0,4,115,110,117,109,
-,0,0,0,10,1,3,8,12,3,0,8,95,103,108,111,
-,97,108,115,0,0,0,0,10,1,3,9,12,3,0,6,
-,105,110,101,110,111,0,0,10,1,3,10,12,3,0,7,
-,108,111,98,97,108,115,0,10,1,3,11,12,3,0,8,
-,103,108,111,98,97,108,115,0,0,0,0,10,1,3,12,
-,3,0,5,99,114,101,103,115,0,0,0,10,1,3,13,
-,3,0,4,116,109,112,99,0,0,0,0,10,1,3,14,
-,7,0,19,32,32,32,32,32,32,32,32,115,101,108,102,
-,95,115,99,111,112,101,105,32,43,61,32,49,0,0,0,
+,0,0,0,10,0,2,1,16,2,0,193,44,18,0,0,
+,2,0,0,9,1,0,2,11,2,0,0,0,0,0,0,
+,0,0,0,28,3,0,0,32,2,0,3,12,5,0,3,
+,101,110,0,13,4,5,0,12,6,0,5,115,116,97,99,
+,0,0,0,9,5,1,6,31,3,5,1,19,3,4,3,
+,3,0,0,18,0,0,56,12,5,0,5,115,116,97,99,
+,0,0,0,9,4,1,5,12,5,0,6,97,112,112,101,
+,100,0,0,9,4,4,5,12,17,0,4,118,97,114,115,
+,0,0,0,9,6,1,17,12,17,0,3,114,50,110,0,
+,7,1,17,12,17,0,3,110,50,114,0,9,8,1,17,
+,17,0,5,95,116,109,112,105,0,0,0,9,9,1,17,
+,17,0,4,109,114,101,103,0,0,0,0,9,10,1,17,
+,17,0,4,115,110,117,109,0,0,0,0,9,11,1,17,
+,17,0,8,95,103,108,111,98,97,108,115,0,0,0,0,
+,12,1,17,12,17,0,6,108,105,110,101,110,111,0,0,
+,13,1,17,12,17,0,7,103,108,111,98,97,108,115,0,
+,14,1,17,12,17,0,5,99,114,101,103,115,0,0,0,
+,15,1,17,12,17,0,4,116,109,112,99,0,0,0,0,
+,16,1,17,27,5,6,11,31,3,5,1,19,3,4,3,
+,0,0,13,12,5,0,5,115,116,97,99,107,0,0,0,
+,4,1,5,12,5,0,6,97,112,112,101,110,100,0,0,
+,4,4,5,28,5,0,0,31,3,5,1,19,3,4,3,
+,0,0,1,27,4,0,0,15,3,4,0,26,5,0,0,
+,4,5,0,26,6,0,0,15,5,6,0,11,7,0,0,
+,0,0,0,0,0,0,0,15,6,7,0,11,8,0,0,
+,0,0,0,0,0,0,0,15,7,8,0,12,11,0,3,
+,116,114,0,13,10,11,0,12,12,0,7,95,115,99,111,
+,101,105,0,9,11,1,12,31,9,11,1,19,9,10,9,
+,8,9,0,15,9,2,0,11,11,0,0,0,0,0,0,
+,0,240,191,15,10,11,0,27,12,0,0,15,11,12,0,
+,14,0,4,114,101,103,115,0,0,0,0,27,13,14,1,
+,12,13,0,11,14,0,0,0,0,0,0,0,0,0,0,
+,13,14,0,12,14,0,4,118,97,114,115,0,0,0,0,
+,1,14,3,12,3,0,3,114,50,110,0,10,1,3,4,
+,3,0,3,110,50,114,0,10,1,3,5,12,3,0,5,
+,116,109,112,105,0,0,0,10,1,3,6,12,3,0,4,
+,114,101,103,0,0,0,0,10,1,3,7,12,3,0,4,
+,110,117,109,0,0,0,0,10,1,3,8,12,3,0,8,
+,103,108,111,98,97,108,115,0,0,0,0,10,1,3,9,
+,3,0,6,108,105,110,101,110,111,0,0,10,1,3,10,
+,3,0,7,103,108,111,98,97,108,115,0,10,1,3,11,
+,3,0,5,99,114,101,103,115,0,0,0,10,1,3,12,
+,3,0,4,116,109,112,99,0,0,0,0,10,1,3,13,
 ,4,0,7,95,115,99,111,112,101,105,0,9,3,1,4,
 ,4,0,0,0,0,0,0,0,0,240,63,1,3,3,4,
 ,4,0,7,95,115,99,111,112,101,105,0,10,1,4,3,
-,7,0,20,32,32,32,32,32,32,32,32,105,110,115,101,
-,116,40,115,101,108,102,46,99,114,101,103,115,41,0,0,
 ,5,0,6,105,110,115,101,114,116,0,0,13,4,5,0,
 ,6,0,5,99,114,101,103,115,0,0,0,9,5,1,6,
 ,3,5,1,19,3,4,3,0,0,0,0,12,3,0,5,
-,101,103,105,110,0,0,0,10,0,3,2,16,3,1,51,
-,7,0,0,30,5,0,21,32,32,32,32,100,101,102,32,
-,110,100,40,115,101,108,102,41,58,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,3,101,110,100,0,34,1,0,0,
-,2,0,0,9,1,0,2,30,10,0,22,32,32,32,32,
-,32,32,32,115,101,108,102,46,99,114,101,103,115,46,97,
-,112,101,110,100,40,115,101,108,102,46,109,114,101,103,41,
-,0,0,0,12,4,0,5,99,114,101,103,115,0,0,0,
-,3,1,4,12,4,0,6,97,112,112,101,110,100,0,0,
-,3,3,4,12,5,0,4,109,114,101,103,0,0,0,0,
-,4,1,5,31,2,4,1,19,2,3,2,30,5,0,23,
-,32,32,32,32,32,32,32,99,111,100,101,40,69,79,70,
-,0,0,0,12,4,0,4,99,111,100,101,0,0,0,0,
+,101,103,105,110,0,0,0,10,0,3,2,16,3,0,164,
+,7,0,0,28,2,0,0,9,1,0,2,12,4,0,5,
+,114,101,103,115,0,0,0,9,3,1,4,12,4,0,6,
+,112,112,101,110,100,0,0,9,3,3,4,12,5,0,4,
+,114,101,103,0,0,0,0,9,4,1,5,31,2,4,1,
+,2,3,2,12,4,0,4,99,111,100,101,0,0,0,0,
 ,3,4,0,12,5,0,3,69,79,70,0,13,4,5,0,
-,2,4,1,19,2,3,2,30,7,0,29,32,32,32,32,
-,32,32,32,105,102,32,115,101,108,102,46,116,109,112,99,
-,33,61,32,48,58,0,0,12,3,0,4,116,109,112,99,
-,0,0,0,9,2,1,3,11,3,0,0,0,0,0,0,
-,0,0,0,35,2,2,3,21,2,0,0,18,0,0,39,
-,17,0,30,32,32,32,32,32,32,32,32,32,32,32,32,
-,114,105,110,116,40,34,87,97,114,110,105,110,103,58,92,
-,101,110,99,111,100,101,46,112,121,32,99,111,110,116,97,
-,110,115,32,97,32,114,101,103,105,115,116,101,114,32,108,
-,97,107,92,110,34,41,0,12,4,0,5,112,114,105,110,
-,0,0,0,13,3,4,0,12,4,0,44,87,97,114,110,
-,110,103,58,10,101,110,99,111,100,101,46,112,121,32,99,
-,110,116,97,105,110,115,32,97,32,114,101,103,105,115,116,
-,114,32,108,101,97,107,10,0,0,0,0,31,2,4,1,
-,2,3,2,18,0,0,1,30,8,0,32,32,32,32,32,
-,32,32,32,105,102,32,108,101,110,40,115,101,108,102,46,
-,116,97,99,107,41,32,62,32,49,58,0,11,2,0,0,
-,0,0,0,0,0,240,63,12,5,0,3,108,101,110,0,
-,4,5,0,12,6,0,5,115,116,97,99,107,0,0,0,
-,5,1,6,31,3,5,1,19,3,4,3,25,2,2,3,
-,2,0,0,18,0,0,149,30,41,0,33,32,32,32,32,
-,32,32,32,32,32,32,32,115,101,108,102,46,118,97,114,
-,44,115,101,108,102,46,114,50,110,44,115,101,108,102,46,
-,50,114,44,115,101,108,102,46,95,116,109,112,105,44,115,
-,108,102,46,109,114,101,103,44,115,101,108,102,46,115,110,
-,109,44,115,101,108,102,46,95,103,108,111,98,97,108,115,
-,115,101,108,102,46,108,105,110,101,110,111,44,115,101,108,
-,46,103,108,111,98,97,108,115,44,115,101,108,102,46,114,
-,108,111,98,97,108,115,44,115,101,108,102,46,99,114,101,
-,115,44,115,101,108,102,46,116,109,112,99,32,61,32,115,
-,108,102,46,115,116,97,99,107,46,112,111,112,40,41,0,
+,2,4,1,19,2,3,2,12,4,0,6,97,115,115,101,
+,116,0,0,13,3,4,0,12,5,0,4,116,109,112,99,
+,0,0,0,9,4,1,5,11,5,0,0,0,0,0,0,
+,0,0,0,23,4,4,5,31,2,4,1,19,2,3,2,
+,2,0,0,0,0,0,0,0,0,240,63,12,5,0,3,
+,101,110,0,13,4,5,0,12,6,0,5,115,116,97,99,
+,0,0,0,9,5,1,6,31,3,5,1,19,3,4,3,
+,2,2,3,21,2,0,0,18,0,0,98,12,4,0,5,
+,116,97,99,107,0,0,0,9,3,1,4,12,4,0,3,
+,111,112,0,9,3,3,4,31,2,0,0,19,2,3,2,
+,4,0,0,0,0,0,0,0,0,0,0,9,3,2,4,
+,4,0,4,118,97,114,115,0,0,0,0,10,1,4,3,
+,4,0,0,0,0,0,0,0,0,240,63,9,3,2,4,
+,4,0,3,114,50,110,0,10,1,4,3,11,4,0,0,
+,0,0,0,0,0,0,64,9,3,2,4,12,4,0,3,
+,50,114,0,10,1,4,3,11,4,0,0,0,0,0,0,
+,0,8,64,9,3,2,4,12,4,0,5,95,116,109,112,
+,0,0,0,10,1,4,3,11,4,0,0,0,0,0,0,
+,0,16,64,9,3,2,4,12,4,0,4,109,114,101,103,
+,0,0,0,10,1,4,3,11,4,0,0,0,0,0,0,
+,0,20,64,9,3,2,4,12,4,0,4,115,110,117,109,
+,0,0,0,10,1,4,3,11,4,0,0,0,0,0,0,
+,0,24,64,9,3,2,4,12,4,0,8,95,103,108,111,
+,97,108,115,0,0,0,0,10,1,4,3,11,4,0,0,
+,0,0,0,0,0,28,64,9,3,2,4,12,4,0,6,
+,105,110,101,110,111,0,0,10,1,4,3,11,4,0,0,
+,0,0,0,0,0,32,64,9,3,2,4,12,4,0,7,
+,108,111,98,97,108,115,0,10,1,4,3,11,4,0,0,
+,0,0,0,0,0,34,64,9,3,2,4,12,4,0,5,
+,114,101,103,115,0,0,0,10,1,4,3,11,4,0,0,
+,0,0,0,0,0,36,64,9,3,2,4,12,4,0,4,
+,109,112,99,0,0,0,0,10,1,4,3,18,0,0,11,
 ,4,0,5,115,116,97,99,107,0,0,0,9,3,1,4,
 ,4,0,3,112,111,112,0,9,3,3,4,31,2,0,0,
-,2,3,2,11,4,0,0,0,0,0,0,0,0,0,0,
-,3,2,4,12,4,0,4,118,97,114,115,0,0,0,0,
-,1,4,3,11,4,0,0,0,0,0,0,0,0,240,63,
-,3,2,4,12,4,0,3,114,50,110,0,10,1,4,3,
-,4,0,0,0,0,0,0,0,0,0,64,9,3,2,4,
-,4,0,3,110,50,114,0,10,1,4,3,11,4,0,0,
-,0,0,0,0,0,8,64,9,3,2,4,12,4,0,5,
-,116,109,112,105,0,0,0,10,1,4,3,11,4,0,0,
-,0,0,0,0,0,16,64,9,3,2,4,12,4,0,4,
-,114,101,103,0,0,0,0,10,1,4,3,11,4,0,0,
-,0,0,0,0,0,20,64,9,3,2,4,12,4,0,4,
-,110,117,109,0,0,0,0,10,1,4,3,11,4,0,0,
-,0,0,0,0,0,24,64,9,3,2,4,12,4,0,8,
-,103,108,111,98,97,108,115,0,0,0,0,10,1,4,3,
-,4,0,0,0,0,0,0,0,0,28,64,9,3,2,4,
-,4,0,6,108,105,110,101,110,111,0,0,10,1,4,3,
-,4,0,0,0,0,0,0,0,0,32,64,9,3,2,4,
-,4,0,7,103,108,111,98,97,108,115,0,10,1,4,3,
-,4,0,0,0,0,0,0,0,0,34,64,9,3,2,4,
-,4,0,8,114,103,108,111,98,97,108,115,0,0,0,0,
-,1,4,3,11,4,0,0,0,0,0,0,0,0,36,64,
-,3,2,4,12,4,0,5,99,114,101,103,115,0,0,0,
-,1,4,3,11,4,0,0,0,0,0,0,0,0,38,64,
-,3,2,4,12,4,0,4,116,109,112,99,0,0,0,0,
-,1,4,3,18,0,0,20,30,8,0,34,32,32,32,32,
-,32,32,32,101,108,115,101,58,32,115,101,108,102,46,115,
-,97,99,107,46,112,111,112,40,41,0,0,12,4,0,5,
-,116,97,99,107,0,0,0,9,3,1,4,12,4,0,3,
-,111,112,0,9,3,3,4,31,2,0,0,19,2,3,2,
-,0,0,1,0,0,0,0,12,4,0,3,101,110,100,0,
-,0,4,3,30,8,0,37,100,101,102,32,105,110,115,101,
-,116,40,118,41,58,32,68,46,111,117,116,46,97,112,112,
-,110,100,40,118,41,0,0,16,0,0,37,44,5,0,0,
-,8,0,37,100,101,102,32,105,110,115,101,114,116,40,118,
-,58,32,68,46,111,117,116,46,97,112,112,101,110,100,40,
-,41,0,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,6,
-,110,115,101,114,116,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,12,4,0,1,68,0,0,0,13,3,4,0,
-,4,0,3,111,117,116,0,9,3,3,4,12,4,0,6,
-,112,112,101,110,100,0,0,9,3,3,4,15,4,1,0,
-,2,4,1,19,2,3,2,0,0,0,0,12,4,0,6,
-,110,115,101,114,116,0,0,14,4,0,0,30,4,0,38,
-,101,102,32,119,114,105,116,101,40,118,41,58,0,0,0,
-,4,0,121,44,14,0,0,30,4,0,38,100,101,102,32,
-,114,105,116,101,40,118,41,58,0,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,5,119,114,105,116,101,0,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,30,7,0,39,
-,32,32,32,105,102,32,105,115,116,121,112,101,40,118,44,
-,108,105,115,116,39,41,58,0,0,0,0,12,4,0,6,
-,115,116,121,112,101,0,0,13,3,4,0,15,4,1,0,
-,5,0,4,108,105,115,116,0,0,0,0,31,2,4,2,
-,2,3,2,21,2,0,0,18,0,0,22,30,5,0,40,
-,32,32,32,32,32,32,32,105,110,115,101,114,116,40,118,
-,0,0,0,12,4,0,6,105,110,115,101,114,116,0,0,
+,2,3,2,18,0,0,1,0,0,0,0,12,4,0,3,
+,110,100,0,10,0,4,3,16,4,0,62,44,7,0,0,
+,2,0,0,9,1,0,2,12,4,0,4,98,105,110,100,
+,0,0,0,13,3,4,0,12,6,0,6,68,83,116,97,
+,101,0,0,13,4,6,0,12,6,0,8,95,95,105,110,
+,116,95,95,0,0,0,0,9,4,4,6,15,5,1,0,
+,2,4,2,19,2,3,2,12,3,0,8,95,95,105,110,
+,116,95,95,0,0,0,0,10,1,3,2,12,4,0,4,
+,105,110,100,0,0,0,0,13,3,4,0,12,6,0,6,
+,83,116,97,116,101,0,0,13,4,6,0,12,6,0,5,
+,101,103,105,110,0,0,0,9,4,4,6,15,5,1,0,
+,2,4,2,19,2,3,2,12,3,0,5,98,101,103,105,
+,0,0,0,10,1,3,2,12,4,0,4,98,105,110,100,
+,0,0,0,13,3,4,0,12,6,0,6,68,83,116,97,
+,101,0,0,13,4,6,0,12,6,0,3,101,110,100,0,
+,4,4,6,15,5,1,0,31,2,4,2,19,2,3,2,
+,3,0,3,101,110,100,0,10,1,3,2,0,0,0,0,
+,5,0,7,95,95,110,101,119,95,95,0,10,0,5,4,
+,5,0,22,44,5,0,0,26,1,0,0,12,4,0,6,
+,83,116,97,116,101,0,0,13,3,4,0,12,4,0,7,
+,95,110,101,119,95,95,0,9,3,3,4,15,4,1,0,
+,2,4,1,19,2,3,2,12,3,0,8,95,95,105,110,
+,116,95,95,0,0,0,0,9,2,1,3,19,4,2,0,
+,1,0,0,0,0,0,0,12,6,0,8,95,95,99,97,
+,108,95,95,0,0,0,0,10,0,6,5,16,0,0,18,
+,5,0,0,28,2,0,0,9,1,0,2,12,4,0,1,
+,0,0,0,13,3,4,0,12,4,0,3,111,117,116,0,
+,3,3,4,12,4,0,6,97,112,112,101,110,100,0,0,
+,3,3,4,15,4,1,0,31,2,4,1,19,2,3,2,
+,0,0,0,12,6,0,6,105,110,115,101,114,116,0,0,
+,6,0,0,16,6,0,68,44,14,0,0,28,2,0,0,
+,1,0,2,12,4,0,6,105,115,116,121,112,101,0,0,
+,3,4,0,15,4,1,0,12,5,0,4,108,105,115,116,
+,0,0,0,31,2,4,2,19,2,3,2,21,2,0,0,
+,0,0,11,12,4,0,6,105,110,115,101,114,116,0,0,
 ,3,4,0,15,4,1,0,31,2,4,1,19,2,3,2,
-,4,0,41,32,32,32,32,32,32,32,32,114,101,116,117,
-,110,0,0,28,2,0,0,20,2,0,0,18,0,0,1,
-,8,0,42,32,32,32,32,102,111,114,32,110,32,105,110,
-,114,97,110,103,101,40,48,44,108,101,110,40,118,41,44,
-,41,58,0,12,5,0,5,114,97,110,103,101,0,0,0,
-,4,5,0,11,5,0,0,0,0,0,0,0,0,0,0,
-,9,0,3,108,101,110,0,13,8,9,0,15,9,1,0,
-,6,9,1,19,6,8,6,11,7,0,0,0,0,0,0,
-,0,16,64,31,3,5,3,19,3,4,3,11,4,0,0,
-,0,0,0,0,0,0,0,42,2,3,4,18,0,0,29,
-,9,0,43,32,32,32,32,32,32,32,32,105,110,115,101,
-,116,40,40,39,100,97,116,97,39,44,118,91,110,58,110,
-,52,93,41,41,0,0,0,12,7,0,6,105,110,115,101,
+,2,0,0,20,2,0,0,18,0,0,1,12,5,0,5,
+,97,110,103,101,0,0,0,13,4,5,0,11,5,0,0,
+,0,0,0,0,0,0,0,12,9,0,3,108,101,110,0,
+,8,9,0,15,9,1,0,31,6,9,1,19,6,8,6,
+,7,0,0,0,0,0,0,0,0,16,64,31,3,5,3,
+,3,4,3,11,4,0,0,0,0,0,0,0,0,0,0,
+,2,3,4,18,0,0,19,12,7,0,6,105,110,115,101,
 ,116,0,0,13,6,7,0,12,8,0,4,100,97,116,97,
 ,0,0,0,15,11,2,0,11,13,0,0,0,0,0,0,
 ,0,16,64,1,12,2,13,27,10,11,2,9,9,1,10,
-,7,8,2,31,5,7,1,19,5,6,5,18,0,255,227,
-,0,0,0,12,5,0,5,119,114,105,116,101,0,0,0,
-,5,4,0,30,4,0,44,100,101,102,32,115,101,116,112,
-,115,40,118,41,58,0,0,16,5,0,185,44,12,0,0,
-,4,0,44,100,101,102,32,115,101,116,112,111,115,40,118,
-,58,0,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,6,
-,101,116,112,111,115,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,30,8,0,45,32,32,32,32,105,102,32,39,
-,110,111,112,111,115,39,32,105,110,32,65,82,71,86,58,
-,114,101,116,117,114,110,0,12,3,0,4,65,82,71,86,
-,0,0,0,13,2,3,0,12,3,0,6,45,110,111,112,
-,115,0,0,36,2,2,3,21,2,0,0,18,0,0,4,
-,2,0,0,20,2,0,0,18,0,0,1,30,4,0,46,
-,32,32,32,108,105,110,101,44,120,32,61,32,118,0,0,
-,4,0,0,0,0,0,0,0,0,0,0,9,3,1,4,
-,2,3,0,11,5,0,0,0,0,0,0,0,0,240,63,
-,4,1,5,15,3,4,0,30,8,0,47,32,32,32,32,
-,102,32,108,105,110,101,32,61,61,32,68,46,108,105,110,
-,110,111,58,32,114,101,116,117,114,110,0,12,5,0,1,
-,0,0,0,13,4,5,0,12,5,0,6,108,105,110,101,
-,111,0,0,9,4,4,5,23,1,2,4,21,1,0,0,
-,0,0,4,28,1,0,0,20,1,0,0,18,0,0,1,
-,7,0,48,32,32,32,32,116,101,120,116,32,61,32,68,
-,108,105,110,101,115,91,108,105,110,101,45,49,93,0,0,
-,5,0,1,68,0,0,0,13,4,5,0,12,5,0,5,
-,105,110,101,115,0,0,0,9,4,4,5,11,6,0,0,
-,0,0,0,0,0,240,63,2,5,2,6,9,4,4,5,
-,1,4,0,30,5,0,49,32,32,32,32,68,46,108,105,
-,101,110,111,32,61,32,108,105,110,101,0,12,5,0,1,
-,0,0,0,13,4,5,0,12,5,0,6,108,105,110,101,
-,111,0,0,10,4,5,2,30,10,0,50,32,32,32,32,
-,97,108,32,61,32,116,101,120,116,32,43,32,34,92,48,
-,42,40,52,45,108,101,110,40,116,101,120,116,41,37,52,
-,0,0,0,12,6,0,1,0,0,0,0,11,7,0,0,
+,7,8,2,31,5,7,1,19,5,6,5,18,0,255,237,
+,0,0,0,12,7,0,5,119,114,105,116,101,0,0,0,
+,7,6,0,16,7,0,107,44,12,0,0,28,2,0,0,
+,1,0,2,12,3,0,4,65,82,71,86,0,0,0,0,
+,2,3,0,12,3,0,6,45,110,111,112,111,115,0,0,
+,2,2,3,21,2,0,0,18,0,0,4,28,2,0,0,
+,2,0,0,18,0,0,1,11,4,0,0,0,0,0,0,
+,0,0,0,9,3,1,4,15,2,3,0,11,5,0,0,
+,0,0,0,0,0,240,63,9,4,1,5,15,3,4,0,
+,5,0,1,68,0,0,0,13,4,5,0,12,5,0,6,
+,105,110,101,110,111,0,0,9,4,4,5,23,1,2,4,
+,1,0,0,18,0,0,4,28,1,0,0,20,1,0,0,
+,0,0,1,12,5,0,1,68,0,0,0,13,4,5,0,
+,5,0,5,108,105,110,101,115,0,0,0,9,4,4,5,
+,6,0,0,0,0,0,0,0,0,240,63,2,5,2,6,
+,4,4,5,15,1,4,0,12,5,0,1,68,0,0,0,
+,4,5,0,12,5,0,6,108,105,110,101,110,111,0,0,
+,4,5,2,12,6,0,1,0,0,0,0,11,7,0,0,
 ,0,0,0,0,0,16,64,12,10,0,3,108,101,110,0,
 ,9,10,0,15,10,1,0,31,8,10,1,19,8,9,8,
 ,9,0,0,0,0,0,0,0,0,16,64,39,8,8,9,
 ,7,7,8,3,6,6,7,1,5,1,6,15,4,5,0,
-,9,0,51,32,32,32,32,99,111,100,101,95,49,54,40,
-,79,83,44,108,101,110,40,118,97,108,41,47,52,44,108,
-,110,101,41,0,0,0,0,12,7,0,7,99,111,100,101,
-,49,54,0,13,6,7,0,12,10,0,3,80,79,83,0,
-,7,10,0,12,11,0,3,108,101,110,0,13,10,11,0,
-,11,4,0,31,8,11,1,19,8,10,8,11,10,0,0,
-,0,0,0,0,0,16,64,4,8,8,10,15,9,2,0,
-,5,7,3,19,5,6,5,30,4,0,52,32,32,32,32,
-,114,105,116,101,40,118,97,108,41,0,0,12,7,0,5,
-,114,105,116,101,0,0,0,13,6,7,0,15,7,4,0,
-,5,7,1,19,5,6,5,0,0,0,0,12,6,0,6,
-,101,116,112,111,115,0,0,14,6,5,0,30,7,0,53,
-,101,102,32,99,111,100,101,40,105,44,97,61,48,44,98,
-,48,44,99,61,48,41,58,0,0,0,0,16,6,0,168,
-,13,0,0,30,7,0,53,100,101,102,32,99,111,100,101,
-,105,44,97,61,48,44,98,61,48,44,99,61,48,41,58,
-,0,0,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,4,
-,111,100,101,0,0,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,11,2,0,0,0,0,0,0,0,0,0,0,
-,3,0,0,32,2,0,3,11,3,0,0,0,0,0,0,
-,0,0,0,28,4,0,0,32,3,0,4,11,4,0,0,
-,0,0,0,0,0,0,0,28,5,0,0,32,4,0,5,
-,10,0,54,32,32,32,32,105,102,32,110,111,116,32,105,
-,116,121,112,101,40,105,44,39,110,117,109,98,101,114,39,
-,58,32,114,97,105,115,101,0,0,0,0,12,8,0,6,
-,115,116,121,112,101,0,0,13,7,8,0,15,8,1,0,
-,9,0,6,110,117,109,98,101,114,0,0,31,6,8,2,
-,6,7,6,47,5,6,0,21,5,0,0,18,0,0,4,
-,5,0,0,37,5,0,0,18,0,0,1,30,10,0,55,
-,32,32,32,105,102,32,110,111,116,32,105,115,116,121,112,
-,40,97,44,39,110,117,109,98,101,114,39,41,58,32,114,
-,105,115,101,0,0,0,0,12,8,0,6,105,115,116,121,
-,101,0,0,13,7,8,0,15,8,2,0,12,9,0,6,
+,7,0,7,99,111,100,101,95,49,54,0,13,6,7,0,
+,10,0,3,80,79,83,0,13,7,10,0,12,11,0,3,
+,101,110,0,13,10,11,0,15,11,4,0,31,8,11,1,
+,8,10,8,11,10,0,0,0,0,0,0,0,0,16,64,
+,8,8,10,15,9,2,0,31,5,7,3,19,5,6,5,
+,7,0,5,119,114,105,116,101,0,0,0,13,6,7,0,
+,7,4,0,31,5,7,1,19,5,6,5,0,0,0,0,
+,8,0,6,115,101,116,112,111,115,0,0,14,8,7,0,
+,8,0,110,44,13,0,0,28,2,0,0,9,1,0,2,
+,2,0,0,0,0,0,0,0,0,0,0,28,3,0,0,
+,2,0,3,11,3,0,0,0,0,0,0,0,0,0,0,
+,4,0,0,32,3,0,4,11,4,0,0,0,0,0,0,
+,0,0,0,28,5,0,0,32,4,0,5,11,5,0,0,
+,0,0,0,0,0,0,0,12,8,0,6,105,115,116,121,
+,101,0,0,13,7,8,0,15,8,1,0,12,9,0,6,
 ,117,109,98,101,114,0,0,31,6,8,2,19,6,7,6,
-,5,6,0,21,5,0,0,18,0,0,4,28,5,0,0,
-,5,0,0,18,0,0,1,30,10,0,56,32,32,32,32,
-,102,32,110,111,116,32,105,115,116,121,112,101,40,98,44,
-,110,117,109,98,101,114,39,41,58,32,114,97,105,115,101,
+,5,5,6,21,5,0,0,18,0,0,4,28,5,0,0,
+,5,0,0,18,0,0,1,11,5,0,0,0,0,0,0,
 ,0,0,0,12,8,0,6,105,115,116,121,112,101,0,0,
-,7,8,0,15,8,3,0,12,9,0,6,110,117,109,98,
-,114,0,0,31,6,8,2,19,6,7,6,47,5,6,0,
+,7,8,0,15,8,2,0,12,9,0,6,110,117,109,98,
+,114,0,0,31,6,8,2,19,6,7,6,23,5,5,6,
 ,5,0,0,18,0,0,4,28,5,0,0,37,5,0,0,
-,0,0,1,30,10,0,57,32,32,32,32,105,102,32,110,
-,116,32,105,115,116,121,112,101,40,99,44,39,110,117,109,
-,101,114,39,41,58,32,114,97,105,115,101,0,0,0,0,
+,0,0,1,11,5,0,0,0,0,0,0,0,0,0,0,
 ,8,0,6,105,115,116,121,112,101,0,0,13,7,8,0,
-,8,4,0,12,9,0,6,110,117,109,98,101,114,0,0,
-,6,8,2,19,6,7,6,47,5,6,0,21,5,0,0,
+,8,3,0,12,9,0,6,110,117,109,98,101,114,0,0,
+,6,8,2,19,6,7,6,23,5,5,6,21,5,0,0,
 ,0,0,4,28,5,0,0,37,5,0,0,18,0,0,1,
-,7,0,58,32,32,32,32,119,114,105,116,101,40,40,39,
-,111,100,101,39,44,105,44,97,44,98,44,99,41,41,0,
-,7,0,5,119,114,105,116,101,0,0,0,13,6,7,0,
-,8,0,4,99,111,100,101,0,0,0,0,15,9,1,0,
-,10,2,0,15,11,3,0,15,12,4,0,27,7,8,5,
-,5,7,1,19,5,6,5,0,0,0,0,12,7,0,4,
-,111,100,101,0,0,0,0,14,7,6,0,30,5,0,59,
-,101,102,32,99,111,100,101,95,49,54,40,105,44,97,44,
-,41,58,0,16,7,0,80,44,11,0,0,30,5,0,59,
-,101,102,32,99,111,100,101,95,49,54,40,105,44,97,44,
-,41,58,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,7,
-,111,100,101,95,49,54,0,34,1,0,0,28,2,0,0,
-,1,0,2,28,3,0,0,9,2,0,3,28,4,0,0,
-,3,0,4,30,7,0,60,32,32,32,32,105,102,32,98,
-,60,32,48,58,32,98,32,43,61,32,48,120,56,48,48,
-,0,0,0,11,5,0,0,0,0,0,0,0,0,0,0,
-,4,3,5,21,4,0,0,18,0,0,7,11,5,0,0,
-,0,0,0,0,0,224,64,1,4,3,5,15,3,4,0,
-,0,0,1,30,10,0,61,32,32,32,32,99,111,100,101,
-,105,44,97,44,40,98,38,48,120,102,102,48,48,41,62,
-,56,44,40,98,38,48,120,102,102,41,62,62,48,41,0,
-,6,0,4,99,111,100,101,0,0,0,0,13,5,6,0,
-,6,1,0,15,7,2,0,11,10,0,0,0,0,0,0,
-,224,239,64,6,8,3,10,11,10,0,0,0,0,0,0,
-,0,32,64,41,8,8,10,11,10,0,0,0,0,0,0,
-,224,111,64,6,9,3,10,11,10,0,0,0,0,0,0,
-,0,0,0,41,9,9,10,31,4,6,4,19,4,5,4,
-,0,0,0,12,8,0,7,99,111,100,101,95,49,54,0,
-,8,7,0,30,6,0,62,100,101,102,32,103,101,116,95,
-,111,100,101,49,54,40,105,44,97,44,98,41,58,0,0,
-,8,0,64,44,11,0,0,30,6,0,62,100,101,102,32,
-,101,116,95,99,111,100,101,49,54,40,105,44,97,44,98,
-,58,0,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,10,
-,101,116,95,99,111,100,101,49,54,0,0,34,1,0,0,
+,5,0,0,0,0,0,0,0,0,0,0,12,8,0,6,
+,115,116,121,112,101,0,0,13,7,8,0,15,8,4,0,
+,9,0,6,110,117,109,98,101,114,0,0,31,6,8,2,
+,6,7,6,23,5,5,6,21,5,0,0,18,0,0,4,
+,5,0,0,37,5,0,0,18,0,0,1,12,7,0,5,
+,114,105,116,101,0,0,0,13,6,7,0,12,8,0,4,
+,111,100,101,0,0,0,0,15,9,1,0,15,10,2,0,
+,11,3,0,15,12,4,0,27,7,8,5,31,5,7,1,
+,5,6,5,0,0,0,0,12,9,0,4,99,111,100,101,
+,0,0,0,14,9,8,0,16,9,0,45,44,11,0,0,
 ,2,0,0,9,1,0,2,28,3,0,0,9,2,0,3,
-,4,0,0,9,3,0,4,30,13,0,63,32,32,32,32,
-,101,116,117,114,110,32,40,39,99,111,100,101,39,44,105,
-,97,44,40,98,38,48,120,102,102,48,48,41,62,62,56,
-,40,98,38,48,120,102,102,41,62,62,48,41,0,0,0,
-,5,0,4,99,111,100,101,0,0,0,0,15,6,1,0,
-,7,2,0,11,10,0,0,0,0,0,0,0,224,239,64,
-,8,3,10,11,10,0,0,0,0,0,0,0,0,32,64,
-,8,8,10,11,10,0,0,0,0,0,0,0,224,111,64,
-,9,3,10,11,10,0,0,0,0,0,0,0,0,0,0,
-,9,9,10,27,4,5,5,20,4,0,0,0,0,0,0,
-,9,0,10,103,101,116,95,99,111,100,101,49,54,0,0,
-,9,8,0,30,7,0,65,100,101,102,32,95,100,111,95,
-,116,114,105,110,103,40,118,44,114,61,78,111,110,101,41,
-,0,0,0,16,9,0,113,44,11,0,0,30,7,0,65,
-,101,102,32,95,100,111,95,115,116,114,105,110,103,40,118,
-,114,61,78,111,110,101,41,58,0,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,10,95,100,111,95,115,116,114,105,
-,103,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,2,0,0,28,3,0,0,32,2,0,3,30,5,0,66,
-,32,32,32,114,32,61,32,103,101,116,95,116,109,112,40,
-,41,0,0,12,5,0,7,103,101,116,95,116,109,112,0,
-,4,5,0,15,5,2,0,31,3,5,1,19,3,4,3,
-,2,3,0,30,8,0,67,32,32,32,32,118,97,108,32,
-,32,118,32,43,32,34,92,48,34,42,40,52,45,108,101,
-,40,118,41,37,52,41,0,12,5,0,1,0,0,0,0,
-,6,0,0,0,0,0,0,0,0,16,64,12,9,0,3,
-,101,110,0,13,8,9,0,15,9,1,0,31,7,9,1,
-,7,8,7,11,8,0,0,0,0,0,0,0,0,16,64,
-,7,7,8,2,6,6,7,3,5,5,6,1,4,1,5,
-,3,4,0,30,8,0,68,32,32,32,32,99,111,100,101,
-,49,54,40,83,84,82,73,78,71,44,114,44,108,101,110,
-,118,41,41,0,0,0,0,12,6,0,7,99,111,100,101,
+,4,0,0,9,3,0,4,11,5,0,0,0,0,0,0,
+,0,0,0,25,4,3,5,21,4,0,0,18,0,0,7,
+,5,0,0,0,0,0,0,0,0,224,64,1,4,3,5,
+,3,4,0,18,0,0,1,12,6,0,4,99,111,100,101,
+,0,0,0,13,5,6,0,15,6,1,0,15,7,2,0,
+,10,0,0,0,0,0,0,0,224,239,64,6,8,3,10,
+,10,0,0,0,0,0,0,0,0,32,64,41,8,8,10,
+,10,0,0,0,0,0,0,0,224,111,64,6,9,3,10,
+,10,0,0,0,0,0,0,0,0,0,0,41,9,9,10,
+,4,6,4,19,4,5,4,0,0,0,0,12,10,0,7,
+,111,100,101,95,49,54,0,14,10,9,0,16,10,0,32,
+,11,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
+,2,0,3,28,4,0,0,9,3,0,4,12,5,0,4,
+,111,100,101,0,0,0,0,15,6,1,0,15,7,2,0,
+,10,0,0,0,0,0,0,0,224,239,64,6,8,3,10,
+,10,0,0,0,0,0,0,0,0,32,64,41,8,8,10,
+,10,0,0,0,0,0,0,0,224,111,64,6,9,3,10,
+,10,0,0,0,0,0,0,0,0,0,0,41,9,9,10,
+,4,5,5,20,4,0,0,0,0,0,0,12,11,0,10,
+,101,116,95,99,111,100,101,49,54,0,0,14,11,10,0,
+,11,0,60,44,11,0,0,28,2,0,0,9,1,0,2,
+,2,0,0,28,3,0,0,32,2,0,3,12,5,0,7,
+,101,116,95,116,109,112,0,13,4,5,0,15,5,2,0,
+,3,5,1,19,3,4,3,15,2,3,0,12,5,0,1,
+,0,0,0,11,6,0,0,0,0,0,0,0,0,16,64,
+,9,0,3,108,101,110,0,13,8,9,0,15,9,1,0,
+,7,9,1,19,7,8,7,11,8,0,0,0,0,0,0,
+,0,16,64,39,7,7,8,2,6,6,7,3,5,5,6,
+,4,1,5,15,3,4,0,12,6,0,7,99,111,100,101,
 ,49,54,0,13,5,6,0,12,9,0,6,83,84,82,73,
 ,71,0,0,13,6,9,0,15,7,2,0,12,10,0,3,
 ,101,110,0,13,9,10,0,15,10,1,0,31,8,10,1,
-,8,9,8,31,4,6,3,19,4,5,4,30,4,0,69,
-,32,32,32,119,114,105,116,101,40,118,97,108,41,0,0,
-,6,0,5,119,114,105,116,101,0,0,0,13,5,6,0,
-,6,3,0,31,4,6,1,19,4,5,4,30,4,0,70,
-,32,32,32,114,101,116,117,114,110,32,114,0,0,0,0,
-,2,0,0,0,0,0,0,12,10,0,10,95,100,111,95,
-,116,114,105,110,103,0,0,14,10,9,0,30,7,0,71,
-,101,102,32,100,111,95,115,116,114,105,110,103,40,116,44,
-,61,78,111,110,101,41,58,0,0,0,0,16,10,0,48,
-,8,0,0,30,7,0,71,100,101,102,32,100,111,95,115,
-,114,105,110,103,40,116,44,114,61,78,111,110,101,41,58,
-,0,0,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,9,
-,111,95,115,116,114,105,110,103,0,0,0,34,1,0,0,
+,8,9,8,31,4,6,3,19,4,5,4,12,6,0,5,
+,114,105,116,101,0,0,0,13,5,6,0,15,6,3,0,
+,4,6,1,19,4,5,4,20,2,0,0,0,0,0,0,
+,12,0,10,95,100,111,95,115,116,114,105,110,103,0,0,
+,12,11,0,16,12,0,20,44,8,0,0,28,2,0,0,
+,1,0,2,28,2,0,0,28,3,0,0,32,2,0,3,
+,5,0,10,95,100,111,95,115,116,114,105,110,103,0,0,
+,4,5,0,12,7,0,3,118,97,108,0,9,5,1,7,
+,6,2,0,31,3,5,2,19,3,4,3,20,3,0,0,
+,0,0,0,12,13,0,9,100,111,95,115,116,114,105,110,
+,0,0,0,14,13,12,0,16,13,0,53,44,10,0,0,
 ,2,0,0,9,1,0,2,28,2,0,0,28,3,0,0,
-,2,0,3,30,8,0,72,32,32,32,32,114,101,116,117,
-,110,32,95,100,111,95,115,116,114,105,110,103,40,116,46,
-,97,108,44,114,41,0,0,12,5,0,10,95,100,111,95,
-,116,114,105,110,103,0,0,13,4,5,0,12,7,0,3,
-,97,108,0,9,5,1,7,15,6,2,0,31,3,5,2,
-,3,4,3,20,3,0,0,0,0,0,0,12,11,0,9,
-,111,95,115,116,114,105,110,103,0,0,0,14,11,10,0,
-,7,0,74,100,101,102,32,95,100,111,95,110,117,109,98,
-,114,40,118,44,114,61,78,111,110,101,41,58,0,0,0,
-,11,0,98,44,10,0,0,30,7,0,74,100,101,102,32,
-,100,111,95,110,117,109,98,101,114,40,118,44,114,61,78,
-,110,101,41,58,0,0,0,12,1,0,14,99,111,114,101,
-,101,110,99,111,100,101,46,112,121,0,0,33,1,0,0,
-,1,0,10,95,100,111,95,110,117,109,98,101,114,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,28,2,0,0,
-,3,0,0,32,2,0,3,30,5,0,75,32,32,32,32,
-,32,61,32,103,101,116,95,116,109,112,40,114,41,0,0,
-,5,0,7,103,101,116,95,116,109,112,0,13,4,5,0,
-,5,2,0,31,3,5,1,19,3,4,3,15,2,3,0,
-,6,0,76,32,32,32,32,99,111,100,101,40,78,85,77,
-,69,82,44,114,44,48,44,48,41,0,0,12,5,0,4,
-,111,100,101,0,0,0,0,13,4,5,0,12,9,0,6,
-,85,77,66,69,82,0,0,13,5,9,0,15,6,2,0,
-,7,0,0,0,0,0,0,0,0,0,0,11,8,0,0,
-,0,0,0,0,0,0,0,31,3,5,4,19,3,4,3,
-,7,0,77,32,32,32,32,119,114,105,116,101,40,102,112,
-,99,107,40,110,117,109,98,101,114,40,118,41,41,41,0,
-,5,0,5,119,114,105,116,101,0,0,0,13,4,5,0,
-,7,0,5,102,112,97,99,107,0,0,0,13,6,7,0,
-,9,0,6,110,117,109,98,101,114,0,0,13,8,9,0,
-,9,1,0,31,7,9,1,19,7,8,7,31,5,7,1,
-,5,6,5,31,3,5,1,19,3,4,3,30,4,0,78,
-,32,32,32,114,101,116,117,114,110,32,114,0,0,0,0,
-,2,0,0,0,0,0,0,12,12,0,10,95,100,111,95,
-,117,109,98,101,114,0,0,14,12,11,0,30,7,0,79,
-,101,102,32,100,111,95,110,117,109,98,101,114,40,116,44,
-,61,78,111,110,101,41,58,0,0,0,0,16,12,0,48,
-,8,0,0,30,7,0,79,100,101,102,32,100,111,95,110,
-,109,98,101,114,40,116,44,114,61,78,111,110,101,41,58,
-,0,0,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,9,
-,111,95,110,117,109,98,101,114,0,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,28,2,0,0,28,3,0,0,
-,2,0,3,30,8,0,80,32,32,32,32,114,101,116,117,
-,110,32,95,100,111,95,110,117,109,98,101,114,40,116,46,
-,97,108,44,114,41,0,0,12,5,0,10,95,100,111,95,
-,117,109,98,101,114,0,0,13,4,5,0,12,7,0,3,
-,97,108,0,9,5,1,7,15,6,2,0,31,3,5,2,
-,3,4,3,20,3,0,0,0,0,0,0,12,13,0,9,
-,111,95,110,117,109,98,101,114,0,0,0,14,13,12,0,
-,4,0,82,100,101,102,32,103,101,116,95,116,97,103,40,
-,58,0,0,16,13,0,68,44,6,0,0,30,4,0,82,
-,101,102,32,103,101,116,95,116,97,103,40,41,58,0,0,
-,1,0,14,99,111,114,101,47,101,110,99,111,100,101,46,
-,121,0,0,33,1,0,0,12,1,0,7,103,101,116,95,
-,97,103,0,34,1,0,0,30,6,0,83,32,32,32,32,
-,32,61,32,115,116,114,40,68,46,95,116,97,103,105,41,
-,0,0,0,12,4,0,3,115,116,114,0,13,3,4,0,
-,5,0,1,68,0,0,0,13,4,5,0,12,5,0,5,
-,116,97,103,105,0,0,0,9,4,4,5,31,2,4,1,
-,2,3,2,15,1,2,0,30,5,0,84,32,32,32,32,
-,46,95,116,97,103,105,32,43,61,32,49,0,0,0,0,
+,2,0,3,12,5,0,7,103,101,116,95,116,109,112,0,
+,4,5,0,15,5,2,0,31,3,5,1,19,3,4,3,
+,2,3,0,12,5,0,4,99,111,100,101,0,0,0,0,
+,4,5,0,12,9,0,6,78,85,77,66,69,82,0,0,
+,5,9,0,15,6,2,0,11,7,0,0,0,0,0,0,
+,0,0,0,11,8,0,0,0,0,0,0,0,0,0,0,
+,3,5,4,19,3,4,3,12,5,0,5,119,114,105,116,
+,0,0,0,13,4,5,0,12,7,0,5,102,112,97,99,
+,0,0,0,13,6,7,0,12,9,0,6,110,117,109,98,
+,114,0,0,13,8,9,0,15,9,1,0,31,7,9,1,
+,7,8,7,31,5,7,1,19,5,6,5,31,3,5,1,
+,3,4,3,20,2,0,0,0,0,0,0,12,14,0,10,
+,100,111,95,110,117,109,98,101,114,0,0,14,14,13,0,
+,14,0,20,44,8,0,0,28,2,0,0,9,1,0,2,
+,2,0,0,28,3,0,0,32,2,0,3,12,5,0,10,
+,100,111,95,110,117,109,98,101,114,0,0,13,4,5,0,
+,7,0,3,118,97,108,0,9,5,1,7,15,6,2,0,
+,3,5,2,19,3,4,3,20,3,0,0,0,0,0,0,
+,15,0,9,100,111,95,110,117,109,98,101,114,0,0,0,
+,15,14,0,16,15,0,35,44,6,0,0,12,4,0,3,
+,116,114,0,13,3,4,0,12,5,0,1,68,0,0,0,
+,4,5,0,12,5,0,5,95,116,97,103,105,0,0,0,
+,4,4,5,31,2,4,1,19,2,3,2,15,1,2,0,
 ,3,0,1,68,0,0,0,13,2,3,0,12,4,0,1,
 ,0,0,0,13,3,4,0,12,4,0,5,95,116,97,103,
 ,0,0,0,9,3,3,4,11,4,0,0,0,0,0,0,
 ,0,240,63,1,3,3,4,12,4,0,5,95,116,97,103,
-,0,0,0,10,2,4,3,30,4,0,85,32,32,32,32,
-,101,116,117,114,110,32,107,0,0,0,0,20,1,0,0,
-,0,0,0,12,14,0,7,103,101,116,95,116,97,103,0,
-,14,13,0,30,5,0,86,100,101,102,32,115,116,97,99,
-,95,116,97,103,40,41,58,0,0,0,0,16,14,0,60,
-,5,0,0,30,5,0,86,100,101,102,32,115,116,97,99,
-,95,116,97,103,40,41,58,0,0,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,9,115,116,97,99,107,95,116,97,
-,0,0,0,34,1,0,0,30,5,0,87,32,32,32,32,
-,32,61,32,103,101,116,95,116,97,103,40,41,0,0,0,
-,4,0,7,103,101,116,95,116,97,103,0,13,3,4,0,
-,2,0,0,19,2,3,2,15,1,2,0,30,6,0,88,
-,32,32,32,68,46,116,115,116,97,99,107,46,97,112,112,
-,110,100,40,107,41,0,0,12,4,0,1,68,0,0,0,
-,3,4,0,12,4,0,6,116,115,116,97,99,107,0,0,
-,3,3,4,12,4,0,6,97,112,112,101,110,100,0,0,
-,3,3,4,15,4,1,0,31,2,4,1,19,2,3,2,
-,4,0,89,32,32,32,32,114,101,116,117,114,110,32,107,
-,0,0,0,20,1,0,0,0,0,0,0,12,15,0,9,
-,116,97,99,107,95,116,97,103,0,0,0,14,15,14,0,
-,4,0,90,100,101,102,32,112,111,112,95,116,97,103,40,
-,58,0,0,16,15,0,36,44,4,0,0,30,4,0,90,
-,101,102,32,112,111,112,95,116,97,103,40,41,58,0,0,
-,1,0,14,99,111,114,101,47,101,110,99,111,100,101,46,
-,121,0,0,33,1,0,0,12,1,0,7,112,111,112,95,
-,97,103,0,34,1,0,0,30,5,0,91,32,32,32,32,
-,46,116,115,116,97,99,107,46,112,111,112,40,41,0,0,
+,0,0,0,10,2,4,3,20,1,0,0,0,0,0,0,
+,16,0,7,103,101,116,95,116,97,103,0,14,16,15,0,
+,16,0,25,44,5,0,0,12,4,0,7,103,101,116,95,
+,97,103,0,13,3,4,0,31,2,0,0,19,2,3,2,
+,1,2,0,12,4,0,1,68,0,0,0,13,3,4,0,
+,4,0,6,116,115,116,97,99,107,0,0,9,3,3,4,
+,4,0,6,97,112,112,101,110,100,0,0,9,3,3,4,
+,4,1,0,31,2,4,1,19,2,3,2,20,1,0,0,
+,0,0,0,12,17,0,9,115,116,97,99,107,95,116,97,
+,0,0,0,14,17,16,0,16,17,0,15,44,4,0,0,
 ,3,0,1,68,0,0,0,13,2,3,0,12,3,0,6,
 ,115,116,97,99,107,0,0,9,2,2,3,12,3,0,3,
 ,111,112,0,9,2,2,3,31,1,0,0,19,1,2,1,
-,0,0,0,12,16,0,7,112,111,112,95,116,97,103,0,
-,16,15,0,30,4,0,93,100,101,102,32,116,97,103,40,
-,116,41,58,0,0,0,0,16,16,0,87,44,12,0,0,
-,4,0,93,100,101,102,32,116,97,103,40,42,116,41,58,
-,0,0,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,3,
-,97,103,0,34,1,0,0,12,2,0,1,42,0,0,0,
-,1,0,2,30,13,0,94,32,32,32,32,116,32,61,32,
-,46,115,110,117,109,43,39,58,39,43,39,58,39,46,106,
-,105,110,40,91,115,116,114,40,118,41,32,102,111,114,32,
-,32,105,110,32,116,93,41,0,0,0,0,12,3,0,1,
-,0,0,0,13,2,3,0,12,3,0,4,115,110,117,109,
-,0,0,0,9,2,2,3,12,3,0,1,58,0,0,0,
-,2,2,3,12,4,0,1,58,0,0,0,12,5,0,4,
-,111,105,110,0,0,0,0,9,4,4,5,27,6,0,0,
-,8,0,0,0,0,0,0,0,0,0,0,42,7,1,8,
-,0,0,10,12,11,0,3,115,116,114,0,13,10,11,0,
-,11,7,0,31,9,11,1,19,9,10,9,28,10,0,0,
-,6,10,9,18,0,255,246,15,5,6,0,31,3,5,1,
-,3,4,3,1,2,2,3,15,1,2,0,30,6,0,95,
-,32,32,32,105,110,115,101,114,116,40,40,39,116,97,103,
-,44,116,41,41,0,0,0,12,4,0,6,105,110,115,101,
+,0,0,0,12,18,0,7,112,111,112,95,116,97,103,0,
+,18,17,0,16,18,0,52,44,12,0,0,12,2,0,1,
+,0,0,0,9,1,0,2,12,3,0,1,68,0,0,0,
+,2,3,0,12,3,0,4,115,110,117,109,0,0,0,0,
+,2,2,3,12,3,0,1,58,0,0,0,1,2,2,3,
+,4,0,1,58,0,0,0,12,5,0,4,106,111,105,110,
+,0,0,0,9,4,4,5,27,6,0,0,11,8,0,0,
+,0,0,0,0,0,0,0,42,7,1,8,18,0,0,10,
+,11,0,3,115,116,114,0,13,10,11,0,15,11,7,0,
+,9,11,1,19,9,10,9,28,10,0,0,10,6,10,9,
+,0,255,246,15,5,6,0,31,3,5,1,19,3,4,3,
+,2,2,3,15,1,2,0,12,4,0,6,105,110,115,101,
 ,116,0,0,13,3,4,0,12,8,0,3,116,97,103,0,
 ,9,1,0,27,4,8,2,31,2,4,1,19,2,3,2,
-,0,0,0,12,17,0,3,116,97,103,0,14,17,16,0,
-,4,0,96,100,101,102,32,106,117,109,112,40,42,116,41,
-,0,0,0,16,17,0,89,44,12,0,0,30,4,0,96,
-,101,102,32,106,117,109,112,40,42,116,41,58,0,0,0,
-,1,0,14,99,111,114,101,47,101,110,99,111,100,101,46,
-,121,0,0,33,1,0,0,12,1,0,4,106,117,109,112,
-,0,0,0,34,1,0,0,12,2,0,1,42,0,0,0,
-,1,0,2,30,13,0,97,32,32,32,32,116,32,61,32,
-,46,115,110,117,109,43,39,58,39,43,39,58,39,46,106,
-,105,110,40,91,115,116,114,40,118,41,32,102,111,114,32,
-,32,105,110,32,116,93,41,0,0,0,0,12,3,0,1,
-,0,0,0,13,2,3,0,12,3,0,4,115,110,117,109,
-,0,0,0,9,2,2,3,12,3,0,1,58,0,0,0,
-,2,2,3,12,4,0,1,58,0,0,0,12,5,0,4,
-,111,105,110,0,0,0,0,9,4,4,5,27,6,0,0,
-,8,0,0,0,0,0,0,0,0,0,0,42,7,1,8,
-,0,0,10,12,11,0,3,115,116,114,0,13,10,11,0,
-,11,7,0,31,9,11,1,19,9,10,9,28,10,0,0,
-,6,10,9,18,0,255,246,15,5,6,0,31,3,5,1,
-,3,4,3,1,2,2,3,15,1,2,0,30,6,0,98,
-,32,32,32,105,110,115,101,114,116,40,40,39,106,117,109,
-,39,44,116,41,41,0,0,12,4,0,6,105,110,115,101,
-,116,0,0,13,3,4,0,12,8,0,4,106,117,109,112,
-,0,0,0,15,9,1,0,27,4,8,2,31,2,4,1,
-,2,3,2,0,0,0,0,12,18,0,4,106,117,109,112,
-,0,0,0,14,18,17,0,30,4,0,99,100,101,102,32,
-,101,116,106,109,112,40,42,116,41,58,0,16,18,0,90,
-,12,0,0,30,4,0,99,100,101,102,32,115,101,116,106,
-,112,40,42,116,41,58,0,12,1,0,14,99,111,114,101,
-,101,110,99,111,100,101,46,112,121,0,0,33,1,0,0,
-,1,0,6,115,101,116,106,109,112,0,0,34,1,0,0,
-,2,0,1,42,0,0,0,9,1,0,2,30,13,0,100,
-,32,32,32,116,32,61,32,68,46,115,110,117,109,43,39,
-,39,43,39,58,39,46,106,111,105,110,40,91,115,116,114,
-,118,41,32,102,111,114,32,118,32,105,110,32,116,93,41,
-,0,0,0,12,3,0,1,68,0,0,0,13,2,3,0,
+,0,0,0,12,19,0,3,116,97,103,0,14,19,18,0,
+,19,0,53,44,12,0,0,12,2,0,1,42,0,0,0,
+,1,0,2,12,3,0,1,68,0,0,0,13,2,3,0,
 ,3,0,4,115,110,117,109,0,0,0,0,9,2,2,3,
 ,3,0,1,58,0,0,0,1,2,2,3,12,4,0,1,
 ,0,0,0,12,5,0,4,106,111,105,110,0,0,0,0,
 ,22 → 2054,26
 ,116,114,0,13,10,11,0,15,11,7,0,31,9,11,1,
 ,9,10,9,28,10,0,0,10,6,10,9,18,0,255,246,
 ,5,6,0,31,3,5,1,19,3,4,3,1,2,2,3,
-,1,2,0,30,7,0,101,32,32,32,32,105,110,115,101,
-,116,40,40,39,115,101,116,106,109,112,39,44,116,41,41,
-,0,0,0,12,4,0,6,105,110,115,101,114,116,0,0,
-,3,4,0,12,8,0,6,115,101,116,106,109,112,0,0,
+,1,2,0,12,4,0,6,105,110,115,101,114,116,0,0,
+,3,4,0,12,8,0,4,106,117,109,112,0,0,0,0,
 ,9,1,0,27,4,8,2,31,2,4,1,19,2,3,2,
-,0,0,0,12,19,0,6,115,101,116,106,109,112,0,0,
-,19,18,0,30,4,0,102,100,101,102,32,102,110,99,40,
-,116,41,58,0,0,0,0,16,19,0,108,44,12,0,0,
-,4,0,102,100,101,102,32,102,110,99,40,42,116,41,58,
-,0,0,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,3,
-,110,99,0,34,1,0,0,12,2,0,1,42,0,0,0,
-,1,0,2,30,13,0,103,32,32,32,32,116,32,61,32,
-,46,115,110,117,109,43,39,58,39,43,39,58,39,46,106,
-,105,110,40,91,115,116,114,40,118,41,32,102,111,114,32,
-,32,105,110,32,116,93,41,0,0,0,0,12,3,0,1,
+,0,0,0,12,20,0,4,106,117,109,112,0,0,0,0,
+,20,19,0,16,20,0,53,44,12,0,0,12,2,0,1,
+,0,0,0,9,1,0,2,12,3,0,1,68,0,0,0,
+,2,3,0,12,3,0,4,115,110,117,109,0,0,0,0,
+,2,2,3,12,3,0,1,58,0,0,0,1,2,2,3,
+,4,0,1,58,0,0,0,12,5,0,4,106,111,105,110,
+,0,0,0,9,4,4,5,27,6,0,0,11,8,0,0,
+,0,0,0,0,0,0,0,42,7,1,8,18,0,0,10,
+,11,0,3,115,116,114,0,13,10,11,0,15,11,7,0,
+,9,11,1,19,9,10,9,28,10,0,0,10,6,10,9,
+,0,255,246,15,5,6,0,31,3,5,1,19,3,4,3,
+,2,2,3,15,1,2,0,12,4,0,6,105,110,115,101,
+,116,0,0,13,3,4,0,12,8,0,6,115,101,116,106,
+,112,0,0,15,9,1,0,27,4,8,2,31,2,4,1,
+,2,3,2,0,0,0,0,12,21,0,6,115,101,116,106,
+,112,0,0,14,21,20,0,16,21,0,62,44,12,0,0,
+,2,0,1,42,0,0,0,9,1,0,2,12,3,0,1,
 ,0,0,0,13,2,3,0,12,3,0,4,115,110,117,109,
 ,0,0,0,9,2,2,3,12,3,0,1,58,0,0,0,
 ,2,2,3,12,4,0,1,58,0,0,0,12,5,0,4,
 ,157 → 2082,84
 ,0,0,10,12,11,0,3,115,116,114,0,13,10,11,0,
 ,11,7,0,31,9,11,1,19,9,10,9,28,10,0,0,
 ,6,10,9,18,0,255,246,15,5,6,0,31,3,5,1,
-,3,4,3,1,2,2,3,15,1,2,0,30,5,0,104,
-,32,32,32,114,32,61,32,103,101,116,95,114,101,103,40,
-,41,0,0,12,5,0,7,103,101,116,95,114,101,103,0,
-,4,5,0,15,5,1,0,31,3,5,1,19,3,4,3,
-,2,3,0,30,6,0,105,32,32,32,32,105,110,115,101,
-,116,40,40,39,102,110,99,39,44,114,44,116,41,41,0,
-,5,0,6,105,110,115,101,114,116,0,0,13,4,5,0,
-,8,0,3,102,110,99,0,15,9,2,0,15,10,1,0,
-,5,8,3,31,3,5,1,19,3,4,3,30,4,0,106,
-,32,32,32,114,101,116,117,114,110,32,114,0,0,0,0,
-,2,0,0,0,0,0,0,12,20,0,3,102,110,99,0,
-,20,19,0,30,4,0,108,100,101,102,32,109,97,112,95,
-,97,103,115,40,41,58,0,16,20,2,176,44,17,0,0,
-,4,0,108,100,101,102,32,109,97,112,95,116,97,103,115,
-,41,58,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,8,
-,97,112,95,116,97,103,115,0,0,0,0,34,1,0,0,
-,4,0,109,32,32,32,32,116,97,103,115,32,61,32,123,
-,0,0,0,26,2,0,0,15,1,2,0,30,4,0,110,
-,32,32,32,111,117,116,32,61,32,91,93,0,0,0,0,
-,3,0,0,15,2,3,0,30,3,0,111,32,32,32,32,
-,32,61,32,48,0,0,0,11,4,0,0,0,0,0,0,
-,0,0,0,15,3,4,0,30,6,0,112,32,32,32,32,
-,111,114,32,105,116,101,109,32,105,110,32,68,46,111,117,
-,58,0,0,12,6,0,1,68,0,0,0,13,5,6,0,
+,3,4,3,1,2,2,3,15,1,2,0,12,5,0,7,
+,101,116,95,114,101,103,0,13,4,5,0,15,5,1,0,
+,3,5,1,19,3,4,3,15,2,3,0,12,5,0,6,
+,110,115,101,114,116,0,0,13,4,5,0,12,8,0,3,
+,110,99,0,15,9,2,0,15,10,1,0,27,5,8,3,
+,3,5,1,19,3,4,3,20,2,0,0,0,0,0,0,
+,22,0,3,102,110,99,0,14,22,21,0,16,22,1,119,
+,17,0,0,26,2,0,0,15,1,2,0,27,3,0,0,
+,2,3,0,11,4,0,0,0,0,0,0,0,0,0,0,
+,3,4,0,12,6,0,1,68,0,0,0,13,5,6,0,
 ,6,0,3,111,117,116,0,9,5,5,6,11,6,0,0,
-,0,0,0,0,0,0,0,42,4,5,6,18,0,0,145,
-,8,0,113,32,32,32,32,32,32,32,32,105,102,32,105,
-,101,109,91,48,93,32,61,61,32,39,116,97,103,39,58,
-,0,0,0,11,8,0,0,0,0,0,0,0,0,0,0,
-,7,4,8,12,8,0,3,116,97,103,0,23,7,7,8,
-,7,0,0,18,0,0,24,30,8,0,114,32,32,32,32,
-,32,32,32,32,32,32,32,116,97,103,115,91,105,116,101,
-,91,49,93,93,32,61,32,110,0,0,0,11,8,0,0,
-,0,0,0,0,0,240,63,9,7,4,8,10,1,7,3,
-,6,0,115,32,32,32,32,32,32,32,32,32,32,32,32,
-,111,110,116,105,110,117,101,0,0,0,0,18,0,255,215,
-,0,0,1,30,8,0,116,32,32,32,32,32,32,32,32,
-,102,32,105,116,101,109,91,48,93,32,61,61,32,39,114,
-,103,115,39,58,0,0,0,11,8,0,0,0,0,0,0,
-,0,0,0,9,7,4,8,12,8,0,4,114,101,103,115,
-,0,0,0,23,7,7,8,21,7,0,0,18,0,0,59,
-,13,0,117,32,32,32,32,32,32,32,32,32,32,32,32,
-,117,116,46,97,112,112,101,110,100,40,103,101,116,95,99,
-,100,101,49,54,40,82,69,71,83,44,105,116,101,109,91,
-,93,44,48,41,41,0,0,12,9,0,6,97,112,112,101,
+,0,0,0,0,0,0,0,42,4,5,6,18,0,0,71,
+,8,0,0,0,0,0,0,0,0,0,0,9,7,4,8,
+,8,0,3,116,97,103,0,23,7,7,8,21,7,0,0,
+,0,0,8,11,8,0,0,0,0,0,0,0,0,240,63,
+,7,4,8,10,1,7,3,18,0,255,240,18,0,0,1,
+,8,0,0,0,0,0,0,0,0,0,0,9,7,4,8,
+,8,0,4,114,101,103,115,0,0,0,0,23,7,7,8,
+,7,0,0,18,0,0,32,12,9,0,6,97,112,112,101,
 ,100,0,0,9,8,2,9,12,11,0,10,103,101,116,95,
 ,111,100,101,49,54,0,0,13,10,11,0,12,14,0,4,
 ,69,71,83,0,0,0,0,13,11,14,0,11,14,0,0,
 ,0,0,0,0,0,240,63,9,12,4,14,11,13,0,0,
 ,0,0,0,0,0,0,0,31,9,11,3,19,9,10,9,
-,7,9,1,19,7,8,7,30,5,0,118,32,32,32,32,
-,32,32,32,32,32,32,32,110,32,43,61,32,49,0,0,
+,7,9,1,19,7,8,7,11,8,0,0,0,0,0,0,
+,0,240,63,1,7,3,8,15,3,7,0,18,0,255,199,
+,0,0,1,12,9,0,6,97,112,112,101,110,100,0,0,
+,8,2,9,15,9,4,0,31,7,9,1,19,7,8,7,
 ,8,0,0,0,0,0,0,0,0,240,63,1,7,3,8,
-,3,7,0,30,6,0,119,32,32,32,32,32,32,32,32,
-,32,32,32,99,111,110,116,105,110,117,101,0,0,0,0,
-,0,255,138,18,0,0,1,30,7,0,120,32,32,32,32,
-,32,32,32,111,117,116,46,97,112,112,101,110,100,40,105,
-,101,109,41,0,0,0,0,12,9,0,6,97,112,112,101,
-,100,0,0,9,8,2,9,15,9,4,0,31,7,9,1,
-,7,8,7,30,4,0,121,32,32,32,32,32,32,32,32,
-,32,43,61,32,49,0,0,11,8,0,0,0,0,0,0,
-,0,240,63,1,7,3,8,15,3,7,0,18,0,255,111,
-,8,0,122,32,32,32,32,102,111,114,32,110,32,105,110,
-,114,97,110,103,101,40,48,44,108,101,110,40,111,117,116,
-,41,58,0,12,7,0,5,114,97,110,103,101,0,0,0,
-,6,7,0,11,7,0,0,0,0,0,0,0,0,0,0,
-,10,0,3,108,101,110,0,13,9,10,0,15,10,2,0,
-,8,10,1,19,8,9,8,31,5,7,2,19,5,6,5,
-,6,0,0,0,0,0,0,0,0,0,0,42,3,5,6,
-,0,0,182,30,6,0,123,32,32,32,32,32,32,32,32,
-,116,101,109,32,61,32,111,117,116,91,110,93,0,0,0,
-,7,2,3,15,4,7,0,30,8,0,124,32,32,32,32,
-,32,32,32,105,102,32,105,116,101,109,91,48,93,32,61,
-,32,39,106,117,109,112,39,58,0,0,0,11,8,0,0,
-,0,0,0,0,0,0,0,9,7,4,8,12,8,0,4,
-,117,109,112,0,0,0,0,23,7,7,8,21,7,0,0,
-,0,0,38,30,14,0,125,32,32,32,32,32,32,32,32,
-,32,32,32,111,117,116,91,110,93,32,61,32,103,101,116,
-,99,111,100,101,49,54,40,74,85,77,80,44,48,44,116,
-,103,115,91,105,116,101,109,91,49,93,93,45,110,41,0,
-,9,0,10,103,101,116,95,99,111,100,101,49,54,0,0,
-,8,9,0,12,12,0,4,74,85,77,80,0,0,0,0,
-,9,12,0,11,10,0,0,0,0,0,0,0,0,0,0,
-,13,0,0,0,0,0,0,0,0,240,63,9,12,4,13,
-,11,1,12,2,11,11,3,31,7,9,3,19,7,8,7,
-,2,3,7,18,0,0,116,30,9,0,126,32,32,32,32,
-,32,32,32,101,108,105,102,32,105,116,101,109,91,48,93,
-,61,61,32,39,115,101,116,106,109,112,39,58,0,0,0,
+,3,7,0,18,0,255,185,12,7,0,5,114,97,110,103,
+,0,0,0,13,6,7,0,11,7,0,0,0,0,0,0,
+,0,0,0,12,10,0,3,108,101,110,0,13,9,10,0,
+,10,2,0,31,8,10,1,19,8,9,8,31,5,7,2,
+,5,6,5,11,6,0,0,0,0,0,0,0,0,0,0,
+,3,5,6,18,0,0,99,9,7,2,3,15,4,7,0,
 ,8,0,0,0,0,0,0,0,0,0,0,9,7,4,8,
+,8,0,4,106,117,109,112,0,0,0,0,23,7,7,8,
+,7,0,0,18,0,0,23,12,9,0,10,103,101,116,95,
+,111,100,101,49,54,0,0,13,8,9,0,12,12,0,4,
+,85,77,80,0,0,0,0,13,9,12,0,11,10,0,0,
+,0,0,0,0,0,0,0,11,13,0,0,0,0,0,0,
+,0,240,63,9,12,4,13,9,11,1,12,2,11,11,3,
+,7,9,3,19,7,8,7,10,2,3,7,18,0,0,64,
+,8,0,0,0,0,0,0,0,0,0,0,9,7,4,8,
 ,8,0,6,115,101,116,106,109,112,0,0,23,7,7,8,
-,7,0,0,18,0,0,39,30,15,0,127,32,32,32,32,
-,32,32,32,32,32,32,32,111,117,116,91,110,93,32,61,
-,103,101,116,95,99,111,100,101,49,54,40,83,69,84,74,
-,80,44,48,44,116,97,103,115,91,105,116,101,109,91,49,
-,93,45,110,41,0,0,0,12,9,0,10,103,101,116,95,
+,7,0,0,18,0,0,23,12,9,0,10,103,101,116,95,
 ,111,100,101,49,54,0,0,13,8,9,0,12,12,0,6,
 ,69,84,74,77,80,0,0,13,9,12,0,11,10,0,0,
 ,0,0,0,0,0,0,0,11,13,0,0,0,0,0,0,
 ,0,240,63,9,12,4,13,9,11,1,12,2,11,11,3,
-,7,9,3,19,7,8,7,10,2,3,7,18,0,0,58,
-,8,0,128,32,32,32,32,32,32,32,32,101,108,105,102,
-,105,116,101,109,91,48,93,32,61,61,32,39,102,110,99,
-,58,0,0,11,8,0,0,0,0,0,0,0,0,0,0,
-,7,4,8,12,8,0,3,102,110,99,0,23,7,7,8,
-,7,0,0,18,0,0,40,30,16,0,129,32,32,32,32,
-,32,32,32,32,32,32,32,111,117,116,91,110,93,32,61,
-,103,101,116,95,99,111,100,101,49,54,40,68,69,70,44,
-,116,101,109,91,49,93,44,116,97,103,115,91,105,116,101,
-,91,50,93,93,45,110,41,0,0,0,0,12,9,0,10,
-,101,116,95,99,111,100,101,49,54,0,0,13,8,9,0,
-,12,0,3,68,69,70,0,13,9,12,0,11,12,0,0,
-,0,0,0,0,0,240,63,9,10,4,12,11,13,0,0,
-,0,0,0,0,0,0,64,9,12,4,13,9,11,1,12,
-,11,11,3,31,7,9,3,19,7,8,7,10,2,3,7,
-,0,0,1,18,0,255,74,30,8,0,130,32,32,32,32,
-,111,114,32,110,32,105,110,32,114,97,110,103,101,40,48,
-,108,101,110,40,111,117,116,41,41,58,0,12,7,0,5,
-,97,110,103,101,0,0,0,13,6,7,0,11,7,0,0,
-,0,0,0,0,0,0,0,12,10,0,3,108,101,110,0,
-,9,10,0,15,10,2,0,31,8,10,1,19,8,9,8,
-,5,7,2,19,5,6,5,11,6,0,0,0,0,0,0,
-,0,0,0,42,3,5,6,18,0,0,236,30,6,0,131,
-,32,32,32,32,32,32,32,105,116,101,109,32,61,32,111,
-,116,91,110,93,0,0,0,9,7,2,3,15,4,7,0,
-,8,0,132,32,32,32,32,32,32,32,32,105,102,32,105,
-,101,109,91,48,93,32,61,61,32,39,100,97,116,97,39,
-,0,0,0,11,8,0,0,0,0,0,0,0,0,0,0,
-,7,4,8,12,8,0,4,100,97,116,97,0,0,0,0,
-,7,7,8,21,7,0,0,18,0,0,16,30,8,0,133,
-,32,32,32,32,32,32,32,32,32,32,32,111,117,116,91,
-,93,32,61,32,105,116,101,109,91,49,93,0,0,0,0,
+,7,9,3,19,7,8,7,10,2,3,7,18,0,0,32,
+,8,0,0,0,0,0,0,0,0,0,0,9,7,4,8,
+,8,0,3,102,110,99,0,23,7,7,8,21,7,0,0,
+,0,0,23,12,9,0,10,103,101,116,95,99,111,100,101,
+,54,0,0,13,8,9,0,12,12,0,3,68,69,70,0,
+,9,12,0,11,12,0,0,0,0,0,0,0,0,240,63,
+,10,4,12,11,13,0,0,0,0,0,0,0,0,0,64,
+,12,4,13,9,11,1,12,2,11,11,3,31,7,9,3,
+,7,8,7,10,2,3,7,18,0,0,1,18,0,255,157,
+,7,0,5,114,97,110,103,101,0,0,0,13,6,7,0,
+,7,0,0,0,0,0,0,0,0,0,0,12,10,0,3,
+,101,110,0,13,9,10,0,15,10,2,0,31,8,10,1,
+,8,9,8,31,5,7,2,19,5,6,5,11,6,0,0,
+,0,0,0,0,0,0,0,42,3,5,6,18,0,0,140,
+,7,2,3,15,4,7,0,11,8,0,0,0,0,0,0,
+,0,0,0,9,7,4,8,12,8,0,4,100,97,116,97,
+,0,0,0,23,7,7,8,21,7,0,0,18,0,0,7,
 ,8,0,0,0,0,0,0,0,0,240,63,9,7,4,8,
-,2,3,7,18,0,0,121,30,8,0,134,32,32,32,32,
-,32,32,32,101,108,105,102,32,105,116,101,109,91,48,93,
-,61,61,32,39,99,111,100,101,39,58,0,11,8,0,0,
-,0,0,0,0,0,0,0,9,7,4,8,12,8,0,4,
-,111,100,101,0,0,0,0,23,7,7,8,21,7,0,0,
-,0,0,79,30,8,0,135,32,32,32,32,32,32,32,32,
-,32,32,32,105,44,97,44,98,44,99,32,61,32,105,116,
-,109,91,49,58,93,0,0,11,9,0,0,0,0,0,0,
-,0,240,63,28,10,0,0,27,8,9,2,9,7,4,8,
-,10,0,0,0,0,0,0,0,0,0,0,9,9,7,10,
-,8,9,0,11,11,0,0,0,0,0,0,0,0,240,63,
-,10,7,11,15,9,10,0,11,12,0,0,0,0,0,0,
-,0,0,64,9,11,7,12,15,10,11,0,11,13,0,0,
-,0,0,0,0,0,8,64,9,12,7,13,15,11,12,0,
-,13,0,136,32,32,32,32,32,32,32,32,32,32,32,32,
-,117,116,91,110,93,32,61,32,99,104,114,40,105,41,43,
-,104,114,40,97,41,43,99,104,114,40,98,41,43,99,104,
-,40,99,41,0,0,0,0,12,13,0,3,99,104,114,0,
+,2,3,7,18,0,0,78,11,8,0,0,0,0,0,0,
+,0,0,0,9,7,4,8,12,8,0,4,99,111,100,101,
+,0,0,0,23,7,7,8,21,7,0,0,18,0,0,56,
+,9,0,0,0,0,0,0,0,0,240,63,28,10,0,0,
+,8,9,2,9,7,4,8,11,10,0,0,0,0,0,0,
+,0,0,0,9,9,7,10,15,8,9,0,11,11,0,0,
+,0,0,0,0,0,240,63,9,10,7,11,15,9,10,0,
+,12,0,0,0,0,0,0,0,0,0,64,9,11,7,12,
+,10,11,0,11,13,0,0,0,0,0,0,0,0,8,64,
+,12,7,13,15,11,12,0,12,13,0,3,99,104,114,0,
 ,12,13,0,15,13,8,0,31,7,13,1,19,7,12,7,
 ,14,0,3,99,104,114,0,13,13,14,0,15,14,9,0,
 ,12,14,1,19,12,13,12,1,7,7,12,12,14,0,3,
 ,226 → 2166,119
 ,104,114,0,13,13,14,0,15,14,10,0,31,12,14,1,
 ,12,13,12,1,7,7,12,12,14,0,3,99,104,114,0,
 ,13,14,0,15,14,11,0,31,12,14,1,19,12,13,12,
-,7,7,12,10,2,3,7,18,0,0,24,30,10,0,138,
-,32,32,32,32,32,32,32,32,32,32,32,114,97,105,115,
-,32,115,116,114,40,40,39,104,117,104,63,39,44,105,116,
-,109,41,41,0,0,0,0,12,13,0,3,115,116,114,0,
-,12,13,0,12,14,0,4,104,117,104,63,0,0,0,0,
-,15,4,0,27,13,14,2,31,7,13,1,19,7,12,7,
-,7,0,0,18,0,0,1,30,8,0,139,32,32,32,32,
-,32,32,32,105,102,32,108,101,110,40,111,117,116,91,110,
-,41,32,33,61,32,52,58,0,0,0,0,12,13,0,3,
+,7,7,12,10,2,3,7,18,0,0,13,12,13,0,3,
+,116,114,0,13,12,13,0,12,14,0,4,104,117,104,63,
+,0,0,0,15,15,4,0,27,13,14,2,31,7,13,1,
+,7,12,7,37,7,0,0,18,0,0,1,12,13,0,3,
 ,101,110,0,13,12,13,0,9,13,2,3,31,7,13,1,
 ,7,12,7,11,12,0,0,0,0,0,0,0,0,16,64,
-,7,7,12,21,7,0,0,18,0,0,51,30,18,0,140,
-,32,32,32,32,32,32,32,32,32,32,32,114,97,105,115,
-,32,40,39,99,111,100,101,32,39,43,115,116,114,40,110,
-,43,39,32,105,115,32,119,114,111,110,103,32,108,101,110,
-,116,104,32,39,43,115,116,114,40,108,101,110,40,111,117,
-,91,110,93,41,41,41,0,12,7,0,5,99,111,100,101,
-,0,0,0,12,14,0,3,115,116,114,0,13,13,14,0,
-,14,3,0,31,12,14,1,19,12,13,12,1,7,7,12,
-,12,0,17,32,105,115,32,119,114,111,110,103,32,108,101,
-,103,116,104,32,0,0,0,1,7,7,12,12,14,0,3,
-,116,114,0,13,13,14,0,12,16,0,3,108,101,110,0,
-,15,16,0,9,16,2,3,31,14,16,1,19,14,15,14,
-,12,14,1,19,12,13,12,1,7,7,12,37,7,0,0,
-,0,0,1,18,0,255,20,30,4,0,141,32,32,32,32,
-,46,111,117,116,32,61,32,111,117,116,0,12,6,0,1,
+,7,7,12,21,7,0,0,18,0,0,32,12,7,0,5,
+,111,100,101,32,0,0,0,12,14,0,3,115,116,114,0,
+,13,14,0,15,14,3,0,31,12,14,1,19,12,13,12,
+,7,7,12,12,12,0,17,32,105,115,32,119,114,111,110,
+,32,108,101,110,103,116,104,32,0,0,0,1,7,7,12,
+,14,0,3,115,116,114,0,13,13,14,0,12,16,0,3,
+,101,110,0,13,15,16,0,9,16,2,3,31,14,16,1,
+,14,15,14,31,12,14,1,19,12,13,12,1,7,7,12,
+,7,0,0,18,0,0,1,18,0,255,116,12,6,0,1,
 ,0,0,0,13,5,6,0,12,6,0,3,111,117,116,0,
-,5,6,2,0,0,0,0,12,21,0,8,109,97,112,95,
-,97,103,115,0,0,0,0,14,21,20,0,30,6,0,143,
-,101,102,32,103,101,116,95,116,109,112,40,114,61,78,111,
-,101,41,58,0,0,0,0,16,21,0,60,44,5,0,0,
-,6,0,143,100,101,102,32,103,101,116,95,116,109,112,40,
-,61,78,111,110,101,41,58,0,0,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,7,103,101,116,95,116,109,112,0,
-,1,0,0,28,1,0,0,28,2,0,0,32,1,0,2,
-,7,0,144,32,32,32,32,105,102,32,114,32,33,61,32,
-,111,110,101,58,32,114,101,116,117,114,110,32,114,0,0,
+,5,6,2,0,0,0,0,12,23,0,8,109,97,112,95,
+,97,103,115,0,0,0,0,14,23,22,0,16,23,0,27,
+,5,0,0,28,1,0,0,28,2,0,0,32,1,0,2,
 ,3,0,0,35,2,1,3,21,2,0,0,18,0,0,3,
-,1,0,0,18,0,0,1,30,7,0,145,32,32,32,32,
-,101,116,117,114,110,32,103,101,116,95,116,109,112,115,40,
-,41,91,48,93,0,0,0,12,4,0,8,103,101,116,95,
+,1,0,0,18,0,0,1,12,4,0,8,103,101,116,95,
 ,109,112,115,0,0,0,0,13,3,4,0,11,4,0,0,
 ,0,0,0,0,0,240,63,31,2,4,1,19,2,3,2,
 ,3,0,0,0,0,0,0,0,0,0,0,9,2,2,3,
-,2,0,0,0,0,0,0,12,22,0,7,103,101,116,95,
-,109,112,0,14,22,21,0,30,5,0,146,100,101,102,32,
-,101,116,95,116,109,112,115,40,116,41,58,0,0,0,0,
-,22,0,150,44,14,0,0,30,5,0,146,100,101,102,32,
-,101,116,95,116,109,112,115,40,116,41,58,0,0,0,0,
-,1,0,14,99,111,114,101,47,101,110,99,111,100,101,46,
-,121,0,0,33,1,0,0,12,1,0,8,103,101,116,95,
-,109,112,115,0,0,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,30,5,0,147,32,32,32,32,114,115,32,61,
-,97,108,108,111,99,40,116,41,0,0,0,12,5,0,5,
-,108,108,111,99,0,0,0,13,4,5,0,15,5,1,0,
-,3,5,1,19,3,4,3,15,2,3,0,30,7,0,148,
-,32,32,32,114,101,103,115,32,61,32,114,97,110,103,101,
-,114,115,44,114,115,43,116,41,0,0,0,12,6,0,5,
-,97,110,103,101,0,0,0,13,5,6,0,15,6,2,0,
-,7,2,1,31,4,6,2,19,4,5,4,15,3,4,0,
-,5,0,149,32,32,32,32,102,111,114,32,114,32,105,110,
-,114,101,103,115,58,0,0,11,5,0,0,0,0,0,0,
-,0,0,0,42,4,3,5,18,0,0,59,30,9,0,150,
-,32,32,32,32,32,32,32,115,101,116,95,114,101,103,40,
-,44,34,36,34,43,115,116,114,40,68,46,95,116,109,112,
-,41,41,0,12,8,0,7,115,101,116,95,114,101,103,0,
-,7,8,0,15,8,4,0,12,9,0,1,36,0,0,0,
-,12,0,3,115,116,114,0,13,11,12,0,12,13,0,1,
-,0,0,0,13,12,13,0,12,13,0,5,95,116,109,112,
-,0,0,0,9,12,12,13,31,10,12,1,19,10,11,10,
-,9,9,10,31,6,8,2,19,6,7,6,30,6,0,151,
-,32,32,32,32,32,32,32,68,46,95,116,109,112,105,32,
-,61,32,49,0,0,0,0,12,7,0,1,68,0,0,0,
+,2,0,0,0,0,0,0,12,24,0,7,103,101,116,95,
+,109,112,0,14,24,23,0,16,24,0,84,44,14,0,0,
+,2,0,0,9,1,0,2,12,5,0,5,97,108,108,111,
+,0,0,0,13,4,5,0,15,5,1,0,31,3,5,1,
+,3,4,3,15,2,3,0,12,6,0,5,114,97,110,103,
+,0,0,0,13,5,6,0,15,6,2,0,1,7,2,1,
+,4,6,2,19,4,5,4,15,3,4,0,11,5,0,0,
+,0,0,0,0,0,0,0,42,4,3,5,18,0,0,42,
+,8,0,7,115,101,116,95,114,101,103,0,13,7,8,0,
+,8,4,0,12,9,0,1,36,0,0,0,12,12,0,3,
+,116,114,0,13,11,12,0,12,13,0,1,68,0,0,0,
+,12,13,0,12,13,0,5,95,116,109,112,105,0,0,0,
+,12,12,13,31,10,12,1,19,10,11,10,1,9,9,10,
+,6,8,2,19,6,7,6,12,7,0,1,68,0,0,0,
 ,6,7,0,12,8,0,1,68,0,0,0,13,7,8,0,
 ,8,0,5,95,116,109,112,105,0,0,0,9,7,7,8,
 ,8,0,0,0,0,0,0,0,0,240,63,1,7,7,8,
 ,8,0,5,95,116,109,112,105,0,0,0,10,6,8,7,
-,0,255,197,30,6,0,152,32,32,32,32,68,46,116,109,
-,99,32,43,61,32,116,32,35,82,69,71,0,0,0,0,
-,6,0,1,68,0,0,0,13,5,6,0,12,7,0,1,
-,0,0,0,13,6,7,0,12,7,0,4,116,109,112,99,
-,0,0,0,9,6,6,7,1,6,6,1,12,7,0,4,
-,109,112,99,0,0,0,0,10,5,7,6,30,4,0,153,
-,32,32,32,114,101,116,117,114,110,32,114,101,103,115,0,
-,3,0,0,0,0,0,0,12,23,0,8,103,101,116,95,
-,109,112,115,0,0,0,0,14,23,22,0,30,4,0,154,
-,101,102,32,97,108,108,111,99,40,116,41,58,0,0,0,
-,23,0,111,44,16,0,0,30,4,0,154,100,101,102,32,
-,108,108,111,99,40,116,41,58,0,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,5,97,108,108,111,99,0,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,30,18,0,155,
-,32,32,32,115,32,61,32,39,39,46,106,111,105,110,40,
-,34,48,49,34,91,114,32,105,110,32,68,46,114,50,110,
-,32,102,111,114,32,114,32,105,110,32,114,97,110,103,101,
-,48,44,109,105,110,40,50,53,54,44,68,46,109,114,101,
-,43,116,41,41,93,41,0,12,4,0,0,0,0,0,0,
-,5,0,4,106,111,105,110,0,0,0,0,9,4,4,5,
-,6,0,0,12,10,0,5,114,97,110,103,101,0,0,0,
-,9,10,0,11,10,0,0,0,0,0,0,0,0,0,0,
-,13,0,3,109,105,110,0,13,12,13,0,11,13,0,0,
-,0,0,0,0,0,112,64,12,15,0,1,68,0,0,0,
-,14,15,0,12,15,0,4,109,114,101,103,0,0,0,0,
-,14,14,15,1,14,14,1,31,11,13,2,19,11,12,11,
-,8,10,2,19,8,9,8,11,9,0,0,0,0,0,0,
-,0,0,0,42,7,8,9,18,0,0,14,12,10,0,2,
-,49,0,0,12,12,0,1,68,0,0,0,13,11,12,0,
-,12,0,3,114,50,110,0,9,11,11,12,36,11,11,7,
-,10,10,11,28,11,0,0,10,6,11,10,18,0,255,242,
-,5,6,0,31,3,5,1,19,3,4,3,15,2,3,0,
-,7,0,156,32,32,32,32,114,101,116,117,114,110,32,115,
-,105,110,100,101,120,40,39,48,39,42,116,41,0,0,0,
-,5,0,5,105,110,100,101,120,0,0,0,9,4,2,5,
-,5,0,1,48,0,0,0,3,5,5,1,31,3,5,1,
-,3,4,3,20,3,0,0,0,0,0,0,12,24,0,5,
-,108,108,111,99,0,0,0,14,24,23,0,30,4,0,157,
-,101,102,32,105,115,95,116,109,112,40,114,41,58,0,0,
-,24,0,62,44,4,0,0,30,4,0,157,100,101,102,32,
-,115,95,116,109,112,40,114,41,58,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,6,105,115,95,116,109,112,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,30,8,0,158,
-,32,32,32,105,102,32,114,32,105,115,32,78,111,110,101,
-,32,114,101,116,117,114,110,32,70,97,108,115,101,0,0,
+,0,255,214,12,6,0,1,68,0,0,0,13,5,6,0,
+,7,0,1,68,0,0,0,13,6,7,0,12,7,0,4,
+,109,112,99,0,0,0,0,9,6,6,7,1,6,6,1,
+,7,0,4,116,109,112,99,0,0,0,0,10,5,7,6,
+,3,0,0,0,0,0,0,12,25,0,8,103,101,116,95,
+,109,112,115,0,0,0,0,14,25,24,0,16,25,0,69,
+,16,0,0,28,2,0,0,9,1,0,2,12,4,0,0,
+,0,0,0,12,5,0,4,106,111,105,110,0,0,0,0,
+,4,4,5,27,6,0,0,12,10,0,5,114,97,110,103,
+,0,0,0,13,9,10,0,11,10,0,0,0,0,0,0,
+,0,0,0,12,13,0,3,109,105,110,0,13,12,13,0,
+,13,0,0,0,0,0,0,0,0,112,64,12,15,0,1,
+,0,0,0,13,14,15,0,12,15,0,4,109,114,101,103,
+,0,0,0,9,14,14,15,1,14,14,1,31,11,13,2,
+,11,12,11,31,8,10,2,19,8,9,8,11,9,0,0,
+,0,0,0,0,0,0,0,42,7,8,9,18,0,0,14,
+,10,0,2,48,49,0,0,12,12,0,1,68,0,0,0,
+,11,12,0,12,12,0,3,114,50,110,0,9,11,11,12,
+,11,11,7,9,10,10,11,28,11,0,0,10,6,11,10,
+,0,255,242,15,5,6,0,31,3,5,1,19,3,4,3,
+,2,3,0,12,5,0,5,105,110,100,101,120,0,0,0,
+,4,2,5,12,5,0,1,48,0,0,0,3,5,5,1,
+,3,5,1,19,3,4,3,20,3,0,0,0,0,0,0,
+,26,0,5,97,108,108,111,99,0,0,0,14,26,25,0,
+,26,0,29,44,4,0,0,28,2,0,0,9,1,0,2,
 ,3,0,0,23,2,1,3,21,2,0,0,18,0,0,6,
 ,2,0,0,0,0,0,0,0,0,0,0,20,2,0,0,
-,0,0,1,30,8,0,159,32,32,32,32,114,101,116,117,
-,110,32,40,68,46,114,50,110,91,114,93,91,48,93,32,
-,61,32,39,36,39,41,0,12,3,0,1,68,0,0,0,
-,2,3,0,12,3,0,3,114,50,110,0,9,2,2,3,
-,2,2,1,11,3,0,0,0,0,0,0,0,0,0,0,
-,2,2,3,12,3,0,1,36,0,0,0,23,2,2,3,
-,2,0,0,0,0,0,0,12,25,0,6,105,115,95,116,
-,112,0,0,14,25,24,0,30,4,0,160,100,101,102,32,
-,110,95,116,109,112,40,114,41,58,0,0,16,25,0,64,
-,7,0,0,30,4,0,160,100,101,102,32,117,110,95,116,
-,112,40,114,41,58,0,0,12,1,0,14,99,111,114,101,
-,101,110,99,111,100,101,46,112,121,0,0,33,1,0,0,
-,1,0,6,117,110,95,116,109,112,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,30,5,0,161,32,32,32,32,
-,32,61,32,68,46,114,50,110,91,114,93,0,0,0,0,
-,4,0,1,68,0,0,0,13,3,4,0,12,4,0,3,
-,50,110,0,9,3,3,4,9,3,3,1,15,2,3,0,
-,4,0,162,32,32,32,32,102,114,101,101,95,114,101,103,
-,114,41,0,12,5,0,8,102,114,101,101,95,114,101,103,
+,0,0,1,12,3,0,1,68,0,0,0,13,2,3,0,
+,3,0,3,114,50,110,0,9,2,2,3,9,2,2,1,
+,3,0,0,0,0,0,0,0,0,0,0,9,2,2,3,
+,3,0,1,36,0,0,0,23,2,2,3,20,2,0,0,
+,0,0,0,12,27,0,6,105,115,95,116,109,112,0,0,
+,27,26,0,16,27,0,31,44,7,0,0,28,2,0,0,
+,1,0,2,12,4,0,1,68,0,0,0,13,3,4,0,
+,4,0,3,114,50,110,0,9,3,3,4,9,3,3,1,
+,2,3,0,12,5,0,8,102,114,101,101,95,114,101,103,
 ,0,0,0,13,4,5,0,15,5,1,0,31,3,5,1,
-,3,4,3,30,6,0,163,32,32,32,32,115,101,116,95,
-,101,103,40,114,44,39,42,39,43,110,41,0,0,0,0,
-,5,0,7,115,101,116,95,114,101,103,0,13,4,5,0,
-,5,1,0,12,6,0,1,42,0,0,0,1,6,6,2,
-,3,5,2,19,3,4,3,0,0,0,0,12,26,0,6,
-,110,95,116,109,112,0,0,14,26,25,0,30,5,0,164,
-,101,102,32,102,114,101,101,95,116,109,112,40,114,41,58,
-,0,0,0,16,26,0,55,44,5,0,0,30,5,0,164,
-,101,102,32,102,114,101,101,95,116,109,112,40,114,41,58,
-,0,0,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,8,
-,114,101,101,95,116,109,112,0,0,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,30,8,0,165,32,32,32,32,
-,102,32,105,115,95,116,109,112,40,114,41,58,32,102,114,
-,101,95,114,101,103,40,114,41,0,0,0,12,4,0,6,
-,115,95,116,109,112,0,0,13,3,4,0,15,4,1,0,
-,2,4,1,19,2,3,2,21,2,0,0,18,0,0,10,
-,4,0,8,102,114,101,101,95,114,101,103,0,0,0,0,
-,3,4,0,15,4,1,0,31,2,4,1,19,2,3,2,
-,0,0,1,30,4,0,166,32,32,32,32,114,101,116,117,
-,110,32,114,0,0,0,0,20,1,0,0,0,0,0,0,
-,27,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
-,27,26,0,30,5,0,167,100,101,102,32,102,114,101,101,
-,116,109,112,115,40,114,41,58,0,0,0,16,27,0,44,
-,7,0,0,30,5,0,167,100,101,102,32,102,114,101,101,
-,116,109,112,115,40,114,41,58,0,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,9,102,114,101,101,95,116,109,112,
-,0,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,7,0,168,32,32,32,32,102,111,114,32,107,32,105,110,
-,114,58,32,102,114,101,101,95,116,109,112,40,107,41,0,
-,3,0,0,0,0,0,0,0,0,0,0,42,2,1,3,
-,0,0,10,12,6,0,8,102,114,101,101,95,116,109,112,
-,0,0,0,13,5,6,0,15,6,2,0,31,4,6,1,
-,4,5,4,18,0,255,246,0,0,0,0,12,28,0,9,
-,114,101,101,95,116,109,112,115,0,0,0,14,28,27,0,
-,4,0,169,100,101,102,32,103,101,116,95,114,101,103,40,
-,41,58,0,16,28,0,79,44,8,0,0,30,4,0,169,
-,101,102,32,103,101,116,95,114,101,103,40,110,41,58,0,
-,1,0,14,99,111,114,101,47,101,110,99,111,100,101,46,
-,121,0,0,33,1,0,0,12,1,0,7,103,101,116,95,
-,101,103,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,6,0,170,32,32,32,32,105,102,32,110,32,110,111,116,
-,105,110,32,68,46,110,50,114,58,0,0,12,3,0,1,
+,3,4,3,12,5,0,7,115,101,116,95,114,101,103,0,
+,4,5,0,15,5,1,0,12,6,0,1,42,0,0,0,
+,6,6,2,31,3,5,2,19,3,4,3,0,0,0,0,
+,28,0,6,117,110,95,116,109,112,0,0,14,28,27,0,
+,28,0,24,44,5,0,0,28,2,0,0,9,1,0,2,
+,4,0,6,105,115,95,116,109,112,0,0,13,3,4,0,
+,4,1,0,31,2,4,1,19,2,3,2,21,2,0,0,
+,0,0,10,12,4,0,8,102,114,101,101,95,114,101,103,
+,0,0,0,13,3,4,0,15,4,1,0,31,2,4,1,
+,2,3,2,18,0,0,1,20,1,0,0,0,0,0,0,
+,29,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,29,28,0,16,29,0,19,44,7,0,0,28,2,0,0,
+,1,0,2,11,3,0,0,0,0,0,0,0,0,0,0,
+,2,1,3,18,0,0,10,12,6,0,8,102,114,101,101,
+,116,109,112,0,0,0,0,13,5,6,0,15,6,2,0,
+,4,6,1,19,4,5,4,18,0,255,246,0,0,0,0,
+,30,0,9,102,114,101,101,95,116,109,112,115,0,0,0,
+,30,29,0,16,30,0,43,44,8,0,0,28,2,0,0,
+,1,0,2,12,3,0,1,68,0,0,0,13,2,3,0,
+,3,0,3,110,50,114,0,9,2,2,3,36,2,2,1,
+,3,0,0,0,0,0,0,0,0,0,0,23,2,2,3,
+,2,0,0,18,0,0,18,12,4,0,7,115,101,116,95,
+,101,103,0,13,3,4,0,12,7,0,5,97,108,108,111,
+,0,0,0,13,6,7,0,11,7,0,0,0,0,0,0,
+,0,240,63,31,4,7,1,19,4,6,4,15,5,1,0,
+,2,4,2,19,2,3,2,18,0,0,1,12,3,0,1,
 ,0,0,0,13,2,3,0,12,3,0,3,110,50,114,0,
-,2,2,3,36,2,2,1,11,3,0,0,0,0,0,0,
-,0,0,0,23,2,2,3,21,2,0,0,18,0,0,26,
-,7,0,171,32,32,32,32,32,32,32,32,115,101,116,95,
-,101,103,40,97,108,108,111,99,40,49,41,44,110,41,0,
-,4,0,7,115,101,116,95,114,101,103,0,13,3,4,0,
-,7,0,5,97,108,108,111,99,0,0,0,13,6,7,0,
-,7,0,0,0,0,0,0,0,0,240,63,31,4,7,1,
-,4,6,4,15,5,1,0,31,2,4,2,19,2,3,2,
-,0,0,1,30,5,0,172,32,32,32,32,114,101,116,117,
-,110,32,68,46,110,50,114,91,110,93,0,12,3,0,1,
-,0,0,0,13,2,3,0,12,3,0,3,110,50,114,0,
 ,2,2,3,9,2,2,1,20,2,0,0,0,0,0,0,
-,29,0,7,103,101,116,95,114,101,103,0,14,29,28,0,
-,5,0,177,100,101,102,32,115,101,116,95,114,101,103,40,
-,44,110,41,58,0,0,0,16,29,0,78,44,9,0,0,
-,5,0,177,100,101,102,32,115,101,116,95,114,101,103,40,
-,44,110,41,58,0,0,0,12,1,0,14,99,111,114,101,
-,101,110,99,111,100,101,46,112,121,0,0,33,1,0,0,
-,1,0,7,115,101,116,95,114,101,103,0,34,1,0,0,
-,2,0,0,9,1,0,2,28,3,0,0,9,2,0,3,
-,8,0,178,32,32,32,32,68,46,110,50,114,91,110,93,
-,61,32,114,59,32,68,46,114,50,110,91,114,93,32,61,
-,110,0,0,12,4,0,1,68,0,0,0,13,3,4,0,
-,4,0,3,110,50,114,0,9,3,3,4,10,3,2,1,
-,4,0,1,68,0,0,0,13,3,4,0,12,4,0,3,
-,50,110,0,9,3,3,4,10,3,1,2,30,8,0,179,
-,32,32,32,68,46,109,114,101,103,32,61,32,109,97,120,
-,68,46,109,114,101,103,44,114,43,49,41,0,0,0,0,
+,31,0,7,103,101,116,95,114,101,103,0,14,31,30,0,
+,31,0,44,44,9,0,0,28,2,0,0,9,1,0,2,
+,3,0,0,9,2,0,3,12,4,0,1,68,0,0,0,
+,3,4,0,12,4,0,3,110,50,114,0,9,3,3,4,
+,3,2,1,12,4,0,1,68,0,0,0,13,3,4,0,
+,4,0,3,114,50,110,0,9,3,3,4,10,3,1,2,
 ,4,0,1,68,0,0,0,13,3,4,0,12,6,0,3,
 ,97,120,0,13,5,6,0,12,8,0,1,68,0,0,0,
 ,6,8,0,12,8,0,4,109,114,101,103,0,0,0,0,
 ,16 → 2285,8
 ,6,6,8,11,8,0,0,0,0,0,0,0,0,240,63,
 ,7,1,8,31,4,6,2,19,4,5,4,12,5,0,4,
 ,114,101,103,0,0,0,0,10,3,5,4,0,0,0,0,
-,30,0,7,115,101,116,95,114,101,103,0,14,30,29,0,
-,5,0,180,100,101,102,32,102,114,101,101,95,114,101,103,
-,114,41,58,0,0,0,0,16,30,0,94,44,5,0,0,
-,5,0,180,100,101,102,32,102,114,101,101,95,114,101,103,
-,114,41,58,0,0,0,0,12,1,0,14,99,111,114,101,
-,101,110,99,111,100,101,46,112,121,0,0,33,1,0,0,
-,1,0,8,102,114,101,101,95,114,101,103,0,0,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,30,8,0,181,
-,32,32,32,105,102,32,105,115,95,116,109,112,40,114,41,
-,32,68,46,116,109,112,99,32,45,61,32,49,0,0,0,
+,32,0,7,115,101,116,95,114,101,103,0,14,32,31,0,
+,32,0,55,44,5,0,0,28,2,0,0,9,1,0,2,
 ,4,0,6,105,115,95,116,109,112,0,0,13,3,4,0,
 ,4,1,0,31,2,4,1,19,2,3,2,21,2,0,0,
 ,0,0,20,12,3,0,1,68,0,0,0,13,2,3,0,
 ,1087 → 2294,592
 ,109,112,99,0,0,0,0,9,3,3,4,11,4,0,0,
 ,0,0,0,0,0,240,63,2,3,3,4,12,4,0,4,
 ,109,112,99,0,0,0,0,10,2,4,3,18,0,0,1,
-,12,0,182,32,32,32,32,110,32,61,32,68,46,114,50,
-,91,114,93,59,32,100,101,108,32,68,46,114,50,110,91,
-,93,59,32,100,101,108,32,68,46,110,50,114,91,110,93,
-,0,0,0,12,4,0,1,68,0,0,0,13,3,4,0,
-,4,0,3,114,50,110,0,9,3,3,4,9,3,3,1,
-,2,3,0,12,4,0,1,68,0,0,0,13,3,4,0,
-,4,0,3,114,50,110,0,9,3,3,4,43,3,1,0,
 ,4,0,1,68,0,0,0,13,3,4,0,12,4,0,3,
-,50,114,0,9,3,3,4,43,3,2,0,0,0,0,0,
-,31,0,8,102,114,101,101,95,114,101,103,0,0,0,0,
-,31,30,0,30,6,0,184,100,101,102,32,105,109,97,110,
-,103,101,40,111,114,105,103,44,102,110,99,41,58,0,0,
-,31,0,103,44,14,0,0,30,6,0,184,100,101,102,32,
-,109,97,110,97,103,101,40,111,114,105,103,44,102,110,99,
-,58,0,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,7,
-,109,97,110,97,103,101,0,34,1,0,0,28,2,0,0,
-,1,0,2,28,3,0,0,9,2,0,3,30,6,0,185,
-,32,32,32,105,116,101,109,115,32,61,32,111,114,105,103,
-,105,116,101,109,115,0,0,12,5,0,5,105,116,101,109,
-,0,0,0,9,4,1,5,15,3,4,0,30,8,0,186,
-,32,32,32,111,114,105,103,46,118,97,108,32,61,32,111,
-,105,103,46,118,97,108,91,58,45,49,93,0,0,0,0,
-,5,0,3,118,97,108,0,9,4,1,5,28,6,0,0,
-,7,0,0,0,0,0,0,0,0,240,191,27,5,6,2,
-,4,4,5,12,5,0,3,118,97,108,0,10,1,5,4,
-,14,0,187,32,32,32,32,116,32,61,32,84,111,107,101,
-,40,111,114,105,103,46,112,111,115,44,39,115,121,109,98,
-,108,39,44,39,61,39,44,91,105,116,101,109,115,91,48,
-,44,111,114,105,103,93,41,0,0,0,0,12,7,0,5,
+,50,110,0,9,3,3,4,9,3,3,1,15,2,3,0,
+,4,0,1,68,0,0,0,13,3,4,0,12,4,0,3,
+,50,110,0,9,3,3,4,43,3,1,0,12,4,0,1,
+,0,0,0,13,3,4,0,12,4,0,3,110,50,114,0,
+,3,3,4,43,3,2,0,0,0,0,0,12,33,0,8,
+,114,101,101,95,114,101,103,0,0,0,0,14,33,32,0,
+,33,0,49,44,14,0,0,28,2,0,0,9,1,0,2,
+,3,0,0,9,2,0,3,12,5,0,5,105,116,101,109,
+,0,0,0,9,4,1,5,15,3,4,0,12,5,0,3,
+,97,108,0,9,4,1,5,28,6,0,0,11,7,0,0,
+,0,0,0,0,0,240,191,27,5,6,2,9,4,4,5,
+,5,0,3,118,97,108,0,10,1,5,4,12,7,0,5,
 ,111,107,101,110,0,0,0,13,6,7,0,12,11,0,3,
 ,111,115,0,9,7,1,11,12,8,0,6,115,121,109,98,
 ,108,0,0,12,9,0,1,61,0,0,0,11,13,0,0,
 ,0,0,0,0,0,0,0,9,11,3,13,15,12,1,0,
 ,10,11,2,31,5,7,4,19,5,6,5,15,4,5,0,
-,5,0,188,32,32,32,32,114,101,116,117,114,110,32,102,
-,99,40,116,41,0,0,0,15,6,4,0,31,5,6,1,
-,5,2,5,20,5,0,0,0,0,0,0,12,32,0,7,
-,109,97,110,97,103,101,0,14,32,31,0,30,6,0,190,
-,101,102,32,117,110,97,114,121,40,105,44,116,98,44,114,
-,78,111,110,101,41,58,0,16,32,0,93,44,10,0,0,
-,6,0,190,100,101,102,32,117,110,97,114,121,40,105,44,
-,98,44,114,61,78,111,110,101,41,58,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,5,117,110,97,114,121,0,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
-,2,0,3,28,3,0,0,28,4,0,0,32,3,0,4,
-,5,0,191,32,32,32,32,114,32,61,32,103,101,116,95,
-,109,112,40,114,41,0,0,12,6,0,7,103,101,116,95,
-,109,112,0,13,5,6,0,15,6,3,0,31,4,6,1,
-,4,5,4,15,3,4,0,30,4,0,192,32,32,32,32,
-,32,61,32,100,111,40,116,98,41,0,0,12,7,0,2,
-,111,0,0,13,6,7,0,15,7,2,0,31,5,7,1,
-,5,6,5,15,4,5,0,30,4,0,193,32,32,32,32,
-,111,100,101,40,105,44,114,44,98,41,0,12,7,0,4,
-,111,100,101,0,0,0,0,13,6,7,0,15,7,1,0,
-,8,3,0,15,9,4,0,31,5,7,3,19,5,6,5,
-,7,0,194,32,32,32,32,105,102,32,114,32,33,61,32,
-,58,32,102,114,101,101,95,116,109,112,40,98,41,0,0,
-,5,3,4,21,5,0,0,18,0,0,10,12,7,0,8,
-,114,101,101,95,116,109,112,0,0,0,0,13,6,7,0,
-,7,4,0,31,5,7,1,19,5,6,5,18,0,0,1,
-,4,0,195,32,32,32,32,114,101,116,117,114,110,32,114,
-,0,0,0,20,3,0,0,0,0,0,0,12,33,0,5,
-,110,97,114,121,0,0,0,14,33,32,0,30,7,0,196,
-,101,102,32,105,110,102,105,120,40,105,44,116,98,44,116,
-,44,114,61,78,111,110,101,41,58,0,0,16,33,0,124,
-,13,0,0,30,7,0,196,100,101,102,32,105,110,102,105,
-,40,105,44,116,98,44,116,99,44,114,61,78,111,110,101,
-,58,0,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,5,
-,110,102,105,120,0,0,0,34,1,0,0,28,2,0,0,
+,6,4,0,31,5,6,1,19,5,2,5,20,5,0,0,
+,0,0,0,12,34,0,7,105,109,97,110,97,103,101,0,
+,34,33,0,16,34,0,68,44,13,0,0,28,2,0,0,
 ,1,0,2,28,3,0,0,9,2,0,3,28,4,0,0,
 ,3,0,4,28,4,0,0,28,5,0,0,32,4,0,5,
-,5,0,197,32,32,32,32,114,32,61,32,103,101,116,95,
-,109,112,40,114,41,0,0,12,7,0,7,103,101,116,95,
-,109,112,0,13,6,7,0,15,7,4,0,31,5,7,1,
-,5,6,5,15,4,5,0,30,7,0,198,32,32,32,32,
-,44,99,32,61,32,100,111,40,116,98,44,114,41,44,100,
-,40,116,99,41,0,0,0,12,8,0,2,100,111,0,0,
-,7,8,0,15,8,2,0,15,9,4,0,31,6,8,2,
-,6,7,6,15,5,6,0,12,9,0,2,100,111,0,0,
-,8,9,0,15,9,3,0,31,7,9,1,19,7,8,7,
-,6,7,0,15,7,5,0,15,5,6,0,30,5,0,199,
-,32,32,32,99,111,100,101,40,105,44,114,44,98,44,99,
-,0,0,0,12,9,0,4,99,111,100,101,0,0,0,0,
+,7,0,7,103,101,116,95,116,109,112,0,13,6,7,0,
+,7,4,0,31,5,7,1,19,5,6,5,15,4,5,0,
+,8,0,2,100,111,0,0,13,7,8,0,15,8,2,0,
+,9,4,0,31,6,8,2,19,6,7,6,15,5,6,0,
+,9,0,2,100,111,0,0,13,8,9,0,15,9,3,0,
+,7,9,1,19,7,8,7,15,6,7,0,15,7,5,0,
+,5,6,0,12,9,0,4,99,111,100,101,0,0,0,0,
 ,8,9,0,15,9,1,0,15,10,4,0,15,11,7,0,
-,12,5,0,31,6,9,4,19,6,8,6,30,7,0,200,
-,32,32,32,105,102,32,114,32,33,61,32,98,58,32,102,
-,101,101,95,116,109,112,40,98,41,0,0,35,6,4,7,
+,12,5,0,31,6,9,4,19,6,8,6,35,6,4,7,
 ,6,0,0,18,0,0,10,12,9,0,8,102,114,101,101,
 ,116,109,112,0,0,0,0,13,8,9,0,15,9,7,0,
-,6,9,1,19,6,8,6,18,0,0,1,30,4,0,201,
-,32,32,32,102,114,101,101,95,116,109,112,40,99,41,0,
-,9,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
-,8,9,0,15,9,5,0,31,6,9,1,19,6,8,6,
-,4,0,202,32,32,32,32,114,101,116,117,114,110,32,114,
-,0,0,0,20,4,0,0,0,0,0,0,12,34,0,5,
-,110,102,105,120,0,0,0,14,34,33,0,30,10,0,203,
-,101,102,32,108,111,103,105,99,95,105,110,102,105,120,40,
-,112,44,32,116,98,44,32,116,99,44,32,95,114,61,78,
-,110,101,41,58,0,0,0,16,34,0,211,44,12,0,0,
-,10,0,203,100,101,102,32,108,111,103,105,99,95,105,110,
-,105,120,40,111,112,44,32,116,98,44,32,116,99,44,32,
-,114,61,78,111,110,101,41,58,0,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,11,108,111,103,105,99,95,105,110,
-,105,120,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,3,0,0,9,2,0,3,28,4,0,0,9,3,0,4,
-,4,0,0,28,5,0,0,32,4,0,5,30,5,0,204,
-,32,32,32,116,32,61,32,103,101,116,95,116,97,103,40,
-,32,0,0,12,8,0,7,103,101,116,95,116,97,103,0,
-,7,8,0,31,6,0,0,19,6,7,6,15,5,6,0,
-,5,0,205,32,32,32,32,114,32,61,32,100,111,40,116,
-,44,32,95,114,41,0,0,12,9,0,2,100,111,0,0,
-,8,9,0,15,9,2,0,15,10,4,0,31,7,9,2,
-,7,8,7,15,6,7,0,30,9,0,206,32,32,32,32,
-,102,32,95,114,32,33,61,32,114,58,32,102,114,101,101,
-,116,109,112,40,95,114,41,32,35,82,69,71,0,0,0,
-,7,4,6,21,7,0,0,18,0,0,10,12,9,0,8,
+,6,9,1,19,6,8,6,18,0,0,1,12,9,0,8,
 ,114,101,101,95,116,109,112,0,0,0,0,13,8,9,0,
-,9,4,0,31,7,9,1,19,7,8,7,18,0,0,1,
-,9,0,207,32,32,32,32,105,102,32,111,112,32,61,61,
-,39,97,110,100,39,58,32,32,32,99,111,100,101,40,73,
-,44,32,114,41,0,0,0,12,8,0,3,97,110,100,0,
-,7,1,8,21,7,0,0,18,0,0,12,12,9,0,4,
-,111,100,101,0,0,0,0,13,8,9,0,12,11,0,2,
-,70,0,0,13,9,11,0,15,10,6,0,31,7,9,2,
-,7,8,7,18,0,0,27,30,9,0,208,32,32,32,32,
-,108,105,102,32,111,112,32,61,61,32,39,111,114,39,58,
-,32,99,111,100,101,40,73,70,78,44,32,114,41,0,0,
-,8,0,2,111,114,0,0,23,7,1,8,21,7,0,0,
-,0,0,12,12,9,0,4,99,111,100,101,0,0,0,0,
-,8,9,0,12,11,0,3,73,70,78,0,13,9,11,0,
-,10,6,0,31,7,9,2,19,7,8,7,18,0,0,1,
-,5,0,209,32,32,32,32,106,117,109,112,40,116,44,32,
-,101,110,100,39,41,0,0,12,9,0,4,106,117,109,112,
-,0,0,0,13,8,9,0,15,9,5,0,12,10,0,3,
-,110,100,0,31,7,9,2,19,7,8,7,30,3,0,210,
-,32,32,32,95,114,32,61,32,114,0,0,15,4,6,0,
-,5,0,211,32,32,32,32,114,32,61,32,100,111,40,116,
-,44,32,95,114,41,0,0,12,9,0,2,100,111,0,0,
-,8,9,0,15,9,3,0,15,10,4,0,31,7,9,2,
-,7,8,7,15,6,7,0,30,9,0,212,32,32,32,32,
-,102,32,95,114,32,33,61,32,114,58,32,102,114,101,101,
-,116,109,112,40,95,114,41,32,35,82,69,71,0,0,0,
-,7,4,6,21,7,0,0,18,0,0,10,12,9,0,8,
-,114,101,101,95,116,109,112,0,0,0,0,13,8,9,0,
-,9,4,0,31,7,9,1,19,7,8,7,18,0,0,1,
-,5,0,213,32,32,32,32,116,97,103,40,116,44,32,39,
-,110,100,39,41,0,0,0,12,9,0,3,116,97,103,0,
-,8,9,0,15,9,5,0,12,10,0,3,101,110,100,0,
-,7,9,2,19,7,8,7,30,4,0,214,32,32,32,32,
-,101,116,117,114,110,32,114,0,0,0,0,20,6,0,0,
-,0,0,0,12,35,0,11,108,111,103,105,99,95,105,110,
-,105,120,0,14,35,34,0,30,6,0,216,100,101,102,32,
-,100,111,95,110,111,110,101,40,114,61,78,111,110,101,41,
-,0,0,0,16,35,0,61,44,7,0,0,30,6,0,216,
-,101,102,32,95,100,111,95,110,111,110,101,40,114,61,78,
-,110,101,41,58,0,0,0,12,1,0,14,99,111,114,101,
-,101,110,99,111,100,101,46,112,121,0,0,33,1,0,0,
-,1,0,8,95,100,111,95,110,111,110,101,0,0,0,0,
-,1,0,0,28,1,0,0,28,2,0,0,32,1,0,2,
-,5,0,217,32,32,32,32,114,32,61,32,103,101,116,95,
-,109,112,40,114,41,0,0,12,4,0,7,103,101,116,95,
-,109,112,0,13,3,4,0,15,4,1,0,31,2,4,1,
-,2,3,2,15,1,2,0,30,5,0,218,32,32,32,32,
-,111,100,101,40,78,79,78,69,44,114,41,0,0,0,0,
-,4,0,4,99,111,100,101,0,0,0,0,13,3,4,0,
-,6,0,4,78,79,78,69,0,0,0,0,13,4,6,0,
-,5,1,0,31,2,4,2,19,2,3,2,30,4,0,219,
-,32,32,32,114,101,116,117,114,110,32,114,0,0,0,0,
-,1,0,0,0,0,0,0,12,36,0,8,95,100,111,95,
-,111,110,101,0,0,0,0,14,36,35,0,30,7,0,221,
-,101,102,32,100,111,95,115,121,109,98,111,108,40,116,44,
-,61,78,111,110,101,41,58,0,0,0,0,16,36,3,192,
-,31,0,0,30,7,0,221,100,101,102,32,100,111,95,115,
-,109,98,111,108,40,116,44,114,61,78,111,110,101,41,58,
-,0,0,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,9,
-,111,95,115,121,109,98,111,108,0,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,28,2,0,0,28,3,0,0,
-,2,0,3,30,5,0,222,32,32,32,32,115,101,116,115,
-,61,32,91,39,61,39,93,0,0,0,0,12,5,0,1,
-,0,0,0,27,4,5,1,15,3,4,0,30,13,0,223,
-,32,32,32,105,115,101,116,115,32,61,32,91,39,43,61,
-,44,39,45,61,39,44,39,42,61,39,44,39,47,61,39,
-,32,39,124,61,39,44,32,39,38,61,39,44,32,39,94,
-,39,93,0,12,6,0,2,43,61,0,0,12,7,0,2,
-,61,0,0,12,8,0,2,42,61,0,0,12,9,0,2,
-,61,0,0,12,10,0,2,124,61,0,0,12,11,0,2,
-,61,0,0,12,12,0,2,94,61,0,0,27,5,6,7,
-,4,5,0,30,11,0,224,32,32,32,32,99,109,112,115,
-,61,32,91,39,60,39,44,39,62,39,44,39,60,61,39,
-,39,62,61,39,44,39,61,61,39,44,39,33,61,39,93,
-,0,0,0,12,7,0,1,60,0,0,0,12,8,0,1,
-,0,0,0,12,9,0,2,60,61,0,0,12,10,0,2,
-,61,0,0,12,11,0,2,61,61,0,0,12,12,0,2,
-,61,0,0,27,6,7,6,15,5,6,0,30,4,0,225,
-,32,32,32,109,101,116,97,115,32,61,32,123,0,0,0,
-,11,0,226,32,32,32,32,32,32,32,32,39,43,39,58,
-,68,68,44,39,42,39,58,77,85,76,44,39,47,39,58,
-,73,86,44,39,42,42,39,58,80,79,87,44,0,0,0,
-,8,0,1,43,0,0,0,12,30,0,3,65,68,68,0,
-,9,30,0,12,10,0,1,42,0,0,0,12,30,0,3,
-,85,76,0,13,11,30,0,12,12,0,1,47,0,0,0,
-,30,0,3,68,73,86,0,13,13,30,0,12,14,0,2,
-,42,0,0,12,30,0,3,80,79,87,0,13,15,30,0,
-,5,0,227,32,32,32,32,32,32,32,32,39,45,39,58,
-,85,66,44,0,0,0,0,12,16,0,1,45,0,0,0,
-,30,0,3,83,85,66,0,13,17,30,0,30,9,0,228,
-,32,32,32,32,32,32,32,39,37,39,58,77,79,68,44,
-,62,62,39,58,82,83,72,44,39,60,60,39,58,76,83,
-,44,0,0,12,18,0,1,37,0,0,0,12,30,0,3,
-,79,68,0,13,19,30,0,12,20,0,2,62,62,0,0,
-,30,0,3,82,83,72,0,13,21,30,0,12,22,0,2,
-,60,0,0,12,30,0,3,76,83,72,0,13,23,30,0,
-,11,0,229,32,32,32,32,32,32,32,32,39,38,39,58,
-,73,84,65,78,68,44,39,124,39,58,66,73,84,79,82,
-,39,94,39,58,66,73,84,88,79,82,44,0,0,0,0,
-,24,0,1,38,0,0,0,12,30,0,6,66,73,84,65,
-,68,0,0,13,25,30,0,12,26,0,1,124,0,0,0,
-,30,0,5,66,73,84,79,82,0,0,0,13,27,30,0,
-,28,0,1,94,0,0,0,12,30,0,6,66,73,84,88,
-,82,0,0,13,29,30,0,26,7,8,22,15,6,7,0,
-,11,0,231,32,32,32,32,105,102,32,116,46,118,97,108,
-,61,61,32,39,78,111,110,101,39,58,32,114,101,116,117,
-,110,32,95,100,111,95,110,111,110,101,40,114,41,0,0,
-,8,0,3,118,97,108,0,9,7,1,8,12,8,0,4,
-,111,110,101,0,0,0,0,23,7,7,8,21,7,0,0,
-,0,0,11,12,9,0,8,95,100,111,95,110,111,110,101,
-,0,0,0,13,8,9,0,15,9,2,0,31,7,9,1,
-,7,8,7,20,7,0,0,18,0,0,1,30,6,0,232,
-,32,32,32,105,102,32,116,46,118,97,108,32,61,61,32,
-,84,114,117,101,39,58,0,12,8,0,3,118,97,108,0,
-,7,1,8,12,8,0,4,84,114,117,101,0,0,0,0,
-,7,7,8,21,7,0,0,18,0,0,23,30,9,0,233,
-,32,32,32,32,32,32,32,114,101,116,117,114,110,32,95,
-,111,95,110,117,109,98,101,114,40,39,49,39,44,114,41,
-,0,0,0,12,9,0,10,95,100,111,95,110,117,109,98,
-,114,0,0,13,8,9,0,12,9,0,1,49,0,0,0,
-,10,2,0,31,7,9,2,19,7,8,7,20,7,0,0,
-,0,0,1,30,7,0,234,32,32,32,32,105,102,32,116,
-,118,97,108,32,61,61,32,39,70,97,108,115,101,39,58,
-,0,0,0,12,8,0,3,118,97,108,0,9,7,1,8,
-,8,0,5,70,97,108,115,101,0,0,0,23,7,7,8,
-,7,0,0,18,0,0,23,30,9,0,235,32,32,32,32,
-,32,32,32,114,101,116,117,114,110,32,95,100,111,95,110,
-,109,98,101,114,40,39,48,39,44,114,41,0,0,0,0,
-,9,0,10,95,100,111,95,110,117,109,98,101,114,0,0,
-,8,9,0,12,9,0,1,48,0,0,0,15,10,2,0,
-,7,9,2,19,7,8,7,20,7,0,0,18,0,0,1,
-,5,0,236,32,32,32,32,105,116,101,109,115,32,61,32,
-,46,105,116,101,109,115,0,12,9,0,5,105,116,101,109,
-,0,0,0,9,8,1,9,15,7,8,0,30,8,0,238,
-,32,32,32,105,102,32,116,46,118,97,108,32,105,110,32,
-,39,97,110,100,39,44,39,111,114,39,93,58,0,0,0,
+,9,5,0,31,6,9,1,19,6,8,6,20,4,0,0,
+,0,0,0,12,35,0,5,105,110,102,105,120,0,0,0,
+,35,34,0,16,35,0,136,44,15,0,0,28,2,0,0,
+,1,0,2,28,3,0,0,9,2,0,3,28,4,0,0,
+,3,0,4,28,5,0,0,9,4,0,5,28,5,0,0,
+,6,0,0,32,5,0,6,12,8,0,7,103,101,116,95,
+,109,112,0,13,7,8,0,15,8,5,0,31,6,8,1,
+,6,7,6,15,5,6,0,12,9,0,7,103,101,116,95,
+,109,112,0,13,8,9,0,31,7,0,0,19,7,8,7,
+,6,7,0,12,9,0,10,95,100,111,95,110,117,109,98,
+,114,0,0,13,8,9,0,15,9,1,0,31,7,9,1,
+,7,8,7,15,1,7,0,12,10,0,7,103,101,116,95,
+,97,103,0,13,9,10,0,31,8,0,0,19,8,9,8,
+,7,8,0,12,10,0,2,100,111,0,0,13,9,10,0,
+,10,3,0,15,11,5,0,31,8,10,2,19,8,9,8,
+,5,8,0,12,10,0,4,99,111,100,101,0,0,0,0,
+,9,10,0,12,14,0,2,69,81,0,0,13,10,14,0,
+,11,6,0,15,12,5,0,15,13,1,0,31,8,10,4,
+,8,9,8,12,10,0,4,99,111,100,101,0,0,0,0,
+,9,10,0,12,12,0,2,73,70,0,0,13,10,12,0,
+,11,6,0,31,8,10,2,19,8,9,8,12,10,0,4,
+,117,109,112,0,0,0,0,13,9,10,0,15,10,7,0,
+,11,0,4,101,108,115,101,0,0,0,0,31,8,10,2,
+,8,9,8,12,10,0,4,106,117,109,112,0,0,0,0,
+,9,10,0,15,10,7,0,12,11,0,3,101,110,100,0,
+,8,10,2,19,8,9,8,12,10,0,3,116,97,103,0,
+,9,10,0,15,10,7,0,12,11,0,4,101,108,115,101,
+,0,0,0,31,8,10,2,19,8,9,8,12,10,0,2,
+,111,0,0,13,9,10,0,15,10,4,0,15,11,5,0,
+,8,10,2,19,8,9,8,15,5,8,0,12,10,0,3,
+,97,103,0,13,9,10,0,15,10,7,0,12,11,0,3,
+,110,100,0,31,8,10,2,19,8,9,8,12,10,0,8,
+,114,101,101,95,116,109,112,0,0,0,0,13,9,10,0,
+,10,6,0,31,8,10,1,19,8,9,8,12,10,0,8,
+,114,101,101,95,116,109,112,0,0,0,0,13,9,10,0,
+,10,1,0,31,8,10,1,19,8,9,8,20,5,0,0,
+,0,0,0,12,36,0,8,115,115,95,105,110,102,105,120,
+,0,0,0,14,36,35,0,16,36,0,26,44,7,0,0,
+,1,0,0,28,2,0,0,32,1,0,2,12,4,0,7,
+,101,116,95,116,109,112,0,13,3,4,0,15,4,1,0,
+,2,4,1,19,2,3,2,15,1,2,0,12,4,0,4,
+,111,100,101,0,0,0,0,13,3,4,0,12,6,0,4,
+,79,78,69,0,0,0,0,13,4,6,0,15,5,1,0,
+,2,4,2,19,2,3,2,20,1,0,0,0,0,0,0,
+,37,0,8,95,100,111,95,110,111,110,101,0,0,0,0,
+,37,36,0,16,37,2,41,44,33,0,0,28,2,0,0,
+,1,0,2,28,2,0,0,28,3,0,0,32,2,0,3,
+,5,0,1,61,0,0,0,27,4,5,1,15,3,4,0,
+,6,0,2,43,61,0,0,12,7,0,2,45,61,0,0,
+,8,0,2,42,61,0,0,12,9,0,2,47,61,0,0,
+,5,6,4,15,4,5,0,12,7,0,1,60,0,0,0,
+,8,0,1,62,0,0,0,12,9,0,2,60,61,0,0,
+,10,0,2,62,61,0,0,12,11,0,2,61,61,0,0,
+,12,0,2,33,61,0,0,27,6,7,6,15,5,6,0,
+,8,0,1,43,0,0,0,12,32,0,3,65,68,68,0,
+,9,32,0,12,10,0,1,42,0,0,0,12,32,0,3,
+,85,76,0,13,11,32,0,12,12,0,1,47,0,0,0,
+,32,0,3,68,73,86,0,13,13,32,0,12,14,0,2,
+,42,0,0,12,32,0,3,80,79,87,0,13,15,32,0,
+,16,0,1,45,0,0,0,12,32,0,3,83,85,66,0,
+,17,32,0,12,18,0,3,97,110,100,0,12,32,0,3,
+,78,68,0,13,19,32,0,12,20,0,2,111,114,0,0,
+,32,0,2,79,82,0,0,13,21,32,0,12,22,0,1,
+,0,0,0,12,32,0,3,77,79,68,0,13,23,32,0,
+,24,0,2,62,62,0,0,12,32,0,3,82,83,72,0,
+,25,32,0,12,26,0,2,60,60,0,0,12,32,0,3,
+,83,72,0,13,27,32,0,12,28,0,1,38,0,0,0,
+,32,0,3,65,78,68,0,13,29,32,0,12,30,0,1,
+,0,0,0,12,32,0,2,79,82,0,0,13,31,32,0,
+,7,8,24,15,6,7,0,12,8,0,3,118,97,108,0,
+,7,1,8,12,8,0,4,78,111,110,101,0,0,0,0,
+,7,7,8,21,7,0,0,18,0,0,11,12,9,0,8,
+,100,111,95,110,111,110,101,0,0,0,0,13,8,9,0,
+,9,2,0,31,7,9,1,19,7,8,7,20,7,0,0,
+,0,0,1,12,8,0,3,118,97,108,0,9,7,1,8,
+,8,0,4,84,114,117,101,0,0,0,0,23,7,7,8,
+,7,0,0,18,0,0,13,12,9,0,10,95,100,111,95,
+,117,109,98,101,114,0,0,13,8,9,0,12,9,0,1,
+,0,0,0,15,10,2,0,31,7,9,2,19,7,8,7,
+,7,0,0,18,0,0,1,12,8,0,3,118,97,108,0,
+,7,1,8,12,8,0,5,70,97,108,115,101,0,0,0,
+,7,7,8,21,7,0,0,18,0,0,13,12,9,0,10,
+,100,111,95,110,117,109,98,101,114,0,0,13,8,9,0,
+,9,0,1,48,0,0,0,15,10,2,0,31,7,9,2,
+,7,8,7,20,7,0,0,18,0,0,1,12,9,0,5,
+,116,101,109,115,0,0,0,9,8,1,9,15,7,8,0,
 ,9,0,3,97,110,100,0,12,10,0,2,111,114,0,0,
 ,8,9,2,12,10,0,3,118,97,108,0,9,9,1,10,
-,8,8,9,21,8,0,0,18,0,0,38,30,15,0,239,
-,32,32,32,32,32,32,32,114,101,116,117,114,110,32,108,
-,103,105,99,95,105,110,102,105,120,40,116,46,118,97,108,
-,32,105,116,101,109,115,91,48,93,44,32,105,116,101,109,
-,91,49,93,44,32,114,41,0,0,0,0,12,10,0,11,
-,111,103,105,99,95,105,110,102,105,120,0,13,9,10,0,
-,14,0,3,118,97,108,0,9,10,1,14,11,14,0,0,
-,0,0,0,0,0,0,0,9,11,7,14,11,14,0,0,
-,0,0,0,0,0,240,63,9,12,7,14,15,13,2,0,
-,8,10,4,19,8,9,8,20,8,0,0,18,0,0,1,
-,6,0,240,32,32,32,32,105,102,32,116,46,118,97,108,
-,105,110,32,105,115,101,116,115,58,0,0,12,10,0,3,
-,97,108,0,9,9,1,10,36,8,4,9,21,8,0,0,
-,0,0,25,30,9,0,241,32,32,32,32,32,32,32,32,
-,101,116,117,114,110,32,105,109,97,110,97,103,101,40,116,
-,100,111,95,115,121,109,98,111,108,41,0,12,10,0,7,
-,109,97,110,97,103,101,0,13,9,10,0,15,10,1,0,
-,12,0,9,100,111,95,115,121,109,98,111,108,0,0,0,
-,11,12,0,31,8,10,2,19,8,9,8,20,8,0,0,
-,0,0,1,30,6,0,242,32,32,32,32,105,102,32,116,
-,118,97,108,32,61,61,32,39,105,115,39,58,0,0,0,
-,9,0,3,118,97,108,0,9,8,1,9,12,9,0,2,
-,115,0,0,23,8,8,9,21,8,0,0,18,0,0,34,
-,12,0,243,32,32,32,32,32,32,32,32,114,101,116,117,
-,110,32,105,110,102,105,120,40,69,81,44,105,116,101,109,
-,91,48,93,44,105,116,101,109,115,91,49,93,44,114,41,
-,0,0,0,12,10,0,5,105,110,102,105,120,0,0,0,
-,9,10,0,12,14,0,2,69,81,0,0,13,10,14,0,
-,14,0,0,0,0,0,0,0,0,0,0,9,11,7,14,
-,14,0,0,0,0,0,0,0,0,240,63,9,12,7,14,
-,13,2,0,31,8,10,4,19,8,9,8,20,8,0,0,
-,0,0,1,30,7,0,244,32,32,32,32,105,102,32,116,
-,118,97,108,32,61,61,32,39,105,115,110,111,116,39,58,
-,0,0,0,12,9,0,3,118,97,108,0,9,8,1,9,
-,9,0,5,105,115,110,111,116,0,0,0,23,8,8,9,
-,8,0,0,18,0,0,34,30,12,0,245,32,32,32,32,
-,32,32,32,114,101,116,117,114,110,32,105,110,102,105,120,
-,67,77,80,44,105,116,101,109,115,91,48,93,44,105,116,
-,109,115,91,49,93,44,114,41,0,0,0,12,10,0,5,
-,110,102,105,120,0,0,0,13,9,10,0,12,14,0,3,
-,77,80,0,13,10,14,0,11,14,0,0,0,0,0,0,
-,0,0,0,9,11,7,14,11,14,0,0,0,0,0,0,
-,0,240,63,9,12,7,14,15,13,2,0,31,8,10,4,
-,8,9,8,20,8,0,0,18,0,0,1,30,6,0,246,
-,32,32,32,105,102,32,116,46,118,97,108,32,61,61,32,
-,110,111,116,39,58,0,0,12,9,0,3,118,97,108,0,
-,8,1,9,12,9,0,3,110,111,116,0,23,8,8,9,
-,8,0,0,18,0,0,28,30,10,0,247,32,32,32,32,
-,32,32,32,114,101,116,117,114,110,32,117,110,97,114,121,
-,78,79,84,44,32,105,116,101,109,115,91,48,93,44,32,
-,41,0,0,12,10,0,5,117,110,97,114,121,0,0,0,
-,9,10,0,12,13,0,3,78,79,84,0,13,10,13,0,
-,13,0,0,0,0,0,0,0,0,0,0,9,11,7,13,
-,12,2,0,31,8,10,3,19,8,9,8,20,8,0,0,
-,0,0,1,30,6,0,248,32,32,32,32,105,102,32,116,
-,118,97,108,32,61,61,32,39,105,110,39,58,0,0,0,
-,9,0,3,118,97,108,0,9,8,1,9,12,9,0,2,
-,110,0,0,23,8,8,9,21,8,0,0,18,0,0,34,
-,12,0,249,32,32,32,32,32,32,32,32,114,101,116,117,
-,110,32,105,110,102,105,120,40,72,65,83,44,105,116,101,
-,115,91,49,93,44,105,116,101,109,115,91,48,93,44,114,
-,0,0,0,12,10,0,5,105,110,102,105,120,0,0,0,
-,9,10,0,12,14,0,3,72,65,83,0,13,10,14,0,
-,14,0,0,0,0,0,0,0,0,240,63,9,11,7,14,
+,8,8,9,21,8,0,0,18,0,0,36,12,11,0,3,
+,110,116,0,13,10,11,0,12,12,0,3,118,97,108,0,
+,11,1,12,12,12,0,2,111,114,0,0,23,11,11,12,
+,9,11,1,19,9,10,9,15,8,9,0,12,11,0,8,
+,115,95,105,110,102,105,120,0,0,0,0,13,10,11,0,
+,11,8,0,12,17,0,3,118,97,108,0,9,16,1,17,
+,12,6,16,11,16,0,0,0,0,0,0,0,0,0,0,
+,13,7,16,11,16,0,0,0,0,0,0,0,0,240,63,
+,14,7,16,15,15,2,0,31,9,11,5,19,9,10,9,
+,9,0,0,18,0,0,1,12,11,0,3,118,97,108,0,
+,10,1,11,36,9,4,10,21,9,0,0,18,0,0,15,
+,11,0,7,105,109,97,110,97,103,101,0,13,10,11,0,
+,11,1,0,12,13,0,9,100,111,95,115,121,109,98,111,
+,0,0,0,13,12,13,0,31,9,11,2,19,9,10,9,
+,9,0,0,18,0,0,1,12,10,0,3,118,97,108,0,
+,9,1,10,12,10,0,2,105,115,0,0,23,9,9,10,
+,9,0,0,18,0,0,21,12,11,0,5,105,110,102,105,
+,0,0,0,13,10,11,0,12,15,0,2,69,81,0,0,
+,11,15,0,11,15,0,0,0,0,0,0,0,0,0,0,
+,12,7,15,11,15,0,0,0,0,0,0,0,0,240,63,
+,13,7,15,15,14,2,0,31,9,11,4,19,9,10,9,
+,9,0,0,18,0,0,1,12,10,0,3,118,97,108,0,
+,9,1,10,12,10,0,5,105,115,110,111,116,0,0,0,
+,9,9,10,21,9,0,0,18,0,0,21,12,11,0,5,
+,110,102,105,120,0,0,0,13,10,11,0,12,15,0,3,
+,77,80,0,13,11,15,0,11,15,0,0,0,0,0,0,
+,0,0,0,9,12,7,15,11,15,0,0,0,0,0,0,
+,0,240,63,9,13,7,15,15,14,2,0,31,9,11,4,
+,9,10,9,20,9,0,0,18,0,0,1,12,10,0,3,
+,97,108,0,9,9,1,10,12,10,0,3,110,111,116,0,
+,9,9,10,21,9,0,0,18,0,0,32,12,11,0,5,
+,110,102,105,120,0,0,0,13,10,11,0,12,15,0,2,
+,81,0,0,13,11,15,0,12,16,0,5,84,111,107,101,
+,0,0,0,13,15,16,0,12,19,0,3,112,111,115,0,
+,16,1,19,12,17,0,6,110,117,109,98,101,114,0,0,
+,18,0,0,0,0,0,0,0,0,0,0,31,12,16,3,
+,12,15,12,11,15,0,0,0,0,0,0,0,0,0,0,
+,13,7,15,15,14,2,0,31,9,11,4,19,9,10,9,
+,9,0,0,18,0,0,1,12,10,0,3,118,97,108,0,
+,9,1,10,12,10,0,2,105,110,0,0,23,9,9,10,
+,9,0,0,18,0,0,21,12,11,0,5,105,110,102,105,
+,0,0,0,13,10,11,0,12,15,0,3,72,65,83,0,
+,11,15,0,11,15,0,0,0,0,0,0,0,0,240,63,
+,12,7,15,11,15,0,0,0,0,0,0,0,0,0,0,
+,13,7,15,15,14,2,0,31,9,11,4,19,9,10,9,
+,9,0,0,18,0,0,1,12,10,0,3,118,97,108,0,
+,9,1,10,12,10,0,5,110,111,116,105,110,0,0,0,
+,9,9,10,21,9,0,0,18,0,0,51,12,11,0,5,
+,110,102,105,120,0,0,0,13,10,11,0,12,15,0,3,
+,65,83,0,13,11,15,0,11,15,0,0,0,0,0,0,
+,0,240,63,9,12,7,15,11,15,0,0,0,0,0,0,
+,0,0,0,9,13,7,15,15,14,2,0,31,9,11,4,
+,9,10,9,15,2,9,0,12,12,0,10,95,100,111,95,
+,117,109,98,101,114,0,0,13,11,12,0,12,12,0,1,
+,0,0,0,31,10,12,1,19,10,11,10,15,9,10,0,
+,12,0,4,99,111,100,101,0,0,0,0,13,11,12,0,
+,16,0,2,69,81,0,0,13,12,16,0,15,13,2,0,
+,14,2,0,12,17,0,8,102,114,101,101,95,116,109,112,
+,0,0,0,13,16,17,0,15,17,9,0,31,15,17,1,
+,15,16,15,31,10,12,4,19,10,11,10,20,2,0,0,
+,0,0,1,12,12,0,3,118,97,108,0,9,11,1,12,
+,10,3,11,21,10,0,0,18,0,0,18,12,12,0,10,
+,111,95,115,101,116,95,99,116,120,0,0,13,11,12,0,
 ,14,0,0,0,0,0,0,0,0,0,0,9,12,7,14,
-,13,2,0,31,8,10,4,19,8,9,8,20,8,0,0,
-,0,0,1,30,7,0,250,32,32,32,32,105,102,32,116,
-,118,97,108,32,61,61,32,39,110,111,116,105,110,39,58,
-,0,0,0,12,9,0,3,118,97,108,0,9,8,1,9,
-,9,0,5,110,111,116,105,110,0,0,0,23,8,8,9,
-,8,0,0,18,0,0,88,30,11,0,251,32,32,32,32,
-,32,32,32,114,32,61,32,105,110,102,105,120,40,72,65,
-,44,105,116,101,109,115,91,49,93,44,105,116,101,109,115,
-,48,93,44,114,41,0,0,12,10,0,5,105,110,102,105,
-,0,0,0,13,9,10,0,12,14,0,3,72,65,83,0,
-,10,14,0,11,14,0,0,0,0,0,0,0,0,240,63,
-,11,7,14,11,14,0,0,0,0,0,0,0,0,0,0,
-,12,7,14,15,13,2,0,31,8,10,4,19,8,9,8,
-,2,8,0,30,8,0,252,32,32,32,32,32,32,32,32,
-,101,114,111,32,61,32,95,100,111,95,110,117,109,98,101,
-,40,39,48,39,41,0,0,12,11,0,10,95,100,111,95,
-,117,109,98,101,114,0,0,13,10,11,0,12,11,0,1,
-,0,0,0,31,9,11,1,19,9,10,9,15,8,9,0,
-,9,0,253,32,32,32,32,32,32,32,32,99,111,100,101,
-,69,81,44,114,44,114,44,102,114,101,101,95,116,109,112,
-,122,101,114,111,41,41,0,12,11,0,4,99,111,100,101,
-,0,0,0,13,10,11,0,12,15,0,2,69,81,0,0,
-,11,15,0,15,12,2,0,15,13,2,0,12,16,0,8,
-,114,101,101,95,116,109,112,0,0,0,0,13,15,16,0,
-,16,8,0,31,14,16,1,19,14,15,14,31,9,11,4,
-,9,10,9,30,5,0,254,32,32,32,32,32,32,32,32,
-,101,116,117,114,110,32,114,0,0,0,0,20,2,0,0,
-,0,0,1,30,6,0,255,32,32,32,32,105,102,32,116,
-,118,97,108,32,105,110,32,115,101,116,115,58,0,0,0,
-,11,0,3,118,97,108,0,9,10,1,11,36,9,3,10,
-,9,0,0,18,0,0,31,30,12,1,0,32,32,32,32,
-,32,32,32,114,101,116,117,114,110,32,100,111,95,115,101,
-,95,99,116,120,40,105,116,101,109,115,91,48,93,44,105,
-,101,109,115,91,49,93,41,59,0,0,0,12,11,0,10,
-,111,95,115,101,116,95,99,116,120,0,0,13,10,11,0,
-,13,0,0,0,0,0,0,0,0,0,0,9,11,7,13,
-,13,0,0,0,0,0,0,0,0,240,63,9,12,7,13,
-,9,11,2,19,9,10,9,20,9,0,0,18,0,0,215,
-,6,1,1,32,32,32,32,101,108,105,102,32,116,46,118,
-,108,32,105,110,32,99,109,112,115,58,0,12,11,0,3,
-,97,108,0,9,10,1,11,36,9,5,10,21,9,0,0,
-,0,0,166,30,8,1,2,32,32,32,32,32,32,32,32,
-,44,99,32,61,32,105,116,101,109,115,91,48,93,44,105,
-,101,109,115,91,49,93,0,11,11,0,0,0,0,0,0,
-,0,0,0,9,10,7,11,15,9,10,0,11,12,0,0,
-,0,0,0,0,0,240,63,9,11,7,12,15,10,11,0,
-,11,9,0,15,9,10,0,30,5,1,3,32,32,32,32,
-,32,32,32,118,32,61,32,116,46,118,97,108,0,0,0,
-,13,0,3,118,97,108,0,9,12,1,13,15,10,12,0,
-,8,1,4,32,32,32,32,32,32,32,32,105,102,32,118,
-,48,93,32,105,110,32,40,39,62,39,44,39,62,61,39,
-,58,0,0,12,13,0,1,62,0,0,0,12,14,0,2,
-,61,0,0,27,12,13,2,11,14,0,0,0,0,0,0,
-,0,0,0,9,13,10,14,36,12,12,13,21,12,0,0,
-,0,0,27,30,9,1,5,32,32,32,32,32,32,32,32,
-,32,32,32,98,44,99,44,118,32,61,32,99,44,98,44,
-,60,39,43,118,91,49,58,93,0,0,0,15,12,9,0,
-,13,11,0,12,15,0,1,60,0,0,0,11,18,0,0,
-,0,0,0,0,0,240,63,28,19,0,0,27,17,18,2,
-,16,10,17,1,15,15,16,15,14,15,0,15,11,12,0,
-,9,13,0,15,10,14,0,18,0,0,1,30,4,1,6,
-,32,32,32,32,32,32,32,99,100,32,61,32,69,81,0,
-,14,0,2,69,81,0,0,13,13,14,0,15,12,13,0,
-,8,1,7,32,32,32,32,32,32,32,32,105,102,32,118,
-,61,61,32,39,60,39,58,32,99,100,32,61,32,76,84,
-,0,0,0,12,14,0,1,60,0,0,0,23,13,10,14,
-,13,0,0,18,0,0,6,12,14,0,2,76,84,0,0,
-,13,14,0,15,12,13,0,18,0,0,1,30,8,1,8,
-,32,32,32,32,32,32,32,105,102,32,118,32,61,61,32,
-,60,61,39,58,32,99,100,32,61,32,76,69,0,0,0,
-,14,0,2,60,61,0,0,23,13,10,14,21,13,0,0,
-,0,0,6,12,14,0,2,76,69,0,0,13,13,14,0,
-,12,13,0,18,0,0,1,30,8,1,9,32,32,32,32,
-,32,32,32,105,102,32,118,32,61,61,32,39,33,61,39,
-,32,99,100,32,61,32,78,69,0,0,0,12,14,0,2,
-,61,0,0,23,13,10,14,21,13,0,0,18,0,0,6,
-,14,0,2,78,69,0,0,13,13,14,0,15,12,13,0,
-,0,0,1,30,8,1,10,32,32,32,32,32,32,32,32,
-,101,116,117,114,110,32,105,110,102,105,120,40,99,100,44,
-,44,99,44,114,41,0,0,12,15,0,5,105,110,102,105,
-,0,0,0,13,14,15,0,15,15,12,0,15,16,11,0,
-,17,9,0,15,18,2,0,31,13,15,4,19,13,14,13,
-,13,0,0,18,0,0,37,30,14,1,12,32,32,32,32,
-,32,32,32,114,101,116,117,114,110,32,105,110,102,105,120,
-,109,101,116,97,115,91,116,46,118,97,108,93,44,105,116,
-,109,115,91,48,93,44,105,116,101,109,115,91,49,93,44,
-,41,0,0,12,15,0,5,105,110,102,105,120,0,0,0,
-,14,15,0,12,20,0,3,118,97,108,0,9,19,1,20,
-,15,6,19,11,19,0,0,0,0,0,0,0,0,0,0,
-,16,7,19,11,19,0,0,0,0,0,0,0,0,240,63,
-,17,7,19,15,18,2,0,31,13,15,4,19,13,14,13,
-,13,0,0,18,0,0,1,0,0,0,0,12,37,0,9,
-,111,95,115,121,109,98,111,108,0,0,0,14,37,36,0,
-,6,1,14,100,101,102,32,100,111,95,115,101,116,95,99,
-,120,40,107,44,118,41,58,0,0,0,0,16,37,3,103,
-,34,0,0,30,6,1,14,100,101,102,32,100,111,95,115,
-,116,95,99,116,120,40,107,44,118,41,58,0,0,0,0,
-,1,0,14,99,111,114,101,47,101,110,99,111,100,101,46,
-,121,0,0,33,1,0,0,12,1,0,10,100,111,95,115,
-,116,95,99,116,120,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,28,3,0,0,9,2,0,3,30,7,1,15,
-,32,32,32,105,102,32,107,46,116,121,112,101,32,61,61,
-,39,110,97,109,101,39,58,0,0,0,0,12,4,0,4,
-,121,112,101,0,0,0,0,9,3,1,4,12,4,0,4,
-,97,109,101,0,0,0,0,23,3,3,4,21,3,0,0,
-,0,0,222,30,19,1,16,32,32,32,32,32,32,32,32,
-,102,32,40,68,46,95,103,108,111,98,97,108,115,32,97,
-,100,32,107,46,118,97,108,32,110,111,116,32,105,110,32,
-,46,118,97,114,115,41,32,111,114,32,40,107,46,118,97,
-,32,105,110,32,68,46,103,108,111,98,97,108,115,41,58,
-,0,0,0,12,4,0,1,68,0,0,0,13,3,4,0,
-,4,0,8,95,103,108,111,98,97,108,115,0,0,0,0,
-,3,3,4,21,3,0,0,18,0,0,16,12,4,0,1,
-,0,0,0,13,3,4,0,12,4,0,4,118,97,114,115,
-,0,0,0,9,3,3,4,12,5,0,3,118,97,108,0,
-,4,1,5,36,3,3,4,11,4,0,0,0,0,0,0,
-,0,0,0,23,3,3,4,46,3,0,0,18,0,0,12,
-,4,0,1,68,0,0,0,13,3,4,0,12,4,0,7,
-,108,111,98,97,108,115,0,9,3,3,4,12,5,0,3,
-,97,108,0,9,4,1,5,36,3,3,4,21,3,0,0,
-,0,0,92,30,8,1,17,32,32,32,32,32,32,32,32,
-,32,32,32,99,32,61,32,100,111,95,115,116,114,105,110,
-,40,107,41,0,0,0,0,12,6,0,9,100,111,95,115,
-,114,105,110,103,0,0,0,13,5,6,0,15,6,1,0,
-,4,6,1,19,4,5,4,15,3,4,0,30,6,1,18,
-,32,32,32,32,32,32,32,32,32,32,32,98,32,61,32,
-,111,40,118,41,0,0,0,12,7,0,2,100,111,0,0,
+,14,0,0,0,0,0,0,0,0,240,63,9,13,7,14,
+,10,12,2,19,10,11,10,20,10,0,0,18,0,0,118,
+,12,0,3,118,97,108,0,9,11,1,12,36,10,5,11,
+,10,0,0,18,0,0,91,11,12,0,0,0,0,0,0,
+,0,0,0,9,11,7,12,15,10,11,0,11,13,0,0,
+,0,0,0,0,0,240,63,9,12,7,13,15,11,12,0,
+,12,10,0,15,10,11,0,12,14,0,3,118,97,108,0,
+,13,1,14,15,11,13,0,12,14,0,1,62,0,0,0,
+,15,0,2,62,61,0,0,27,13,14,2,11,15,0,0,
+,0,0,0,0,0,0,0,9,14,11,15,36,13,13,14,
+,13,0,0,18,0,0,17,15,13,10,0,15,14,12,0,
+,16,0,1,60,0,0,0,11,19,0,0,0,0,0,0,
+,0,240,63,28,20,0,0,27,18,19,2,9,17,11,18,
+,16,16,17,15,15,16,0,15,12,13,0,15,10,14,0,
+,11,15,0,18,0,0,1,12,15,0,2,69,81,0,0,
+,14,15,0,15,13,14,0,12,15,0,1,60,0,0,0,
+,14,11,15,21,14,0,0,18,0,0,6,12,15,0,2,
+,84,0,0,13,14,15,0,15,13,14,0,18,0,0,1,
+,15,0,2,60,61,0,0,23,14,11,15,21,14,0,0,
+,0,0,6,12,15,0,2,76,69,0,0,13,14,15,0,
+,13,14,0,18,0,0,1,12,15,0,2,33,61,0,0,
+,14,11,15,21,14,0,0,18,0,0,6,12,15,0,2,
+,69,0,0,13,14,15,0,15,13,14,0,18,0,0,1,
+,16,0,5,105,110,102,105,120,0,0,0,13,15,16,0,
+,16,13,0,15,17,12,0,15,18,10,0,15,19,2,0,
+,14,16,4,19,14,15,14,20,14,0,0,18,0,0,22,
+,16,0,5,105,110,102,105,120,0,0,0,13,15,16,0,
+,21,0,3,118,97,108,0,9,20,1,21,9,16,6,20,
+,20,0,0,0,0,0,0,0,0,0,0,9,17,7,20,
+,20,0,0,0,0,0,0,0,0,240,63,9,18,7,20,
+,19,2,0,31,14,16,4,19,14,15,14,20,14,0,0,
+,0,0,1,0,0,0,0,12,38,0,9,100,111,95,115,
+,109,98,111,108,0,0,0,14,38,37,0,16,38,1,221,
+,34,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
+,2,0,3,12,4,0,4,116,121,112,101,0,0,0,0,
+,3,1,4,12,4,0,4,110,97,109,101,0,0,0,0,
+,3,3,4,21,3,0,0,18,0,0,136,11,5,0,0,
+,0,0,0,0,0,240,63,11,7,0,0,0,0,0,0,
+,0,0,0,12,8,0,1,68,0,0,0,13,3,8,0,
+,8,0,8,95,103,108,111,98,97,108,115,0,0,0,0,
+,3,3,8,23,6,3,7,21,6,0,0,18,0,0,2,
+,0,0,16,12,8,0,1,68,0,0,0,13,3,8,0,
+,8,0,4,118,97,114,115,0,0,0,0,9,3,3,8,
+,9,0,3,118,97,108,0,9,8,1,9,36,3,3,8,
+,8,0,0,0,0,0,0,0,0,0,0,23,3,3,8,
+,4,3,5,21,4,0,0,18,0,0,2,18,0,0,12,
+,6,0,1,68,0,0,0,13,3,6,0,12,6,0,7,
+,108,111,98,97,108,115,0,9,3,3,6,12,7,0,3,
+,97,108,0,9,6,1,7,36,3,3,6,21,3,0,0,
+,0,0,48,12,6,0,9,100,111,95,115,116,114,105,110,
+,0,0,0,13,5,6,0,15,6,1,0,31,4,6,1,
+,4,5,4,15,3,4,0,12,7,0,2,100,111,0,0,
 ,6,7,0,15,7,2,0,31,5,7,1,19,5,6,5,
-,4,5,0,30,7,1,19,32,32,32,32,32,32,32,32,
-,32,32,32,99,111,100,101,40,71,83,69,84,44,99,44,
-,41,0,0,12,7,0,4,99,111,100,101,0,0,0,0,
+,4,5,0,12,7,0,4,99,111,100,101,0,0,0,0,
 ,6,7,0,12,10,0,4,71,83,69,84,0,0,0,0,
 ,7,10,0,15,8,3,0,15,9,4,0,31,5,7,3,
-,5,6,5,30,6,1,20,32,32,32,32,32,32,32,32,
-,32,32,32,102,114,101,101,95,116,109,112,40,99,41,0,
-,7,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
-,6,7,0,15,7,3,0,31,5,7,1,19,5,6,5,
-,6,1,21,32,32,32,32,32,32,32,32,32,32,32,32,
-,114,101,101,95,116,109,112,40,98,41,0,12,7,0,8,
-,114,101,101,95,116,109,112,0,0,0,0,13,6,7,0,
-,7,4,0,31,5,7,1,19,5,6,5,30,5,1,22,
-,32,32,32,32,32,32,32,32,32,32,32,114,101,116,117,
-,110,0,0,28,5,0,0,20,5,0,0,18,0,0,1,
-,6,1,23,32,32,32,32,32,32,32,32,97,32,61,32,
-,111,95,108,111,99,97,108,40,107,41,0,12,8,0,8,
-,111,95,108,111,99,97,108,0,0,0,0,13,7,8,0,
-,8,1,0,31,6,8,1,19,6,7,6,15,5,6,0,
-,5,1,24,32,32,32,32,32,32,32,32,98,32,61,32,
-,111,40,118,41,0,0,0,12,8,0,2,100,111,0,0,
-,7,8,0,15,8,2,0,31,6,8,1,19,6,7,6,
-,4,6,0,30,6,1,25,32,32,32,32,32,32,32,32,
-,111,100,101,40,77,79,86,69,44,97,44,98,41,0,0,
+,5,6,5,12,7,0,8,102,114,101,101,95,116,109,112,
+,0,0,0,13,6,7,0,15,7,3,0,31,5,7,1,
+,5,6,5,12,7,0,8,102,114,101,101,95,116,109,112,
+,0,0,0,13,6,7,0,15,7,4,0,31,5,7,1,
+,5,6,5,28,5,0,0,20,5,0,0,18,0,0,1,
+,8,0,8,100,111,95,108,111,99,97,108,0,0,0,0,
+,7,8,0,15,8,1,0,31,6,8,1,19,6,7,6,
+,5,6,0,12,8,0,2,100,111,0,0,13,7,8,0,
+,8,2,0,31,6,8,1,19,6,7,6,15,4,6,0,
 ,8,0,4,99,111,100,101,0,0,0,0,13,7,8,0,
 ,11,0,4,77,79,86,69,0,0,0,0,13,8,11,0,
 ,9,5,0,15,10,4,0,31,6,8,3,19,6,7,6,
-,5,1,26,32,32,32,32,32,32,32,32,102,114,101,101,
-,116,109,112,40,98,41,0,12,8,0,8,102,114,101,101,
-,116,109,112,0,0,0,0,13,7,8,0,15,8,4,0,
-,6,8,1,19,6,7,6,30,5,1,27,32,32,32,32,
-,32,32,32,114,101,116,117,114,110,32,97,0,0,0,0,
-,5,0,0,18,0,1,242,30,10,1,28,32,32,32,32,
-,108,105,102,32,107,46,116,121,112,101,32,105,110,32,40,
-,116,117,112,108,101,39,44,39,108,105,115,116,39,41,58,
-,0,0,0,12,7,0,5,116,117,112,108,101,0,0,0,
-,8,0,4,108,105,115,116,0,0,0,0,27,6,7,2,
-,8,0,4,116,121,112,101,0,0,0,0,9,7,1,8,
-,6,6,7,21,6,0,0,18,0,1,217,30,10,1,29,
-,32,32,32,32,32,32,32,105,102,32,118,46,116,121,112,
-,32,105,110,32,40,39,116,117,112,108,101,39,44,39,108,
-,115,116,39,41,58,0,0,12,7,0,5,116,117,112,108,
+,8,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,7,8,0,15,8,4,0,31,6,8,1,19,6,7,6,
+,5,0,0,18,0,1,6,12,7,0,5,116,117,112,108,
 ,0,0,0,12,8,0,4,108,105,115,116,0,0,0,0,
 ,6,7,2,12,8,0,4,116,121,112,101,0,0,0,0,
-,7,2,8,36,6,6,7,21,6,0,0,18,0,1,12,
-,7,1,30,32,32,32,32,32,32,32,32,32,32,32,32,
-,44,116,109,112,115,32,61,32,48,44,91,93,0,0,0,
-,7,0,0,0,0,0,0,0,0,0,0,15,6,7,0,
-,8,0,0,15,7,8,0,15,8,6,0,15,6,7,0,
-,8,1,31,32,32,32,32,32,32,32,32,32,32,32,32,
-,111,114,32,107,107,32,105,110,32,107,46,105,116,101,109,
-,58,0,0,12,10,0,5,105,116,101,109,115,0,0,0,
-,9,1,10,11,10,0,0,0,0,0,0,0,0,0,0,
-,7,9,10,18,0,0,112,30,8,1,32,32,32,32,32,
-,32,32,32,32,32,32,32,32,32,32,32,118,118,32,61,
-,118,46,105,116,101,109,115,91,110,93,0,12,13,0,5,
+,7,1,8,36,6,6,7,21,6,0,0,18,0,0,248,
+,7,0,5,116,117,112,108,101,0,0,0,12,8,0,4,
+,105,115,116,0,0,0,0,27,6,7,2,12,8,0,4,
+,121,112,101,0,0,0,0,9,7,2,8,36,6,6,7,
+,6,0,0,18,0,0,128,11,7,0,0,0,0,0,0,
+,0,0,0,15,6,7,0,27,8,0,0,15,7,8,0,
+,8,6,0,15,6,7,0,12,10,0,5,105,116,101,109,
+,0,0,0,9,9,1,10,11,10,0,0,0,0,0,0,
+,0,0,0,42,7,9,10,18,0,0,54,12,13,0,5,
 ,116,101,109,115,0,0,0,9,12,2,13,9,12,12,8,
-,11,12,0,30,13,1,33,32,32,32,32,32,32,32,32,
-,32,32,32,32,32,32,32,116,109,112,32,61,32,103,101,
-,95,116,109,112,40,41,59,32,116,109,112,115,46,97,112,
-,101,110,100,40,116,109,112,41,0,0,0,12,15,0,7,
-,101,116,95,116,109,112,0,13,14,15,0,31,13,0,0,
-,13,14,13,15,12,13,0,12,15,0,6,97,112,112,101,
-,100,0,0,9,14,6,15,15,15,12,0,31,13,15,1,
-,13,14,13,30,7,1,34,32,32,32,32,32,32,32,32,
-,32,32,32,32,32,32,32,114,32,61,32,100,111,40,118,
-,41,0,0,12,16,0,2,100,111,0,0,13,15,16,0,
-,16,11,0,31,14,16,1,19,14,15,14,15,13,14,0,
-,9,1,35,32,32,32,32,32,32,32,32,32,32,32,32,
-,32,32,32,99,111,100,101,40,77,79,86,69,44,116,109,
-,44,114,41,0,0,0,0,12,16,0,4,99,111,100,101,
+,11,12,0,12,15,0,7,103,101,116,95,116,109,112,0,
+,14,15,0,31,13,0,0,19,13,14,13,15,12,13,0,
+,15,0,6,97,112,112,101,110,100,0,0,9,14,6,15,
+,15,12,0,31,13,15,1,19,13,14,13,12,16,0,2,
+,111,0,0,13,15,16,0,15,16,11,0,31,14,16,1,
+,14,15,14,15,13,14,0,12,16,0,4,99,111,100,101,
 ,0,0,0,13,15,16,0,12,19,0,4,77,79,86,69,
 ,0,0,0,13,16,19,0,15,17,12,0,15,18,13,0,
-,14,16,3,19,14,15,14,30,9,1,36,32,32,32,32,
-,32,32,32,32,32,32,32,32,32,32,32,102,114,101,101,
-,116,109,112,40,114,41,32,35,82,69,71,0,0,0,0,
-,16,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
-,15,16,0,15,16,13,0,31,14,16,1,19,14,15,14,
-,6,1,37,32,32,32,32,32,32,32,32,32,32,32,32,
-,32,32,32,110,43,61,49,0,0,0,0,11,15,0,0,
-,0,0,0,0,0,240,63,1,14,8,15,15,8,14,0,
-,0,255,144,30,5,1,38,32,32,32,32,32,32,32,32,
-,32,32,32,110,32,61,32,48,0,0,0,11,9,0,0,
-,0,0,0,0,0,0,0,15,8,9,0,30,8,1,39,
-,32,32,32,32,32,32,32,32,32,32,32,102,111,114,32,
-,107,32,105,110,32,107,46,105,116,101,109,115,58,0,0,
+,14,16,3,19,14,15,14,12,16,0,8,102,114,101,101,
+,116,109,112,0,0,0,0,13,15,16,0,15,16,13,0,
+,14,16,1,19,14,15,14,11,15,0,0,0,0,0,0,
+,0,240,63,1,14,8,15,15,8,14,0,18,0,255,202,
+,9,0,0,0,0,0,0,0,0,0,0,15,8,9,0,
 ,10,0,5,105,116,101,109,115,0,0,0,9,9,1,10,
 ,10,0,0,0,0,0,0,0,0,0,0,42,7,9,10,
-,0,0,86,30,8,1,40,32,32,32,32,32,32,32,32,
-,32,32,32,32,32,32,32,118,118,32,61,32,118,46,105,
-,101,109,115,91,110,93,0,12,15,0,5,105,116,101,109,
-,0,0,0,9,14,2,15,9,14,14,8,15,11,14,0,
-,8,1,41,32,32,32,32,32,32,32,32,32,32,32,32,
-,32,32,32,116,109,112,32,61,32,116,109,112,115,91,110,
-,0,0,0,9,14,6,8,15,12,14,0,30,18,1,42,
-,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,
-,114,101,101,95,116,109,112,40,100,111,95,115,101,116,95,
-,116,120,40,107,107,44,84,111,107,101,110,40,118,118,46,
-,111,115,44,39,114,101,103,39,44,116,109,112,41,41,41,
-,35,82,69,71,0,0,0,12,16,0,8,102,114,101,101,
-,116,109,112,0,0,0,0,13,15,16,0,12,18,0,10,
-,111,95,115,101,116,95,99,116,120,0,0,13,17,18,0,
-,18,7,0,12,21,0,5,84,111,107,101,110,0,0,0,
-,20,21,0,12,24,0,3,112,111,115,0,9,21,11,24,
-,22,0,3,114,101,103,0,15,23,12,0,31,19,21,3,
-,19,20,19,31,16,18,2,19,16,17,16,31,14,16,1,
-,14,15,14,30,6,1,43,32,32,32,32,32,32,32,32,
-,32,32,32,32,32,32,32,110,32,43,61,32,49,0,0,
+,0,0,42,12,15,0,5,105,116,101,109,115,0,0,0,
+,14,2,15,9,14,14,8,15,11,14,0,9,14,6,8,
+,12,14,0,12,16,0,8,102,114,101,101,95,116,109,112,
+,0,0,0,13,15,16,0,12,18,0,10,100,111,95,115,
+,116,95,99,116,120,0,0,13,17,18,0,15,18,7,0,
+,21,0,5,84,111,107,101,110,0,0,0,13,20,21,0,
+,24,0,3,112,111,115,0,9,21,11,24,12,22,0,3,
+,101,103,0,15,23,12,0,31,19,21,3,19,19,20,19,
+,16,18,2,19,16,17,16,31,14,16,1,19,14,15,14,
 ,15,0,0,0,0,0,0,0,0,240,63,1,14,8,15,
-,8,14,0,18,0,255,170,30,5,1,44,32,32,32,32,
-,32,32,32,32,32,32,32,114,101,116,117,114,110,0,0,
-,9,0,0,20,9,0,0,18,0,0,1,30,8,1,46,
-,32,32,32,32,32,32,32,114,32,61,32,100,111,40,118,
-,59,32,117,110,95,116,109,112,40,114,41,0,0,0,0,
-,14,0,2,100,111,0,0,13,10,14,0,15,14,2,0,
-,9,14,1,19,9,10,9,15,13,9,0,12,14,0,6,
-,110,95,116,109,112,0,0,13,10,14,0,15,14,13,0,
-,9,14,1,19,9,10,9,30,11,1,47,32,32,32,32,
-,32,32,32,110,44,32,116,109,112,32,61,32,48,44,32,
-,111,107,101,110,40,118,46,112,111,115,44,39,114,101,103,
-,44,114,41,0,0,0,0,11,10,0,0,0,0,0,0,
-,0,0,0,15,9,10,0,12,16,0,5,84,111,107,101,
-,0,0,0,13,15,16,0,12,19,0,3,112,111,115,0,
-,16,2,19,12,17,0,3,114,101,103,0,15,18,13,0,
-,14,16,3,19,14,15,14,15,10,14,0,15,8,9,0,
-,12,10,0,30,7,1,48,32,32,32,32,32,32,32,32,
-,111,114,32,116,116,32,105,110,32,107,46,105,116,101,109,
-,58,0,0,12,14,0,5,105,116,101,109,115,0,0,0,
-,10,1,14,11,14,0,0,0,0,0,0,0,0,0,0,
-,9,10,14,18,0,0,88,30,27,1,49,32,32,32,32,
-,32,32,32,32,32,32,32,102,114,101,101,95,116,109,112,
-,100,111,95,115,101,116,95,99,116,120,40,116,116,44,84,
-,107,101,110,40,116,109,112,46,112,111,115,44,39,103,101,
-,39,44,78,111,110,101,44,91,116,109,112,44,84,111,107,
-,110,40,116,109,112,46,112,111,115,44,39,110,117,109,98,
-,114,39,44,115,116,114,40,110,41,41,93,41,41,41,32,
-,82,69,71,0,0,0,0,12,17,0,8,102,114,101,101,
-,116,109,112,0,0,0,0,13,16,17,0,12,19,0,10,
-,111,95,115,101,116,95,99,116,120,0,0,13,18,19,0,
-,19,9,0,12,22,0,5,84,111,107,101,110,0,0,0,
-,21,22,0,12,26,0,3,112,111,115,0,9,22,12,26,
-,23,0,3,103,101,116,0,28,24,0,0,15,26,12,0,
-,29,0,5,84,111,107,101,110,0,0,0,13,28,29,0,
-,32,0,3,112,111,115,0,9,29,12,32,12,30,0,6,
-,117,109,98,101,114,0,0,12,33,0,3,115,116,114,0,
-,32,33,0,15,33,8,0,31,31,33,1,19,31,32,31,
-,27,29,3,19,27,28,27,27,25,26,2,31,20,22,4,
-,20,21,20,31,17,19,2,19,17,18,17,31,15,17,1,
-,15,16,15,30,5,1,50,32,32,32,32,32,32,32,32,
-,32,32,32,110,32,43,61,32,49,0,0,11,16,0,0,
-,0,0,0,0,0,240,63,1,15,8,16,15,8,15,0,
-,0,255,168,30,5,1,51,32,32,32,32,32,32,32,32,
-,114,101,101,95,114,101,103,40,114,41,0,12,15,0,8,
-,114,101,101,95,114,101,103,0,0,0,0,13,14,15,0,
-,15,13,0,31,10,15,1,19,10,14,10,30,4,1,52,
-,32,32,32,32,32,32,32,114,101,116,117,114,110,0,0,
-,10,0,0,20,10,0,0,18,0,0,1,30,6,1,53,
-,32,32,32,114,32,61,32,100,111,40,107,46,105,116,101,
-,115,91,48,93,41,0,0,12,15,0,2,100,111,0,0,
-,14,15,0,12,16,0,5,105,116,101,109,115,0,0,0,
-,15,1,16,11,16,0,0,0,0,0,0,0,0,0,0,
-,15,15,16,31,10,15,1,19,10,14,10,15,13,10,0,
-,4,1,54,32,32,32,32,114,114,32,61,32,100,111,40,
-,41,0,0,12,16,0,2,100,111,0,0,13,15,16,0,
+,8,14,0,18,0,255,214,28,9,0,0,20,9,0,0,
+,0,0,1,12,14,0,2,100,111,0,0,13,10,14,0,
+,14,2,0,31,9,14,1,19,9,10,9,15,13,9,0,
+,14,0,6,117,110,95,116,109,112,0,0,13,10,14,0,
+,14,13,0,31,9,14,1,19,9,10,9,11,10,0,0,
+,0,0,0,0,0,0,0,15,9,10,0,12,16,0,5,
+,111,107,101,110,0,0,0,13,15,16,0,12,19,0,3,
+,111,115,0,9,16,2,19,12,17,0,3,114,101,103,0,
+,18,13,0,31,14,16,3,19,14,15,14,15,10,14,0,
+,8,9,0,15,12,10,0,12,14,0,5,105,116,101,109,
+,0,0,0,9,10,1,14,11,14,0,0,0,0,0,0,
+,0,0,0,42,9,10,14,18,0,0,54,12,17,0,8,
+,114,101,101,95,116,109,112,0,0,0,0,13,16,17,0,
+,19,0,10,100,111,95,115,101,116,95,99,116,120,0,0,
+,18,19,0,15,19,9,0,12,22,0,5,84,111,107,101,
+,0,0,0,13,21,22,0,12,26,0,3,112,111,115,0,
+,22,12,26,12,23,0,3,103,101,116,0,28,24,0,0,
+,26,12,0,12,29,0,5,84,111,107,101,110,0,0,0,
+,28,29,0,12,32,0,3,112,111,115,0,9,29,12,32,
+,30,0,6,110,117,109,98,101,114,0,0,12,33,0,3,
+,116,114,0,13,32,33,0,15,33,8,0,31,31,33,1,
+,31,32,31,31,27,29,3,19,27,28,27,27,25,26,2,
+,20,22,4,19,20,21,20,31,17,19,2,19,17,18,17,
+,15,17,1,19,15,16,15,11,16,0,0,0,0,0,0,
+,0,240,63,1,15,8,16,15,8,15,0,18,0,255,202,
+,15,0,8,102,114,101,101,95,114,101,103,0,0,0,0,
+,14,15,0,15,15,13,0,31,10,15,1,19,10,14,10,
+,10,0,0,20,10,0,0,18,0,0,1,12,15,0,2,
+,111,0,0,13,14,15,0,12,16,0,5,105,116,101,109,
+,0,0,0,9,15,1,16,11,16,0,0,0,0,0,0,
+,0,0,0,9,15,15,16,31,10,15,1,19,10,14,10,
+,13,10,0,12,16,0,2,100,111,0,0,13,15,16,0,
 ,16,2,0,31,14,16,1,19,14,15,14,15,10,14,0,
-,7,1,55,32,32,32,32,116,109,112,32,61,32,100,111,
-,107,46,105,116,101,109,115,91,49,93,41,0,0,0,0,
 ,16,0,2,100,111,0,0,13,15,16,0,12,17,0,5,
 ,116,101,109,115,0,0,0,9,16,1,17,11,17,0,0,
 ,0,0,0,0,0,240,63,9,16,16,17,31,14,16,1,
-,14,15,14,15,12,14,0,30,6,1,56,32,32,32,32,
-,111,100,101,40,83,69,84,44,114,44,116,109,112,44,114,
-,41,0,0,12,16,0,4,99,111,100,101,0,0,0,0,
-,15,16,0,12,20,0,3,83,69,84,0,13,16,20,0,
-,17,13,0,15,18,12,0,15,19,10,0,31,14,16,4,
-,14,15,14,30,6,1,57,32,32,32,32,102,114,101,101,
-,116,109,112,40,114,41,32,35,82,69,71,0,0,0,0,
-,16,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
-,15,16,0,15,16,13,0,31,14,16,1,19,14,15,14,
-,6,1,58,32,32,32,32,102,114,101,101,95,116,109,112,
-,116,109,112,41,32,35,82,69,71,0,0,12,16,0,8,
-,114,101,101,95,116,109,112,0,0,0,0,13,15,16,0,
-,16,12,0,31,14,16,1,19,14,15,14,30,4,1,59,
-,32,32,32,114,101,116,117,114,110,32,114,114,0,0,0,
-,10,0,0,0,0,0,0,12,38,0,10,100,111,95,115,
-,116,95,99,116,120,0,0,14,38,37,0,30,9,1,61,
-,101,102,32,109,97,110,97,103,101,95,115,101,113,40,105,
-,97,44,105,116,101,109,115,44,115,97,118,61,48,41,58,
-,0,0,0,16,38,1,20,44,19,0,0,30,9,1,61,
-,101,102,32,109,97,110,97,103,101,95,115,101,113,40,105,
-,97,44,105,116,101,109,115,44,115,97,118,61,48,41,58,
-,0,0,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,10,
-,97,110,97,103,101,95,115,101,113,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,28,3,0,0,9,2,0,3,
-,4,0,0,9,3,0,4,11,4,0,0,0,0,0,0,
-,0,0,0,28,5,0,0,32,4,0,5,30,7,1,62,
-,32,32,32,108,32,61,32,109,97,120,40,115,97,118,44,
-,101,110,40,105,116,101,109,115,41,41,0,12,8,0,3,
-,97,120,0,13,7,8,0,15,8,4,0,12,11,0,3,
-,101,110,0,13,10,11,0,15,11,3,0,31,9,11,1,
-,9,10,9,31,6,8,2,19,6,7,6,15,5,6,0,
-,7,1,63,32,32,32,32,110,44,116,109,112,115,32,61,
-,48,44,103,101,116,95,116,109,112,115,40,108,41,0,0,
-,7,0,0,0,0,0,0,0,0,0,0,15,6,7,0,
-,10,0,8,103,101,116,95,116,109,112,115,0,0,0,0,
-,9,10,0,15,10,5,0,31,8,10,1,19,8,9,8,
-,7,8,0,15,8,6,0,15,6,7,0,30,6,1,64,
-,32,32,32,102,111,114,32,116,116,32,105,110,32,105,116,
-,109,115,58,0,0,0,0,11,9,0,0,0,0,0,0,
-,0,0,0,42,7,3,9,18,0,0,80,30,5,1,65,
-,32,32,32,32,32,32,32,114,32,61,32,116,109,112,115,
-,110,93,0,9,11,6,8,15,10,11,0,30,6,1,66,
-,32,32,32,32,32,32,32,98,32,61,32,100,111,40,116,
-,44,114,41,0,0,0,0,12,14,0,2,100,111,0,0,
-,13,14,0,15,14,7,0,15,15,10,0,31,12,14,2,
-,12,13,12,15,11,12,0,30,5,1,67,32,32,32,32,
-,32,32,32,105,102,32,114,32,33,61,32,98,58,0,0,
-,12,10,11,21,12,0,0,18,0,0,37,30,7,1,68,
-,32,32,32,32,32,32,32,32,32,32,32,99,111,100,101,
-,77,79,86,69,44,114,44,98,41,0,0,12,14,0,4,
-,111,100,101,0,0,0,0,13,13,14,0,12,17,0,4,
-,79,86,69,0,0,0,0,13,14,17,0,15,15,10,0,
-,16,11,0,31,12,14,3,19,12,13,12,30,6,1,69,
-,32,32,32,32,32,32,32,32,32,32,32,102,114,101,101,
-,116,109,112,40,98,41,0,12,14,0,8,102,114,101,101,
-,116,109,112,0,0,0,0,13,13,14,0,15,14,11,0,
-,12,14,1,19,12,13,12,18,0,0,1,30,4,1,70,
-,32,32,32,32,32,32,32,110,32,43,61,49,0,0,0,
-,13,0,0,0,0,0,0,0,0,240,63,1,12,8,13,
-,8,12,0,18,0,255,176,30,6,1,71,32,32,32,32,
-,102,32,110,111,116,32,108,101,110,40,116,109,112,115,41,
-,0,0,0,12,14,0,3,108,101,110,0,13,13,14,0,
-,14,6,0,31,12,14,1,19,12,13,12,47,9,12,0,
-,9,0,0,18,0,0,33,30,6,1,72,32,32,32,32,
-,32,32,32,99,111,100,101,40,105,44,97,44,48,44,48,
-,0,0,0,12,13,0,4,99,111,100,101,0,0,0,0,
-,12,13,0,15,13,1,0,15,14,2,0,11,15,0,0,
-,0,0,0,0,0,0,0,11,16,0,0,0,0,0,0,
-,0,0,0,31,9,13,4,19,9,12,9,30,5,1,73,
-,32,32,32,32,32,32,32,114,101,116,117,114,110,32,48,
-,0,0,0,11,9,0,0,0,0,0,0,0,0,0,0,
-,9,0,0,18,0,0,1,30,9,1,74,32,32,32,32,
-,111,100,101,40,105,44,97,44,116,109,112,115,91,48,93,
-,108,101,110,40,105,116,101,109,115,41,41,0,0,0,0,
-,13,0,4,99,111,100,101,0,0,0,0,13,12,13,0,
-,13,1,0,15,14,2,0,11,17,0,0,0,0,0,0,
-,0,0,0,9,15,6,17,12,18,0,3,108,101,110,0,
-,17,18,0,15,18,3,0,31,16,18,1,19,16,17,16,
-,9,13,4,19,9,12,9,30,7,1,75,32,32,32,32,
-,114,101,101,95,116,109,112,115,40,116,109,112,115,91,115,
-,118,58,93,41,0,0,0,12,13,0,9,102,114,101,101,
-,116,109,112,115,0,0,0,13,12,13,0,15,15,4,0,
-,16,0,0,27,14,15,2,9,13,6,14,31,9,13,1,
-,9,12,9,30,5,1,76,32,32,32,32,114,101,116,117,
-,110,32,116,109,112,115,91,48,93,0,0,11,12,0,0,
+,14,15,14,15,12,14,0,12,16,0,4,99,111,100,101,
+,0,0,0,13,15,16,0,12,20,0,3,83,69,84,0,
+,16,20,0,15,17,13,0,15,18,12,0,15,19,10,0,
+,14,16,4,19,14,15,14,12,16,0,8,102,114,101,101,
+,116,109,112,0,0,0,0,13,15,16,0,15,16,13,0,
+,14,16,1,19,14,15,14,12,16,0,8,102,114,101,101,
+,116,109,112,0,0,0,0,13,15,16,0,15,16,12,0,
+,14,16,1,19,14,15,14,20,10,0,0,0,0,0,0,
+,39,0,10,100,111,95,115,101,116,95,99,116,120,0,0,
+,39,38,0,16,39,0,152,44,19,0,0,28,2,0,0,
+,1,0,2,28,3,0,0,9,2,0,3,28,4,0,0,
+,3,0,4,11,4,0,0,0,0,0,0,0,0,0,0,
+,5,0,0,32,4,0,5,12,8,0,3,109,97,120,0,
+,7,8,0,15,8,4,0,12,11,0,3,108,101,110,0,
+,10,11,0,15,11,3,0,31,9,11,1,19,9,10,9,
+,6,8,2,19,6,7,6,15,5,6,0,11,7,0,0,
+,0,0,0,0,0,0,0,15,6,7,0,12,10,0,8,
+,101,116,95,116,109,112,115,0,0,0,0,13,9,10,0,
+,10,5,0,31,8,10,1,19,8,9,8,15,7,8,0,
+,8,6,0,15,6,7,0,11,9,0,0,0,0,0,0,
+,0,0,0,42,7,3,9,18,0,0,41,9,11,6,8,
+,10,11,0,12,14,0,2,100,111,0,0,13,13,14,0,
+,14,7,0,15,15,10,0,31,12,14,2,19,12,13,12,
+,11,12,0,35,12,10,11,21,12,0,0,18,0,0,22,
+,14,0,4,99,111,100,101,0,0,0,0,13,13,14,0,
+,17,0,4,77,79,86,69,0,0,0,0,13,14,17,0,
+,15,10,0,15,16,11,0,31,12,14,3,19,12,13,12,
+,14,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,13,14,0,15,14,11,0,31,12,14,1,19,12,13,12,
+,0,0,1,11,13,0,0,0,0,0,0,0,0,240,63,
+,12,8,13,15,8,12,0,18,0,255,215,11,9,0,0,
+,0,0,0,0,0,0,0,12,14,0,3,108,101,110,0,
+,13,14,0,15,14,6,0,31,12,14,1,19,12,13,12,
+,9,9,12,21,9,0,0,18,0,0,20,12,13,0,4,
+,111,100,101,0,0,0,0,13,12,13,0,15,13,1,0,
+,14,2,0,11,15,0,0,0,0,0,0,0,0,0,0,
+,16,0,0,0,0,0,0,0,0,0,0,31,9,13,4,
+,9,12,9,11,9,0,0,0,0,0,0,0,0,0,0,
+,9,0,0,18,0,0,1,12,13,0,4,99,111,100,101,
+,0,0,0,13,12,13,0,15,13,1,0,15,14,2,0,
+,17,0,0,0,0,0,0,0,0,0,0,9,15,6,17,
+,18,0,3,108,101,110,0,13,17,18,0,15,18,3,0,
+,16,18,1,19,16,17,16,31,9,13,4,19,9,12,9,
+,13,0,9,102,114,101,101,95,116,109,112,115,0,0,0,
+,12,13,0,15,15,4,0,28,16,0,0,27,14,15,2,
+,13,6,14,31,9,13,1,19,9,12,9,11,12,0,0,
 ,0,0,0,0,0,0,0,9,9,6,12,20,9,0,0,
-,0,0,0,12,39,0,10,109,97,110,97,103,101,95,115,
-,113,0,0,14,39,38,0,30,6,1,78,100,101,102,32,
-,95,102,105,108,116,101,114,40,105,116,101,109,115,41,58,
-,0,0,0,16,39,0,172,44,12,0,0,30,6,1,78,
-,101,102,32,112,95,102,105,108,116,101,114,40,105,116,101,
-,115,41,58,0,0,0,0,12,1,0,14,99,111,114,101,
-,101,110,99,111,100,101,46,112,121,0,0,33,1,0,0,
-,1,0,8,112,95,102,105,108,116,101,114,0,0,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,30,8,1,79,
-,32,32,32,97,44,98,44,99,44,100,32,61,32,91,93,
-,91,93,44,78,111,110,101,44,78,111,110,101,0,0,0,
-,3,0,0,15,2,3,0,27,4,0,0,15,3,4,0,
-,5,0,0,15,4,5,0,28,6,0,0,15,5,6,0,
-,6,2,0,15,2,3,0,15,3,4,0,15,4,5,0,
-,5,1,80,32,32,32,32,102,111,114,32,116,32,105,110,
-,105,116,101,109,115,58,0,11,7,0,0,0,0,0,0,
-,0,0,0,42,5,1,7,18,0,0,106,30,15,1,81,
-,32,32,32,32,32,32,32,105,102,32,116,46,116,121,112,
-,32,61,61,32,39,115,121,109,98,111,108,39,32,97,110,
-,32,116,46,118,97,108,32,61,61,32,39,61,39,58,32,
-,46,97,112,112,101,110,100,40,116,41,0,12,9,0,4,
-,121,112,101,0,0,0,0,9,8,5,9,12,9,0,6,
-,121,109,98,111,108,0,0,23,8,8,9,21,8,0,0,
-,0,0,7,12,9,0,3,118,97,108,0,9,8,5,9,
-,9,0,1,61,0,0,0,23,8,8,9,21,8,0,0,
-,0,0,9,12,10,0,6,97,112,112,101,110,100,0,0,
-,9,2,10,15,10,5,0,31,8,10,1,19,8,9,8,
-,0,0,63,30,10,1,82,32,32,32,32,32,32,32,32,
-,108,105,102,32,116,46,116,121,112,101,32,61,61,32,39,
-,114,103,115,39,58,32,99,32,61,32,116,0,0,0,0,
-,9,0,4,116,121,112,101,0,0,0,0,9,8,5,9,
-,9,0,4,97,114,103,115,0,0,0,0,23,8,8,9,
-,8,0,0,18,0,0,3,15,3,5,0,18,0,0,40,
-,10,1,83,32,32,32,32,32,32,32,32,101,108,105,102,
-,116,46,116,121,112,101,32,61,61,32,39,110,97,114,103,
-,39,58,32,100,32,61,32,116,0,0,0,12,9,0,4,
-,121,112,101,0,0,0,0,9,8,5,9,12,9,0,5,
-,97,114,103,115,0,0,0,23,8,8,9,21,8,0,0,
-,0,0,3,15,4,5,0,18,0,0,17,30,7,1,84,
-,32,32,32,32,32,32,32,101,108,115,101,58,32,97,46,
-,112,112,101,110,100,40,116,41,0,0,0,12,10,0,6,
-,112,112,101,110,100,0,0,9,9,6,10,15,10,5,0,
-,8,10,1,19,8,9,8,18,0,0,1,18,0,255,150,
-,5,1,85,32,32,32,32,114,101,116,117,114,110,32,97,
-,98,44,99,44,100,0,0,15,8,6,0,15,9,2,0,
-,10,3,0,15,11,4,0,27,7,8,4,20,7,0,0,
-,0,0,0,12,40,0,8,112,95,102,105,108,116,101,114,
-,0,0,0,14,40,39,0,30,5,1,87,100,101,102,32,
-,111,95,105,109,112,111,114,116,40,116,41,58,0,0,0,
-,40,0,170,44,21,0,0,30,5,1,87,100,101,102,32,
-,111,95,105,109,112,111,114,116,40,116,41,58,0,0,0,
-,1,0,14,99,111,114,101,47,101,110,99,111,100,101,46,
-,121,0,0,33,1,0,0,12,1,0,9,100,111,95,105,
-,112,111,114,116,0,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,30,6,1,88,32,32,32,32,102,111,114,32,
-,111,100,32,105,110,32,116,46,105,116,101,109,115,58,0,
-,4,0,5,105,116,101,109,115,0,0,0,9,3,1,4,
-,4,0,0,0,0,0,0,0,0,0,0,42,2,3,4,
-,0,0,133,30,7,1,89,32,32,32,32,32,32,32,32,
-,111,100,46,116,121,112,101,32,61,32,39,115,116,114,105,
-,103,39,0,12,5,0,6,115,116,114,105,110,103,0,0,
-,6,0,4,116,121,112,101,0,0,0,0,10,2,6,5,
-,12,1,90,32,32,32,32,32,32,32,32,118,32,61,32,
-,111,95,99,97,108,108,40,84,111,107,101,110,40,116,46,
-,111,115,44,39,99,97,108,108,39,44,78,111,110,101,44,
-,0,0,0,12,8,0,7,100,111,95,99,97,108,108,0,
-,7,8,0,12,10,0,5,84,111,107,101,110,0,0,0,
-,9,10,0,12,14,0,3,112,111,115,0,9,10,1,14,
-,11,0,4,99,97,108,108,0,0,0,0,28,12,0,0,
-,11,1,91,32,32,32,32,32,32,32,32,32,32,32,32,
-,111,107,101,110,40,116,46,112,111,115,44,39,110,97,109,
-,39,44,39,105,109,112,111,114,116,39,41,44,0,0,0,
-,17,0,5,84,111,107,101,110,0,0,0,13,16,17,0,
-,20,0,3,112,111,115,0,9,17,1,20,12,18,0,4,
-,97,109,101,0,0,0,0,12,19,0,6,105,109,112,111,
-,116,0,0,31,14,17,3,19,14,16,14,30,5,1,92,
-,32,32,32,32,32,32,32,32,32,32,32,109,111,100,93,
-,41,0,0,15,15,2,0,27,13,14,2,31,8,10,4,
+,0,0,0,12,40,0,10,109,97,110,97,103,101,95,115,
+,113,0,0,14,40,39,0,16,40,0,92,44,12,0,0,
+,2,0,0,9,1,0,2,27,3,0,0,15,2,3,0,
+,4,0,0,15,3,4,0,28,5,0,0,15,4,5,0,
+,6,0,0,15,5,6,0,15,6,2,0,15,2,3,0,
+,3,4,0,15,4,5,0,11,7,0,0,0,0,0,0,
+,0,0,0,42,5,1,7,18,0,0,65,11,10,0,0,
+,0,0,0,0,0,0,0,12,11,0,4,116,121,112,101,
+,0,0,0,9,8,5,11,12,11,0,6,115,121,109,98,
+,108,0,0,23,8,8,11,23,9,8,10,21,9,0,0,
+,0,0,2,18,0,0,7,12,11,0,3,118,97,108,0,
+,8,5,11,12,11,0,1,61,0,0,0,23,8,8,11,
+,8,0,0,18,0,0,9,12,10,0,6,97,112,112,101,
+,100,0,0,9,9,2,10,15,10,5,0,31,8,10,1,
+,8,9,8,18,0,0,33,12,9,0,4,116,121,112,101,
+,0,0,0,9,8,5,9,12,9,0,4,97,114,103,115,
+,0,0,0,23,8,8,9,21,8,0,0,18,0,0,3,
+,3,5,0,18,0,0,21,12,9,0,4,116,121,112,101,
+,0,0,0,9,8,5,9,12,9,0,5,110,97,114,103,
+,0,0,0,23,8,8,9,21,8,0,0,18,0,0,3,
+,4,5,0,18,0,0,9,12,10,0,6,97,112,112,101,
+,100,0,0,9,9,6,10,15,10,5,0,31,8,10,1,
+,8,9,8,18,0,0,1,18,0,255,191,15,8,6,0,
+,9,2,0,15,10,3,0,15,11,4,0,27,7,8,4,
+,7,0,0,0,0,0,0,12,41,0,8,112,95,102,105,
+,116,101,114,0,0,0,0,14,41,40,0,16,41,0,86,
+,21,0,0,28,2,0,0,9,1,0,2,12,4,0,5,
+,116,101,109,115,0,0,0,9,3,1,4,11,4,0,0,
+,0,0,0,0,0,0,0,42,2,3,4,18,0,0,73,
+,5,0,6,115,116,114,105,110,103,0,0,12,6,0,4,
+,121,112,101,0,0,0,0,10,2,6,5,12,8,0,7,
+,111,95,99,97,108,108,0,13,7,8,0,12,10,0,5,
+,111,107,101,110,0,0,0,13,9,10,0,12,14,0,3,
+,111,115,0,9,10,1,14,12,11,0,4,99,97,108,108,
+,0,0,0,28,12,0,0,12,17,0,5,84,111,107,101,
+,0,0,0,13,16,17,0,12,20,0,3,112,111,115,0,
+,17,1,20,12,18,0,4,110,97,109,101,0,0,0,0,
+,19,0,6,105,109,112,111,114,116,0,0,31,14,17,3,
+,14,16,14,15,15,2,0,27,13,14,2,31,8,10,4,
 ,8,9,8,31,6,8,1,19,6,7,6,15,5,6,0,
-,7,1,93,32,32,32,32,32,32,32,32,109,111,100,46,
-,121,112,101,32,61,32,39,110,97,109,101,39,0,0,0,
 ,6,0,4,110,97,109,101,0,0,0,0,12,7,0,4,
-,121,112,101,0,0,0,0,10,2,7,6,30,12,1,94,
-,32,32,32,32,32,32,32,100,111,95,115,101,116,95,99,
-,120,40,109,111,100,44,84,111,107,101,110,40,116,46,112,
-,115,44,39,114,101,103,39,44,118,41,41,0,0,0,0,
-,8,0,10,100,111,95,115,101,116,95,99,116,120,0,0,
-,7,8,0,15,8,2,0,12,11,0,5,84,111,107,101,
-,0,0,0,13,10,11,0,12,14,0,3,112,111,115,0,
-,11,1,14,12,12,0,3,114,101,103,0,15,13,5,0,
-,9,11,3,19,9,10,9,31,6,8,2,19,6,7,6,
-,0,255,123,0,0,0,0,12,41,0,9,100,111,95,105,
-,112,111,114,116,0,0,0,14,41,40,0,30,4,1,95,
-,101,102,32,100,111,95,102,114,111,109,40,116,41,58,0,
-,41,1,145,44,23,0,0,30,4,1,95,100,101,102,32,
-,111,95,102,114,111,109,40,116,41,58,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,7,100,111,95,102,114,111,109,0,
-,1,0,0,28,2,0,0,9,1,0,2,30,6,1,96,
-,32,32,32,109,111,100,32,61,32,116,46,105,116,101,109,
-,91,48,93,0,0,0,0,12,4,0,5,105,116,101,109,
+,121,112,101,0,0,0,0,10,2,7,6,12,8,0,10,
+,111,95,115,101,116,95,99,116,120,0,0,13,7,8,0,
+,8,2,0,12,11,0,5,84,111,107,101,110,0,0,0,
+,10,11,0,12,14,0,3,112,111,115,0,9,11,1,14,
+,12,0,3,114,101,103,0,15,13,5,0,31,9,11,3,
+,9,10,9,31,6,8,2,19,6,7,6,18,0,255,183,
+,0,0,0,12,42,0,9,100,111,95,105,109,112,111,114,
+,0,0,0,14,42,41,0,16,42,0,222,44,23,0,0,
+,2,0,0,9,1,0,2,12,4,0,5,105,116,101,109,
 ,0,0,0,9,3,1,4,11,4,0,0,0,0,0,0,
-,0,0,0,9,3,3,4,15,2,3,0,30,6,1,97,
-,32,32,32,109,111,100,46,116,121,112,101,32,61,32,39,
-,116,114,105,110,103,39,0,12,3,0,6,115,116,114,105,
-,103,0,0,12,4,0,4,116,121,112,101,0,0,0,0,
-,2,4,3,30,10,1,98,32,32,32,32,118,32,61,32,
-,111,40,84,111,107,101,110,40,116,46,112,111,115,44,39,
-,97,108,108,39,44,78,111,110,101,44,91,0,0,0,0,
-,6,0,2,100,111,0,0,13,5,6,0,12,8,0,5,
-,111,107,101,110,0,0,0,13,7,8,0,12,12,0,3,
-,111,115,0,9,8,1,12,12,9,0,4,99,97,108,108,
-,0,0,0,28,10,0,0,30,10,1,99,32,32,32,32,
-,32,32,32,84,111,107,101,110,40,116,46,112,111,115,44,
-,110,97,109,101,39,44,39,105,109,112,111,114,116,39,41,
-,0,0,0,12,15,0,5,84,111,107,101,110,0,0,0,
-,14,15,0,12,18,0,3,112,111,115,0,9,15,1,18,
-,16,0,4,110,97,109,101,0,0,0,0,12,17,0,6,
-,109,112,111,114,116,0,0,31,12,15,3,19,12,14,12,
-,4,1,100,32,32,32,32,32,32,32,32,109,111,100,93,
-,41,0,0,15,13,2,0,27,11,12,2,31,6,8,4,
-,6,7,6,31,4,6,1,19,4,5,4,15,3,4,0,
-,6,1,101,32,32,32,32,105,116,101,109,32,61,32,116,
-,105,116,101,109,115,91,49,93,0,0,0,12,6,0,5,
-,116,101,109,115,0,0,0,9,5,1,6,11,6,0,0,
-,0,0,0,0,0,240,63,9,5,5,6,15,4,5,0,
-,6,1,102,32,32,32,32,105,102,32,105,116,101,109,46,
-,97,108,32,61,61,32,39,42,39,58,0,12,6,0,3,
+,0,0,0,9,3,3,4,15,2,3,0,12,3,0,6,
+,116,114,105,110,103,0,0,12,4,0,4,116,121,112,101,
+,0,0,0,10,2,4,3,12,6,0,2,100,111,0,0,
+,5,6,0,12,8,0,5,84,111,107,101,110,0,0,0,
+,7,8,0,12,12,0,3,112,111,115,0,9,8,1,12,
+,9,0,4,99,97,108,108,0,0,0,0,28,10,0,0,
+,15,0,5,84,111,107,101,110,0,0,0,13,14,15,0,
+,18,0,3,112,111,115,0,9,15,1,18,12,16,0,4,
+,97,109,101,0,0,0,0,12,17,0,6,105,109,112,111,
+,116,0,0,31,12,15,3,19,12,14,12,15,13,2,0,
+,11,12,2,31,6,8,4,19,6,7,6,31,4,6,1,
+,4,5,4,15,3,4,0,12,6,0,5,105,116,101,109,
+,0,0,0,9,5,1,6,11,6,0,0,0,0,0,0,
+,0,240,63,9,5,5,6,15,4,5,0,12,6,0,3,
 ,97,108,0,9,5,4,6,12,6,0,1,42,0,0,0,
-,5,5,6,21,5,0,0,18,0,0,120,30,12,1,103,
-,32,32,32,32,32,32,32,102,114,101,101,95,116,109,112,
-,100,111,40,84,111,107,101,110,40,116,46,112,111,115,44,
-,99,97,108,108,39,44,78,111,110,101,44,91,0,0,0,
-,7,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
-,6,7,0,12,9,0,2,100,111,0,0,13,8,9,0,
-,11,0,5,84,111,107,101,110,0,0,0,13,10,11,0,
-,15,0,3,112,111,115,0,9,11,1,15,12,12,0,4,
-,97,108,108,0,0,0,0,28,13,0,0,30,11,1,104,
-,32,32,32,32,32,32,32,32,32,32,32,84,111,107,101,
-,40,116,46,112,111,115,44,39,110,97,109,101,39,44,39,
-,101,114,103,101,39,41,44,0,0,0,0,12,19,0,5,
-,111,107,101,110,0,0,0,13,18,19,0,12,22,0,3,
-,111,115,0,9,19,1,22,12,20,0,4,110,97,109,101,
-,0,0,0,12,21,0,5,109,101,114,103,101,0,0,0,
-,15,19,3,19,15,18,15,30,11,1,105,32,32,32,32,
-,32,32,32,32,32,32,32,84,111,107,101,110,40,116,46,
-,111,115,44,39,110,97,109,101,39,44,39,95,95,100,105,
-,116,95,95,39,41,44,0,12,19,0,5,84,111,107,101,
+,5,5,6,21,5,0,0,18,0,0,71,12,7,0,8,
+,114,101,101,95,116,109,112,0,0,0,0,13,6,7,0,
+,9,0,2,100,111,0,0,13,8,9,0,12,11,0,5,
+,111,107,101,110,0,0,0,13,10,11,0,12,15,0,3,
+,111,115,0,9,11,1,15,12,12,0,4,99,97,108,108,
+,0,0,0,28,13,0,0,12,19,0,5,84,111,107,101,
 ,0,0,0,13,18,19,0,12,22,0,3,112,111,115,0,
 ,19,1,22,12,20,0,4,110,97,109,101,0,0,0,0,
-,21,0,8,95,95,100,105,99,116,95,95,0,0,0,0,
-,16,19,3,19,16,18,16,30,11,1,106,32,32,32,32,
-,32,32,32,32,32,32,32,84,111,107,101,110,40,116,46,
-,111,115,44,39,114,101,103,39,44,118,41,93,41,41,41,
-,35,82,69,71,0,0,0,12,19,0,5,84,111,107,101,
+,21,0,5,109,101,114,103,101,0,0,0,31,15,19,3,
+,15,18,15,12,19,0,5,84,111,107,101,110,0,0,0,
+,18,19,0,12,22,0,3,112,111,115,0,9,19,1,22,
+,20,0,4,110,97,109,101,0,0,0,0,12,21,0,8,
+,95,100,105,99,116,95,95,0,0,0,0,31,16,19,3,
+,16,18,16,12,19,0,5,84,111,107,101,110,0,0,0,
+,18,19,0,12,22,0,3,112,111,115,0,9,19,1,22,
+,20,0,3,114,101,103,0,15,21,3,0,31,17,19,3,
+,17,18,17,27,14,15,3,31,9,11,4,19,9,10,9,
+,7,9,1,19,7,8,7,31,5,7,1,19,5,6,5,
+,0,0,79,12,5,0,6,115,116,114,105,110,103,0,0,
+,6,0,4,116,121,112,101,0,0,0,0,10,4,6,5,
+,7,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,6,7,0,12,9,0,10,100,111,95,115,101,116,95,99,
+,120,0,0,13,8,9,0,12,12,0,5,84,111,107,101,
+,0,0,0,13,11,12,0,12,16,0,3,112,111,115,0,
+,12,1,16,12,13,0,3,103,101,116,0,28,14,0,0,
+,19,0,5,84,111,107,101,110,0,0,0,13,18,19,0,
+,22,0,3,112,111,115,0,9,19,1,22,12,20,0,4,
+,97,109,101,0,0,0,0,12,21,0,8,95,95,100,105,
+,116,95,95,0,0,0,0,31,16,19,3,19,16,18,16,
+,17,4,0,27,15,16,2,31,9,12,4,19,9,11,9,
+,12,0,5,84,111,107,101,110,0,0,0,13,11,12,0,
+,16,0,3,112,111,115,0,9,12,1,16,12,13,0,3,
+,101,116,0,28,14,0,0,12,19,0,5,84,111,107,101,
 ,0,0,0,13,18,19,0,12,22,0,3,112,111,115,0,
 ,19,1,22,12,20,0,3,114,101,103,0,15,21,3,0,
-,17,19,3,19,17,18,17,27,14,15,3,31,9,11,4,
-,9,10,9,31,7,9,1,19,7,8,7,31,5,7,1,
-,5,6,5,18,0,0,139,30,3,1,107,32,32,32,32,
-,108,115,101,58,0,0,0,30,8,1,108,32,32,32,32,
-,32,32,32,105,116,101,109,46,116,121,112,101,32,61,32,
-,115,116,114,105,110,103,39,0,0,0,0,12,5,0,6,
-,116,114,105,110,103,0,0,12,6,0,4,116,121,112,101,
-,0,0,0,10,4,6,5,30,8,1,109,32,32,32,32,
-,32,32,32,102,114,101,101,95,116,109,112,40,100,111,95,
-,101,116,95,99,116,120,40,0,0,0,0,12,7,0,8,
-,114,101,101,95,116,109,112,0,0,0,0,13,6,7,0,
-,9,0,10,100,111,95,115,101,116,95,99,116,120,0,0,
-,8,9,0,30,19,1,110,32,32,32,32,32,32,32,32,
-,32,32,32,84,111,107,101,110,40,116,46,112,111,115,44,
-,103,101,116,39,44,78,111,110,101,44,91,32,84,111,107,
-,110,40,116,46,112,111,115,44,39,110,97,109,101,39,44,
-,95,95,100,105,99,116,95,95,39,41,44,105,116,101,109,
-,41,44,0,12,12,0,5,84,111,107,101,110,0,0,0,
-,11,12,0,12,16,0,3,112,111,115,0,9,12,1,16,
-,13,0,3,103,101,116,0,28,14,0,0,12,19,0,5,
-,111,107,101,110,0,0,0,13,18,19,0,12,22,0,3,
-,111,115,0,9,19,1,22,12,20,0,4,110,97,109,101,
-,0,0,0,12,21,0,8,95,95,100,105,99,116,95,95,
-,0,0,0,31,16,19,3,19,16,18,16,15,17,4,0,
-,15,16,2,31,9,12,4,19,9,11,9,30,17,1,111,
-,32,32,32,32,32,32,32,32,32,32,32,84,111,107,101,
-,40,116,46,112,111,115,44,39,103,101,116,39,44,78,111,
-,101,44,91,32,84,111,107,101,110,40,116,46,112,111,115,
-,39,114,101,103,39,44,118,41,44,105,116,101,109,93,41,
-,0,0,0,12,12,0,5,84,111,107,101,110,0,0,0,
-,11,12,0,12,16,0,3,112,111,115,0,9,12,1,16,
-,13,0,3,103,101,116,0,28,14,0,0,12,19,0,5,
-,111,107,101,110,0,0,0,13,18,19,0,12,22,0,3,
-,111,115,0,9,19,1,22,12,20,0,3,114,101,103,0,
-,21,3,0,31,16,19,3,19,16,18,16,15,17,4,0,
-,15,16,2,31,10,12,4,19,10,11,10,31,7,9,2,
-,7,8,7,31,5,7,1,19,5,6,5,18,0,0,1,
-,0,0,0,12,42,0,7,100,111,95,102,114,111,109,0,
-,42,41,0,30,5,1,115,100,101,102,32,100,111,95,103,
-,111,98,97,108,115,40,116,41,58,0,0,16,42,0,93,
-,8,0,0,30,5,1,115,100,101,102,32,100,111,95,103,
-,111,98,97,108,115,40,116,41,58,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,10,100,111,95,103,108,111,98,97,
-,115,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,6,1,116,32,32,32,32,102,111,114,32,116,32,105,110,
-,116,46,105,116,101,109,115,58,0,0,0,12,3,0,5,
-,116,101,109,115,0,0,0,9,2,1,3,11,3,0,0,
-,0,0,0,0,0,0,0,42,1,2,3,18,0,0,56,
-,9,1,117,32,32,32,32,32,32,32,32,105,102,32,116,
-,118,97,108,32,110,111,116,32,105,110,32,68,46,103,108,
-,98,97,108,115,58,0,0,12,5,0,1,68,0,0,0,
-,4,5,0,12,5,0,7,103,108,111,98,97,108,115,0,
-,4,4,5,12,6,0,3,118,97,108,0,9,5,1,6,
-,4,4,5,11,5,0,0,0,0,0,0,0,0,0,0,
-,4,4,5,21,4,0,0,18,0,0,28,30,9,1,118,
-,32,32,32,32,32,32,32,32,32,32,32,68,46,103,108,
-,98,97,108,115,46,97,112,112,101,110,100,40,116,46,118,
-,108,41,0,12,6,0,1,68,0,0,0,13,5,6,0,
-,6,0,7,103,108,111,98,97,108,115,0,9,5,5,6,
-,6,0,6,97,112,112,101,110,100,0,0,9,5,5,6,
-,7,0,3,118,97,108,0,9,6,1,7,31,4,6,1,
-,4,5,4,18,0,0,1,18,0,255,200,0,0,0,0,
-,43,0,10,100,111,95,103,108,111,98,97,108,115,0,0,
-,43,42,0,30,4,1,119,100,101,102,32,100,111,95,100,
-,108,40,116,116,41,58,0,16,43,0,126,44,13,0,0,
-,4,1,119,100,101,102,32,100,111,95,100,101,108,40,116,
-,41,58,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,6,
-,111,95,100,101,108,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,30,6,1,120,32,32,32,32,102,111,114,32,
-,32,105,110,32,116,116,46,105,116,101,109,115,58,0,0,
-,4,0,5,105,116,101,109,115,0,0,0,9,3,1,4,
-,4,0,0,0,0,0,0,0,0,0,0,42,2,3,4,
-,0,0,91,30,7,1,121,32,32,32,32,32,32,32,32,
-,32,61,32,100,111,40,116,46,105,116,101,109,115,91,48,
-,41,0,0,12,8,0,2,100,111,0,0,13,7,8,0,
-,9,0,5,105,116,101,109,115,0,0,0,9,8,2,9,
-,9,0,0,0,0,0,0,0,0,0,0,9,8,8,9,
-,6,8,1,19,6,7,6,15,5,6,0,30,7,1,122,
-,32,32,32,32,32,32,32,114,50,32,61,32,100,111,40,
-,46,105,116,101,109,115,91,49,93,41,0,12,9,0,2,
-,111,0,0,13,8,9,0,12,10,0,5,105,116,101,109,
-,0,0,0,9,9,2,10,11,10,0,0,0,0,0,0,
-,0,240,63,9,9,9,10,31,7,9,1,19,7,8,7,
-,6,7,0,30,6,1,123,32,32,32,32,32,32,32,32,
-,111,100,101,40,68,69,76,44,114,44,114,50,41,0,0,
-,9,0,4,99,111,100,101,0,0,0,0,13,8,9,0,
-,12,0,3,68,69,76,0,13,9,12,0,15,10,5,0,
-,11,6,0,31,7,9,3,19,7,8,7,30,10,1,124,
-,32,32,32,32,32,32,32,102,114,101,101,95,116,109,112,
-,114,41,59,32,102,114,101,101,95,116,109,112,40,114,50,
-,32,35,82,69,71,0,0,12,9,0,8,102,114,101,101,
+,16,19,3,19,16,18,16,15,17,4,0,27,15,16,2,
+,10,12,4,19,10,11,10,31,7,9,2,19,7,8,7,
+,5,7,1,19,5,6,5,18,0,0,1,0,0,0,0,
+,43,0,7,100,111,95,102,114,111,109,0,14,43,42,0,
+,43,0,49,44,8,0,0,28,2,0,0,9,1,0,2,
+,3,0,5,105,116,101,109,115,0,0,0,9,2,1,3,
+,3,0,0,0,0,0,0,0,0,0,0,42,1,2,3,
+,0,0,36,12,5,0,1,68,0,0,0,13,4,5,0,
+,5,0,7,103,108,111,98,97,108,115,0,9,4,4,5,
+,6,0,3,118,97,108,0,9,5,1,6,36,4,4,5,
+,5,0,0,0,0,0,0,0,0,0,0,23,4,4,5,
+,4,0,0,18,0,0,18,12,6,0,1,68,0,0,0,
+,5,6,0,12,6,0,7,103,108,111,98,97,108,115,0,
+,5,5,6,12,6,0,6,97,112,112,101,110,100,0,0,
+,5,5,6,12,7,0,3,118,97,108,0,9,6,1,7,
+,4,6,1,19,4,5,4,18,0,0,1,18,0,255,220,
+,0,0,0,12,44,0,10,100,111,95,103,108,111,98,97,
+,115,0,0,14,44,43,0,16,44,0,70,44,13,0,0,
+,2,0,0,9,1,0,2,12,4,0,5,105,116,101,109,
+,0,0,0,9,3,1,4,11,4,0,0,0,0,0,0,
+,0,0,0,42,2,3,4,18,0,0,57,12,8,0,2,
+,111,0,0,13,7,8,0,12,9,0,5,105,116,101,109,
+,0,0,0,9,8,2,9,11,9,0,0,0,0,0,0,
+,0,0,0,9,8,8,9,31,6,8,1,19,6,7,6,
+,5,6,0,12,9,0,2,100,111,0,0,13,8,9,0,
+,10,0,5,105,116,101,109,115,0,0,0,9,9,2,10,
+,10,0,0,0,0,0,0,0,0,240,63,9,9,9,10,
+,7,9,1,19,7,8,7,15,6,7,0,12,9,0,4,
+,111,100,101,0,0,0,0,13,8,9,0,12,12,0,3,
+,69,76,0,13,9,12,0,15,10,5,0,15,11,6,0,
+,7,9,3,19,7,8,7,12,9,0,8,102,114,101,101,
 ,116,109,112,0,0,0,0,13,8,9,0,15,9,5,0,
 ,7,9,1,19,7,8,7,12,9,0,8,102,114,101,101,
 ,116,109,112,0,0,0,0,13,8,9,0,15,9,6,0,
-,7,9,1,19,7,8,7,18,0,255,165,0,0,0,0,
-,44,0,6,100,111,95,100,101,108,0,0,14,44,43,0,
-,6,1,126,100,101,102,32,100,111,95,99,97,108,108,40,
-,44,114,61,78,111,110,101,41,58,0,0,16,44,2,125,
-,31,0,0,30,6,1,126,100,101,102,32,100,111,95,99,
-,108,108,40,116,44,114,61,78,111,110,101,41,58,0,0,
-,1,0,14,99,111,114,101,47,101,110,99,111,100,101,46,
-,121,0,0,33,1,0,0,12,1,0,7,100,111,95,99,
-,108,108,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,2,0,0,28,3,0,0,32,2,0,3,30,5,1,127,
-,32,32,32,114,32,61,32,103,101,116,95,116,109,112,40,
-,41,0,0,12,5,0,7,103,101,116,95,116,109,112,0,
-,4,5,0,15,5,2,0,31,3,5,1,19,3,4,3,
-,2,3,0,30,5,1,128,32,32,32,32,105,116,101,109,
-,32,61,32,116,46,105,116,101,109,115,0,12,5,0,5,
+,7,9,1,19,7,8,7,18,0,255,199,0,0,0,0,
+,45,0,6,100,111,95,100,101,108,0,0,14,45,44,0,
+,45,1,133,44,31,0,0,28,2,0,0,9,1,0,2,
+,2,0,0,28,3,0,0,32,2,0,3,12,5,0,7,
+,101,116,95,116,109,112,0,13,4,5,0,15,5,2,0,
+,3,5,1,19,3,4,3,15,2,3,0,12,5,0,5,
 ,116,101,109,115,0,0,0,9,4,1,5,15,3,4,0,
-,6,1,129,32,32,32,32,102,110,99,32,61,32,100,111,
-,105,116,101,109,115,91,48,93,41,0,0,12,7,0,2,
-,111,0,0,13,6,7,0,11,8,0,0,0,0,0,0,
-,0,0,0,9,7,3,8,31,5,7,1,19,5,6,5,
-,4,5,0,30,9,1,130,32,32,32,32,97,44,98,44,
-,44,100,32,61,32,112,95,102,105,108,116,101,114,40,116,
-,105,116,101,109,115,91,49,58,93,41,0,12,7,0,8,
-,95,102,105,108,116,101,114,0,0,0,0,13,6,7,0,
-,8,0,5,105,116,101,109,115,0,0,0,9,7,1,8,
-,9,0,0,0,0,0,0,0,0,240,63,28,10,0,0,
-,8,9,2,9,7,7,8,31,5,7,1,19,5,6,5,
-,8,0,0,0,0,0,0,0,0,0,0,9,7,5,8,
-,6,7,0,11,9,0,0,0,0,0,0,0,0,240,63,
-,8,5,9,15,7,8,0,11,10,0,0,0,0,0,0,
-,0,0,64,9,9,5,10,15,8,9,0,11,11,0,0,
-,0,0,0,0,0,8,64,9,10,5,11,15,9,10,0,
-,4,1,131,32,32,32,32,101,32,61,32,78,111,110,101,
-,0,0,0,28,10,0,0,15,5,10,0,30,9,1,132,
-,32,32,32,105,102,32,108,101,110,40,98,41,32,33,61,
-,48,32,111,114,32,100,32,33,61,32,78,111,110,101,58,
-,0,0,0,12,12,0,3,108,101,110,0,13,11,12,0,
-,12,7,0,31,10,12,1,19,10,11,10,11,11,0,0,
-,0,0,0,0,0,0,0,35,10,10,11,46,10,0,0,
-,0,0,3,28,11,0,0,35,10,9,11,21,10,0,0,
-,0,1,14,30,14,1,133,32,32,32,32,32,32,32,32,
-,32,61,32,100,111,40,84,111,107,101,110,40,116,46,112,
-,115,44,39,100,105,99,116,39,44,78,111,110,101,44,91,
-,41,41,59,32,117,110,95,116,109,112,40,101,41,59,0,
-,12,0,2,100,111,0,0,13,11,12,0,12,14,0,5,
-,111,107,101,110,0,0,0,13,13,14,0,12,18,0,3,
-,111,115,0,9,14,1,18,12,15,0,4,100,105,99,116,
-,0,0,0,28,16,0,0,27,17,0,0,31,12,14,4,
-,12,13,12,31,10,12,1,19,10,11,10,15,5,10,0,
-,12,0,6,117,110,95,116,109,112,0,0,13,11,12,0,
-,12,5,0,31,10,12,1,19,10,11,10,30,5,1,134,
-,32,32,32,32,32,32,32,102,111,114,32,112,32,105,110,
-,98,58,0,11,11,0,0,0,0,0,0,0,0,0,0,
-,10,7,11,18,0,0,121,30,10,1,135,32,32,32,32,
-,32,32,32,32,32,32,32,112,46,105,116,101,109,115,91,
-,93,46,116,121,112,101,32,61,32,39,115,116,114,105,110,
-,39,0,0,12,13,0,5,105,116,101,109,115,0,0,0,
-,12,10,13,11,13,0,0,0,0,0,0,0,0,0,0,
-,12,12,13,12,13,0,6,115,116,114,105,110,103,0,0,
-,14,0,4,116,121,112,101,0,0,0,0,10,12,14,13,
-,13,1,136,32,32,32,32,32,32,32,32,32,32,32,32,
-,49,44,116,50,32,61,32,100,111,40,112,46,105,116,101,
-,115,91,48,93,41,44,100,111,40,112,46,105,116,101,109,
-,91,49,93,41,0,0,0,12,15,0,2,100,111,0,0,
-,14,15,0,12,16,0,5,105,116,101,109,115,0,0,0,
-,15,10,16,11,16,0,0,0,0,0,0,0,0,0,0,
-,15,15,16,31,13,15,1,19,13,14,13,15,12,13,0,
-,16,0,2,100,111,0,0,13,15,16,0,12,17,0,5,
-,116,101,109,115,0,0,0,9,16,10,17,11,17,0,0,
-,0,0,0,0,0,240,63,9,16,16,17,31,14,16,1,
-,14,15,14,15,13,14,0,15,14,12,0,15,12,13,0,
-,8,1,137,32,32,32,32,32,32,32,32,32,32,32,32,
-,111,100,101,40,83,69,84,44,101,44,116,49,44,116,50,
-,0,0,0,12,16,0,4,99,111,100,101,0,0,0,0,
-,15,16,0,12,20,0,3,83,69,84,0,13,16,20,0,
-,17,5,0,15,18,14,0,15,19,12,0,31,13,16,4,
-,13,15,13,30,11,1,138,32,32,32,32,32,32,32,32,
-,32,32,32,102,114,101,101,95,116,109,112,40,116,49,41,
-,32,102,114,101,101,95,116,109,112,40,116,50,41,32,35,
-,69,71,0,12,16,0,8,102,114,101,101,95,116,109,112,
-,0,0,0,13,15,16,0,15,16,14,0,31,13,16,1,
-,13,15,13,12,16,0,8,102,114,101,101,95,116,109,112,
-,0,0,0,13,15,16,0,15,16,12,0,31,13,16,1,
-,13,15,13,18,0,255,135,30,30,1,139,32,32,32,32,
-,32,32,32,105,102,32,100,58,32,102,114,101,101,95,116,
-,112,40,100,111,40,84,111,107,101,110,40,116,46,112,111,
-,44,39,99,97,108,108,39,44,78,111,110,101,44,91,84,
-,107,101,110,40,116,46,112,111,115,44,39,110,97,109,101,
-,44,39,109,101,114,103,101,39,41,44,84,111,107,101,110,
-,116,46,112,111,115,44,39,114,101,103,39,44,101,41,44,
-,46,105,116,101,109,115,91,48,93,93,41,41,41,32,35,
-,69,71,0,21,9,0,0,18,0,0,63,12,15,0,8,
-,114,101,101,95,116,109,112,0,0,0,0,13,13,15,0,
-,17,0,2,100,111,0,0,13,16,17,0,12,19,0,5,
-,111,107,101,110,0,0,0,13,18,19,0,12,23,0,3,
-,111,115,0,9,19,1,23,12,20,0,4,99,97,108,108,
-,0,0,0,28,21,0,0,12,27,0,5,84,111,107,101,
-,0,0,0,13,26,27,0,12,30,0,3,112,111,115,0,
-,27,1,30,12,28,0,4,110,97,109,101,0,0,0,0,
-,29,0,5,109,101,114,103,101,0,0,0,31,23,27,3,
-,23,26,23,12,27,0,5,84,111,107,101,110,0,0,0,
+,7,0,2,100,111,0,0,13,6,7,0,11,8,0,0,
+,0,0,0,0,0,0,0,9,7,3,8,31,5,7,1,
+,5,6,5,15,4,5,0,12,7,0,8,112,95,102,105,
+,116,101,114,0,0,0,0,13,6,7,0,12,8,0,5,
+,116,101,109,115,0,0,0,9,7,1,8,11,9,0,0,
+,0,0,0,0,0,240,63,28,10,0,0,27,8,9,2,
+,7,7,8,31,5,7,1,19,5,6,5,11,8,0,0,
+,0,0,0,0,0,0,0,9,7,5,8,15,6,7,0,
+,9,0,0,0,0,0,0,0,0,240,63,9,8,5,9,
+,7,8,0,11,10,0,0,0,0,0,0,0,0,0,64,
+,9,5,10,15,8,9,0,11,11,0,0,0,0,0,0,
+,0,8,64,9,10,5,11,15,9,10,0,28,10,0,0,
+,5,10,0,11,12,0,0,0,0,0,0,0,0,240,63,
+,14,0,3,108,101,110,0,13,13,14,0,15,14,7,0,
+,10,14,1,19,10,13,10,11,13,0,0,0,0,0,0,
+,0,0,0,35,10,10,13,23,11,10,12,21,11,0,0,
+,0,0,2,18,0,0,3,28,13,0,0,35,10,9,13,
+,10,0,0,18,0,0,172,12,12,0,2,100,111,0,0,
+,11,12,0,12,14,0,5,84,111,107,101,110,0,0,0,
+,13,14,0,12,18,0,3,112,111,115,0,9,14,1,18,
+,15,0,4,100,105,99,116,0,0,0,0,28,16,0,0,
+,17,0,0,31,12,14,4,19,12,13,12,31,10,12,1,
+,10,11,10,15,5,10,0,12,12,0,6,117,110,95,116,
+,112,0,0,13,11,12,0,15,12,5,0,31,10,12,1,
+,10,11,10,11,11,0,0,0,0,0,0,0,0,0,0,
+,10,7,11,18,0,0,75,12,13,0,5,105,116,101,109,
+,0,0,0,9,12,10,13,11,13,0,0,0,0,0,0,
+,0,0,0,9,12,12,13,12,13,0,6,115,116,114,105,
+,103,0,0,12,14,0,4,116,121,112,101,0,0,0,0,
+,12,14,13,12,15,0,2,100,111,0,0,13,14,15,0,
+,16,0,5,105,116,101,109,115,0,0,0,9,15,10,16,
+,16,0,0,0,0,0,0,0,0,0,0,9,15,15,16,
+,13,15,1,19,13,14,13,15,12,13,0,12,16,0,2,
+,111,0,0,13,15,16,0,12,17,0,5,105,116,101,109,
+,0,0,0,9,16,10,17,11,17,0,0,0,0,0,0,
+,0,240,63,9,16,16,17,31,14,16,1,19,14,15,14,
+,13,14,0,15,14,12,0,15,12,13,0,12,16,0,4,
+,111,100,101,0,0,0,0,13,15,16,0,12,20,0,3,
+,69,84,0,13,16,20,0,15,17,5,0,15,18,14,0,
+,19,12,0,31,13,16,4,19,13,15,13,12,16,0,8,
+,114,101,101,95,116,109,112,0,0,0,0,13,15,16,0,
+,16,14,0,31,13,16,1,19,13,15,13,12,16,0,8,
+,114,101,101,95,116,109,112,0,0,0,0,13,15,16,0,
+,16,12,0,31,13,16,1,19,13,15,13,18,0,255,181,
+,9,0,0,18,0,0,63,12,15,0,8,102,114,101,101,
+,116,109,112,0,0,0,0,13,13,15,0,12,17,0,2,
+,111,0,0,13,16,17,0,12,19,0,5,84,111,107,101,
+,0,0,0,13,18,19,0,12,23,0,3,112,111,115,0,
+,19,1,23,12,20,0,4,99,97,108,108,0,0,0,0,
+,21,0,0,12,27,0,5,84,111,107,101,110,0,0,0,
 ,26,27,0,12,30,0,3,112,111,115,0,9,27,1,30,
-,28,0,3,114,101,103,0,15,29,5,0,31,24,27,3,
-,24,26,24,12,26,0,5,105,116,101,109,115,0,0,0,
-,25,9,26,11,26,0,0,0,0,0,0,0,0,0,0,
-,25,25,26,27,22,23,3,31,17,19,4,19,17,18,17,
-,15,17,1,19,15,16,15,31,11,15,1,19,11,13,11,
-,0,0,1,18,0,0,1,30,7,1,140,32,32,32,32,
-,97,110,97,103,101,95,115,101,113,40,80,65,82,65,77,
-,44,114,44,97,41,0,0,12,15,0,10,109,97,110,97,
-,101,95,115,101,113,0,0,13,13,15,0,12,18,0,6,
-,65,82,65,77,83,0,0,13,15,18,0,15,16,2,0,
-,17,6,0,31,11,15,3,19,11,13,11,30,5,1,141,
-,32,32,32,105,102,32,99,32,33,61,32,78,111,110,101,
-,0,0,0,28,13,0,0,35,11,8,13,21,11,0,0,
-,0,0,88,30,12,1,142,32,32,32,32,32,32,32,32,
-,49,44,116,50,32,61,32,95,100,111,95,115,116,114,105,
-,103,40,39,42,39,41,44,100,111,40,99,46,105,116,101,
-,115,91,48,93,41,0,0,12,16,0,10,95,100,111,95,
+,28,0,4,110,97,109,101,0,0,0,0,12,29,0,5,
+,101,114,103,101,0,0,0,31,23,27,3,19,23,26,23,
+,27,0,5,84,111,107,101,110,0,0,0,13,26,27,0,
+,30,0,3,112,111,115,0,9,27,1,30,12,28,0,3,
+,101,103,0,15,29,5,0,31,24,27,3,19,24,26,24,
+,26,0,5,105,116,101,109,115,0,0,0,9,25,9,26,
+,26,0,0,0,0,0,0,0,0,0,0,9,25,25,26,
+,22,23,3,31,17,19,4,19,17,18,17,31,15,17,1,
+,15,16,15,31,11,15,1,19,11,13,11,18,0,0,1,
+,0,0,1,12,15,0,10,109,97,110,97,103,101,95,115,
+,113,0,0,13,13,15,0,12,18,0,6,80,65,82,65,
+,83,0,0,13,15,18,0,15,16,2,0,15,17,6,0,
+,11,15,3,19,11,13,11,28,13,0,0,35,11,8,13,
+,11,0,0,18,0,0,56,12,16,0,10,95,100,111,95,
 ,116,114,105,110,103,0,0,13,15,16,0,12,16,0,1,
 ,0,0,0,31,13,16,1,19,13,15,13,15,11,13,0,
 ,17,0,2,100,111,0,0,13,16,17,0,12,18,0,5,
 ,1109 → 2886,698
 ,116,101,109,115,0,0,0,9,17,8,18,11,18,0,0,
 ,0,0,0,0,0,0,0,9,17,17,18,31,15,17,1,
 ,15,16,15,15,13,15,0,15,14,11,0,15,12,13,0,
-,7,1,143,32,32,32,32,32,32,32,32,99,111,100,101,
-,83,69,84,44,114,44,116,49,44,116,50,41,0,0,0,
 ,15,0,4,99,111,100,101,0,0,0,0,13,13,15,0,
 ,19,0,3,83,69,84,0,13,15,19,0,15,16,2,0,
 ,17,14,0,15,18,12,0,31,11,15,4,19,11,13,11,
-,10,1,144,32,32,32,32,32,32,32,32,102,114,101,101,
-,116,109,112,40,116,49,41,59,32,102,114,101,101,95,116,
-,112,40,116,50,41,32,35,82,69,71,0,12,15,0,8,
-,114,101,101,95,116,109,112,0,0,0,0,13,13,15,0,
-,15,14,0,31,11,15,1,19,11,13,11,12,15,0,8,
-,114,101,101,95,116,109,112,0,0,0,0,13,13,15,0,
-,15,12,0,31,11,15,1,19,11,13,11,18,0,0,1,
-,5,1,145,32,32,32,32,105,102,32,101,32,33,61,32,
-,111,110,101,58,0,0,0,28,13,0,0,35,11,5,13,
-,11,0,0,18,0,0,53,30,6,1,146,32,32,32,32,
-,32,32,32,116,49,32,61,32,95,100,111,95,110,111,110,
-,40,41,0,12,15,0,8,95,100,111,95,110,111,110,101,
+,15,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,13,15,0,15,15,14,0,31,11,15,1,19,11,13,11,
+,15,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,13,15,0,15,15,12,0,31,11,15,1,19,11,13,11,
+,0,0,1,28,13,0,0,35,11,5,13,21,11,0,0,
+,0,0,30,12,15,0,8,95,100,111,95,110,111,110,101,
 ,0,0,0,13,13,15,0,31,11,0,0,19,11,13,11,
-,14,11,0,30,7,1,147,32,32,32,32,32,32,32,32,
-,111,100,101,40,83,69,84,44,114,44,116,49,44,101,41,
-,0,0,0,12,15,0,4,99,111,100,101,0,0,0,0,
+,14,11,0,12,15,0,4,99,111,100,101,0,0,0,0,
 ,13,15,0,12,19,0,3,83,69,84,0,13,15,19,0,
 ,16,2,0,15,17,14,0,15,18,5,0,31,11,15,4,
-,11,13,11,30,7,1,148,32,32,32,32,32,32,32,32,
-,114,101,101,95,116,109,112,40,116,49,41,32,35,82,69,
-,0,0,0,12,15,0,8,102,114,101,101,95,116,109,112,
+,11,13,11,12,15,0,8,102,114,101,101,95,116,109,112,
 ,0,0,0,13,13,15,0,15,15,14,0,31,11,15,1,
-,11,13,11,18,0,0,1,30,6,1,149,32,32,32,32,
-,111,100,101,40,67,65,76,76,44,114,44,102,110,99,44,
-,41,0,0,12,15,0,4,99,111,100,101,0,0,0,0,
-,13,15,0,12,19,0,4,67,65,76,76,0,0,0,0,
-,15,19,0,15,16,2,0,15,17,4,0,15,18,2,0,
-,11,15,4,19,11,13,11,30,6,1,150,32,32,32,32,
-,114,101,101,95,116,109,112,40,102,110,99,41,32,35,82,
-,71,0,0,12,15,0,8,102,114,101,101,95,116,109,112,
-,0,0,0,13,13,15,0,15,15,4,0,31,11,15,1,
-,11,13,11,30,4,1,151,32,32,32,32,114,101,116,117,
-,110,32,114,0,0,0,0,20,2,0,0,0,0,0,0,
-,45,0,7,100,111,95,99,97,108,108,0,14,45,44,0,
-,6,1,153,100,101,102,32,100,111,95,110,97,109,101,40,
-,44,114,61,78,111,110,101,41,58,0,0,16,45,0,187,
-,10,0,0,30,6,1,153,100,101,102,32,100,111,95,110,
-,109,101,40,116,44,114,61,78,111,110,101,41,58,0,0,
-,1,0,14,99,111,114,101,47,101,110,99,111,100,101,46,
-,121,0,0,33,1,0,0,12,1,0,7,100,111,95,110,
-,109,101,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,2,0,0,28,3,0,0,32,2,0,3,30,6,1,154,
-,32,32,32,105,102,32,116,46,118,97,108,32,105,110,32,
-,46,118,97,114,115,58,0,12,4,0,1,68,0,0,0,
+,11,13,11,18,0,0,1,12,15,0,4,99,111,100,101,
+,0,0,0,13,13,15,0,12,19,0,4,67,65,76,76,
+,0,0,0,13,15,19,0,15,16,2,0,15,17,4,0,
+,18,2,0,31,11,15,4,19,11,13,11,12,15,0,8,
+,114,101,101,95,116,109,112,0,0,0,0,13,13,15,0,
+,15,4,0,31,11,15,1,19,11,13,11,20,2,0,0,
+,0,0,0,12,46,0,7,100,111,95,99,97,108,108,0,
+,46,45,0,16,46,0,70,44,10,0,0,28,2,0,0,
+,1,0,2,28,2,0,0,28,3,0,0,32,2,0,3,
+,4,0,1,68,0,0,0,13,3,4,0,12,4,0,4,
+,97,114,115,0,0,0,0,9,3,3,4,12,5,0,3,
+,97,108,0,9,4,1,5,36,3,3,4,21,3,0,0,
+,0,0,12,12,5,0,8,100,111,95,108,111,99,97,108,
+,0,0,0,13,4,5,0,15,5,1,0,15,6,2,0,
+,3,5,2,19,3,4,3,20,3,0,0,18,0,0,1,
+,5,0,7,103,101,116,95,116,109,112,0,13,4,5,0,
+,5,2,0,31,3,5,1,19,3,4,3,15,2,3,0,
+,6,0,9,100,111,95,115,116,114,105,110,103,0,0,0,
+,5,6,0,15,6,1,0,31,4,6,1,19,4,5,4,
+,3,4,0,12,6,0,4,99,111,100,101,0,0,0,0,
+,5,6,0,12,9,0,4,71,71,69,84,0,0,0,0,
+,6,9,0,15,7,2,0,15,8,3,0,31,4,6,3,
+,4,5,4,12,6,0,8,102,114,101,101,95,116,109,112,
+,0,0,0,13,5,6,0,15,6,3,0,31,4,6,1,
+,4,5,4,20,2,0,0,0,0,0,0,12,47,0,7,
+,111,95,110,97,109,101,0,14,47,46,0,16,47,0,52,
+,7,0,0,28,2,0,0,9,1,0,2,28,2,0,0,
+,3,0,0,32,2,0,3,12,4,0,1,68,0,0,0,
 ,3,4,0,12,4,0,4,118,97,114,115,0,0,0,0,
 ,3,3,4,12,5,0,3,118,97,108,0,9,4,1,5,
-,3,3,4,21,3,0,0,18,0,0,21,30,8,1,155,
-,32,32,32,32,32,32,32,114,101,116,117,114,110,32,100,
-,95,108,111,99,97,108,40,116,44,114,41,0,0,0,0,
-,5,0,8,100,111,95,108,111,99,97,108,0,0,0,0,
-,4,5,0,15,5,1,0,15,6,2,0,31,3,5,2,
-,3,4,3,20,3,0,0,18,0,0,1,30,8,1,156,
-,32,32,32,105,102,32,116,46,118,97,108,32,110,111,116,
-,105,110,32,68,46,114,103,108,111,98,97,108,115,58,0,
-,4,0,1,68,0,0,0,13,3,4,0,12,4,0,8,
-,103,108,111,98,97,108,115,0,0,0,0,9,3,3,4,
-,5,0,3,118,97,108,0,9,4,1,5,36,3,3,4,
-,4,0,0,0,0,0,0,0,0,0,0,23,3,3,4,
-,3,0,0,18,0,0,29,30,9,1,157,32,32,32,32,
-,32,32,32,68,46,114,103,108,111,98,97,108,115,46,97,
-,112,101,110,100,40,116,46,118,97,108,41,0,0,0,0,
-,5,0,1,68,0,0,0,13,4,5,0,12,5,0,8,
-,103,108,111,98,97,108,115,0,0,0,0,9,4,4,5,
-,5,0,6,97,112,112,101,110,100,0,0,9,4,4,5,
-,6,0,3,118,97,108,0,9,5,1,6,31,3,5,1,
-,3,4,3,18,0,0,1,30,5,1,158,32,32,32,32,
-,32,61,32,103,101,116,95,116,109,112,40,114,41,0,0,
-,5,0,7,103,101,116,95,116,109,112,0,13,4,5,0,
-,5,2,0,31,3,5,1,19,3,4,3,15,2,3,0,
-,6,1,159,32,32,32,32,99,32,61,32,100,111,95,115,
-,114,105,110,103,40,116,41,0,0,0,0,12,6,0,9,
-,111,95,115,116,114,105,110,103,0,0,0,13,5,6,0,
-,6,1,0,31,4,6,1,19,4,5,4,15,3,4,0,
-,5,1,160,32,32,32,32,99,111,100,101,40,71,71,69,
-,44,114,44,99,41,0,0,12,6,0,4,99,111,100,101,
-,0,0,0,13,5,6,0,12,9,0,4,71,71,69,84,
-,0,0,0,13,6,9,0,15,7,2,0,15,8,3,0,
-,4,6,3,19,4,5,4,30,4,1,161,32,32,32,32,
-,114,101,101,95,116,109,112,40,99,41,0,12,6,0,8,
-,114,101,101,95,116,109,112,0,0,0,0,13,5,6,0,
-,6,3,0,31,4,6,1,19,4,5,4,30,4,1,162,
-,32,32,32,114,101,116,117,114,110,32,114,0,0,0,0,
-,2,0,0,0,0,0,0,12,46,0,7,100,111,95,110,
-,109,101,0,14,46,45,0,30,6,1,164,100,101,102,32,
-,111,95,108,111,99,97,108,40,116,44,114,61,78,111,110,
-,41,58,0,16,46,0,178,44,9,0,0,30,6,1,164,
-,101,102,32,100,111,95,108,111,99,97,108,40,116,44,114,
-,78,111,110,101,41,58,0,12,1,0,14,99,111,114,101,
-,101,110,99,111,100,101,46,112,121,0,0,33,1,0,0,
-,1,0,8,100,111,95,108,111,99,97,108,0,0,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,28,2,0,0,
-,3,0,0,32,2,0,3,30,7,1,165,32,32,32,32,
-,102,32,116,46,118,97,108,32,105,110,32,68,46,114,103,
-,111,98,97,108,115,58,0,12,4,0,1,68,0,0,0,
-,3,4,0,12,4,0,8,114,103,108,111,98,97,108,115,
-,0,0,0,9,3,3,4,12,5,0,3,118,97,108,0,
-,4,1,5,36,3,3,4,21,3,0,0,18,0,0,62,
-,6,1,166,32,32,32,32,32,32,32,32,68,46,101,114,
-,111,114,32,61,32,84,114,117,101,0,0,12,4,0,1,
-,0,0,0,13,3,4,0,11,4,0,0,0,0,0,0,
-,0,240,63,12,5,0,5,101,114,114,111,114,0,0,0,
-,3,5,4,30,15,1,167,32,32,32,32,32,32,32,32,
-,111,107,101,110,105,122,101,46,117,95,101,114,114,111,114,
-,39,85,110,98,111,117,110,100,76,111,99,97,108,69,114,
-,111,114,39,44,68,46,99,111,100,101,44,116,46,112,111,
-,41,0,0,12,5,0,8,116,111,107,101,110,105,122,101,
-,0,0,0,13,4,5,0,12,5,0,7,117,95,101,114,
-,111,114,0,9,4,4,5,12,5,0,17,85,110,98,111,
-,110,100,76,111,99,97,108,69,114,114,111,114,0,0,0,
-,8,0,1,68,0,0,0,13,6,8,0,12,8,0,4,
-,111,100,101,0,0,0,0,9,6,6,8,12,8,0,3,
-,111,115,0,9,7,1,8,31,3,5,3,19,3,4,3,
-,0,0,1,30,7,1,168,32,32,32,32,105,102,32,116,
-,118,97,108,32,110,111,116,32,105,110,32,68,46,118,97,
-,115,58,0,12,4,0,1,68,0,0,0,13,3,4,0,
-,4,0,4,118,97,114,115,0,0,0,0,9,3,3,4,
-,5,0,3,118,97,108,0,9,4,1,5,36,3,3,4,
-,4,0,0,0,0,0,0,0,0,0,0,23,3,3,4,
-,3,0,0,18,0,0,27,30,8,1,169,32,32,32,32,
-,32,32,32,68,46,118,97,114,115,46,97,112,112,101,110,
-,40,116,46,118,97,108,41,0,0,0,0,12,5,0,1,
+,3,3,4,11,4,0,0,0,0,0,0,0,0,0,0,
+,3,3,4,21,3,0,0,18,0,0,18,12,5,0,1,
 ,0,0,0,13,4,5,0,12,5,0,4,118,97,114,115,
 ,0,0,0,9,4,4,5,12,5,0,6,97,112,112,101,
 ,100,0,0,9,4,4,5,12,6,0,3,118,97,108,0,
 ,5,1,6,31,3,5,1,19,3,4,3,18,0,0,1,
-,7,1,170,32,32,32,32,114,101,116,117,114,110,32,103,
-,116,95,114,101,103,40,116,46,118,97,108,41,0,0,0,
 ,5,0,7,103,101,116,95,114,101,103,0,13,4,5,0,
 ,6,0,3,118,97,108,0,9,5,1,6,31,3,5,1,
-,3,4,3,20,3,0,0,0,0,0,0,12,47,0,8,
-,111,95,108,111,99,97,108,0,0,0,0,14,47,46,0,
-,7,1,172,100,101,102,32,100,111,95,100,101,102,40,116,
-,107,44,107,108,115,61,78,111,110,101,41,58,0,0,0,
-,47,3,65,44,25,0,0,30,7,1,172,100,101,102,32,
-,111,95,100,101,102,40,116,111,107,44,107,108,115,61,78,
-,110,101,41,58,0,0,0,12,1,0,14,99,111,114,101,
-,101,110,99,111,100,101,46,112,121,0,0,33,1,0,0,
-,1,0,6,100,111,95,100,101,102,0,0,34,1,0,0,
-,2,0,0,9,1,0,2,28,2,0,0,28,3,0,0,
-,2,0,3,30,6,1,173,32,32,32,32,105,116,101,109,
-,32,61,32,116,111,107,46,105,116,101,109,115,0,0,0,
-,5,0,5,105,116,101,109,115,0,0,0,9,4,1,5,
-,3,4,0,30,5,1,175,32,32,32,32,116,32,61,32,
-,101,116,95,116,97,103,40,41,0,0,0,12,7,0,7,
-,101,116,95,116,97,103,0,13,6,7,0,31,5,0,0,
-,5,6,5,15,4,5,0,30,6,1,176,32,32,32,32,
-,102,32,61,32,102,110,99,40,116,44,39,101,110,100,39,
-,0,0,0,12,8,0,3,102,110,99,0,13,7,8,0,
-,8,4,0,12,9,0,3,101,110,100,0,31,6,8,2,
-,6,7,6,15,5,6,0,30,4,1,178,32,32,32,32,
-,46,98,101,103,105,110,40,41,0,0,0,12,8,0,1,
-,0,0,0,13,7,8,0,12,8,0,5,98,101,103,105,
-,0,0,0,9,7,7,8,31,6,0,0,19,6,7,6,
-,5,1,179,32,32,32,32,115,101,116,112,111,115,40,116,
-,107,46,112,111,115,41,0,12,8,0,6,115,101,116,112,
-,115,0,0,13,7,8,0,12,9,0,3,112,111,115,0,
-,8,1,9,31,6,8,1,19,6,7,6,30,13,1,180,
-,32,32,32,114,32,61,32,100,111,95,108,111,99,97,108,
-,84,111,107,101,110,40,116,111,107,46,112,111,115,44,39,
-,97,109,101,39,44,39,95,95,112,97,114,97,109,115,39,
-,41,0,0,12,9,0,8,100,111,95,108,111,99,97,108,
-,0,0,0,13,8,9,0,12,11,0,5,84,111,107,101,
-,0,0,0,13,10,11,0,12,14,0,3,112,111,115,0,
-,11,1,14,12,12,0,4,110,97,109,101,0,0,0,0,
-,13,0,8,95,95,112,97,114,97,109,115,0,0,0,0,
-,9,11,3,19,9,10,9,31,7,9,1,19,7,8,7,
-,6,7,0,30,7,1,181,32,32,32,32,100,111,95,105,
-,102,111,40,105,116,101,109,115,91,48,93,46,118,97,108,
-,0,0,0,12,9,0,7,100,111,95,105,110,102,111,0,
-,8,9,0,11,10,0,0,0,0,0,0,0,0,0,0,
-,9,3,10,12,10,0,3,118,97,108,0,9,9,9,10,
-,7,9,1,19,7,8,7,30,10,1,182,32,32,32,32,
-,44,98,44,99,44,100,32,61,32,112,95,102,105,108,116,
-,114,40,105,116,101,109,115,91,49,93,46,105,116,101,109,
-,41,0,0,12,9,0,8,112,95,102,105,108,116,101,114,
-,0,0,0,13,8,9,0,11,10,0,0,0,0,0,0,
-,0,240,63,9,9,3,10,12,10,0,5,105,116,101,109,
-,0,0,0,9,9,9,10,31,7,9,1,19,7,8,7,
-,10,0,0,0,0,0,0,0,0,0,0,9,9,7,10,
-,8,9,0,11,11,0,0,0,0,0,0,0,0,240,63,
-,10,7,11,15,9,10,0,11,12,0,0,0,0,0,0,
-,0,0,64,9,11,7,12,15,10,11,0,11,13,0,0,
-,0,0,0,0,0,8,64,9,12,7,13,15,11,12,0,
-,4,1,183,32,32,32,32,102,111,114,32,112,32,105,110,
-,97,58,0,11,12,0,0,0,0,0,0,0,0,0,0,
-,7,8,12,18,0,0,70,30,6,1,184,32,32,32,32,
-,32,32,32,118,32,61,32,100,111,95,108,111,99,97,108,
-,112,41,0,12,16,0,8,100,111,95,108,111,99,97,108,
-,0,0,0,13,15,16,0,15,16,7,0,31,14,16,1,
-,14,15,14,15,13,14,0,30,7,1,185,32,32,32,32,
-,32,32,32,116,109,112,32,61,32,95,100,111,95,110,111,
-,101,40,41,0,0,0,0,12,17,0,8,95,100,111,95,
-,111,110,101,0,0,0,0,13,16,17,0,31,15,0,0,
-,15,16,15,15,14,15,0,30,7,1,186,32,32,32,32,
-,32,32,32,99,111,100,101,40,71,69,84,44,118,44,114,
-,116,109,112,41,0,0,0,12,17,0,4,99,111,100,101,
-,0,0,0,13,16,17,0,12,21,0,3,71,69,84,0,
-,17,21,0,15,18,13,0,15,19,6,0,15,20,14,0,
-,15,17,4,19,15,16,15,30,7,1,187,32,32,32,32,
-,32,32,32,102,114,101,101,95,116,109,112,40,116,109,112,
-,32,35,82,69,71,0,0,12,17,0,8,102,114,101,101,
-,116,109,112,0,0,0,0,13,16,17,0,15,17,14,0,
-,15,17,1,19,15,16,15,18,0,255,186,30,4,1,188,
-,32,32,32,102,111,114,32,112,32,105,110,32,98,58,0,
-,12,0,0,0,0,0,0,0,0,0,0,42,7,9,12,
-,0,0,103,30,9,1,189,32,32,32,32,32,32,32,32,
-,32,61,32,100,111,95,108,111,99,97,108,40,112,46,105,
-,101,109,115,91,48,93,41,0,0,0,0,12,17,0,8,
-,111,95,108,111,99,97,108,0,0,0,0,13,16,17,0,
-,18,0,5,105,116,101,109,115,0,0,0,9,17,7,18,
-,18,0,0,0,0,0,0,0,0,0,0,9,17,17,18,
-,15,17,1,19,15,16,15,15,13,15,0,30,7,1,190,
-,32,32,32,32,32,32,32,100,111,40,112,46,105,116,101,
-,115,91,49,93,44,118,41,0,0,0,0,12,17,0,2,
-,111,0,0,13,16,17,0,12,19,0,5,105,116,101,109,
-,0,0,0,9,17,7,19,11,19,0,0,0,0,0,0,
-,0,240,63,9,17,17,19,15,18,13,0,31,15,17,2,
-,15,16,15,30,7,1,191,32,32,32,32,32,32,32,32,
-,109,112,32,61,32,95,100,111,95,110,111,110,101,40,41,
-,0,0,0,12,17,0,8,95,100,111,95,110,111,110,101,
-,0,0,0,13,16,17,0,31,15,0,0,19,15,16,15,
-,14,15,0,30,7,1,192,32,32,32,32,32,32,32,32,
-,111,100,101,40,73,71,69,84,44,118,44,114,44,116,109,
-,41,0,0,12,17,0,4,99,111,100,101,0,0,0,0,
-,16,17,0,12,21,0,4,73,71,69,84,0,0,0,0,
-,17,21,0,15,18,13,0,15,19,6,0,15,20,14,0,
-,15,17,4,19,15,16,15,30,7,1,193,32,32,32,32,
-,32,32,32,102,114,101,101,95,116,109,112,40,116,109,112,
-,32,35,82,69,71,0,0,12,17,0,8,102,114,101,101,
-,116,109,112,0,0,0,0,13,16,17,0,15,17,14,0,
-,15,17,1,19,15,16,15,18,0,255,153,30,5,1,194,
-,32,32,32,105,102,32,99,32,33,61,32,78,111,110,101,
-,0,0,0,28,15,0,0,35,12,10,15,21,12,0,0,
-,0,0,83,30,9,1,195,32,32,32,32,32,32,32,32,
-,32,61,32,100,111,95,108,111,99,97,108,40,99,46,105,
-,101,109,115,91,48,93,41,0,0,0,0,12,16,0,8,
+,3,4,3,20,3,0,0,0,0,0,0,12,48,0,8,
+,111,95,108,111,99,97,108,0,0,0,0,14,48,47,0,
+,48,1,229,44,25,0,0,28,2,0,0,9,1,0,2,
+,2,0,0,28,3,0,0,32,2,0,3,12,5,0,5,
+,116,101,109,115,0,0,0,9,4,1,5,15,3,4,0,
+,7,0,7,103,101,116,95,116,97,103,0,13,6,7,0,
+,5,0,0,19,5,6,5,15,4,5,0,12,8,0,3,
+,110,99,0,13,7,8,0,15,8,4,0,12,9,0,3,
+,110,100,0,31,6,8,2,19,6,7,6,15,5,6,0,
+,8,0,1,68,0,0,0,13,7,8,0,12,8,0,5,
+,101,103,105,110,0,0,0,9,7,7,8,31,6,0,0,
+,6,7,6,12,8,0,6,115,101,116,112,111,115,0,0,
+,7,8,0,12,9,0,3,112,111,115,0,9,8,1,9,
+,6,8,1,19,6,7,6,12,9,0,8,100,111,95,108,
+,99,97,108,0,0,0,0,13,8,9,0,12,11,0,5,
+,111,107,101,110,0,0,0,13,10,11,0,12,14,0,3,
+,111,115,0,9,11,1,14,12,12,0,4,110,97,109,101,
+,0,0,0,12,13,0,8,95,95,112,97,114,97,109,115,
+,0,0,0,31,9,11,3,19,9,10,9,31,7,9,1,
+,7,8,7,15,6,7,0,12,9,0,7,100,111,95,105,
+,102,111,0,13,8,9,0,11,10,0,0,0,0,0,0,
+,0,0,0,9,9,3,10,12,10,0,3,118,97,108,0,
+,9,9,10,31,7,9,1,19,7,8,7,12,9,0,8,
+,95,102,105,108,116,101,114,0,0,0,0,13,8,9,0,
+,10,0,0,0,0,0,0,0,0,240,63,9,9,3,10,
+,10,0,5,105,116,101,109,115,0,0,0,9,9,9,10,
+,7,9,1,19,7,8,7,11,10,0,0,0,0,0,0,
+,0,0,0,9,9,7,10,15,8,9,0,11,11,0,0,
+,0,0,0,0,0,240,63,9,10,7,11,15,9,10,0,
+,12,0,0,0,0,0,0,0,0,0,64,9,11,7,12,
+,10,11,0,11,13,0,0,0,0,0,0,0,0,8,64,
+,12,7,13,15,11,12,0,11,12,0,0,0,0,0,0,
+,0,0,0,42,7,8,12,18,0,0,39,12,16,0,8,
 ,111,95,108,111,99,97,108,0,0,0,0,13,15,16,0,
-,17,0,5,105,116,101,109,115,0,0,0,9,16,10,17,
-,17,0,0,0,0,0,0,0,0,0,0,9,16,16,17,
-,12,16,1,19,12,15,12,15,13,12,0,30,8,1,196,
-,32,32,32,32,32,32,32,116,109,112,32,61,32,95,100,
-,95,115,116,114,105,110,103,40,39,42,39,41,0,0,0,
-,16,0,10,95,100,111,95,115,116,114,105,110,103,0,0,
-,15,16,0,12,16,0,1,42,0,0,0,31,12,16,1,
-,12,15,12,15,14,12,0,30,7,1,197,32,32,32,32,
-,32,32,32,99,111,100,101,40,71,69,84,44,118,44,114,
-,116,109,112,41,0,0,0,12,16,0,4,99,111,100,101,
-,0,0,0,13,15,16,0,12,20,0,3,71,69,84,0,
-,16,20,0,15,17,13,0,15,18,6,0,15,19,14,0,
-,12,16,4,19,12,15,12,30,7,1,198,32,32,32,32,
-,32,32,32,102,114,101,101,95,116,109,112,40,116,109,112,
-,32,35,82,69,71,0,0,12,16,0,8,102,114,101,101,
-,116,109,112,0,0,0,0,13,15,16,0,15,16,14,0,
-,12,16,1,19,12,15,12,18,0,0,1,30,5,1,199,
-,32,32,32,105,102,32,100,32,33,61,32,78,111,110,101,
-,0,0,0,28,15,0,0,35,12,11,15,21,12,0,0,
-,0,0,106,30,9,1,200,32,32,32,32,32,32,32,32,
-,32,61,32,100,111,95,108,111,99,97,108,40,100,46,105,
-,101,109,115,91,48,93,41,0,0,0,0,12,17,0,8,
-,111,95,108,111,99,97,108,0,0,0,0,13,16,17,0,
-,18,0,5,105,116,101,109,115,0,0,0,9,17,11,18,
-,18,0,0,0,0,0,0,0,0,0,0,9,17,17,18,
-,15,17,1,19,15,16,15,15,12,15,0,30,7,1,201,
-,32,32,32,32,32,32,32,99,111,100,101,40,68,73,67,
-,44,101,44,48,44,48,41,0,0,0,0,12,17,0,4,
-,111,100,101,0,0,0,0,13,16,17,0,12,21,0,4,
-,73,67,84,0,0,0,0,13,17,21,0,15,18,12,0,
-,19,0,0,0,0,0,0,0,0,0,0,11,20,0,0,
-,0,0,0,0,0,0,0,31,15,17,4,19,15,16,15,
-,7,1,202,32,32,32,32,32,32,32,32,116,109,112,32,
-,32,95,100,111,95,110,111,110,101,40,41,0,0,0,0,
+,16,7,0,31,14,16,1,19,14,15,14,15,13,14,0,
 ,17,0,8,95,100,111,95,110,111,110,101,0,0,0,0,
 ,16,17,0,31,15,0,0,19,15,16,15,15,14,15,0,
-,7,1,203,32,32,32,32,32,32,32,32,99,111,100,101,
-,73,71,69,84,44,101,44,114,44,116,109,112,41,0,0,
 ,17,0,4,99,111,100,101,0,0,0,0,13,16,17,0,
+,21,0,3,71,69,84,0,13,17,21,0,15,18,13,0,
+,19,6,0,15,20,14,0,31,15,17,4,19,15,16,15,
+,17,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,16,17,0,15,17,14,0,31,15,17,1,19,15,16,15,
+,0,255,217,11,12,0,0,0,0,0,0,0,0,0,0,
+,7,9,12,18,0,0,61,12,17,0,8,100,111,95,108,
+,99,97,108,0,0,0,0,13,16,17,0,12,18,0,5,
+,116,101,109,115,0,0,0,9,17,7,18,11,18,0,0,
+,0,0,0,0,0,0,0,9,17,17,18,31,15,17,1,
+,15,16,15,15,13,15,0,12,17,0,2,100,111,0,0,
+,16,17,0,12,19,0,5,105,116,101,109,115,0,0,0,
+,17,7,19,11,19,0,0,0,0,0,0,0,0,240,63,
+,17,17,19,15,18,13,0,31,15,17,2,19,15,16,15,
+,17,0,8,95,100,111,95,110,111,110,101,0,0,0,0,
+,16,17,0,31,15,0,0,19,15,16,15,15,14,15,0,
+,17,0,4,99,111,100,101,0,0,0,0,13,16,17,0,
 ,21,0,4,73,71,69,84,0,0,0,0,13,17,21,0,
-,18,12,0,15,19,6,0,15,20,14,0,31,15,17,4,
-,15,16,15,30,7,1,204,32,32,32,32,32,32,32,32,
-,114,101,101,95,116,109,112,40,116,109,112,41,32,35,82,
-,71,0,0,12,17,0,8,102,114,101,101,95,116,109,112,
+,18,13,0,15,19,6,0,15,20,14,0,31,15,17,4,
+,15,16,15,12,17,0,8,102,114,101,101,95,116,109,112,
 ,0,0,0,13,16,17,0,15,17,14,0,31,15,17,1,
-,15,16,15,18,0,0,1,30,8,1,205,32,32,32,32,
-,114,101,101,95,116,109,112,40,100,111,40,105,116,101,109,
-,91,50,93,41,41,32,35,82,69,71,0,12,17,0,8,
+,15,16,15,18,0,255,195,28,15,0,0,35,12,10,15,
+,12,0,0,18,0,0,48,12,16,0,8,100,111,95,108,
+,99,97,108,0,0,0,0,13,15,16,0,12,17,0,5,
+,116,101,109,115,0,0,0,9,16,10,17,11,17,0,0,
+,0,0,0,0,0,0,0,9,16,16,17,31,12,16,1,
+,12,15,12,15,13,12,0,12,16,0,10,95,100,111,95,
+,116,114,105,110,103,0,0,13,15,16,0,12,16,0,1,
+,0,0,0,31,12,16,1,19,12,15,12,15,14,12,0,
+,16,0,4,99,111,100,101,0,0,0,0,13,15,16,0,
+,20,0,3,71,69,84,0,13,16,20,0,15,17,13,0,
+,18,6,0,15,19,14,0,31,12,16,4,19,12,15,12,
+,16,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,15,16,0,15,16,14,0,31,12,16,1,19,12,15,12,
+,0,0,1,28,15,0,0,35,12,11,15,21,12,0,0,
+,0,0,64,12,17,0,8,100,111,95,108,111,99,97,108,
+,0,0,0,13,16,17,0,12,18,0,5,105,116,101,109,
+,0,0,0,9,17,11,18,11,18,0,0,0,0,0,0,
+,0,0,0,9,17,17,18,31,15,17,1,19,15,16,15,
+,12,15,0,12,17,0,4,99,111,100,101,0,0,0,0,
+,16,17,0,12,21,0,4,68,73,67,84,0,0,0,0,
+,17,21,0,15,18,12,0,11,19,0,0,0,0,0,0,
+,0,0,0,11,20,0,0,0,0,0,0,0,0,0,0,
+,15,17,4,19,15,16,15,12,17,0,8,95,100,111,95,
+,111,110,101,0,0,0,0,13,16,17,0,31,15,0,0,
+,15,16,15,15,14,15,0,12,17,0,4,99,111,100,101,
+,0,0,0,13,16,17,0,12,21,0,4,73,71,69,84,
+,0,0,0,13,17,21,0,15,18,12,0,15,19,6,0,
+,20,14,0,31,15,17,4,19,15,16,15,12,17,0,8,
 ,114,101,101,95,116,109,112,0,0,0,0,13,16,17,0,
-,19,0,2,100,111,0,0,13,18,19,0,11,20,0,0,
-,0,0,0,0,0,0,64,9,19,3,20,31,17,19,1,
-,17,18,17,31,15,17,1,19,15,16,15,30,3,1,206,
-,32,32,32,68,46,101,110,100,40,41,0,12,17,0,1,
-,0,0,0,13,16,17,0,12,17,0,3,101,110,100,0,
-,16,16,17,31,15,0,0,19,15,16,15,30,5,1,208,
-,32,32,32,116,97,103,40,116,44,39,101,110,100,39,41,
-,0,0,0,12,17,0,3,116,97,103,0,13,16,17,0,
-,17,4,0,12,18,0,3,101,110,100,0,31,15,17,2,
-,15,16,15,30,5,1,210,32,32,32,32,105,102,32,107,
-,115,32,61,61,32,78,111,110,101,58,0,28,16,0,0,
-,15,2,16,21,15,0,0,18,0,0,98,30,17,1,211,
-,32,32,32,32,32,32,32,105,102,32,68,46,95,103,108,
-,98,97,108,115,58,32,100,111,95,103,108,111,98,97,108,
-,40,84,111,107,101,110,40,116,111,107,46,112,111,115,44,
-,44,48,44,91,105,116,101,109,115,91,48,93,93,41,41,
-,0,0,0,12,16,0,1,68,0,0,0,13,15,16,0,
-,16,0,8,95,103,108,111,98,97,108,115,0,0,0,0,
-,15,15,16,21,15,0,0,18,0,0,29,12,17,0,10,
-,111,95,103,108,111,98,97,108,115,0,0,13,16,17,0,
-,19,0,5,84,111,107,101,110,0,0,0,13,18,19,0,
-,23,0,3,112,111,115,0,9,19,1,23,11,20,0,0,
-,0,0,0,0,0,0,0,11,21,0,0,0,0,0,0,
-,0,0,0,11,24,0,0,0,0,0,0,0,0,0,0,
-,23,3,24,27,22,23,1,31,17,19,4,19,17,18,17,
-,15,17,1,19,15,16,15,18,0,0,1,30,15,1,212,
-,32,32,32,32,32,32,32,114,32,61,32,100,111,95,115,
-,116,95,99,116,120,40,105,116,101,109,115,91,48,93,44,
-,111,107,101,110,40,116,111,107,46,112,111,115,44,39,114,
-,103,39,44,114,102,41,41,0,0,0,0,12,17,0,10,
-,111,95,115,101,116,95,99,116,120,0,0,13,16,17,0,
-,19,0,0,0,0,0,0,0,0,0,0,9,17,3,19,
-,20,0,5,84,111,107,101,110,0,0,0,13,19,20,0,
-,23,0,3,112,111,115,0,9,20,1,23,12,21,0,3,
-,101,103,0,15,22,5,0,31,18,20,3,19,18,19,18,
-,15,17,2,19,15,16,15,15,6,15,0,18,0,0,63,
-,3,1,213,32,32,32,32,101,108,115,101,58,0,0,0,
-,9,1,214,32,32,32,32,32,32,32,32,114,110,32,61,
-,100,111,95,115,116,114,105,110,103,40,105,116,101,109,115,
-,48,93,41,0,0,0,0,12,18,0,9,100,111,95,115,
-,114,105,110,103,0,0,0,13,17,18,0,11,19,0,0,
-,0,0,0,0,0,0,0,9,18,3,19,31,16,18,1,
-,16,17,16,15,15,16,0,30,7,1,215,32,32,32,32,
-,32,32,32,99,111,100,101,40,83,69,84,44,107,108,115,
-,114,110,44,114,102,41,0,12,18,0,4,99,111,100,101,
-,0,0,0,13,17,18,0,12,22,0,3,83,69,84,0,
-,18,22,0,15,19,2,0,15,20,15,0,15,21,5,0,
-,16,18,4,19,16,17,16,30,6,1,216,32,32,32,32,
-,32,32,32,102,114,101,101,95,116,109,112,40,114,110,41,
-,0,0,0,12,18,0,8,102,114,101,101,95,116,109,112,
-,0,0,0,13,17,18,0,15,18,15,0,31,16,18,1,
-,16,17,16,18,0,0,1,30,5,1,218,32,32,32,32,
-,114,101,101,95,116,109,112,40,114,102,41,0,0,0,0,
+,17,14,0,31,15,17,1,19,15,16,15,18,0,0,1,
+,17,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,16,17,0,12,19,0,2,100,111,0,0,13,18,19,0,
+,20,0,0,0,0,0,0,0,0,0,64,9,19,3,20,
+,17,19,1,19,17,18,17,31,15,17,1,19,15,16,15,
+,17,0,1,68,0,0,0,13,16,17,0,12,17,0,3,
+,110,100,0,9,16,16,17,31,15,0,0,19,15,16,15,
+,17,0,3,116,97,103,0,13,16,17,0,15,17,4,0,
+,18,0,3,101,110,100,0,31,15,17,2,19,15,16,15,
+,16,0,0,23,15,2,16,21,15,0,0,18,0,0,64,
+,16,0,1,68,0,0,0,13,15,16,0,12,16,0,8,
+,103,108,111,98,97,108,115,0,0,0,0,9,15,15,16,
+,15,0,0,18,0,0,29,12,17,0,10,100,111,95,103,
+,111,98,97,108,115,0,0,13,16,17,0,12,19,0,5,
+,111,107,101,110,0,0,0,13,18,19,0,12,23,0,3,
+,111,115,0,9,19,1,23,11,20,0,0,0,0,0,0,
+,0,0,0,11,21,0,0,0,0,0,0,0,0,0,0,
+,24,0,0,0,0,0,0,0,0,0,0,9,23,3,24,
+,22,23,1,31,17,19,4,19,17,18,17,31,15,17,1,
+,15,16,15,18,0,0,1,12,17,0,10,100,111,95,115,
+,116,95,99,116,120,0,0,13,16,17,0,11,19,0,0,
+,0,0,0,0,0,0,0,9,17,3,19,12,20,0,5,
+,111,107,101,110,0,0,0,13,19,20,0,12,23,0,3,
+,111,115,0,9,20,1,23,12,21,0,3,114,101,103,0,
+,22,5,0,31,18,20,3,19,18,19,18,31,15,17,2,
+,15,16,15,15,6,15,0,18,0,0,34,12,18,0,9,
+,111,95,115,116,114,105,110,103,0,0,0,13,17,18,0,
+,19,0,0,0,0,0,0,0,0,0,0,9,18,3,19,
+,16,18,1,19,16,17,16,15,15,16,0,12,18,0,4,
+,111,100,101,0,0,0,0,13,17,18,0,12,22,0,3,
+,69,84,0,13,18,22,0,15,19,2,0,15,20,15,0,
+,21,5,0,31,16,18,4,19,16,17,16,12,18,0,8,
+,114,101,101,95,116,109,112,0,0,0,0,13,17,18,0,
+,18,15,0,31,16,18,1,19,16,17,16,18,0,0,1,
 ,18,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
 ,17,18,0,15,18,5,0,31,16,18,1,19,16,17,16,
-,0,0,0,12,48,0,6,100,111,95,100,101,102,0,0,
-,48,47,0,30,5,1,220,100,101,102,32,100,111,95,99,
-,97,115,115,40,116,41,58,0,0,0,0,16,48,1,234,
-,26,0,0,30,5,1,220,100,101,102,32,100,111,95,99,
-,97,115,115,40,116,41,58,0,0,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,8,100,111,95,99,108,97,115,115,
-,0,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,3,1,221,32,32,32,32,116,111,107,32,61,32,116,0,
-,2,1,0,30,5,1,222,32,32,32,32,105,116,101,109,
-,32,61,32,116,46,105,116,101,109,115,0,12,5,0,5,
-,116,101,109,115,0,0,0,9,4,1,5,15,3,4,0,
-,5,1,223,32,32,32,32,112,97,114,101,110,116,32,61,
-,78,111,110,101,0,0,0,28,5,0,0,15,4,5,0,
-,8,1,224,32,32,32,32,105,102,32,105,116,101,109,115,
-,48,93,46,116,121,112,101,32,61,61,32,39,110,97,109,
-,39,58,0,11,6,0,0,0,0,0,0,0,0,0,0,
+,0,0,0,12,49,0,6,100,111,95,100,101,102,0,0,
+,49,48,0,16,49,3,36,44,44,0,0,28,2,0,0,
+,1,0,2,15,2,1,0,12,5,0,5,105,116,101,109,
+,0,0,0,9,4,1,5,15,3,4,0,28,5,0,0,
+,4,5,0,11,6,0,0,0,0,0,0,0,0,0,0,
 ,5,3,6,12,6,0,4,116,121,112,101,0,0,0,0,
 ,5,5,6,12,6,0,4,110,97,109,101,0,0,0,0,
-,5,5,6,21,5,0,0,18,0,0,47,30,7,1,225,
-,32,32,32,32,32,32,32,110,97,109,101,32,61,32,105,
-,101,109,115,91,48,93,46,118,97,108,0,11,7,0,0,
+,5,5,6,21,5,0,0,18,0,0,10,11,7,0,0,
 ,0,0,0,0,0,0,0,9,6,3,7,12,7,0,3,
-,97,108,0,9,6,6,7,15,5,6,0,30,12,1,226,
-,32,32,32,32,32,32,32,112,97,114,101,110,116,32,61,
-,84,111,107,101,110,40,116,111,107,46,112,111,115,44,39,
-,97,109,101,39,44,39,111,98,106,101,99,116,39,41,0,
-,8,0,5,84,111,107,101,110,0,0,0,13,7,8,0,
-,11,0,3,112,111,115,0,9,8,2,11,12,9,0,4,
-,97,109,101,0,0,0,0,12,10,0,6,111,98,106,101,
-,116,0,0,31,6,8,3,19,6,7,6,15,4,6,0,
-,0,0,56,30,3,1,227,32,32,32,32,101,108,115,101,
-,0,0,0,30,10,1,228,32,32,32,32,32,32,32,32,
-,97,109,101,32,61,32,105,116,101,109,115,91,48,93,46,
-,116,101,109,115,91,48,93,46,118,97,108,0,0,0,0,
+,97,108,0,9,6,6,7,15,5,6,0,18,0,0,34,
 ,7,0,0,0,0,0,0,0,0,0,0,9,6,3,7,
 ,7,0,5,105,116,101,109,115,0,0,0,9,6,6,7,
 ,7,0,0,0,0,0,0,0,0,0,0,9,6,6,7,
 ,7,0,3,118,97,108,0,9,6,6,7,15,5,6,0,
-,9,1,229,32,32,32,32,32,32,32,32,112,97,114,101,
-,116,32,61,32,105,116,101,109,115,91,48,93,46,105,116,
-,109,115,91,49,93,0,0,11,7,0,0,0,0,0,0,
-,0,0,0,9,6,3,7,12,7,0,5,105,116,101,109,
-,0,0,0,9,6,6,7,11,7,0,0,0,0,0,0,
-,0,240,63,9,6,6,7,15,4,6,0,18,0,0,1,
-,10,1,231,32,32,32,32,107,108,115,32,61,32,100,111,
-,84,111,107,101,110,40,116,46,112,111,115,44,39,100,105,
-,116,39,44,48,44,91,93,41,41,0,0,12,9,0,2,
-,111,0,0,13,8,9,0,12,11,0,5,84,111,107,101,
-,0,0,0,13,10,11,0,12,15,0,3,112,111,115,0,
-,11,1,15,12,12,0,4,100,105,99,116,0,0,0,0,
-,13,0,0,0,0,0,0,0,0,0,0,27,14,0,0,
-,9,11,4,19,9,10,9,31,7,9,1,19,7,8,7,
-,6,7,0,30,4,1,232,32,32,32,32,117,110,95,116,
-,112,40,107,108,115,41,0,12,9,0,6,117,110,95,116,
-,112,0,0,13,8,9,0,15,9,6,0,31,7,9,1,
-,7,8,7,30,7,1,233,32,32,32,32,116,115,32,61,
-,95,100,111,95,115,116,114,105,110,103,40,110,97,109,101,
-,0,0,0,12,10,0,10,95,100,111,95,115,116,114,105,
-,103,0,0,13,9,10,0,15,10,5,0,31,8,10,1,
-,8,9,8,15,7,8,0,30,6,1,234,32,32,32,32,
-,111,100,101,40,71,83,69,84,44,116,115,44,107,108,115,
-,0,0,0,12,10,0,4,99,111,100,101,0,0,0,0,
-,9,10,0,12,13,0,4,71,83,69,84,0,0,0,0,
-,10,13,0,15,11,7,0,15,12,6,0,31,8,10,3,
-,8,9,8,30,6,1,235,32,32,32,32,102,114,101,101,
-,116,109,112,40,116,115,41,32,35,82,69,71,0,0,0,
+,7,0,0,0,0,0,0,0,0,0,0,9,6,3,7,
+,7,0,5,105,116,101,109,115,0,0,0,9,6,6,7,
+,7,0,0,0,0,0,0,0,0,240,63,9,6,6,7,
+,7,0,3,118,97,108,0,9,6,6,7,15,4,6,0,
+,0,0,1,12,9,0,2,100,111,0,0,13,8,9,0,
+,11,0,5,84,111,107,101,110,0,0,0,13,10,11,0,
+,15,0,3,112,111,115,0,9,11,1,15,12,12,0,4,
+,105,99,116,0,0,0,0,11,13,0,0,0,0,0,0,
+,0,0,0,27,14,0,0,31,9,11,4,19,9,10,9,
+,7,9,1,19,7,8,7,15,6,7,0,12,10,0,10,
+,100,111,95,115,116,114,105,110,103,0,0,13,9,10,0,
+,10,5,0,31,8,10,1,19,8,9,8,15,7,8,0,
+,10,0,4,99,111,100,101,0,0,0,0,13,9,10,0,
+,13,0,4,71,83,69,84,0,0,0,0,13,10,13,0,
+,11,7,0,15,12,6,0,31,8,10,3,19,8,9,8,
 ,10,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
 ,9,10,0,15,10,7,0,31,8,10,1,19,8,9,8,
-,11,1,237,32,32,32,32,102,114,101,101,95,116,109,112,
-,100,111,40,84,111,107,101,110,40,116,111,107,46,112,111,
-,44,39,99,97,108,108,39,44,78,111,110,101,44,91,0,
-,10,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
-,9,10,0,12,12,0,2,100,111,0,0,13,11,12,0,
-,14,0,5,84,111,107,101,110,0,0,0,13,13,14,0,
-,18,0,3,112,111,115,0,9,14,2,18,12,15,0,4,
-,97,108,108,0,0,0,0,28,16,0,0,30,11,1,238,
-,32,32,32,32,32,32,32,84,111,107,101,110,40,116,111,
-,46,112,111,115,44,39,110,97,109,101,39,44,39,115,101,
-,109,101,116,97,39,41,44,0,0,0,0,12,22,0,5,
-,111,107,101,110,0,0,0,13,21,22,0,12,25,0,3,
-,111,115,0,9,22,2,25,12,23,0,4,110,97,109,101,
-,0,0,0,12,24,0,7,115,101,116,109,101,116,97,0,
-,18,22,3,19,18,21,18,30,9,1,239,32,32,32,32,
-,32,32,32,84,111,107,101,110,40,116,111,107,46,112,111,
-,44,39,114,101,103,39,44,107,108,115,41,44,0,0,0,
-,22,0,5,84,111,107,101,110,0,0,0,13,21,22,0,
-,25,0,3,112,111,115,0,9,22,2,25,12,23,0,3,
-,101,103,0,15,24,6,0,31,19,22,3,19,19,21,19,
-,5,1,240,32,32,32,32,32,32,32,32,112,97,114,101,
-,116,93,41,41,41,0,0,15,20,4,0,27,17,18,3,
-,12,14,4,19,12,13,12,31,10,12,1,19,10,11,10,
-,8,10,1,19,8,9,8,30,9,1,242,32,32,32,32,
-,111,114,32,109,101,109,98,101,114,32,105,110,32,105,116,
-,109,115,91,49,93,46,105,116,101,109,115,58,0,0,0,
-,10,0,0,0,0,0,0,0,0,240,63,9,9,3,10,
-,10,0,5,105,116,101,109,115,0,0,0,9,9,9,10,
-,10,0,0,0,0,0,0,0,0,0,0,42,8,9,10,
-,0,0,93,30,13,1,243,32,32,32,32,32,32,32,32,
-,102,32,109,101,109,98,101,114,46,116,121,112,101,32,61,
-,32,39,100,101,102,39,58,32,100,111,95,100,101,102,40,
-,101,109,98,101,114,44,107,108,115,41,0,12,12,0,4,
-,121,112,101,0,0,0,0,9,11,8,12,12,12,0,3,
-,101,102,0,23,11,11,12,21,11,0,0,18,0,0,10,
-,13,0,6,100,111,95,100,101,102,0,0,13,12,13,0,
-,13,8,0,15,14,6,0,31,11,13,2,19,11,12,11,
-,0,0,60,30,21,1,244,32,32,32,32,32,32,32,32,
-,108,105,102,32,109,101,109,98,101,114,46,116,121,112,101,
-,61,61,32,39,115,121,109,98,111,108,39,32,97,110,100,
-,109,101,109,98,101,114,46,118,97,108,32,61,61,32,39,
-,39,58,32,100,111,95,99,108,97,115,115,118,97,114,40,
-,101,109,98,101,114,44,107,108,115,41,0,12,12,0,4,
-,121,112,101,0,0,0,0,9,11,8,12,12,12,0,6,
-,121,109,98,111,108,0,0,23,11,11,12,21,11,0,0,
-,0,0,7,12,12,0,3,118,97,108,0,9,11,8,12,
-,12,0,1,61,0,0,0,23,11,11,12,21,11,0,0,
-,0,0,11,12,13,0,11,100,111,95,99,108,97,115,115,
-,97,114,0,13,12,13,0,15,13,8,0,15,14,6,0,
-,11,13,2,19,11,12,11,18,0,0,10,30,6,1,245,
-,32,32,32,32,32,32,32,101,108,115,101,58,32,99,111,
-,116,105,110,117,101,0,0,18,0,255,165,18,0,0,1,
-,0,255,163,30,6,1,247,32,32,32,32,102,114,101,101,
-,114,101,103,40,107,108,115,41,32,35,82,69,71,0,0,
-,11,0,8,102,114,101,101,95,114,101,103,0,0,0,0,
-,10,11,0,15,11,6,0,31,9,11,1,19,9,10,9,
-,0,0,0,12,49,0,8,100,111,95,99,108,97,115,115,
-,0,0,0,14,49,48,0,30,6,1,249,100,101,102,32,
-,111,95,99,108,97,115,115,118,97,114,40,116,44,114,41,
-,0,0,0,16,49,0,119,44,12,0,0,30,6,1,249,
-,101,102,32,100,111,95,99,108,97,115,115,118,97,114,40,
-,44,114,41,58,0,0,0,12,1,0,14,99,111,114,101,
-,101,110,99,111,100,101,46,112,121,0,0,33,1,0,0,
-,1,0,11,100,111,95,99,108,97,115,115,118,97,114,0,
-,1,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
-,2,0,3,30,8,1,250,32,32,32,32,118,97,114,32,
-,32,100,111,95,115,116,114,105,110,103,40,116,46,105,116,
-,109,115,91,48,93,41,0,12,6,0,9,100,111,95,115,
-,114,105,110,103,0,0,0,13,5,6,0,12,7,0,5,
-,116,101,109,115,0,0,0,9,6,1,7,11,7,0,0,
-,0,0,0,0,0,0,0,9,6,6,7,31,4,6,1,
-,4,5,4,15,3,4,0,30,7,1,251,32,32,32,32,
-,97,108,32,61,32,100,111,40,116,46,105,116,101,109,115,
-,49,93,41,0,0,0,0,12,7,0,2,100,111,0,0,
-,6,7,0,12,8,0,5,105,116,101,109,115,0,0,0,
-,7,1,8,11,8,0,0,0,0,0,0,0,0,240,63,
-,7,7,8,31,5,7,1,19,5,6,5,15,4,5,0,
-,6,1,252,32,32,32,32,99,111,100,101,40,83,69,84,
-,114,44,118,97,114,44,118,97,108,41,0,12,7,0,4,
-,111,100,101,0,0,0,0,13,6,7,0,12,11,0,3,
-,69,84,0,13,7,11,0,15,8,2,0,15,9,3,0,
-,10,4,0,31,5,7,4,19,5,6,5,30,5,1,253,
-,32,32,32,102,114,101,101,95,114,101,103,40,118,97,114,
-,0,0,0,12,7,0,8,102,114,101,101,95,114,101,103,
-,0,0,0,13,6,7,0,15,7,3,0,31,5,7,1,
-,5,6,5,30,5,1,254,32,32,32,32,102,114,101,101,
-,114,101,103,40,118,97,108,41,0,0,0,12,7,0,8,
-,114,101,101,95,114,101,103,0,0,0,0,13,6,7,0,
-,7,4,0,31,5,7,1,19,5,6,5,0,0,0,0,
-,50,0,11,100,111,95,99,108,97,115,115,118,97,114,0,
-,50,49,0,30,5,2,0,100,101,102,32,100,111,95,119,
-,105,108,101,40,116,41,58,0,0,0,0,16,50,0,222,
-,10,0,0,30,5,2,0,100,101,102,32,100,111,95,119,
-,105,108,101,40,116,41,58,0,0,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,8,100,111,95,119,104,105,108,101,
-,0,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,5,2,1,32,32,32,32,105,116,101,109,115,32,61,32,
-,46,105,116,101,109,115,0,12,4,0,5,105,116,101,109,
-,0,0,0,9,3,1,4,15,2,3,0,30,5,2,2,
-,32,32,32,116,32,61,32,115,116,97,99,107,95,116,97,
-,40,41,0,12,5,0,9,115,116,97,99,107,95,116,97,
-,0,0,0,13,4,5,0,31,3,0,0,19,3,4,3,
-,1,3,0,30,5,2,3,32,32,32,32,116,97,103,40,
-,44,39,98,101,103,105,110,39,41,0,0,12,5,0,3,
+,9,0,0,0,0,0,0,0,0,0,0,15,8,9,0,
+,10,0,0,15,9,10,0,15,10,8,0,15,8,9,0,
+,4,0,0,18,0,0,78,12,12,0,6,97,112,112,101,
+,100,0,0,9,11,8,12,12,14,0,5,84,111,107,101,
+,0,0,0,13,13,14,0,12,18,0,3,112,111,115,0,
+,14,1,18,12,15,0,4,99,97,108,108,0,0,0,0,
+,16,0,0,12,21,0,5,84,111,107,101,110,0,0,0,
+,20,21,0,12,25,0,3,112,111,115,0,9,21,1,25,
+,22,0,3,103,101,116,0,28,23,0,0,12,28,0,5,
+,111,107,101,110,0,0,0,13,27,28,0,12,31,0,3,
+,111,115,0,9,28,1,31,12,29,0,4,110,97,109,101,
+,0,0,0,15,30,4,0,31,25,28,3,19,25,27,25,
+,28,0,5,84,111,107,101,110,0,0,0,13,27,28,0,
+,31,0,3,112,111,115,0,9,28,1,31,12,29,0,6,
+,116,114,105,110,103,0,0,12,30,0,7,95,95,110,101,
+,95,95,0,31,26,28,3,19,26,27,26,27,24,25,2,
+,18,21,4,19,18,20,18,12,21,0,5,84,111,107,101,
+,0,0,0,13,20,21,0,12,24,0,3,112,111,115,0,
+,21,1,24,12,22,0,4,110,97,109,101,0,0,0,0,
+,23,0,4,115,101,108,102,0,0,0,0,31,19,21,3,
+,19,20,19,27,17,18,2,31,12,14,4,19,12,13,12,
+,9,12,1,19,9,11,9,18,0,0,1,11,12,0,0,
+,0,0,0,0,0,240,63,9,11,3,12,12,12,0,5,
+,116,101,109,115,0,0,0,9,11,11,12,11,12,0,0,
+,0,0,0,0,0,0,0,42,9,11,12,18,0,0,190,
+,14,0,4,116,121,112,101,0,0,0,0,9,13,9,14,
+,14,0,3,100,101,102,0,35,13,13,14,21,13,0,0,
+,0,0,3,18,0,255,245,18,0,0,1,12,15,0,5,
+,116,101,109,115,0,0,0,9,14,9,15,11,15,0,0,
+,0,0,0,0,0,0,0,9,14,14,15,12,15,0,3,
+,97,108,0,9,14,14,15,15,13,14,0,12,15,0,8,
+,95,105,110,105,116,95,95,0,0,0,0,23,14,13,15,
+,14,0,0,18,0,0,6,11,14,0,0,0,0,0,0,
+,0,240,63,15,10,14,0,18,0,0,1,12,16,0,6,
+,111,95,100,101,102,0,0,13,15,16,0,15,16,9,0,
+,17,6,0,31,14,16,2,19,14,15,14,12,16,0,6,
+,112,112,101,110,100,0,0,9,15,8,16,12,18,0,5,
+,111,107,101,110,0,0,0,13,17,18,0,12,22,0,3,
+,111,115,0,9,18,9,22,12,19,0,6,115,121,109,98,
+,108,0,0,12,20,0,1,61,0,0,0,12,25,0,5,
+,111,107,101,110,0,0,0,13,24,25,0,12,29,0,3,
+,111,115,0,9,25,9,29,12,26,0,3,103,101,116,0,
+,27,0,0,12,32,0,5,84,111,107,101,110,0,0,0,
+,31,32,0,12,35,0,3,112,111,115,0,9,32,9,35,
+,33,0,4,110,97,109,101,0,0,0,0,12,34,0,4,
+,101,108,102,0,0,0,0,31,29,32,3,19,29,31,29,
+,32,0,5,84,111,107,101,110,0,0,0,13,31,32,0,
+,35,0,3,112,111,115,0,9,32,9,35,12,33,0,6,
+,116,114,105,110,103,0,0,15,34,13,0,31,30,32,3,
+,30,31,30,27,28,29,2,31,22,25,4,19,22,24,22,
+,25,0,5,84,111,107,101,110,0,0,0,13,24,25,0,
+,29,0,3,112,111,115,0,9,25,9,29,12,26,0,4,
+,97,108,108,0,0,0,0,28,27,0,0,12,33,0,5,
+,111,107,101,110,0,0,0,13,32,33,0,12,36,0,3,
+,111,115,0,9,33,9,36,12,34,0,4,110,97,109,101,
+,0,0,0,12,35,0,4,98,105,110,100,0,0,0,0,
+,29,33,3,19,29,32,29,12,33,0,5,84,111,107,101,
+,0,0,0,13,32,33,0,12,37,0,3,112,111,115,0,
+,33,9,37,12,34,0,3,103,101,116,0,28,35,0,0,
+,40,0,5,84,111,107,101,110,0,0,0,13,39,40,0,
+,43,0,3,112,111,115,0,9,40,9,43,12,41,0,4,
+,97,109,101,0,0,0,0,15,42,5,0,31,37,40,3,
+,37,39,37,12,40,0,5,84,111,107,101,110,0,0,0,
+,39,40,0,12,43,0,3,112,111,115,0,9,40,9,43,
+,41,0,6,115,116,114,105,110,103,0,0,15,42,13,0,
+,38,40,3,19,38,39,38,27,36,37,2,31,30,33,4,
+,30,32,30,12,33,0,5,84,111,107,101,110,0,0,0,
+,32,33,0,12,36,0,3,112,111,115,0,9,33,9,36,
+,34,0,4,110,97,109,101,0,0,0,0,12,35,0,4,
+,101,108,102,0,0,0,0,31,31,33,3,19,31,32,31,
+,28,29,3,31,23,25,4,19,23,24,23,27,21,22,2,
+,16,18,4,19,16,17,16,31,14,16,1,19,14,15,14,
+,0,255,66,12,14,0,6,100,111,95,100,101,102,0,0,
+,12,14,0,12,17,0,5,84,111,107,101,110,0,0,0,
+,16,17,0,12,21,0,3,112,111,115,0,9,17,1,21,
+,18,0,3,100,101,102,0,28,19,0,0,12,25,0,5,
+,111,107,101,110,0,0,0,13,24,25,0,12,28,0,3,
+,111,115,0,9,25,1,28,12,26,0,4,110,97,109,101,
+,0,0,0,12,27,0,7,95,95,110,101,119,95,95,0,
+,21,25,3,19,21,24,21,12,25,0,5,84,111,107,101,
+,0,0,0,13,24,25,0,12,29,0,3,112,111,115,0,
+,25,1,29,12,26,0,4,108,105,115,116,0,0,0,0,
+,27,0,0,12,31,0,5,84,111,107,101,110,0,0,0,
+,30,31,0,12,34,0,3,112,111,115,0,9,31,1,34,
+,32,0,4,110,97,109,101,0,0,0,0,12,33,0,4,
+,101,108,102,0,0,0,0,31,29,31,3,19,29,30,29,
+,28,29,1,31,22,25,4,19,22,24,22,12,25,0,5,
+,111,107,101,110,0,0,0,13,24,25,0,12,29,0,3,
+,111,115,0,9,25,1,29,12,26,0,10,115,116,97,116,
+,109,101,110,116,115,0,0,28,27,0,0,15,28,8,0,
+,23,25,4,19,23,24,23,27,20,21,3,31,14,17,4,
+,14,16,14,15,15,6,0,31,11,14,2,19,11,12,11,
+,14,0,7,103,101,116,95,116,97,103,0,13,12,14,0,
+,11,0,0,19,11,12,11,15,1,11,0,12,15,0,3,
+,110,99,0,13,14,15,0,15,15,1,0,12,16,0,3,
+,110,100,0,31,12,15,2,19,12,14,12,15,11,12,0,
+,15,0,1,68,0,0,0,13,14,15,0,12,15,0,5,
+,101,103,105,110,0,0,0,9,14,14,15,31,12,0,0,
+,12,14,12,12,16,0,8,100,111,95,108,111,99,97,108,
+,0,0,0,13,15,16,0,12,18,0,5,84,111,107,101,
+,0,0,0,13,17,18,0,12,21,0,3,112,111,115,0,
+,18,2,21,12,19,0,4,110,97,109,101,0,0,0,0,
+,20,0,8,95,95,112,97,114,97,109,115,0,0,0,0,
+,16,18,3,19,16,17,16,31,14,16,1,19,14,15,14,
+,12,14,0,12,17,0,8,100,111,95,108,111,99,97,108,
+,0,0,0,13,16,17,0,12,19,0,5,84,111,107,101,
+,0,0,0,13,18,19,0,12,22,0,3,112,111,115,0,
+,19,2,22,12,20,0,4,110,97,109,101,0,0,0,0,
+,21,0,4,115,101,108,102,0,0,0,0,31,17,19,3,
+,17,18,17,31,15,17,1,19,15,16,15,15,14,15,0,
+,17,0,4,99,111,100,101,0,0,0,0,13,16,17,0,
+,21,0,4,68,73,67,84,0,0,0,0,13,17,21,0,
+,18,14,0,11,19,0,0,0,0,0,0,0,0,0,0,
+,20,0,0,0,0,0,0,0,0,0,0,31,15,17,4,
+,15,16,15,12,17,0,8,102,114,101,101,95,116,109,112,
+,0,0,0,13,16,17,0,12,19,0,2,100,111,0,0,
+,18,19,0,12,21,0,5,84,111,107,101,110,0,0,0,
+,20,21,0,12,25,0,3,112,111,115,0,9,21,2,25,
+,22,0,4,99,97,108,108,0,0,0,0,28,23,0,0,
+,28,0,5,84,111,107,101,110,0,0,0,13,27,28,0,
+,32,0,3,112,111,115,0,9,28,2,32,12,29,0,3,
+,101,116,0,28,30,0,0,12,35,0,5,84,111,107,101,
+,0,0,0,13,34,35,0,12,38,0,3,112,111,115,0,
+,35,2,38,12,36,0,4,110,97,109,101,0,0,0,0,
+,37,5,0,31,32,35,3,19,32,34,32,12,35,0,5,
+,111,107,101,110,0,0,0,13,34,35,0,12,38,0,3,
+,111,115,0,9,35,2,38,12,36,0,6,115,116,114,105,
+,103,0,0,12,37,0,7,95,95,110,101,119,95,95,0,
+,33,35,3,19,33,34,33,27,31,32,2,31,25,28,4,
+,25,27,25,12,28,0,5,84,111,107,101,110,0,0,0,
+,27,28,0,12,31,0,3,112,111,115,0,9,28,2,31,
+,29,0,4,110,97,109,101,0,0,0,0,12,30,0,4,
+,101,108,102,0,0,0,0,31,26,28,3,19,26,27,26,
+,24,25,2,31,19,21,4,19,19,20,19,31,17,19,1,
+,17,18,17,31,15,17,1,19,15,16,15,21,10,0,0,
+,0,0,77,12,18,0,7,103,101,116,95,116,109,112,0,
+,17,18,0,31,16,0,0,19,16,17,16,15,15,16,0,
+,19,0,10,95,100,111,95,115,116,114,105,110,103,0,0,
+,18,19,0,12,19,0,8,95,95,105,110,105,116,95,95,
+,0,0,0,31,17,19,1,19,17,18,17,15,16,17,0,
+,19,0,4,99,111,100,101,0,0,0,0,13,18,19,0,
+,23,0,3,71,69,84,0,13,19,23,0,15,20,15,0,
+,21,14,0,15,22,16,0,31,17,19,4,19,17,18,17,
+,20,0,7,103,101,116,95,116,109,112,0,13,19,20,0,
+,18,0,0,19,18,19,18,15,17,18,0,12,20,0,4,
+,111,100,101,0,0,0,0,13,19,20,0,12,24,0,4,
+,65,76,76,0,0,0,0,13,20,24,0,15,21,17,0,
+,22,15,0,15,23,12,0,31,18,20,4,19,18,19,18,
+,20,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,19,20,0,15,20,15,0,31,18,20,1,19,18,19,18,
+,20,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,19,20,0,15,20,16,0,31,18,20,1,19,18,19,18,
+,20,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,19,20,0,15,20,17,0,31,18,20,1,19,18,19,18,
+,0,0,1,12,20,0,4,99,111,100,101,0,0,0,0,
+,19,20,0,12,22,0,6,82,69,84,85,82,78,0,0,
+,20,22,0,15,21,14,0,31,18,20,2,19,18,19,18,
+,20,0,1,68,0,0,0,13,19,20,0,12,20,0,3,
+,110,100,0,9,19,19,20,31,18,0,0,19,18,19,18,
+,20,0,3,116,97,103,0,13,19,20,0,15,20,1,0,
+,21,0,3,101,110,100,0,31,18,20,2,19,18,19,18,
+,20,0,10,95,100,111,95,115,116,114,105,110,103,0,0,
+,19,20,0,12,20,0,8,95,95,99,97,108,108,95,95,
+,0,0,0,31,18,20,1,19,18,19,18,15,7,18,0,
+,20,0,4,99,111,100,101,0,0,0,0,13,19,20,0,
+,24,0,3,83,69,84,0,13,20,24,0,15,21,6,0,
+,22,7,0,15,23,11,0,31,18,20,4,19,18,19,18,
+,20,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,19,20,0,15,20,6,0,31,18,20,1,19,18,19,18,
+,20,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,19,20,0,15,20,7,0,31,18,20,1,19,18,19,18,
+,0,0,0,12,50,0,8,100,111,95,99,108,97,115,115,
+,0,0,0,14,50,49,0,16,50,0,123,44,10,0,0,
+,2,0,0,9,1,0,2,12,4,0,5,105,116,101,109,
+,0,0,0,9,3,1,4,15,2,3,0,12,5,0,9,
+,116,97,99,107,95,116,97,103,0,0,0,13,4,5,0,
+,3,0,0,19,3,4,3,15,1,3,0,12,5,0,3,
 ,97,103,0,13,4,5,0,15,5,1,0,12,6,0,5,
 ,101,103,105,110,0,0,0,31,3,5,2,19,3,4,3,
-,6,2,4,32,32,32,32,116,97,103,40,116,44,39,99,
-,110,116,105,110,117,101,39,41,0,0,0,12,5,0,3,
-,97,103,0,13,4,5,0,15,5,1,0,12,6,0,8,
-,111,110,116,105,110,117,101,0,0,0,0,31,3,5,2,
-,3,4,3,30,6,2,5,32,32,32,32,114,32,61,32,
-,111,40,105,116,101,109,115,91,48,93,41,0,0,0,0,
-,6,0,2,100,111,0,0,13,5,6,0,11,7,0,0,
-,0,0,0,0,0,0,0,9,6,2,7,31,4,6,1,
-,4,5,4,15,3,4,0,30,4,2,6,32,32,32,32,
-,111,100,101,40,73,70,44,114,41,0,0,12,6,0,4,
-,111,100,101,0,0,0,0,13,5,6,0,12,8,0,2,
-,70,0,0,13,6,8,0,15,7,3,0,31,4,6,2,
-,4,5,4,30,6,2,7,32,32,32,32,102,114,101,101,
-,116,109,112,40,114,41,32,35,82,69,71,0,0,0,0,
-,6,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
-,5,6,0,15,6,3,0,31,4,6,1,19,4,5,4,
-,5,2,8,32,32,32,32,106,117,109,112,40,116,44,39,
-,110,100,39,41,0,0,0,12,6,0,4,106,117,109,112,
+,5,0,3,116,97,103,0,13,4,5,0,15,5,1,0,
+,6,0,8,99,111,110,116,105,110,117,101,0,0,0,0,
+,3,5,2,19,3,4,3,12,6,0,2,100,111,0,0,
+,5,6,0,11,7,0,0,0,0,0,0,0,0,0,0,
+,6,2,7,31,4,6,1,19,4,5,4,15,3,4,0,
+,6,0,4,99,111,100,101,0,0,0,0,13,5,6,0,
+,8,0,2,73,70,0,0,13,6,8,0,15,7,3,0,
+,4,6,2,19,4,5,4,12,6,0,8,102,114,101,101,
+,116,109,112,0,0,0,0,13,5,6,0,15,6,3,0,
+,4,6,1,19,4,5,4,12,6,0,4,106,117,109,112,
 ,0,0,0,13,5,6,0,15,6,1,0,12,7,0,3,
-,110,100,0,31,4,6,2,19,4,5,4,30,8,2,9,
-,32,32,32,102,114,101,101,95,116,109,112,40,100,111,40,
-,116,101,109,115,91,49,93,41,41,32,35,82,69,71,0,
-,6,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
-,5,6,0,12,8,0,2,100,111,0,0,13,7,8,0,
-,9,0,0,0,0,0,0,0,0,240,63,9,8,2,9,
-,6,8,1,19,6,7,6,31,4,6,1,19,4,5,4,
-,5,2,10,32,32,32,32,106,117,109,112,40,116,44,39,
-,101,103,105,110,39,41,0,12,6,0,4,106,117,109,112,
-,0,0,0,13,5,6,0,15,6,1,0,12,7,0,5,
-,101,103,105,110,0,0,0,31,4,6,2,19,4,5,4,
-,5,2,11,32,32,32,32,116,97,103,40,116,44,39,98,
-,101,97,107,39,41,0,0,12,6,0,3,116,97,103,0,
-,5,6,0,15,6,1,0,12,7,0,5,98,114,101,97,
-,0,0,0,31,4,6,2,19,4,5,4,30,5,2,12,
-,32,32,32,116,97,103,40,116,44,39,101,110,100,39,41,
-,0,0,0,12,6,0,3,116,97,103,0,13,5,6,0,
-,6,1,0,12,7,0,3,101,110,100,0,31,4,6,2,
-,4,5,4,30,4,2,13,32,32,32,32,112,111,112,95,
-,97,103,40,41,0,0,0,12,6,0,7,112,111,112,95,
+,110,100,0,31,4,6,2,19,4,5,4,12,6,0,8,
+,114,101,101,95,116,109,112,0,0,0,0,13,5,6,0,
+,8,0,2,100,111,0,0,13,7,8,0,11,9,0,0,
+,0,0,0,0,0,240,63,9,8,2,9,31,6,8,1,
+,6,7,6,31,4,6,1,19,4,5,4,12,6,0,4,
+,117,109,112,0,0,0,0,13,5,6,0,15,6,1,0,
+,7,0,5,98,101,103,105,110,0,0,0,31,4,6,2,
+,4,5,4,12,6,0,3,116,97,103,0,13,5,6,0,
+,6,1,0,12,7,0,5,98,114,101,97,107,0,0,0,
+,4,6,2,19,4,5,4,12,6,0,3,116,97,103,0,
+,5,6,0,15,6,1,0,12,7,0,3,101,110,100,0,
+,4,6,2,19,4,5,4,12,6,0,7,112,111,112,95,
 ,97,103,0,13,5,6,0,31,4,0,0,19,4,5,4,
 ,0,0,0,12,51,0,8,100,111,95,119,104,105,108,101,
-,0,0,0,14,51,50,0,30,5,2,15,100,101,102,32,
-,111,95,102,111,114,40,116,111,107,41,58,0,0,0,0,
-,51,1,11,44,14,0,0,30,5,2,15,100,101,102,32,
-,111,95,102,111,114,40,116,111,107,41,58,0,0,0,0,
-,1,0,14,99,111,114,101,47,101,110,99,111,100,101,46,
-,121,0,0,33,1,0,0,12,1,0,6,100,111,95,102,
-,114,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,6,2,16,32,32,32,32,105,116,101,109,115,32,61,32,
-,111,107,46,105,116,101,109,115,0,0,0,12,4,0,5,
-,116,101,109,115,0,0,0,9,3,1,4,15,2,3,0,
-,8,2,18,32,32,32,32,114,101,103,32,61,32,100,111,
-,108,111,99,97,108,40,105,116,101,109,115,91,48,93,41,
-,0,0,0,12,6,0,8,100,111,95,108,111,99,97,108,
-,0,0,0,13,5,6,0,11,7,0,0,0,0,0,0,
-,0,0,0,9,6,2,7,31,4,6,1,19,4,5,4,
-,3,4,0,30,6,2,19,32,32,32,32,105,116,114,32,
-,32,100,111,40,105,116,101,109,115,91,49,93,41,0,0,
-,7,0,2,100,111,0,0,13,6,7,0,11,8,0,0,
-,0,0,0,0,0,240,63,9,7,2,8,31,5,7,1,
-,5,6,5,15,4,5,0,30,6,2,20,32,32,32,32,
-,32,61,32,95,100,111,95,110,117,109,98,101,114,40,39,
-,39,41,0,12,8,0,10,95,100,111,95,110,117,109,98,
+,0,0,0,14,51,50,0,16,51,0,156,44,14,0,0,
+,2,0,0,9,1,0,2,12,4,0,5,105,116,101,109,
+,0,0,0,9,3,1,4,15,2,3,0,12,6,0,8,
+,111,95,108,111,99,97,108,0,0,0,0,13,5,6,0,
+,7,0,0,0,0,0,0,0,0,0,0,9,6,2,7,
+,4,6,1,19,4,5,4,15,3,4,0,12,7,0,2,
+,111,0,0,13,6,7,0,11,8,0,0,0,0,0,0,
+,0,240,63,9,7,2,8,31,5,7,1,19,5,6,5,
+,4,5,0,12,8,0,10,95,100,111,95,110,117,109,98,
 ,114,0,0,13,7,8,0,12,8,0,1,48,0,0,0,
-,6,8,1,19,6,7,6,15,5,6,0,30,14,2,22,
-,32,32,32,116,32,61,32,115,116,97,99,107,95,116,97,
-,40,41,59,32,116,97,103,40,116,44,39,108,111,111,112,
-,41,59,32,116,97,103,40,116,44,39,99,111,110,116,105,
-,117,101,39,41,0,0,0,12,9,0,9,115,116,97,99,
-,95,116,97,103,0,0,0,13,8,9,0,31,7,0,0,
-,7,8,7,15,6,7,0,12,9,0,3,116,97,103,0,
-,8,9,0,15,9,6,0,12,10,0,4,108,111,111,112,
-,0,0,0,31,7,9,2,19,7,8,7,12,9,0,3,
-,97,103,0,13,8,9,0,15,9,6,0,12,10,0,8,
-,111,110,116,105,110,117,101,0,0,0,0,31,7,9,2,
-,7,8,7,30,10,2,23,32,32,32,32,99,111,100,101,
-,73,84,69,82,44,114,101,103,44,105,116,114,44,105,41,
-,32,106,117,109,112,40,116,44,39,101,110,100,39,41,0,
-,9,0,4,99,111,100,101,0,0,0,0,13,8,9,0,
-,13,0,4,73,84,69,82,0,0,0,0,13,9,13,0,
-,10,3,0,15,11,4,0,15,12,5,0,31,7,9,4,
-,7,8,7,12,9,0,4,106,117,109,112,0,0,0,0,
-,8,9,0,15,9,6,0,12,10,0,3,101,110,100,0,
-,7,9,2,19,7,8,7,30,8,2,24,32,32,32,32,
-,114,101,101,95,116,109,112,40,100,111,40,105,116,101,109,
-,91,50,93,41,41,32,35,82,69,71,0,12,9,0,8,
-,114,101,101,95,116,109,112,0,0,0,0,13,8,9,0,
-,11,0,2,100,111,0,0,13,10,11,0,11,12,0,0,
-,0,0,0,0,0,0,64,9,11,2,12,31,9,11,1,
-,9,10,9,31,7,9,1,19,7,8,7,30,5,2,25,
-,32,32,32,106,117,109,112,40,116,44,39,108,111,111,112,
-,41,0,0,12,9,0,4,106,117,109,112,0,0,0,0,
-,8,9,0,15,9,6,0,12,10,0,4,108,111,111,112,
-,0,0,0,31,7,9,2,19,7,8,7,30,11,2,26,
-,32,32,32,116,97,103,40,116,44,39,98,114,101,97,107,
-,41,59,32,116,97,103,40,116,44,39,101,110,100,39,41,
-,32,112,111,112,95,116,97,103,40,41,0,12,9,0,3,
-,97,103,0,13,8,9,0,15,9,6,0,12,10,0,5,
-,114,101,97,107,0,0,0,31,7,9,2,19,7,8,7,
+,6,8,1,19,6,7,6,15,5,6,0,12,9,0,9,
+,116,97,99,107,95,116,97,103,0,0,0,13,8,9,0,
+,7,0,0,19,7,8,7,15,6,7,0,12,9,0,3,
+,97,103,0,13,8,9,0,15,9,6,0,12,10,0,4,
+,111,111,112,0,0,0,0,31,7,9,2,19,7,8,7,
 ,9,0,3,116,97,103,0,13,8,9,0,15,9,6,0,
+,10,0,8,99,111,110,116,105,110,117,101,0,0,0,0,
+,7,9,2,19,7,8,7,12,9,0,4,99,111,100,101,
+,0,0,0,13,8,9,0,12,13,0,4,73,84,69,82,
+,0,0,0,13,9,13,0,15,10,3,0,15,11,4,0,
+,12,5,0,31,7,9,4,19,7,8,7,12,9,0,4,
+,117,109,112,0,0,0,0,13,8,9,0,15,9,6,0,
 ,10,0,3,101,110,100,0,31,7,9,2,19,7,8,7,
-,9,0,7,112,111,112,95,116,97,103,0,13,8,9,0,
-,7,0,0,19,7,8,7,30,6,2,28,32,32,32,32,
-,114,101,101,95,116,109,112,40,105,116,114,41,32,35,82,
-,71,0,0,12,9,0,8,102,114,101,101,95,116,109,112,
+,9,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,8,9,0,12,11,0,2,100,111,0,0,13,10,11,0,
+,12,0,0,0,0,0,0,0,0,0,64,9,11,2,12,
+,9,11,1,19,9,10,9,31,7,9,1,19,7,8,7,
+,9,0,4,106,117,109,112,0,0,0,0,13,8,9,0,
+,9,6,0,12,10,0,4,108,111,111,112,0,0,0,0,
+,7,9,2,19,7,8,7,12,9,0,3,116,97,103,0,
+,8,9,0,15,9,6,0,12,10,0,5,98,114,101,97,
+,0,0,0,31,7,9,2,19,7,8,7,12,9,0,3,
+,97,103,0,13,8,9,0,15,9,6,0,12,10,0,3,
+,110,100,0,31,7,9,2,19,7,8,7,12,9,0,7,
+,111,112,95,116,97,103,0,13,8,9,0,31,7,0,0,
+,7,8,7,12,9,0,8,102,114,101,101,95,116,109,112,
 ,0,0,0,13,8,9,0,15,9,4,0,31,7,9,1,
-,7,8,7,30,4,2,29,32,32,32,32,102,114,101,101,
-,116,109,112,40,105,41,0,12,9,0,8,102,114,101,101,
-,116,109,112,0,0,0,0,13,8,9,0,15,9,5,0,
-,7,9,1,19,7,8,7,0,0,0,0,12,52,0,6,
-,111,95,102,111,114,0,0,14,52,51,0,30,6,2,31,
-,101,102,32,100,111,95,99,111,109,112,40,116,44,114,61,
-,111,110,101,41,58,0,0,16,52,1,15,44,18,0,0,
-,6,2,31,100,101,102,32,100,111,95,99,111,109,112,40,
-,44,114,61,78,111,110,101,41,58,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,7,100,111,95,99,111,109,112,0,
-,1,0,0,28,2,0,0,9,1,0,2,28,2,0,0,
-,3,0,0,32,2,0,3,30,8,2,32,32,32,32,32,
-,97,109,101,32,61,32,39,99,111,109,112,58,39,43,103,
-,116,95,116,97,103,40,41,0,0,0,0,12,4,0,5,
-,111,109,112,58,0,0,0,12,7,0,7,103,101,116,95,
-,97,103,0,13,6,7,0,31,5,0,0,19,5,6,5,
-,4,4,5,15,3,4,0,30,11,2,33,32,32,32,32,
-,32,61,32,100,111,95,108,111,99,97,108,40,84,111,107,
-,110,40,116,46,112,111,115,44,39,110,97,109,101,39,44,
-,97,109,101,41,41,0,0,12,6,0,8,100,111,95,108,
-,99,97,108,0,0,0,0,13,5,6,0,12,8,0,5,
-,111,107,101,110,0,0,0,13,7,8,0,12,11,0,3,
-,111,115,0,9,8,1,11,12,9,0,4,110,97,109,101,
-,0,0,0,15,10,3,0,31,6,8,3,19,6,7,6,
-,4,6,1,19,4,5,4,15,2,4,0,30,6,2,34,
-,32,32,32,99,111,100,101,40,76,73,83,84,44,114,44,
-,44,48,41,0,0,0,0,12,6,0,4,99,111,100,101,
-,0,0,0,13,5,6,0,12,10,0,4,76,73,83,84,
-,0,0,0,13,6,10,0,15,7,2,0,11,8,0,0,
-,0,0,0,0,0,0,0,11,9,0,0,0,0,0,0,
-,0,0,0,31,4,6,4,19,4,5,4,30,9,2,35,
-,32,32,32,107,101,121,32,61,32,84,111,107,101,110,40,
-,46,112,111,115,44,39,103,101,116,39,44,78,111,110,101,
-,91,0,0,12,7,0,5,84,111,107,101,110,0,0,0,
-,6,7,0,12,11,0,3,112,111,115,0,9,7,1,11,
-,8,0,3,103,101,116,0,28,9,0,0,30,9,2,36,
-,32,32,32,32,32,32,32,32,32,32,32,84,111,107,101,
-,40,116,46,112,111,115,44,39,114,101,103,39,44,114,41,
-,0,0,0,12,14,0,5,84,111,107,101,110,0,0,0,
-,13,14,0,12,17,0,3,112,111,115,0,9,14,1,17,
-,15,0,3,114,101,103,0,15,16,2,0,31,11,14,3,
-,11,13,11,30,11,2,37,32,32,32,32,32,32,32,32,
-,32,32,32,84,111,107,101,110,40,116,46,112,111,115,44,
-,115,121,109,98,111,108,39,44,39,78,111,110,101,39,41,
-,41,0,0,12,14,0,5,84,111,107,101,110,0,0,0,
-,13,14,0,12,17,0,3,112,111,115,0,9,14,1,17,
-,15,0,6,115,121,109,98,111,108,0,0,12,16,0,4,
-,111,110,101,0,0,0,0,31,12,14,3,19,12,13,12,
-,10,11,2,31,5,7,4,19,5,6,5,15,4,5,0,
-,13,2,38,32,32,32,32,97,112,32,61,32,84,111,107,
-,110,40,116,46,112,111,115,44,39,115,121,109,98,111,108,
-,44,39,61,39,44,91,107,101,121,44,116,46,105,116,101,
-,115,91,48,93,93,41,0,12,8,0,5,84,111,107,101,
-,0,0,0,13,7,8,0,12,12,0,3,112,111,115,0,
-,8,1,12,12,9,0,6,115,121,109,98,111,108,0,0,
-,10,0,1,61,0,0,0,15,12,4,0,12,14,0,5,
-,116,101,109,115,0,0,0,9,13,1,14,11,14,0,0,
-,0,0,0,0,0,0,0,9,13,13,14,27,11,12,2,
-,6,8,4,19,6,7,6,15,5,6,0,30,15,2,39,
-,32,32,32,100,111,40,84,111,107,101,110,40,116,46,112,
-,115,44,39,102,111,114,39,44,78,111,110,101,44,91,116,
-,105,116,101,109,115,91,49,93,44,116,46,105,116,101,109,
-,91,50,93,44,97,112,93,41,41,0,0,12,8,0,2,
-,111,0,0,13,7,8,0,12,10,0,5,84,111,107,101,
-,0,0,0,13,9,10,0,12,14,0,3,112,111,115,0,
-,10,1,14,12,11,0,3,102,111,114,0,28,12,0,0,
-,17,0,5,105,116,101,109,115,0,0,0,9,14,1,17,
-,17,0,0,0,0,0,0,0,0,240,63,9,14,14,17,
-,17,0,5,105,116,101,109,115,0,0,0,9,15,1,17,
-,17,0,0,0,0,0,0,0,0,0,64,9,15,15,17,
-,16,5,0,27,13,14,3,31,8,10,4,19,8,9,8,
-,6,8,1,19,6,7,6,30,4,2,40,32,32,32,32,
-,101,116,117,114,110,32,114,0,0,0,0,20,2,0,0,
+,7,8,7,12,9,0,8,102,114,101,101,95,116,109,112,
+,0,0,0,13,8,9,0,15,9,5,0,31,7,9,1,
+,7,8,7,0,0,0,0,12,52,0,6,100,111,95,102,
+,114,0,0,14,52,51,0,16,52,0,159,44,18,0,0,
+,2,0,0,9,1,0,2,28,2,0,0,28,3,0,0,
+,2,0,3,12,4,0,5,99,111,109,112,58,0,0,0,
+,7,0,7,103,101,116,95,116,97,103,0,13,6,7,0,
+,5,0,0,19,5,6,5,1,4,4,5,15,3,4,0,
+,6,0,8,100,111,95,108,111,99,97,108,0,0,0,0,
+,5,6,0,12,8,0,5,84,111,107,101,110,0,0,0,
+,7,8,0,12,11,0,3,112,111,115,0,9,8,1,11,
+,9,0,4,110,97,109,101,0,0,0,0,15,10,3,0,
+,6,8,3,19,6,7,6,31,4,6,1,19,4,5,4,
+,2,4,0,12,6,0,4,99,111,100,101,0,0,0,0,
+,5,6,0,12,10,0,4,76,73,83,84,0,0,0,0,
+,6,10,0,15,7,2,0,11,8,0,0,0,0,0,0,
+,0,0,0,11,9,0,0,0,0,0,0,0,0,0,0,
+,4,6,4,19,4,5,4,12,7,0,5,84,111,107,101,
+,0,0,0,13,6,7,0,12,11,0,3,112,111,115,0,
+,7,1,11,12,8,0,3,103,101,116,0,28,9,0,0,
+,14,0,5,84,111,107,101,110,0,0,0,13,13,14,0,
+,17,0,3,112,111,115,0,9,14,1,17,12,15,0,3,
+,101,103,0,15,16,2,0,31,11,14,3,19,11,13,11,
+,14,0,5,84,111,107,101,110,0,0,0,13,13,14,0,
+,17,0,3,112,111,115,0,9,14,1,17,12,15,0,6,
+,121,109,98,111,108,0,0,12,16,0,4,78,111,110,101,
+,0,0,0,31,12,14,3,19,12,13,12,27,10,11,2,
+,5,7,4,19,5,6,5,15,4,5,0,12,8,0,5,
+,111,107,101,110,0,0,0,13,7,8,0,12,12,0,3,
+,111,115,0,9,8,1,12,12,9,0,6,115,121,109,98,
+,108,0,0,12,10,0,1,61,0,0,0,15,12,4,0,
+,14,0,5,105,116,101,109,115,0,0,0,9,13,1,14,
+,14,0,0,0,0,0,0,0,0,0,0,9,13,13,14,
+,11,12,2,31,6,8,4,19,6,7,6,15,5,6,0,
+,8,0,2,100,111,0,0,13,7,8,0,12,10,0,5,
+,111,107,101,110,0,0,0,13,9,10,0,12,14,0,3,
+,111,115,0,9,10,1,14,12,11,0,3,102,111,114,0,
+,12,0,0,12,17,0,5,105,116,101,109,115,0,0,0,
+,14,1,17,11,17,0,0,0,0,0,0,0,0,240,63,
+,14,14,17,12,17,0,5,105,116,101,109,115,0,0,0,
+,15,1,17,11,17,0,0,0,0,0,0,0,0,0,64,
+,15,15,17,15,16,5,0,27,13,14,3,31,8,10,4,
+,8,9,8,31,6,8,1,19,6,7,6,20,2,0,0,
 ,0,0,0,12,53,0,7,100,111,95,99,111,109,112,0,
-,53,52,0,30,4,2,42,100,101,102,32,100,111,95,105,
-,40,116,41,58,0,0,0,16,53,1,53,44,13,0,0,
-,4,2,42,100,101,102,32,100,111,95,105,102,40,116,41,
-,0,0,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,5,
-,111,95,105,102,0,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,30,5,2,43,32,32,32,32,105,116,101,109,
-,32,61,32,116,46,105,116,101,109,115,0,12,4,0,5,
-,116,101,109,115,0,0,0,9,3,1,4,15,2,3,0,
-,5,2,44,32,32,32,32,116,32,61,32,103,101,116,95,
-,97,103,40,41,0,0,0,12,5,0,7,103,101,116,95,
+,53,52,0,16,53,0,171,44,13,0,0,28,2,0,0,
+,1,0,2,12,4,0,5,105,116,101,109,115,0,0,0,
+,3,1,4,15,2,3,0,12,5,0,7,103,101,116,95,
 ,97,103,0,13,4,5,0,31,3,0,0,19,3,4,3,
-,1,3,0,30,3,2,45,32,32,32,32,110,32,61,32,
-,0,0,0,11,4,0,0,0,0,0,0,0,0,0,0,
-,3,4,0,30,6,2,46,32,32,32,32,102,111,114,32,
-,116,32,105,110,32,105,116,101,109,115,58,0,0,0,0,
-,5,0,0,0,0,0,0,0,0,0,0,42,4,2,5,
-,0,0,220,30,5,2,47,32,32,32,32,32,32,32,32,
-,97,103,40,116,44,110,41,0,0,0,0,12,8,0,3,
-,97,103,0,13,7,8,0,15,8,1,0,15,9,3,0,
-,6,8,2,19,6,7,6,30,8,2,48,32,32,32,32,
-,32,32,32,105,102,32,116,116,46,116,121,112,101,32,61,
-,32,39,101,108,105,102,39,58,0,0,0,12,7,0,4,
-,121,112,101,0,0,0,0,9,6,4,7,12,7,0,4,
-,108,105,102,0,0,0,0,23,6,6,7,21,6,0,0,
-,0,0,100,30,15,2,49,32,32,32,32,32,32,32,32,
-,32,32,32,97,32,61,32,100,111,40,116,116,46,105,116,
-,109,115,91,48,93,41,59,32,99,111,100,101,40,73,70,
-,97,41,59,32,102,114,101,101,95,116,109,112,40,97,41,
-,0,0,0,12,9,0,2,100,111,0,0,13,8,9,0,
-,10,0,5,105,116,101,109,115,0,0,0,9,9,4,10,
-,10,0,0,0,0,0,0,0,0,0,0,9,9,9,10,
-,7,9,1,19,7,8,7,15,6,7,0,12,9,0,4,
-,111,100,101,0,0,0,0,13,8,9,0,12,11,0,2,
-,70,0,0,13,9,11,0,15,10,6,0,31,7,9,2,
-,7,8,7,12,9,0,8,102,114,101,101,95,116,109,112,
-,0,0,0,13,8,9,0,15,9,6,0,31,7,9,1,
-,7,8,7,30,6,2,50,32,32,32,32,32,32,32,32,
-,32,32,32,106,117,109,112,40,116,44,110,43,49,41,0,
-,9,0,4,106,117,109,112,0,0,0,0,13,8,9,0,
-,9,1,0,11,11,0,0,0,0,0,0,0,0,240,63,
-,10,3,11,31,7,9,2,19,7,8,7,30,11,2,51,
-,32,32,32,32,32,32,32,32,32,32,32,102,114,101,101,
-,116,109,112,40,100,111,40,116,116,46,105,116,101,109,115,
-,49,93,41,41,32,35,82,69,71,0,0,12,9,0,8,
+,1,3,0,11,4,0,0,0,0,0,0,0,0,0,0,
+,3,4,0,11,5,0,0,0,0,0,0,0,0,0,0,
+,4,2,5,18,0,0,131,12,8,0,3,116,97,103,0,
+,7,8,0,15,8,1,0,15,9,3,0,31,6,8,2,
+,6,7,6,12,7,0,4,116,121,112,101,0,0,0,0,
+,6,4,7,12,7,0,4,101,108,105,102,0,0,0,0,
+,6,6,7,21,6,0,0,18,0,0,65,12,9,0,2,
+,111,0,0,13,8,9,0,12,10,0,5,105,116,101,109,
+,0,0,0,9,9,4,10,11,10,0,0,0,0,0,0,
+,0,0,0,9,9,9,10,31,7,9,1,19,7,8,7,
+,6,7,0,12,9,0,4,99,111,100,101,0,0,0,0,
+,8,9,0,12,11,0,2,73,70,0,0,13,9,11,0,
+,10,6,0,31,7,9,2,19,7,8,7,12,9,0,8,
 ,114,101,101,95,116,109,112,0,0,0,0,13,8,9,0,
-,11,0,2,100,111,0,0,13,10,11,0,12,12,0,5,
-,116,101,109,115,0,0,0,9,11,4,12,11,12,0,0,
-,0,0,0,0,0,240,63,9,11,11,12,31,9,11,1,
-,9,10,9,31,7,9,1,19,7,8,7,18,0,0,62,
-,8,2,52,32,32,32,32,32,32,32,32,101,108,105,102,
-,116,116,46,116,121,112,101,32,61,61,32,39,101,108,115,
-,39,58,0,12,8,0,4,116,121,112,101,0,0,0,0,
-,7,4,8,12,8,0,4,101,108,115,101,0,0,0,0,
-,7,7,8,21,7,0,0,18,0,0,34,30,11,2,53,
-,32,32,32,32,32,32,32,32,32,32,32,102,114,101,101,
-,116,109,112,40,100,111,40,116,116,46,105,116,101,109,115,
-,48,93,41,41,32,35,82,69,71,0,0,12,9,0,8,
-,114,101,101,95,116,109,112,0,0,0,0,13,8,9,0,
-,11,0,2,100,111,0,0,13,10,11,0,12,12,0,5,
-,116,101,109,115,0,0,0,9,11,4,12,11,12,0,0,
-,0,0,0,0,0,0,0,9,11,11,12,31,9,11,1,
-,9,10,9,31,7,9,1,19,7,8,7,18,0,0,10,
-,5,2,55,32,32,32,32,32,32,32,32,32,32,32,32,
-,97,105,115,101,0,0,0,28,7,0,0,37,7,0,0,
-,0,0,1,30,6,2,56,32,32,32,32,32,32,32,32,
-,117,109,112,40,116,44,39,101,110,100,39,41,0,0,0,
-,9,0,4,106,117,109,112,0,0,0,0,13,8,9,0,
-,9,1,0,12,10,0,3,101,110,100,0,31,7,9,2,
-,7,8,7,30,4,2,57,32,32,32,32,32,32,32,32,
-,32,43,61,32,49,0,0,11,8,0,0,0,0,0,0,
-,0,240,63,1,7,3,8,15,3,7,0,18,0,255,36,
-,4,2,58,32,32,32,32,116,97,103,40,116,44,110,41,
-,0,0,0,12,8,0,3,116,97,103,0,13,7,8,0,
-,8,1,0,15,9,3,0,31,5,8,2,19,5,7,5,
-,5,2,59,32,32,32,32,116,97,103,40,116,44,39,101,
-,100,39,41,0,0,0,0,12,8,0,3,116,97,103,0,
-,7,8,0,15,8,1,0,12,9,0,3,101,110,100,0,
-,5,8,2,19,5,7,5,0,0,0,0,12,54,0,5,
-,111,95,105,102,0,0,0,14,54,53,0,30,4,2,61,
-,101,102,32,100,111,95,116,114,121,40,116,41,58,0,0,
-,54,0,185,44,9,0,0,30,4,2,61,100,101,102,32,
-,111,95,116,114,121,40,116,41,58,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,6,100,111,95,116,114,121,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,30,5,2,62,
-,32,32,32,105,116,101,109,115,32,61,32,116,46,105,116,
-,109,115,0,12,4,0,5,105,116,101,109,115,0,0,0,
-,3,1,4,15,2,3,0,30,5,2,63,32,32,32,32,
-,32,61,32,103,101,116,95,116,97,103,40,41,0,0,0,
-,5,0,7,103,101,116,95,116,97,103,0,13,4,5,0,
-,3,0,0,19,3,4,3,15,1,3,0,30,6,2,64,
-,32,32,32,115,101,116,106,109,112,40,116,44,39,101,120,
-,101,112,116,39,41,0,0,12,5,0,6,115,101,116,106,
-,112,0,0,13,4,5,0,15,5,1,0,12,6,0,6,
-,120,99,101,112,116,0,0,31,3,5,2,19,3,4,3,
-,8,2,65,32,32,32,32,102,114,101,101,95,116,109,112,
-,100,111,40,105,116,101,109,115,91,48,93,41,41,32,35,
-,69,71,0,12,5,0,8,102,114,101,101,95,116,109,112,
-,0,0,0,13,4,5,0,12,7,0,2,100,111,0,0,
-,6,7,0,11,8,0,0,0,0,0,0,0,0,0,0,
-,7,2,8,31,5,7,1,19,5,6,5,31,3,5,1,
-,3,4,3,30,5,2,66,32,32,32,32,99,111,100,101,
-,83,69,84,74,77,80,44,48,41,0,0,12,5,0,4,
-,111,100,101,0,0,0,0,13,4,5,0,12,7,0,6,
-,69,84,74,77,80,0,0,13,5,7,0,11,6,0,0,
-,0,0,0,0,0,0,0,31,3,5,2,19,3,4,3,
-,5,2,67,32,32,32,32,106,117,109,112,40,116,44,39,
-,110,100,39,41,0,0,0,12,5,0,4,106,117,109,112,
-,0,0,0,13,4,5,0,15,5,1,0,12,6,0,3,
-,110,100,0,31,3,5,2,19,3,4,3,30,5,2,68,
-,32,32,32,116,97,103,40,116,44,39,101,120,99,101,112,
-,39,41,0,12,5,0,3,116,97,103,0,13,4,5,0,
+,9,6,0,31,7,9,1,19,7,8,7,12,9,0,4,
+,117,109,112,0,0,0,0,13,8,9,0,15,9,1,0,
+,11,0,0,0,0,0,0,0,0,240,63,1,10,3,11,
+,7,9,2,19,7,8,7,12,9,0,8,102,114,101,101,
+,116,109,112,0,0,0,0,13,8,9,0,12,11,0,2,
+,111,0,0,13,10,11,0,12,12,0,5,105,116,101,109,
+,0,0,0,9,11,4,12,11,12,0,0,0,0,0,0,
+,0,240,63,9,11,11,12,31,9,11,1,19,9,10,9,
+,7,9,1,19,7,8,7,18,0,0,35,12,8,0,4,
+,121,112,101,0,0,0,0,9,7,4,8,12,8,0,4,
+,108,115,101,0,0,0,0,23,7,7,8,21,7,0,0,
+,0,0,22,12,9,0,8,102,114,101,101,95,116,109,112,
+,0,0,0,13,8,9,0,12,11,0,2,100,111,0,0,
+,10,11,0,12,12,0,5,105,116,101,109,115,0,0,0,
+,11,4,12,11,12,0,0,0,0,0,0,0,0,0,0,
+,11,11,12,31,9,11,1,19,9,10,9,31,7,9,1,
+,7,8,7,18,0,0,4,28,7,0,0,37,7,0,0,
+,0,0,1,12,9,0,4,106,117,109,112,0,0,0,0,
+,8,9,0,15,9,1,0,12,10,0,3,101,110,100,0,
+,7,9,2,19,7,8,7,11,8,0,0,0,0,0,0,
+,0,240,63,1,7,3,8,15,3,7,0,18,0,255,125,
+,8,0,3,116,97,103,0,13,7,8,0,15,8,1,0,
+,9,3,0,31,5,8,2,19,5,7,5,12,8,0,3,
+,97,103,0,13,7,8,0,15,8,1,0,12,9,0,3,
+,110,100,0,31,5,8,2,19,5,7,5,0,0,0,0,
+,54,0,5,100,111,95,105,102,0,0,0,14,54,53,0,
+,54,0,93,44,9,0,0,28,2,0,0,9,1,0,2,
+,4,0,5,105,116,101,109,115,0,0,0,9,3,1,4,
+,2,3,0,12,5,0,7,103,101,116,95,116,97,103,0,
+,4,5,0,31,3,0,0,19,3,4,3,15,1,3,0,
+,5,0,6,115,101,116,106,109,112,0,0,13,4,5,0,
 ,5,1,0,12,6,0,6,101,120,99,101,112,116,0,0,
-,3,5,2,19,3,4,3,30,11,2,69,32,32,32,32,
-,114,101,101,95,116,109,112,40,100,111,40,105,116,101,109,
-,91,49,93,46,105,116,101,109,115,91,49,93,41,41,32,
-,82,69,71,0,0,0,0,12,5,0,8,102,114,101,101,
+,3,5,2,19,3,4,3,12,5,0,8,102,114,101,101,
 ,116,109,112,0,0,0,0,13,4,5,0,12,7,0,2,
 ,111,0,0,13,6,7,0,11,8,0,0,0,0,0,0,
-,0,240,63,9,7,2,8,12,8,0,5,105,116,101,109,
-,0,0,0,9,7,7,8,11,8,0,0,0,0,0,0,
-,0,240,63,9,7,7,8,31,5,7,1,19,5,6,5,
-,3,5,1,19,3,4,3,30,5,2,70,32,32,32,32,
-,97,103,40,116,44,39,101,110,100,39,41,0,0,0,0,
+,0,0,0,9,7,2,8,31,5,7,1,19,5,6,5,
+,3,5,1,19,3,4,3,12,5,0,4,106,117,109,112,
+,0,0,0,13,4,5,0,15,5,1,0,12,6,0,3,
+,110,100,0,31,3,5,2,19,3,4,3,12,5,0,3,
+,97,103,0,13,4,5,0,15,5,1,0,12,6,0,6,
+,120,99,101,112,116,0,0,31,3,5,2,19,3,4,3,
+,5,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,4,5,0,12,7,0,2,100,111,0,0,13,6,7,0,
+,8,0,0,0,0,0,0,0,0,240,63,9,7,2,8,
+,8,0,5,105,116,101,109,115,0,0,0,9,7,7,8,
+,8,0,0,0,0,0,0,0,0,240,63,9,7,7,8,
+,5,7,1,19,5,6,5,31,3,5,1,19,3,4,3,
 ,5,0,3,116,97,103,0,13,4,5,0,15,5,1,0,
 ,6,0,3,101,110,100,0,31,3,5,2,19,3,4,3,
 ,0,0,0,12,55,0,6,100,111,95,116,114,121,0,0,
-,55,54,0,30,5,2,72,100,101,102,32,100,111,95,114,
-,116,117,114,110,40,116,41,58,0,0,0,16,55,0,106,
-,8,0,0,30,5,2,72,100,101,102,32,100,111,95,114,
-,116,117,114,110,40,116,41,58,0,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,9,100,111,95,114,101,116,117,114,
-,0,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,9,2,73,32,32,32,32,105,102,32,116,46,105,116,101,
-,115,58,32,114,32,61,32,100,111,40,116,46,105,116,101,
-,115,91,48,93,41,0,0,12,3,0,5,105,116,101,109,
+,55,54,0,16,55,0,56,44,8,0,0,28,2,0,0,
+,1,0,2,12,3,0,5,105,116,101,109,115,0,0,0,
+,2,1,3,21,2,0,0,18,0,0,16,12,5,0,2,
+,111,0,0,13,4,5,0,12,6,0,5,105,116,101,109,
+,0,0,0,9,5,1,6,11,6,0,0,0,0,0,0,
+,0,0,0,9,5,5,6,31,3,5,1,19,3,4,3,
+,2,3,0,18,0,0,10,12,5,0,8,95,100,111,95,
+,111,110,101,0,0,0,0,13,4,5,0,31,3,0,0,
+,3,4,3,15,2,3,0,18,0,0,1,12,5,0,4,
+,111,100,101,0,0,0,0,13,4,5,0,12,7,0,6,
+,69,84,85,82,78,0,0,13,5,7,0,15,6,2,0,
+,3,5,2,19,3,4,3,12,5,0,8,102,114,101,101,
+,116,109,112,0,0,0,0,13,4,5,0,15,5,2,0,
+,3,5,1,19,3,4,3,28,3,0,0,20,3,0,0,
+,0,0,0,12,56,0,9,100,111,95,114,101,116,117,114,
+,0,0,0,14,56,55,0,16,56,0,56,44,8,0,0,
+,2,0,0,9,1,0,2,12,3,0,5,105,116,101,109,
 ,0,0,0,9,2,1,3,21,2,0,0,18,0,0,16,
 ,5,0,2,100,111,0,0,13,4,5,0,12,6,0,5,
 ,116,101,109,115,0,0,0,9,5,1,6,11,6,0,0,
 ,0,0,0,0,0,0,0,9,5,5,6,31,3,5,1,
-,3,4,3,15,2,3,0,18,0,0,18,30,7,2,74,
-,32,32,32,101,108,115,101,58,32,114,32,61,32,95,100,
-,95,110,111,110,101,40,41,0,0,0,0,12,5,0,8,
+,3,4,3,15,2,3,0,18,0,0,10,12,5,0,8,
 ,100,111,95,110,111,110,101,0,0,0,0,13,4,5,0,
 ,3,0,0,19,3,4,3,15,2,3,0,18,0,0,1,
-,5,2,75,32,32,32,32,99,111,100,101,40,82,69,84,
-,82,78,44,114,41,0,0,12,5,0,4,99,111,100,101,
-,0,0,0,13,4,5,0,12,7,0,6,82,69,84,85,
-,78,0,0,13,5,7,0,15,6,2,0,31,3,5,2,
-,3,4,3,30,4,2,76,32,32,32,32,102,114,101,101,
-,116,109,112,40,114,41,0,12,5,0,8,102,114,101,101,
-,116,109,112,0,0,0,0,13,4,5,0,15,5,2,0,
-,3,5,1,19,3,4,3,30,3,2,77,32,32,32,32,
-,101,116,117,114,110,0,0,28,3,0,0,20,3,0,0,
-,0,0,0,12,56,0,9,100,111,95,114,101,116,117,114,
-,0,0,0,14,56,55,0,30,5,2,78,100,101,102,32,
-,111,95,114,97,105,115,101,40,116,41,58,0,0,0,0,
-,56,0,106,44,8,0,0,30,5,2,78,100,101,102,32,
-,111,95,114,97,105,115,101,40,116,41,58,0,0,0,0,
-,1,0,14,99,111,114,101,47,101,110,99,111,100,101,46,
-,121,0,0,33,1,0,0,12,1,0,8,100,111,95,114,
-,105,115,101,0,0,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,30,9,2,79,32,32,32,32,105,102,32,116,
-,105,116,101,109,115,58,32,114,32,61,32,100,111,40,116,
-,105,116,101,109,115,91,48,93,41,0,0,12,3,0,5,
-,116,101,109,115,0,0,0,9,2,1,3,21,2,0,0,
-,0,0,16,12,5,0,2,100,111,0,0,13,4,5,0,
-,6,0,5,105,116,101,109,115,0,0,0,9,5,1,6,
-,6,0,0,0,0,0,0,0,0,0,0,9,5,5,6,
-,3,5,1,19,3,4,3,15,2,3,0,18,0,0,18,
-,7,2,80,32,32,32,32,101,108,115,101,58,32,114,32,
-,32,95,100,111,95,110,111,110,101,40,41,0,0,0,0,
-,5,0,8,95,100,111,95,110,111,110,101,0,0,0,0,
-,4,5,0,31,3,0,0,19,3,4,3,15,2,3,0,
-,0,0,1,30,5,2,81,32,32,32,32,99,111,100,101,
-,82,65,73,83,69,44,114,41,0,0,0,12,5,0,4,
-,111,100,101,0,0,0,0,13,4,5,0,12,7,0,5,
-,65,73,83,69,0,0,0,13,5,7,0,15,6,2,0,
-,3,5,2,19,3,4,3,30,4,2,82,32,32,32,32,
-,114,101,101,95,116,109,112,40,114,41,0,12,5,0,8,
+,5,0,4,99,111,100,101,0,0,0,0,13,4,5,0,
+,7,0,5,82,65,73,83,69,0,0,0,13,5,7,0,
+,6,2,0,31,3,5,2,19,3,4,3,12,5,0,8,
 ,114,101,101,95,116,109,112,0,0,0,0,13,4,5,0,
-,5,2,0,31,3,5,1,19,3,4,3,30,3,2,83,
-,32,32,32,114,101,116,117,114,110,0,0,28,3,0,0,
+,5,2,0,31,3,5,1,19,3,4,3,28,3,0,0,
 ,3,0,0,0,0,0,0,12,57,0,8,100,111,95,114,
-,105,115,101,0,0,0,0,14,57,56,0,30,6,2,85,
-,101,102,32,100,111,95,115,116,97,116,101,109,101,110,116,
-,40,116,41,58,0,0,0,16,57,0,58,44,10,0,0,
-,6,2,85,100,101,102,32,100,111,95,115,116,97,116,101,
-,101,110,116,115,40,116,41,58,0,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,13,100,111,95,115,116,97,116,101,
-,101,110,116,115,0,0,0,34,1,0,0,28,2,0,0,
-,1,0,2,30,10,2,86,32,32,32,32,102,111,114,32,
-,116,32,105,110,32,116,46,105,116,101,109,115,58,32,102,
-,101,101,95,116,109,112,40,100,111,40,116,116,41,41,0,
-,4,0,5,105,116,101,109,115,0,0,0,9,3,1,4,
-,4,0,0,0,0,0,0,0,0,0,0,42,2,3,4,
-,0,0,15,12,7,0,8,102,114,101,101,95,116,109,112,
-,0,0,0,13,6,7,0,12,9,0,2,100,111,0,0,
-,8,9,0,15,9,2,0,31,7,9,1,19,7,8,7,
-,5,7,1,19,5,6,5,18,0,255,241,0,0,0,0,
-,58,0,13,100,111,95,115,116,97,116,101,109,101,110,116,
-,0,0,0,14,58,57,0,30,6,2,88,100,101,102,32,
-,111,95,108,105,115,116,40,116,44,114,61,78,111,110,101,
-,58,0,0,16,58,0,70,44,9,0,0,30,6,2,88,
-,101,102,32,100,111,95,108,105,115,116,40,116,44,114,61,
-,111,110,101,41,58,0,0,12,1,0,14,99,111,114,101,
-,101,110,99,111,100,101,46,112,121,0,0,33,1,0,0,
-,1,0,7,100,111,95,108,105,115,116,0,34,1,0,0,
-,2,0,0,9,1,0,2,28,2,0,0,28,3,0,0,
-,2,0,3,30,5,2,89,32,32,32,32,114,32,61,32,
-,101,116,95,116,109,112,40,114,41,0,0,12,5,0,7,
-,101,116,95,116,109,112,0,13,4,5,0,15,5,2,0,
-,3,5,1,19,3,4,3,15,2,3,0,30,8,2,90,
-,32,32,32,109,97,110,97,103,101,95,115,101,113,40,76,
-,83,84,44,114,44,116,46,105,116,101,109,115,41,0,0,
+,105,115,101,0,0,0,0,14,57,56,0,16,57,0,28,
+,10,0,0,28,2,0,0,9,1,0,2,12,4,0,5,
+,116,101,109,115,0,0,0,9,3,1,4,11,4,0,0,
+,0,0,0,0,0,0,0,42,2,3,4,18,0,0,15,
+,7,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
+,6,7,0,12,9,0,2,100,111,0,0,13,8,9,0,
+,9,2,0,31,7,9,1,19,7,8,7,31,5,7,1,
+,5,6,5,18,0,255,241,0,0,0,0,12,58,0,13,
+,111,95,115,116,97,116,101,109,101,110,116,115,0,0,0,
+,58,57,0,16,58,0,33,44,9,0,0,28,2,0,0,
+,1,0,2,28,2,0,0,28,3,0,0,32,2,0,3,
+,5,0,7,103,101,116,95,116,109,112,0,13,4,5,0,
+,5,2,0,31,3,5,1,19,3,4,3,15,2,3,0,
 ,5,0,10,109,97,110,97,103,101,95,115,101,113,0,0,
 ,4,5,0,12,8,0,4,76,73,83,84,0,0,0,0,
 ,5,8,0,15,6,2,0,12,8,0,5,105,116,101,109,
 ,0,0,0,9,7,1,8,31,3,5,3,19,3,4,3,
-,4,2,91,32,32,32,32,114,101,116,117,114,110,32,114,
-,0,0,0,20,2,0,0,0,0,0,0,12,59,0,7,
-,111,95,108,105,115,116,0,14,59,58,0,30,6,2,93,
-,101,102,32,100,111,95,100,105,99,116,40,116,44,114,61,
-,111,110,101,41,58,0,0,16,59,0,70,44,9,0,0,
-,6,2,93,100,101,102,32,100,111,95,100,105,99,116,40,
-,44,114,61,78,111,110,101,41,58,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,7,100,111,95,100,105,99,116,0,
-,1,0,0,28,2,0,0,9,1,0,2,28,2,0,0,
-,3,0,0,32,2,0,3,30,5,2,94,32,32,32,32,
-,32,61,32,103,101,116,95,116,109,112,40,114,41,0,0,
-,5,0,7,103,101,116,95,116,109,112,0,13,4,5,0,
-,5,2,0,31,3,5,1,19,3,4,3,15,2,3,0,
-,8,2,95,32,32,32,32,109,97,110,97,103,101,95,115,
-,113,40,68,73,67,84,44,114,44,116,46,105,116,101,109,
-,41,0,0,12,5,0,10,109,97,110,97,103,101,95,115,
+,2,0,0,0,0,0,0,12,59,0,7,100,111,95,108,
+,115,116,0,14,59,58,0,16,59,0,33,44,9,0,0,
+,2,0,0,9,1,0,2,28,2,0,0,28,3,0,0,
+,2,0,3,12,5,0,7,103,101,116,95,116,109,112,0,
+,4,5,0,15,5,2,0,31,3,5,1,19,3,4,3,
+,2,3,0,12,5,0,10,109,97,110,97,103,101,95,115,
 ,113,0,0,13,4,5,0,12,8,0,4,68,73,67,84,
 ,0,0,0,13,5,8,0,15,6,2,0,12,8,0,5,
 ,116,101,109,115,0,0,0,9,7,1,8,31,3,5,3,
-,3,4,3,30,4,2,96,32,32,32,32,114,101,116,117,
-,110,32,114,0,0,0,0,20,2,0,0,0,0,0,0,
-,60,0,7,100,111,95,100,105,99,116,0,14,60,59,0,
-,6,2,98,100,101,102,32,100,111,95,103,101,116,40,116,
-,114,61,78,111,110,101,41,58,0,0,0,16,60,0,67,
-,11,0,0,30,6,2,98,100,101,102,32,100,111,95,103,
-,116,40,116,44,114,61,78,111,110,101,41,58,0,0,0,
-,1,0,14,99,111,114,101,47,101,110,99,111,100,101,46,
-,121,0,0,33,1,0,0,12,1,0,6,100,111,95,103,
-,116,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,2,0,0,28,3,0,0,32,2,0,3,30,5,2,99,
-,32,32,32,105,116,101,109,115,32,61,32,116,46,105,116,
-,109,115,0,12,5,0,5,105,116,101,109,115,0,0,0,
-,4,1,5,15,3,4,0,30,11,2,100,32,32,32,32,
-,101,116,117,114,110,32,105,110,102,105,120,40,71,69,84,
-,105,116,101,109,115,91,48,93,44,105,116,101,109,115,91,
-,93,44,114,41,0,0,0,12,6,0,5,105,110,102,105,
-,0,0,0,13,5,6,0,12,10,0,3,71,69,84,0,
-,6,10,0,11,10,0,0,0,0,0,0,0,0,0,0,
-,7,3,10,11,10,0,0,0,0,0,0,0,0,240,63,
-,8,3,10,15,9,2,0,31,4,6,4,19,4,5,4,
-,4,0,0,0,0,0,0,12,61,0,6,100,111,95,103,
-,116,0,0,14,61,60,0,30,11,2,102,100,101,102,32,
-,111,95,98,114,101,97,107,40,116,41,58,32,106,117,109,
-,40,68,46,116,115,116,97,99,107,91,45,49,93,44,39,
-,114,101,97,107,39,41,0,16,61,0,48,44,7,0,0,
-,11,2,102,100,101,102,32,100,111,95,98,114,101,97,107,
-,116,41,58,32,106,117,109,112,40,68,46,116,115,116,97,
-,107,91,45,49,93,44,39,98,114,101,97,107,39,41,0,
-,1,0,14,99,111,114,101,47,101,110,99,111,100,101,46,
-,121,0,0,33,1,0,0,12,1,0,8,100,111,95,98,
-,101,97,107,0,0,0,0,34,1,0,0,28,2,0,0,
+,3,4,3,20,2,0,0,0,0,0,0,12,60,0,7,
+,111,95,100,105,99,116,0,14,60,59,0,16,60,0,32,
+,11,0,0,28,2,0,0,9,1,0,2,28,2,0,0,
+,3,0,0,32,2,0,3,12,5,0,5,105,116,101,109,
+,0,0,0,9,4,1,5,15,3,4,0,12,6,0,5,
+,110,102,105,120,0,0,0,13,5,6,0,12,10,0,3,
+,69,84,0,13,6,10,0,11,10,0,0,0,0,0,0,
+,0,0,0,9,7,3,10,11,10,0,0,0,0,0,0,
+,0,240,63,9,8,3,10,15,9,2,0,31,4,6,4,
+,4,5,4,20,4,0,0,0,0,0,0,12,61,0,6,
+,111,95,103,101,116,0,0,14,61,60,0,16,61,0,25,
+,7,0,0,28,2,0,0,9,1,0,2,12,4,0,4,
+,117,109,112,0,0,0,0,13,3,4,0,12,6,0,1,
+,0,0,0,13,4,6,0,12,6,0,6,116,115,116,97,
+,107,0,0,9,4,4,6,11,6,0,0,0,0,0,0,
+,0,240,191,9,4,4,6,12,5,0,5,98,114,101,97,
+,0,0,0,31,2,4,2,19,2,3,2,0,0,0,0,
+,62,0,8,100,111,95,98,114,101,97,107,0,0,0,0,
+,62,61,0,16,62,0,26,44,7,0,0,28,2,0,0,
 ,1,0,2,12,4,0,4,106,117,109,112,0,0,0,0,
 ,3,4,0,12,6,0,1,68,0,0,0,13,4,6,0,
 ,6,0,6,116,115,116,97,99,107,0,0,9,4,4,6,
 ,6,0,0,0,0,0,0,0,0,240,191,9,4,4,6,
-,5,0,5,98,114,101,97,107,0,0,0,31,2,4,2,
-,2,3,2,0,0,0,0,12,62,0,8,100,111,95,98,
-,101,97,107,0,0,0,0,14,62,61,0,30,13,2,103,
-,101,102,32,100,111,95,99,111,110,116,105,110,117,101,40,
-,41,58,32,106,117,109,112,40,68,46,116,115,116,97,99,
-,91,45,49,93,44,39,99,111,110,116,105,110,117,101,39,
-,0,0,0,16,62,0,51,44,7,0,0,30,13,2,103,
-,101,102,32,100,111,95,99,111,110,116,105,110,117,101,40,
-,41,58,32,106,117,109,112,40,68,46,116,115,116,97,99,
-,91,45,49,93,44,39,99,111,110,116,105,110,117,101,39,
-,0,0,0,12,1,0,14,99,111,114,101,47,101,110,99,
-,100,101,46,112,121,0,0,33,1,0,0,12,1,0,11,
-,111,95,99,111,110,116,105,110,117,101,0,34,1,0,0,
-,2,0,0,9,1,0,2,12,4,0,4,106,117,109,112,
-,0,0,0,13,3,4,0,12,6,0,1,68,0,0,0,
-,4,6,0,12,6,0,6,116,115,116,97,99,107,0,0,
-,4,4,6,11,6,0,0,0,0,0,0,0,0,240,191,
-,4,4,6,12,5,0,8,99,111,110,116,105,110,117,101,
-,0,0,0,31,2,4,2,19,2,3,2,0,0,0,0,
-,63,0,11,100,111,95,99,111,110,116,105,110,117,101,0,
-,63,62,0,30,7,2,104,100,101,102,32,100,111,95,112,
-,115,115,40,116,41,58,32,99,111,100,101,40,80,65,83,
-,41,0,0,16,63,0,33,44,6,0,0,30,7,2,104,
-,101,102,32,100,111,95,112,97,115,115,40,116,41,58,32,
-,111,100,101,40,80,65,83,83,41,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,7,100,111,95,112,97,115,115,0,
-,1,0,0,28,2,0,0,9,1,0,2,12,4,0,4,
-,111,100,101,0,0,0,0,13,3,4,0,12,5,0,4,
-,65,83,83,0,0,0,0,13,4,5,0,31,2,4,1,
-,2,3,2,0,0,0,0,12,64,0,7,100,111,95,112,
-,115,115,0,14,64,63,0,30,6,2,106,100,101,102,32,
-,111,95,105,110,102,111,40,110,97,109,101,61,39,63,39,
-,58,0,0,16,64,0,127,44,11,0,0,30,6,2,106,
-,101,102,32,100,111,95,105,110,102,111,40,110,97,109,101,
-,39,63,39,41,58,0,0,12,1,0,14,99,111,114,101,
-,101,110,99,111,100,101,46,112,121,0,0,33,1,0,0,
-,1,0,7,100,111,95,105,110,102,111,0,34,1,0,0,
-,1,0,1,63,0,0,0,28,2,0,0,32,1,0,2,
-,8,2,107,32,32,32,32,105,102,32,39,45,110,111,112,
-,115,39,32,105,110,32,65,82,71,86,58,32,114,101,116,
-,114,110,0,12,3,0,4,65,82,71,86,0,0,0,0,
+,5,0,8,99,111,110,116,105,110,117,101,0,0,0,0,
+,2,4,2,19,2,3,2,0,0,0,0,12,63,0,11,
+,111,95,99,111,110,116,105,110,117,101,0,14,63,62,0,
+,63,0,15,44,6,0,0,28,2,0,0,9,1,0,2,
+,4,0,4,99,111,100,101,0,0,0,0,13,3,4,0,
+,5,0,4,80,65,83,83,0,0,0,0,13,4,5,0,
+,2,4,1,19,2,3,2,0,0,0,0,12,64,0,7,
+,111,95,112,97,115,115,0,14,64,63,0,16,64,0,76,
+,11,0,0,12,1,0,1,63,0,0,0,28,2,0,0,
+,1,0,2,12,3,0,4,65,82,71,86,0,0,0,0,
 ,2,3,0,12,3,0,6,45,110,111,112,111,115,0,0,
 ,2,2,3,21,2,0,0,18,0,0,4,28,2,0,0,
-,2,0,0,18,0,0,1,30,12,2,108,32,32,32,32,
-,111,100,101,40,70,73,76,69,44,102,114,101,101,95,116,
-,112,40,95,100,111,95,115,116,114,105,110,103,40,68,46,
-,110,97,109,101,41,41,41,0,0,0,0,12,4,0,4,
-,111,100,101,0,0,0,0,13,3,4,0,12,6,0,4,
-,73,76,69,0,0,0,0,13,4,6,0,12,7,0,8,
-,114,101,101,95,116,109,112,0,0,0,0,13,6,7,0,
-,9,0,10,95,100,111,95,115,116,114,105,110,103,0,0,
-,8,9,0,12,10,0,1,68,0,0,0,13,9,10,0,
-,10,0,5,102,110,97,109,101,0,0,0,9,9,9,10,
-,7,9,1,19,7,8,7,31,5,7,1,19,5,6,5,
-,2,4,2,19,2,3,2,30,11,2,109,32,32,32,32,
-,111,100,101,40,78,65,77,69,44,102,114,101,101,95,116,
-,112,40,95,100,111,95,115,116,114,105,110,103,40,110,97,
-,101,41,41,41,0,0,0,12,4,0,4,99,111,100,101,
-,0,0,0,13,3,4,0,12,6,0,4,78,65,77,69,
+,2,0,0,18,0,0,1,12,4,0,4,99,111,100,101,
+,0,0,0,13,3,4,0,12,6,0,4,70,73,76,69,
 ,0,0,0,13,4,6,0,12,7,0,8,102,114,101,101,
 ,116,109,112,0,0,0,0,13,6,7,0,12,9,0,10,
 ,100,111,95,115,116,114,105,110,103,0,0,13,8,9,0,
-,9,1,0,31,7,9,1,19,7,8,7,31,5,7,1,
-,5,6,5,31,2,4,2,19,2,3,2,0,0,0,0,
-,65,0,7,100,111,95,105,110,102,111,0,14,65,64,0,
-,5,2,110,100,101,102,32,100,111,95,109,111,100,117,108,
-,40,116,41,58,0,0,0,16,65,0,63,44,8,0,0,
-,5,2,110,100,101,102,32,100,111,95,109,111,100,117,108,
-,40,116,41,58,0,0,0,12,1,0,14,99,111,114,101,
-,101,110,99,111,100,101,46,112,121,0,0,33,1,0,0,
-,1,0,9,100,111,95,109,111,100,117,108,101,0,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,30,4,2,111,
-,32,32,32,100,111,95,105,110,102,111,40,41,0,0,0,
-,4,0,7,100,111,95,105,110,102,111,0,13,3,4,0,
-,2,0,0,19,2,3,2,30,9,2,112,32,32,32,32,
-,114,101,101,95,116,109,112,40,100,111,40,116,46,105,116,
-,109,115,91,48,93,41,41,32,35,82,69,71,0,0,0,
-,4,0,8,102,114,101,101,95,116,109,112,0,0,0,0,
-,3,4,0,12,6,0,2,100,111,0,0,13,5,6,0,
-,7,0,5,105,116,101,109,115,0,0,0,9,6,1,7,
-,7,0,0,0,0,0,0,0,0,0,0,9,6,6,7,
-,4,6,1,19,4,5,4,31,2,4,1,19,2,3,2,
-,0,0,0,12,66,0,9,100,111,95,109,111,100,117,108,
-,0,0,0,14,66,65,0,30,9,2,113,100,101,102,32,
-,111,95,114,101,103,40,116,44,114,61,78,111,110,101,41,
-,32,114,101,116,117,114,110,32,116,46,118,97,108,0,0,
-,66,0,32,44,5,0,0,30,9,2,113,100,101,102,32,
-,111,95,114,101,103,40,116,44,114,61,78,111,110,101,41,
-,32,114,101,116,117,114,110,32,116,46,118,97,108,0,0,
-,1,0,14,99,111,114,101,47,101,110,99,111,100,101,46,
-,121,0,0,33,1,0,0,12,1,0,6,100,111,95,114,
-,103,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,2,0,0,28,3,0,0,32,2,0,3,12,4,0,3,
-,97,108,0,9,3,1,4,20,3,0,0,0,0,0,0,
-,67,0,6,100,111,95,114,101,103,0,0,14,67,66,0,
-,3,2,115,102,109,97,112,32,61,32,123,0,0,0,0,
-,67,0,4,102,109,97,112,0,0,0,0,30,16,2,116,
-,32,32,32,39,109,111,100,117,108,101,39,58,100,111,95,
-,111,100,117,108,101,44,39,115,116,97,116,101,109,101,110,
-,115,39,58,100,111,95,115,116,97,116,101,109,101,110,116,
-,44,39,100,101,102,39,58,100,111,95,100,101,102,44,0,
-,69,0,6,109,111,100,117,108,101,0,0,12,103,0,9,
-,111,95,109,111,100,117,108,101,0,0,0,13,70,103,0,
-,71,0,10,115,116,97,116,101,109,101,110,116,115,0,0,
-,103,0,13,100,111,95,115,116,97,116,101,109,101,110,116,
-,0,0,0,13,72,103,0,12,73,0,3,100,101,102,0,
-,103,0,6,100,111,95,100,101,102,0,0,13,74,103,0,
-,13,2,117,32,32,32,32,39,114,101,116,117,114,110,39,
-,100,111,95,114,101,116,117,114,110,44,39,119,104,105,108,
-,39,58,100,111,95,119,104,105,108,101,44,39,105,102,39,
-,100,111,95,105,102,44,0,12,75,0,6,114,101,116,117,
+,10,0,1,68,0,0,0,13,9,10,0,12,10,0,5,
+,110,97,109,101,0,0,0,9,9,9,10,31,7,9,1,
+,7,8,7,31,5,7,1,19,5,6,5,31,2,4,2,
+,2,3,2,12,4,0,4,99,111,100,101,0,0,0,0,
+,3,4,0,12,6,0,4,78,65,77,69,0,0,0,0,
+,4,6,0,12,7,0,8,102,114,101,101,95,116,109,112,
+,0,0,0,13,6,7,0,12,9,0,10,95,100,111,95,
+,116,114,105,110,103,0,0,13,8,9,0,15,9,1,0,
+,7,9,1,19,7,8,7,31,5,7,1,19,5,6,5,
+,2,4,2,19,2,3,2,0,0,0,0,12,65,0,7,
+,111,95,105,110,102,111,0,14,65,64,0,16,65,0,31,
+,8,0,0,28,2,0,0,9,1,0,2,12,4,0,7,
+,111,95,105,110,102,111,0,13,3,4,0,31,2,0,0,
+,2,3,2,12,4,0,8,102,114,101,101,95,116,109,112,
+,0,0,0,13,3,4,0,12,6,0,2,100,111,0,0,
+,5,6,0,12,7,0,5,105,116,101,109,115,0,0,0,
+,6,1,7,11,7,0,0,0,0,0,0,0,0,0,0,
+,6,6,7,31,4,6,1,19,4,5,4,31,2,4,1,
+,2,3,2,0,0,0,0,12,66,0,9,100,111,95,109,
+,100,117,108,101,0,0,0,14,66,65,0,16,66,0,12,
+,5,0,0,28,2,0,0,9,1,0,2,28,2,0,0,
+,3,0,0,32,2,0,3,12,4,0,3,118,97,108,0,
+,3,1,4,20,3,0,0,0,0,0,0,12,67,0,6,
+,111,95,114,101,103,0,0,14,67,66,0,12,67,0,4,
+,109,97,112,0,0,0,0,12,69,0,6,109,111,100,117,
+,101,0,0,12,103,0,9,100,111,95,109,111,100,117,108,
+,0,0,0,13,70,103,0,12,71,0,10,115,116,97,116,
+,109,101,110,116,115,0,0,12,103,0,13,100,111,95,115,
+,97,116,101,109,101,110,116,115,0,0,0,13,72,103,0,
+,73,0,3,100,101,102,0,12,103,0,6,100,111,95,100,
+,102,0,0,13,74,103,0,12,75,0,6,114,101,116,117,
 ,110,0,0,12,103,0,9,100,111,95,114,101,116,117,114,
 ,0,0,0,13,76,103,0,12,77,0,5,119,104,105,108,
 ,0,0,0,12,103,0,8,100,111,95,119,104,105,108,101,
 ,0,0,0,13,78,103,0,12,79,0,2,105,102,0,0,
 ,103,0,5,100,111,95,105,102,0,0,0,13,80,103,0,
-,19,2,118,32,32,32,32,39,98,114,101,97,107,39,58,
-,111,95,98,114,101,97,107,44,39,112,97,115,115,39,58,
-,111,95,112,97,115,115,44,39,99,111,110,116,105,110,117,
-,39,58,100,111,95,99,111,110,116,105,110,117,101,44,39,
-,111,114,39,58,100,111,95,102,111,114,44,0,0,0,0,
 ,81,0,5,98,114,101,97,107,0,0,0,12,103,0,8,
 ,111,95,98,114,101,97,107,0,0,0,0,13,82,103,0,
 ,83,0,4,112,97,115,115,0,0,0,0,12,103,0,7,
 ,368 → 3585,198
 ,111,110,116,105,110,117,101,0,0,0,0,12,103,0,11,
 ,111,95,99,111,110,116,105,110,117,101,0,13,86,103,0,
 ,87,0,3,102,111,114,0,12,103,0,6,100,111,95,102,
-,114,0,0,13,88,103,0,30,18,2,119,32,32,32,32,
-,99,108,97,115,115,39,58,100,111,95,99,108,97,115,115,
-,39,114,97,105,115,101,39,58,100,111,95,114,97,105,115,
-,44,39,116,114,121,39,58,100,111,95,116,114,121,44,39,
-,109,112,111,114,116,39,58,100,111,95,105,109,112,111,114,
-,44,0,0,12,89,0,5,99,108,97,115,115,0,0,0,
-,103,0,8,100,111,95,99,108,97,115,115,0,0,0,0,
-,90,103,0,12,91,0,5,114,97,105,115,101,0,0,0,
-,103,0,8,100,111,95,114,97,105,115,101,0,0,0,0,
-,92,103,0,12,93,0,3,116,114,121,0,12,103,0,6,
-,111,95,116,114,121,0,0,13,94,103,0,12,95,0,6,
-,109,112,111,114,116,0,0,12,103,0,9,100,111,95,105,
-,112,111,114,116,0,0,0,13,96,103,0,30,14,2,120,
-,32,32,32,39,103,108,111,98,97,108,115,39,58,100,111,
-,103,108,111,98,97,108,115,44,39,100,101,108,39,58,100,
-,95,100,101,108,44,39,102,114,111,109,39,58,100,111,95,
-,114,111,109,44,0,0,0,12,97,0,7,103,108,111,98,
-,108,115,0,12,103,0,10,100,111,95,103,108,111,98,97,
-,115,0,0,13,98,103,0,12,99,0,3,100,101,108,0,
-,103,0,6,100,111,95,100,101,108,0,0,13,100,103,0,
-,101,0,4,102,114,111,109,0,0,0,0,12,103,0,7,
-,111,95,102,114,111,109,0,13,102,103,0,26,68,69,34,
-,67,68,0,30,3,2,122,114,109,97,112,32,61,32,123,
-,0,0,0,12,67,0,4,114,109,97,112,0,0,0,0,
-,18,2,123,32,32,32,32,39,108,105,115,116,39,58,100,
-,95,108,105,115,116,44,32,39,116,117,112,108,101,39,58,
-,111,95,108,105,115,116,44,32,39,100,105,99,116,39,58,
-,111,95,100,105,99,116,44,32,39,115,108,105,99,101,39,
-,100,111,95,108,105,115,116,44,0,0,0,12,69,0,4,
-,105,115,116,0,0,0,0,12,93,0,7,100,111,95,108,
-,115,116,0,13,70,93,0,12,71,0,5,116,117,112,108,
-,0,0,0,12,93,0,7,100,111,95,108,105,115,116,0,
-,72,93,0,12,73,0,4,100,105,99,116,0,0,0,0,
-,93,0,7,100,111,95,100,105,99,116,0,13,74,93,0,
-,75,0,5,115,108,105,99,101,0,0,0,12,93,0,7,
-,111,95,108,105,115,116,0,13,76,93,0,30,19,2,124,
-,32,32,32,39,99,111,109,112,39,58,100,111,95,99,111,
-,112,44,32,39,110,97,109,101,39,58,100,111,95,110,97,
-,101,44,39,115,121,109,98,111,108,39,58,100,111,95,115,
-,109,98,111,108,44,39,110,117,109,98,101,114,39,58,100,
-,95,110,117,109,98,101,114,44,0,0,0,12,77,0,4,
-,111,109,112,0,0,0,0,12,93,0,7,100,111,95,99,
-,109,112,0,13,78,93,0,12,79,0,4,110,97,109,101,
-,0,0,0,12,93,0,7,100,111,95,110,97,109,101,0,
-,80,93,0,12,81,0,6,115,121,109,98,111,108,0,0,
-,93,0,9,100,111,95,115,121,109,98,111,108,0,0,0,
-,82,93,0,12,83,0,6,110,117,109,98,101,114,0,0,
-,93,0,9,100,111,95,110,117,109,98,101,114,0,0,0,
-,84,93,0,30,17,2,125,32,32,32,32,39,115,116,114,
-,110,103,39,58,100,111,95,115,116,114,105,110,103,44,39,
-,101,116,39,58,100,111,95,103,101,116,44,32,39,99,97,
-,108,39,58,100,111,95,99,97,108,108,44,32,39,114,101,
-,39,58,100,111,95,114,101,103,44,0,0,12,85,0,6,
-,116,114,105,110,103,0,0,12,93,0,9,100,111,95,115,
-,114,105,110,103,0,0,0,13,86,93,0,12,87,0,3,
-,101,116,0,12,93,0,6,100,111,95,103,101,116,0,0,
-,88,93,0,12,89,0,4,99,97,108,108,0,0,0,0,
-,93,0,7,100,111,95,99,97,108,108,0,13,90,93,0,
-,91,0,3,114,101,103,0,12,93,0,6,100,111,95,114,
-,103,0,0,13,92,93,0,26,68,69,24,14,67,68,0,
-,5,2,128,100,101,102,32,100,111,40,116,44,114,61,78,
-,110,101,41,58,0,0,0,16,67,0,198,44,9,0,0,
-,5,2,128,100,101,102,32,100,111,40,116,44,114,61,78,
-,110,101,41,58,0,0,0,12,1,0,14,99,111,114,101,
-,101,110,99,111,100,101,46,112,121,0,0,33,1,0,0,
-,1,0,2,100,111,0,0,34,1,0,0,28,2,0,0,
+,114,0,0,13,88,103,0,12,89,0,5,99,108,97,115,
+,0,0,0,12,103,0,8,100,111,95,99,108,97,115,115,
+,0,0,0,13,90,103,0,12,91,0,5,114,97,105,115,
+,0,0,0,12,103,0,8,100,111,95,114,97,105,115,101,
+,0,0,0,13,92,103,0,12,93,0,3,116,114,121,0,
+,103,0,6,100,111,95,116,114,121,0,0,13,94,103,0,
+,95,0,6,105,109,112,111,114,116,0,0,12,103,0,9,
+,111,95,105,109,112,111,114,116,0,0,0,13,96,103,0,
+,97,0,7,103,108,111,98,97,108,115,0,12,103,0,10,
+,111,95,103,108,111,98,97,108,115,0,0,13,98,103,0,
+,99,0,3,100,101,108,0,12,103,0,6,100,111,95,100,
+,108,0,0,13,100,103,0,12,101,0,4,102,114,111,109,
+,0,0,0,12,103,0,7,100,111,95,102,114,111,109,0,
+,102,103,0,26,68,69,34,14,67,68,0,12,67,0,4,
+,109,97,112,0,0,0,0,12,69,0,4,108,105,115,116,
+,0,0,0,12,93,0,7,100,111,95,108,105,115,116,0,
+,70,93,0,12,71,0,5,116,117,112,108,101,0,0,0,
+,93,0,7,100,111,95,108,105,115,116,0,13,72,93,0,
+,73,0,4,100,105,99,116,0,0,0,0,12,93,0,7,
+,111,95,100,105,99,116,0,13,74,93,0,12,75,0,5,
+,108,105,99,101,0,0,0,12,93,0,7,100,111,95,108,
+,115,116,0,13,76,93,0,12,77,0,4,99,111,109,112,
+,0,0,0,12,93,0,7,100,111,95,99,111,109,112,0,
+,78,93,0,12,79,0,4,110,97,109,101,0,0,0,0,
+,93,0,7,100,111,95,110,97,109,101,0,13,80,93,0,
+,81,0,6,115,121,109,98,111,108,0,0,12,93,0,9,
+,111,95,115,121,109,98,111,108,0,0,0,13,82,93,0,
+,83,0,6,110,117,109,98,101,114,0,0,12,93,0,9,
+,111,95,110,117,109,98,101,114,0,0,0,13,84,93,0,
+,85,0,6,115,116,114,105,110,103,0,0,12,93,0,9,
+,111,95,115,116,114,105,110,103,0,0,0,13,86,93,0,
+,87,0,3,103,101,116,0,12,93,0,6,100,111,95,103,
+,116,0,0,13,88,93,0,12,89,0,4,99,97,108,108,
+,0,0,0,12,93,0,7,100,111,95,99,97,108,108,0,
+,90,93,0,12,91,0,3,114,101,103,0,12,93,0,6,
+,111,95,114,101,103,0,0,13,92,93,0,26,68,69,24,
+,67,68,0,16,67,0,110,44,9,0,0,28,2,0,0,
 ,1,0,2,28,2,0,0,28,3,0,0,32,2,0,3,
-,7,2,129,32,32,32,32,105,102,32,116,46,112,111,115,
-,32,115,101,116,112,111,115,40,116,46,112,111,115,41,0,
 ,4,0,3,112,111,115,0,9,3,1,4,21,3,0,0,
 ,0,0,11,12,5,0,6,115,101,116,112,111,115,0,0,
 ,4,5,0,12,6,0,3,112,111,115,0,9,5,1,6,
-,3,5,1,19,3,4,3,18,0,0,1,30,3,2,130,
-,32,32,32,116,114,121,58,0,0,0,0,38,0,0,70,
-,7,2,131,32,32,32,32,32,32,32,32,105,102,32,116,
-,116,121,112,101,32,105,110,32,114,109,97,112,58,0,0,
+,3,5,1,19,3,4,3,18,0,0,1,38,0,0,41,
 ,4,0,4,114,109,97,112,0,0,0,0,13,3,4,0,
 ,5,0,4,116,121,112,101,0,0,0,0,9,4,1,5,
-,3,3,4,21,3,0,0,18,0,0,27,30,10,2,132,
-,32,32,32,32,32,32,32,32,32,32,32,114,101,116,117,
-,110,32,114,109,97,112,91,116,46,116,121,112,101,93,40,
-,44,114,41,0,0,0,0,12,5,0,4,114,109,97,112,
+,3,3,4,21,3,0,0,18,0,0,16,12,5,0,4,
+,109,97,112,0,0,0,0,13,4,5,0,12,6,0,4,
+,121,112,101,0,0,0,0,9,5,1,6,9,4,4,5,
+,5,1,0,15,6,2,0,31,3,5,2,19,3,4,3,
+,3,0,0,18,0,0,1,12,5,0,4,102,109,97,112,
 ,0,0,0,13,4,5,0,12,6,0,4,116,121,112,101,
 ,0,0,0,9,5,1,6,9,4,4,5,15,5,1,0,
-,6,2,0,31,3,5,2,19,3,4,3,20,3,0,0,
-,0,0,1,30,8,2,134,32,32,32,32,32,32,32,32,
-,101,116,117,114,110,32,102,109,97,112,91,116,46,116,121,
-,101,93,40,116,41,0,0,12,5,0,4,102,109,97,112,
-,0,0,0,13,4,5,0,12,6,0,4,116,121,112,101,
-,0,0,0,9,5,1,6,9,4,4,5,15,5,1,0,
-,3,5,1,19,3,4,3,20,3,0,0,38,0,0,0,
-,0,0,79,30,3,2,135,32,32,32,32,101,120,99,101,
-,116,58,0,30,7,2,136,32,32,32,32,32,32,32,32,
-,102,32,68,46,101,114,114,111,114,58,32,114,97,105,115,
-,0,0,0,12,4,0,1,68,0,0,0,13,3,4,0,
-,4,0,5,101,114,114,111,114,0,0,0,9,3,3,4,
-,3,0,0,18,0,0,4,28,3,0,0,37,3,0,0,
-,0,0,1,30,6,2,137,32,32,32,32,32,32,32,32,
-,46,101,114,114,111,114,32,61,32,84,114,117,101,0,0,
+,3,5,1,19,3,4,3,20,3,0,0,18,0,0,47,
+,4,0,1,68,0,0,0,13,3,4,0,12,4,0,5,
+,114,114,111,114,0,0,0,9,3,3,4,21,3,0,0,
+,0,0,4,28,3,0,0,37,3,0,0,18,0,0,1,
 ,4,0,1,68,0,0,0,13,3,4,0,11,4,0,0,
 ,0,0,0,0,0,240,63,12,5,0,5,101,114,114,111,
-,0,0,0,10,3,5,4,30,12,2,138,32,32,32,32,
-,32,32,32,116,111,107,101,110,105,122,101,46,117,95,101,
-,114,111,114,40,39,101,110,99,111,100,101,39,44,68,46,
-,111,100,101,44,116,46,112,111,115,41,0,12,5,0,8,
-,111,107,101,110,105,122,101,0,0,0,0,13,4,5,0,
-,5,0,7,117,95,101,114,114,111,114,0,9,4,4,5,
-,5,0,6,101,110,99,111,100,101,0,0,12,8,0,1,
-,0,0,0,13,6,8,0,12,8,0,4,99,111,100,101,
-,0,0,0,9,6,6,8,12,8,0,3,112,111,115,0,
-,7,1,8,31,3,5,3,19,3,4,3,0,0,0,0,
-,68,0,2,100,111,0,0,14,68,67,0,30,6,2,140,
-,101,102,32,101,110,99,111,100,101,40,102,110,97,109,101,
-,115,44,116,41,58,0,0,16,68,0,192,44,12,0,0,
-,6,2,140,100,101,102,32,101,110,99,111,100,101,40,102,
-,97,109,101,44,115,44,116,41,58,0,0,12,1,0,14,
-,111,114,101,47,101,110,99,111,100,101,46,112,121,0,0,
-,1,0,0,12,1,0,6,101,110,99,111,100,101,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
-,2,0,3,28,4,0,0,9,3,0,4,30,11,2,141,
-,32,32,32,116,32,61,32,84,111,107,101,110,40,40,49,
-,49,41,44,39,109,111,100,117,108,101,39,44,39,109,111,
-,117,108,101,39,44,91,116,93,41,0,0,12,6,0,5,
-,111,107,101,110,0,0,0,13,5,6,0,11,10,0,0,
-,0,0,0,0,0,240,63,11,11,0,0,0,0,0,0,
-,0,240,63,27,6,10,2,12,7,0,6,109,111,100,117,
-,101,0,0,12,8,0,6,109,111,100,117,108,101,0,0,
-,10,3,0,27,9,10,1,31,4,6,4,19,4,5,4,
-,3,4,0,30,4,2,142,32,32,32,32,103,108,111,98,
-,108,32,68,0,0,0,0,30,7,2,143,32,32,32,32,
-,32,61,32,116,111,107,101,110,105,122,101,46,99,108,101,
-,110,40,115,41,0,0,0,12,6,0,8,116,111,107,101,
-,105,122,101,0,0,0,0,13,5,6,0,12,6,0,5,
-,108,101,97,110,0,0,0,9,5,5,6,15,6,2,0,
-,4,6,1,19,4,5,4,15,2,4,0,30,6,2,144,
-,32,32,32,68,32,61,32,68,83,116,97,116,101,40,115,
-,102,110,97,109,101,41,0,12,4,0,1,68,0,0,0,
-,7,0,6,68,83,116,97,116,101,0,0,13,6,7,0,
-,7,2,0,15,8,1,0,31,5,7,2,19,5,6,5,
-,4,5,0,30,5,2,145,32,32,32,32,68,46,98,101,
-,105,110,40,84,114,117,101,41,0,0,0,12,6,0,1,
-,0,0,0,13,5,6,0,12,6,0,5,98,101,103,105,
-,0,0,0,9,5,5,6,11,6,0,0,0,0,0,0,
-,0,240,63,31,4,6,1,19,4,5,4,30,3,2,146,
-,32,32,32,100,111,40,116,41,0,0,0,12,6,0,2,
-,111,0,0,13,5,6,0,15,6,3,0,31,4,6,1,
-,4,5,4,30,3,2,147,32,32,32,32,68,46,101,110,
-,40,41,0,12,6,0,1,68,0,0,0,13,5,6,0,
-,6,0,3,101,110,100,0,9,5,5,6,31,4,0,0,
-,4,5,4,30,4,2,148,32,32,32,32,109,97,112,95,
-,97,103,115,40,41,0,0,12,6,0,8,109,97,112,95,
+,0,0,0,10,3,5,4,12,5,0,8,116,111,107,101,
+,105,122,101,0,0,0,0,13,4,5,0,12,5,0,7,
+,95,101,114,114,111,114,0,9,4,4,5,12,5,0,6,
+,110,99,111,100,101,0,0,12,8,0,1,68,0,0,0,
+,6,8,0,12,8,0,4,99,111,100,101,0,0,0,0,
+,6,6,8,12,8,0,3,112,111,115,0,9,7,1,8,
+,3,5,3,19,3,4,3,0,0,0,0,12,68,0,2,
+,111,0,0,14,68,67,0,16,68,0,109,44,12,0,0,
+,2,0,0,9,1,0,2,28,3,0,0,9,2,0,3,
+,4,0,0,9,3,0,4,12,6,0,5,84,111,107,101,
+,0,0,0,13,5,6,0,11,10,0,0,0,0,0,0,
+,0,240,63,11,11,0,0,0,0,0,0,0,0,240,63,
+,6,10,2,12,7,0,6,109,111,100,117,108,101,0,0,
+,8,0,6,109,111,100,117,108,101,0,0,15,10,3,0,
+,9,10,1,31,4,6,4,19,4,5,4,15,3,4,0,
+,6,0,8,116,111,107,101,110,105,122,101,0,0,0,0,
+,5,6,0,12,6,0,5,99,108,101,97,110,0,0,0,
+,5,5,6,15,6,2,0,31,4,6,1,19,4,5,4,
+,2,4,0,12,4,0,1,68,0,0,0,12,7,0,6,
+,83,116,97,116,101,0,0,13,6,7,0,15,7,2,0,
+,8,1,0,31,5,7,2,19,5,6,5,14,4,5,0,
+,6,0,1,68,0,0,0,13,5,6,0,12,6,0,5,
+,101,103,105,110,0,0,0,9,5,5,6,11,6,0,0,
+,0,0,0,0,0,240,63,31,4,6,1,19,4,5,4,
+,6,0,2,100,111,0,0,13,5,6,0,15,6,3,0,
+,4,6,1,19,4,5,4,12,6,0,1,68,0,0,0,
+,5,6,0,12,6,0,3,101,110,100,0,9,5,5,6,
+,4,0,0,19,4,5,4,12,6,0,8,109,97,112,95,
 ,97,103,115,0,0,0,0,13,5,6,0,31,4,0,0,
-,4,5,4,30,7,2,149,32,32,32,32,111,117,116,32,
-,32,68,46,111,117,116,59,32,68,32,61,32,78,111,110,
-,0,0,0,12,6,0,1,68,0,0,0,13,5,6,0,
+,4,5,4,12,6,0,1,68,0,0,0,13,5,6,0,
 ,6,0,3,111,117,116,0,9,5,5,6,15,4,5,0,
 ,5,0,1,68,0,0,0,28,6,0,0,14,5,6,0,
-,6,2,150,32,32,32,32,114,101,116,117,114,110,32,39,
-,46,106,111,105,110,40,111,117,116,41,0,12,6,0,0,
-,0,0,0,12,7,0,4,106,111,105,110,0,0,0,0,
-,6,6,7,15,7,4,0,31,5,7,1,19,5,6,5,
-,5,0,0,0,0,0,0,12,69,0,6,101,110,99,111,
-,101,0,0,14,69,68,0,0,0,0,0,
+,6,0,0,0,0,0,0,12,7,0,4,106,111,105,110,
+,0,0,0,9,6,6,7,15,7,4,0,31,5,7,1,
+,5,6,5,20,5,0,0,0,0,0,0,12,69,0,6,
+,110,99,111,100,101,0,0,14,69,68,0,0,0,0,0,
 };
 unsigned char tp_py2bc[] = {
-,11,0,0,30,3,0,1,105,109,112,111,114,116,32,115,
-,115,0,0,12,0,0,13,99,111,114,101,47,112,121,50,
-,99,46,112,121,0,0,0,33,0,0,0,12,0,0,1,
-,0,0,0,34,0,0,0,12,2,0,6,105,109,112,111,
-,116,0,0,13,1,2,0,12,2,0,3,115,121,115,0,
-,0,2,1,19,0,1,0,12,1,0,3,115,121,115,0,
-,1,0,0,30,8,0,2,105,102,32,110,111,116,32,34,
-,105,110,121,112,121,34,32,105,110,32,115,121,115,46,118,
-,114,115,105,111,110,58,0,12,2,0,3,115,121,115,0,
-,1,2,0,12,2,0,7,118,101,114,115,105,111,110,0,
-,1,1,2,12,2,0,6,116,105,110,121,112,121,0,0,
-,1,1,2,47,0,1,0,21,0,0,0,18,0,0,30,
-,6,0,3,32,32,32,32,102,114,111,109,32,98,111,111,
-,32,105,109,112,111,114,116,32,42,0,0,12,2,0,6,
-,109,112,111,114,116,0,0,13,1,2,0,12,2,0,4,
-,111,111,116,0,0,0,0,31,0,2,1,19,0,1,0,
-,3,0,5,109,101,114,103,101,0,0,0,13,2,3,0,
-,5,0,8,95,95,100,105,99,116,95,95,0,0,0,0,
-,3,5,0,15,4,0,0,31,1,3,2,19,1,2,1,
-,0,0,1,30,8,0,5,105,109,112,111,114,116,32,116,
-,107,101,110,105,122,101,44,112,97,114,115,101,44,101,110,
-,111,100,101,0,0,0,0,12,2,0,6,105,109,112,111,
-,116,0,0,13,1,2,0,12,2,0,8,116,111,107,101,
-,105,122,101,0,0,0,0,31,0,2,1,19,0,1,0,
-,1,0,8,116,111,107,101,110,105,122,101,0,0,0,0,
-,1,0,0,12,2,0,6,105,109,112,111,114,116,0,0,
-,1,2,0,12,2,0,5,112,97,114,115,101,0,0,0,
-,0,2,1,19,0,1,0,12,1,0,5,112,97,114,115,
-,0,0,0,14,1,0,0,12,2,0,6,105,109,112,111,
-,116,0,0,13,1,2,0,12,2,0,6,101,110,99,111,
-,101,0,0,31,0,2,1,19,0,1,0,12,1,0,6,
-,110,99,111,100,101,0,0,14,1,0,0,30,6,0,7,
-,101,102,32,95,99,111,109,112,105,108,101,40,115,44,102,
-,97,109,101,41,58,0,0,16,0,0,101,44,11,0,0,
-,6,0,7,100,101,102,32,95,99,111,109,112,105,108,101,
-,115,44,102,110,97,109,101,41,58,0,0,12,1,0,13,
-,111,114,101,47,112,121,50,98,99,46,112,121,0,0,0,
-,1,0,0,12,1,0,8,95,99,111,109,112,105,108,101,
-,0,0,0,34,1,0,0,28,2,0,0,9,1,0,2,
-,3,0,0,9,2,0,3,30,9,0,8,32,32,32,32,
-,111,107,101,110,115,32,61,32,116,111,107,101,110,105,122,
-,46,116,111,107,101,110,105,122,101,40,115,41,0,0,0,
+,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,
+,3,0,3,115,116,114,0,13,2,3,0,11,3,0,0,
+,0,0,0,0,0,240,63,31,1,3,1,19,1,2,1,
+,2,0,1,49,0,0,0,23,1,1,2,23,0,0,1,
+,0,0,0,18,0,0,23,12,2,0,6,105,109,112,111,
+,116,0,0,13,1,2,0,12,2,0,4,98,111,111,116,
+,0,0,0,31,0,2,1,19,0,1,0,12,3,0,5,
+,101,114,103,101,0,0,0,13,2,3,0,12,5,0,8,
+,95,100,105,99,116,95,95,0,0,0,0,13,3,5,0,
+,4,0,0,31,1,3,2,19,1,2,1,18,0,0,1,
+,2,0,6,105,109,112,111,114,116,0,0,13,1,2,0,
+,2,0,8,116,111,107,101,110,105,122,101,0,0,0,0,
+,0,2,1,19,0,1,0,12,1,0,8,116,111,107,101,
+,105,122,101,0,0,0,0,14,1,0,0,12,2,0,6,
+,109,112,111,114,116,0,0,13,1,2,0,12,2,0,5,
+,97,114,115,101,0,0,0,31,0,2,1,19,0,1,0,
+,1,0,5,112,97,114,115,101,0,0,0,14,1,0,0,
+,2,0,6,105,109,112,111,114,116,0,0,13,1,2,0,
+,2,0,6,101,110,99,111,100,101,0,0,31,0,2,1,
+,0,1,0,12,1,0,6,101,110,99,111,100,101,0,0,
+,1,0,0,16,0,0,49,44,11,0,0,28,2,0,0,
+,1,0,2,28,3,0,0,9,2,0,3,12,6,0,8,
+,111,107,101,110,105,122,101,0,0,0,0,13,5,6,0,
 ,6,0,8,116,111,107,101,110,105,122,101,0,0,0,0,
-,5,6,0,12,6,0,8,116,111,107,101,110,105,122,101,
-,0,0,0,9,5,5,6,15,6,1,0,31,4,6,1,
-,4,5,4,15,3,4,0,30,8,0,9,32,32,32,32,
-,32,61,32,112,97,114,115,101,46,112,97,114,115,101,40,
-,44,116,111,107,101,110,115,41,0,0,0,12,7,0,5,
-,97,114,115,101,0,0,0,13,6,7,0,12,7,0,5,
-,97,114,115,101,0,0,0,9,6,6,7,15,7,1,0,
-,8,3,0,31,5,7,2,19,5,6,5,15,4,5,0,
-,9,0,10,32,32,32,32,114,32,61,32,101,110,99,111,
-,101,46,101,110,99,111,100,101,40,102,110,97,109,101,44,
-,44,116,41,0,0,0,0,12,8,0,6,101,110,99,111,
+,5,5,6,15,6,1,0,31,4,6,1,19,4,5,4,
+,3,4,0,12,7,0,5,112,97,114,115,101,0,0,0,
+,6,7,0,12,7,0,5,112,97,114,115,101,0,0,0,
+,6,6,7,15,7,1,0,15,8,3,0,31,5,7,2,
+,5,6,5,15,4,5,0,12,8,0,6,101,110,99,111,
 ,101,0,0,13,7,8,0,12,8,0,6,101,110,99,111,
 ,101,0,0,9,7,7,8,15,8,2,0,15,9,1,0,
 ,10,4,0,31,6,8,3,19,6,7,6,15,5,6,0,
-,4,0,11,32,32,32,32,114,101,116,117,114,110,32,114,
-,0,0,0,20,5,0,0,0,0,0,0,12,1,0,8,
-,99,111,109,112,105,108,101,0,0,0,0,14,1,0,0,
-,5,0,13,100,101,102,32,95,105,109,112,111,114,116,40,
-,97,109,101,41,58,0,0,16,1,1,33,44,12,0,0,
-,5,0,13,100,101,102,32,95,105,109,112,111,114,116,40,
-,97,109,101,41,58,0,0,12,1,0,13,99,111,114,101,
-,112,121,50,98,99,46,112,121,0,0,0,33,1,0,0,
-,1,0,7,95,105,109,112,111,114,116,0,34,1,0,0,
-,2,0,0,9,1,0,2,30,6,0,14,32,32,32,32,
-,102,32,110,97,109,101,32,105,110,32,77,79,68,85,76,
-,83,58,0,12,3,0,7,77,79,68,85,76,69,83,0,
-,2,3,0,36,2,2,1,21,2,0,0,18,0,0,17,
-,8,0,15,32,32,32,32,32,32,32,32,114,101,116,117,
-,110,32,77,79,68,85,76,69,83,91,110,97,109,101,93,
-,0,0,0,12,3,0,7,77,79,68,85,76,69,83,0,
-,2,3,0,9,2,2,1,20,2,0,0,18,0,0,1,
-,5,0,16,32,32,32,32,112,121,32,61,32,110,97,109,
-,43,34,46,112,121,34,0,12,4,0,3,46,112,121,0,
-,3,1,4,15,2,3,0,30,6,0,17,32,32,32,32,
-,112,99,32,61,32,110,97,109,101,43,34,46,116,112,99,
-,0,0,0,12,5,0,4,46,116,112,99,0,0,0,0,
-,4,1,5,15,3,4,0,30,5,0,18,32,32,32,32,
-,102,32,101,120,105,115,116,115,40,112,121,41,58,0,0,
-,6,0,6,101,120,105,115,116,115,0,0,13,5,6,0,
-,6,2,0,31,4,6,1,19,4,5,4,21,4,0,0,
-,0,0,97,30,14,0,19,32,32,32,32,32,32,32,32,
-,102,32,110,111,116,32,101,120,105,115,116,115,40,116,112,
-,41,32,111,114,32,109,116,105,109,101,40,112,121,41,32,
-,32,109,116,105,109,101,40,116,112,99,41,58,0,0,0,
-,7,0,6,101,120,105,115,116,115,0,0,13,6,7,0,
-,7,3,0,31,5,7,1,19,5,6,5,47,4,5,0,
-,4,0,0,18,0,0,16,12,6,0,5,109,116,105,109,
-,0,0,0,13,5,6,0,15,6,3,0,31,4,6,1,
-,4,5,4,12,7,0,5,109,116,105,109,101,0,0,0,
-,6,7,0,15,7,2,0,31,5,7,1,19,5,6,5,
-,4,4,5,21,4,0,0,18,0,0,54,30,7,0,20,
-,32,32,32,32,32,32,32,32,32,32,32,115,32,61,32,
-,111,97,100,40,112,121,41,0,0,0,0,12,7,0,4,
-,111,97,100,0,0,0,0,13,6,7,0,15,7,2,0,
-,5,7,1,19,5,6,5,15,4,5,0,30,9,0,21,
-,32,32,32,32,32,32,32,32,32,32,32,99,111,100,101,
-,61,32,95,99,111,109,112,105,108,101,40,115,44,112,121,
-,0,0,0,12,8,0,8,95,99,111,109,112,105,108,101,
-,0,0,0,13,7,8,0,15,8,4,0,15,9,2,0,
-,6,8,2,19,6,7,6,15,5,6,0,30,7,0,22,
-,32,32,32,32,32,32,32,32,32,32,32,115,97,118,101,
-,116,112,99,44,99,111,100,101,41,0,0,12,8,0,4,
-,97,118,101,0,0,0,0,13,7,8,0,15,8,3,0,
-,9,5,0,31,6,8,2,19,6,7,6,18,0,0,1,
-,0,0,1,30,8,0,23,32,32,32,32,105,102,32,110,
-,116,32,101,120,105,115,116,115,40,116,112,99,41,58,32,
-,97,105,115,101,0,0,0,12,9,0,6,101,120,105,115,
-,115,0,0,13,8,9,0,15,9,3,0,31,7,9,1,
-,7,8,7,47,6,7,0,21,6,0,0,18,0,0,4,
-,6,0,0,37,6,0,0,18,0,0,1,30,6,0,24,
-,32,32,32,99,111,100,101,32,61,32,108,111,97,100,40,
-,112,99,41,0,0,0,0,12,8,0,4,108,111,97,100,
+,5,0,0,0,0,0,0,12,1,0,8,95,99,111,109,
+,105,108,101,0,0,0,0,14,1,0,0,16,1,0,155,
+,12,0,0,28,2,0,0,9,1,0,2,12,3,0,7,
+,79,68,85,76,69,83,0,13,2,3,0,36,2,2,1,
+,2,0,0,18,0,0,8,12,3,0,7,77,79,68,85,
+,69,83,0,13,2,3,0,9,2,2,1,20,2,0,0,
+,0,0,1,12,4,0,3,46,112,121,0,1,3,1,4,
+,2,3,0,12,5,0,4,46,116,112,99,0,0,0,0,
+,4,1,5,15,3,4,0,12,6,0,6,101,120,105,115,
+,115,0,0,13,5,6,0,15,6,2,0,31,4,6,1,
+,4,5,4,21,4,0,0,18,0,0,64,11,6,0,0,
+,0,0,0,0,0,240,63,11,4,0,0,0,0,0,0,
+,0,0,0,12,9,0,6,101,120,105,115,116,115,0,0,
+,8,9,0,15,9,3,0,31,7,9,1,19,7,8,7,
+,4,4,7,23,5,4,6,21,5,0,0,18,0,0,2,
+,0,0,16,12,8,0,5,109,116,105,109,101,0,0,0,
+,7,8,0,15,8,3,0,31,4,8,1,19,4,7,4,
+,9,0,5,109,116,105,109,101,0,0,0,13,8,9,0,
+,9,2,0,31,7,9,1,19,7,8,7,25,4,4,7,
+,4,0,0,18,0,0,28,12,7,0,4,108,111,97,100,
+,0,0,0,13,6,7,0,15,7,2,0,31,5,7,1,
+,5,6,5,15,4,5,0,12,8,0,8,95,99,111,109,
+,105,108,101,0,0,0,0,13,7,8,0,15,8,4,0,
+,9,2,0,31,6,8,2,19,6,7,6,15,5,6,0,
+,8,0,4,115,97,118,101,0,0,0,0,13,7,8,0,
+,8,3,0,15,9,5,0,31,6,8,2,19,6,7,6,
+,0,0,1,18,0,0,1,11,6,0,0,0,0,0,0,
+,0,0,0,12,9,0,6,101,120,105,115,116,115,0,0,
+,8,9,0,15,9,3,0,31,7,9,1,19,7,8,7,
+,6,6,7,21,6,0,0,18,0,0,4,28,6,0,0,
+,6,0,0,18,0,0,1,12,8,0,4,108,111,97,100,
 ,0,0,0,13,7,8,0,15,8,3,0,31,6,8,1,
-,6,7,6,15,5,6,0,30,11,0,25,32,32,32,32,
-,32,61,32,123,39,95,95,110,97,109,101,95,95,39,58,
-,97,109,101,44,39,95,95,99,111,100,101,95,95,39,58,
-,111,100,101,125,0,0,0,12,8,0,8,95,95,110,97,
+,6,7,6,15,5,6,0,12,8,0,8,95,95,110,97,
 ,101,95,95,0,0,0,0,15,9,1,0,12,10,0,8,
 ,95,99,111,100,101,95,95,0,0,0,0,15,11,5,0,
-,7,8,4,15,6,7,0,30,6,0,26,32,32,32,32,
-,91,39,95,95,100,105,99,116,95,95,39,93,32,61,32,
-,0,0,0,12,7,0,8,95,95,100,105,99,116,95,95,
-,0,0,0,10,6,7,6,30,6,0,27,32,32,32,32,
-,79,68,85,76,69,83,91,110,97,109,101,93,32,61,32,
-,0,0,0,12,8,0,7,77,79,68,85,76,69,83,0,
-,7,8,0,10,7,1,6,30,5,0,28,32,32,32,32,
-,120,101,99,40,99,111,100,101,44,103,41,0,0,0,0,
+,7,8,4,15,6,7,0,12,7,0,8,95,95,100,105,
+,116,95,95,0,0,0,0,10,6,7,6,12,8,0,7,
+,79,68,85,76,69,83,0,13,7,8,0,10,7,1,6,
 ,9,0,4,101,120,101,99,0,0,0,0,13,8,9,0,
 ,9,5,0,15,10,6,0,31,7,9,2,19,7,8,7,
-,4,0,29,32,32,32,32,114,101,116,117,114,110,32,103,
-,0,0,0,20,6,0,0,0,0,0,0,12,2,0,7,
-,105,109,112,111,114,116,0,14,2,1,0,30,4,0,32,
-,101,102,32,95,105,110,105,116,40,41,58,0,0,0,0,
-,2,0,65,44,4,0,0,30,4,0,32,100,101,102,32,
-,105,110,105,116,40,41,58,0,0,0,0,12,1,0,13,
-,111,114,101,47,112,121,50,98,99,46,112,121,0,0,0,
-,1,0,0,12,1,0,5,95,105,110,105,116,0,0,0,
-,1,0,0,30,9,0,33,32,32,32,32,66,85,73,76,
-,73,78,83,91,39,99,111,109,112,105,108,101,39,93,32,
-,32,95,99,111,109,112,105,108,101,0,0,12,2,0,8,
-,85,73,76,84,73,78,83,0,0,0,0,13,1,2,0,
-,3,0,8,95,99,111,109,112,105,108,101,0,0,0,0,
-,2,3,0,12,3,0,7,99,111,109,112,105,108,101,0,
-,1,3,2,30,9,0,34,32,32,32,32,66,85,73,76,
-,73,78,83,91,39,105,109,112,111,114,116,39,93,32,61,
-,95,105,109,112,111,114,116,0,0,0,0,12,2,0,8,
-,85,73,76,84,73,78,83,0,0,0,0,13,1,2,0,
-,3,0,7,95,105,109,112,111,114,116,0,13,2,3,0,
-,3,0,6,105,109,112,111,114,116,0,0,10,1,3,2,
-,0,0,0,12,3,0,5,95,105,110,105,116,0,0,0,
-,3,2,0,30,8,0,36,100,101,102,32,105,109,112,111,
-,116,95,102,110,97,109,101,40,102,110,97,109,101,44,110,
-,109,101,41,58,0,0,0,16,3,0,125,44,10,0,0,
-,8,0,36,100,101,102,32,105,109,112,111,114,116,95,102,
-,97,109,101,40,102,110,97,109,101,44,110,97,109,101,41,
-,0,0,0,12,1,0,13,99,111,114,101,47,112,121,50,
-,99,46,112,121,0,0,0,33,1,0,0,12,1,0,12,
-,109,112,111,114,116,95,102,110,97,109,101,0,0,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
-,2,0,3,30,3,0,37,32,32,32,32,103,32,61,32,
-,125,0,0,26,4,0,0,15,3,4,0,30,7,0,38,
-,32,32,32,103,91,39,95,95,110,97,109,101,95,95,39,
-,32,61,32,110,97,109,101,0,0,0,0,12,4,0,8,
-,95,110,97,109,101,95,95,0,0,0,0,10,3,4,2,
-,6,0,39,32,32,32,32,77,79,68,85,76,69,83,91,
-,97,109,101,93,32,61,32,103,0,0,0,12,5,0,7,
-,79,68,85,76,69,83,0,13,4,5,0,10,4,2,3,
-,5,0,40,32,32,32,32,115,32,61,32,108,111,97,100,
-,102,110,97,109,101,41,0,12,7,0,4,108,111,97,100,
+,6,0,0,0,0,0,0,12,2,0,7,95,105,109,112,
+,114,116,0,14,2,1,0,16,2,0,30,44,4,0,0,
+,2,0,8,66,85,73,76,84,73,78,83,0,0,0,0,
+,1,2,0,12,3,0,8,95,99,111,109,112,105,108,101,
+,0,0,0,13,2,3,0,12,3,0,7,99,111,109,112,
+,108,101,0,10,1,3,2,12,2,0,8,66,85,73,76,
+,73,78,83,0,0,0,0,13,1,2,0,12,3,0,7,
+,105,109,112,111,114,116,0,13,2,3,0,12,3,0,6,
+,109,112,111,114,116,0,0,10,1,3,2,0,0,0,0,
+,3,0,5,95,105,110,105,116,0,0,0,14,3,2,0,
+,3,0,51,44,10,0,0,28,2,0,0,9,1,0,2,
+,3,0,0,9,2,0,3,26,4,0,0,15,3,4,0,
+,4,0,8,95,95,110,97,109,101,95,95,0,0,0,0,
+,3,4,2,12,5,0,7,77,79,68,85,76,69,83,0,
+,4,5,0,10,4,2,3,12,7,0,4,108,111,97,100,
 ,0,0,0,13,6,7,0,15,7,1,0,31,5,7,1,
-,5,6,5,15,4,5,0,30,8,0,41,32,32,32,32,
-,111,100,101,32,61,32,95,99,111,109,112,105,108,101,40,
-,44,102,110,97,109,101,41,0,0,0,0,12,8,0,8,
-,99,111,109,112,105,108,101,0,0,0,0,13,7,8,0,
-,8,4,0,15,9,1,0,31,6,8,2,19,6,7,6,
-,5,6,0,30,7,0,42,32,32,32,32,103,91,39,95,
-,99,111,100,101,95,95,39,93,32,61,32,99,111,100,101,
-,0,0,0,12,6,0,8,95,95,99,111,100,101,95,95,
-,0,0,0,10,3,6,5,30,5,0,43,32,32,32,32,
-,120,101,99,40,99,111,100,101,44,103,41,0,0,0,0,
-,8,0,4,101,120,101,99,0,0,0,0,13,7,8,0,
-,8,5,0,15,9,3,0,31,6,8,2,19,6,7,6,
-,4,0,44,32,32,32,32,114,101,116,117,114,110,32,103,
-,0,0,0,20,3,0,0,0,0,0,0,12,4,0,12,
+,5,6,5,15,4,5,0,12,8,0,8,95,99,111,109,
+,105,108,101,0,0,0,0,13,7,8,0,15,8,4,0,
+,9,1,0,31,6,8,2,19,6,7,6,15,5,6,0,
+,6,0,8,95,95,99,111,100,101,95,95,0,0,0,0,
+,3,6,5,12,8,0,4,101,120,101,99,0,0,0,0,
+,7,8,0,15,8,5,0,15,9,3,0,31,6,8,2,
+,6,7,6,20,3,0,0,0,0,0,0,12,4,0,12,
 ,109,112,111,114,116,95,102,110,97,109,101,0,0,0,0,
-,4,3,0,30,4,0,46,100,101,102,32,116,105,110,121,
-,121,40,41,58,0,0,0,16,4,0,51,44,6,0,0,
-,4,0,46,100,101,102,32,116,105,110,121,112,121,40,41,
-,0,0,0,12,1,0,13,99,111,114,101,47,112,121,50,
-,99,46,112,121,0,0,0,33,1,0,0,12,1,0,6,
-,105,110,121,112,121,0,0,34,1,0,0,30,11,0,47,
-,32,32,32,114,101,116,117,114,110,32,105,109,112,111,114,
-,95,102,110,97,109,101,40,65,82,71,86,91,48,93,44,
-,95,95,109,97,105,110,95,95,39,41,0,12,3,0,12,
+,4,3,0,16,4,0,24,44,6,0,0,12,3,0,12,
 ,109,112,111,114,116,95,102,110,97,109,101,0,0,0,0,
 ,2,3,0,12,5,0,4,65,82,71,86,0,0,0,0,
 ,3,5,0,11,5,0,0,0,0,0,0,0,0,0,0,
 ,90 → 3783,23
 ,3,3,5,12,4,0,8,95,95,109,97,105,110,95,95,
 ,0,0,0,31,1,3,2,19,1,2,1,20,1,0,0,
 ,0,0,0,12,5,0,6,116,105,110,121,112,121,0,0,
-,5,4,0,30,5,0,49,100,101,102,32,109,97,105,110,
-,115,114,99,44,100,101,115,116,41,58,0,16,5,0,68,
-,9,0,0,30,5,0,49,100,101,102,32,109,97,105,110,
-,115,114,99,44,100,101,115,116,41,58,0,12,1,0,13,
-,111,114,101,47,112,121,50,98,99,46,112,121,0,0,0,
-,1,0,0,12,1,0,4,109,97,105,110,0,0,0,0,
-,1,0,0,28,2,0,0,9,1,0,2,28,3,0,0,
-,2,0,3,30,5,0,50,32,32,32,32,115,32,61,32,
-,111,97,100,40,115,114,99,41,0,0,0,12,6,0,4,
+,5,4,0,16,5,0,33,44,9,0,0,28,2,0,0,
+,1,0,2,28,3,0,0,9,2,0,3,12,6,0,4,
 ,111,97,100,0,0,0,0,13,5,6,0,15,6,1,0,
-,4,6,1,19,4,5,4,15,3,4,0,30,6,0,51,
-,32,32,32,114,32,61,32,95,99,111,109,112,105,108,101,
-,115,44,115,114,99,41,0,12,7,0,8,95,99,111,109,
-,105,108,101,0,0,0,0,13,6,7,0,15,7,3,0,
-,8,1,0,31,5,7,2,19,5,6,5,15,4,5,0,
-,5,0,52,32,32,32,32,115,97,118,101,40,100,101,115,
-,44,114,41,0,0,0,0,12,7,0,4,115,97,118,101,
-,0,0,0,13,6,7,0,15,7,2,0,15,8,4,0,
-,5,7,2,19,5,6,5,0,0,0,0,12,6,0,4,
-,97,105,110,0,0,0,0,14,6,5,0,30,7,0,54,
-,102,32,95,95,110,97,109,101,95,95,32,61,61,32,39,
-,95,109,97,105,110,95,95,39,58,0,0,12,7,0,8,
-,95,110,97,109,101,95,95,0,0,0,0,13,6,7,0,
-,7,0,8,95,95,109,97,105,110,95,95,0,0,0,0,
-,6,6,7,21,6,0,0,18,0,0,242,30,7,0,55,
-,32,32,32,109,97,105,110,40,65,82,71,86,91,49,93,
-,65,82,71,86,91,50,93,41,0,0,0,12,8,0,4,
-,97,105,110,0,0,0,0,13,7,8,0,12,10,0,4,
-,82,71,86,0,0,0,0,13,8,10,0,11,10,0,0,
-,0,0,0,0,0,240,63,9,8,8,10,12,10,0,4,
-,82,71,86,0,0,0,0,13,9,10,0,11,10,0,0,
-,0,0,0,0,0,0,64,9,9,9,10,31,6,8,2,
-,6,7,6,30,7,0,56,32,32,32,32,109,97,105,110,
-,65,82,71,86,91,49,93,44,65,82,71,86,91,50,93,
-,0,0,0,12,8,0,4,109,97,105,110,0,0,0,0,
-,7,8,0,12,10,0,4,65,82,71,86,0,0,0,0,
-,8,10,0,11,10,0,0,0,0,0,0,0,0,240,63,
-,8,8,10,12,10,0,4,65,82,71,86,0,0,0,0,
-,9,10,0,11,10,0,0,0,0,0,0,0,0,0,64,
-,9,9,10,31,6,8,2,19,6,7,6,30,7,0,57,
-,32,32,32,109,97,105,110,40,65,82,71,86,91,49,93,
-,65,82,71,86,91,50,93,41,0,0,0,12,8,0,4,
-,97,105,110,0,0,0,0,13,7,8,0,12,10,0,4,
-,82,71,86,0,0,0,0,13,8,10,0,11,10,0,0,
-,0,0,0,0,0,240,63,9,8,8,10,12,10,0,4,
-,82,71,86,0,0,0,0,13,9,10,0,11,10,0,0,
-,0,0,0,0,0,0,64,9,9,9,10,31,6,8,2,
-,6,7,6,30,7,0,58,32,32,32,32,109,97,105,110,
-,65,82,71,86,91,49,93,44,65,82,71,86,91,50,93,
-,0,0,0,12,8,0,4,109,97,105,110,0,0,0,0,
-,7,8,0,12,10,0,4,65,82,71,86,0,0,0,0,
-,8,10,0,11,10,0,0,0,0,0,0,0,0,240,63,
-,8,8,10,12,10,0,4,65,82,71,86,0,0,0,0,
-,9,10,0,11,10,0,0,0,0,0,0,0,0,0,64,
-,9,9,10,31,6,8,2,19,6,7,6,30,7,0,59,
-,32,32,32,109,97,105,110,40,65,82,71,86,91,49,93,
-,65,82,71,86,91,50,93,41,0,0,0,12,8,0,4,
-,97,105,110,0,0,0,0,13,7,8,0,12,10,0,4,
-,82,71,86,0,0,0,0,13,8,10,0,11,10,0,0,
-,0,0,0,0,0,240,63,9,8,8,10,12,10,0,4,
-,82,71,86,0,0,0,0,13,9,10,0,11,10,0,0,
-,0,0,0,0,0,0,64,9,9,9,10,31,6,8,2,
-,6,7,6,30,7,0,60,32,32,32,32,109,97,105,110,
-,65,82,71,86,91,49,93,44,65,82,71,86,91,50,93,
-,0,0,0,12,8,0,4,109,97,105,110,0,0,0,0,
-,7,8,0,12,10,0,4,65,82,71,86,0,0,0,0,
-,8,10,0,11,10,0,0,0,0,0,0,0,0,240,63,
-,8,8,10,12,10,0,4,65,82,71,86,0,0,0,0,
-,9,10,0,11,10,0,0,0,0,0,0,0,0,0,64,
-,9,9,10,31,6,8,2,19,6,7,6,30,7,0,61,
-,32,32,32,109,97,105,110,40,65,82,71,86,91,49,93,
-,65,82,71,86,91,50,93,41,0,0,0,12,8,0,4,
-,97,105,110,0,0,0,0,13,7,8,0,12,10,0,4,
-,82,71,86,0,0,0,0,13,8,10,0,11,10,0,0,
-,0,0,0,0,0,240,63,9,8,8,10,12,10,0,4,
-,82,71,86,0,0,0,0,13,9,10,0,11,10,0,0,
-,0,0,0,0,0,0,64,9,9,9,10,31,6,8,2,
-,6,7,6,30,7,0,62,32,32,32,32,109,97,105,110,
-,65,82,71,86,91,49,93,44,65,82,71,86,91,50,93,
-,0,0,0,12,8,0,4,109,97,105,110,0,0,0,0,
-,7,8,0,12,10,0,4,65,82,71,86,0,0,0,0,
-,8,10,0,11,10,0,0,0,0,0,0,0,0,240,63,
-,8,8,10,12,10,0,4,65,82,71,86,0,0,0,0,
-,9,10,0,11,10,0,0,0,0,0,0,0,0,0,64,
-,9,9,10,31,6,8,2,19,6,7,6,18,0,0,1,
-,0,0,0,
+,4,6,1,19,4,5,4,15,3,4,0,12,7,0,8,
+,99,111,109,112,105,108,101,0,0,0,0,13,6,7,0,
+,7,3,0,15,8,1,0,31,5,7,2,19,5,6,5,
+,4,5,0,12,7,0,4,115,97,118,101,0,0,0,0,
+,6,7,0,15,7,2,0,15,8,4,0,31,5,7,2,
+,5,6,5,0,0,0,0,12,6,0,4,109,97,105,110,
+,0,0,0,14,6,5,0,12,7,0,8,95,95,110,97,
+,101,95,95,0,0,0,0,13,6,7,0,12,7,0,8,
+,95,109,97,105,110,95,95,0,0,0,0,23,6,6,7,
+,6,0,0,18,0,0,24,12,8,0,4,109,97,105,110,
+,0,0,0,13,7,8,0,12,10,0,4,65,82,71,86,
+,0,0,0,13,8,10,0,11,10,0,0,0,0,0,0,
+,0,240,63,9,8,8,10,12,10,0,4,65,82,71,86,
+,0,0,0,13,9,10,0,11,10,0,0,0,0,0,0,
+,0,0,64,9,9,9,10,31,6,8,2,19,6,7,6,
+,0,0,1,0,0,0,0,
 };

 /programs/develop/tinypy/tinypy/boot.py
 ,0 → 1,46
+def _boot_init():
+    global FTYPE
+    f = open('tp.h','r').read()
+    FTYPE = 'f'
+    if 'double tp_num' in f: FTYPE = 'd'
+    import sys
+    global ARGV
+    ARGV = sys.argv
+_boot_init()
+def merge(a,b):
+    if isinstance(a,dict):
+        for k in b: a[k] = b[k]
+    else:
+        for k in b: setattr(a,k,b[k])
+def number(v):
+    if type(v) is str and v[0:2] == '0x':
+        v = int(v[2:],16)
+    return float(v)
+def istype(v,t):
+    if t == 'string': return isinstance(v,str)
+    elif t == 'list': return (isinstance(v,list) or isinstance(v,tuple))
+    elif t == 'dict': return isinstance(v,dict)
+    elif t == 'number': return (isinstance(v,float) or isinstance(v,int))
+    raise '?'
+def fpack(v):
+    import struct
+    return struct.pack(FTYPE,v)
+def system(cmd):
+    import os
+    return os.system(cmd)
+def load(fname):
+    f = open(fname,'rb')
+    r = f.read()
+    f.close()
+    return r
+def save(fname,v):
+    f = open(fname,'wb')
+    f.write(v)
+    f.close()

 /programs/develop/tinypy/tinypy/dict.c
 ,0 → 1,169
+int tp_lua_hash(void const *v,int l) {
+    int i,step = (l>>5)+1;
+    int h = l + (l >= 4?*(int*)v:0);
+    for (i=l; i>=step; i-=step) {
+        h = h^((h<<5)+(h>>2)+((unsigned char *)v)[i-1]);
+    }
+    return h;
+}
+void _tp_dict_free(_tp_dict *self) {
+    tp_free(self->items);
+    tp_free(self);
+}
+/* void _tp_dict_reset(_tp_dict *self) {
+       memset(self->items,0,self->alloc*sizeof(tp_item));
+       self->len = 0;
+       self->used = 0;
+       self->cur = 0;
+   }*/
+int tp_hash(TP,tp_obj v) {
+    switch (v.type) {
+        case TP_NONE: return 0;
+        case TP_NUMBER: return tp_lua_hash(&v.number.val,sizeof(tp_num));
+        case TP_STRING: return tp_lua_hash(v.string.val,v.string.len);
+        case TP_DICT: return tp_lua_hash(&v.dict.val,sizeof(void*));
+        case TP_LIST: {
+            int r = v.list.val->len; int n; for(n=0; n<v.list.val->len; n++) {
+            tp_obj vv = v.list.val->items[n]; r += vv.type != TP_LIST?tp_hash(tp,v.list.val->items[n]):tp_lua_hash(&vv.list.val,sizeof(void*)); } return r;
+        }
+        case TP_FNC: return tp_lua_hash(&v.fnc.info,sizeof(void*));
+        case TP_DATA: return tp_lua_hash(&v.data.val,sizeof(void*));
+    }
+    tp_raise(0,"tp_hash(%s)",TP_CSTR(v));
+}
+void _tp_dict_hash_set(TP,_tp_dict *self, int hash, tp_obj k, tp_obj v) {
+    tp_item item;
+    int i,idx = hash&self->mask;
+    for (i=idx; i<idx+self->alloc; i++) {
+        int n = i&self->mask;
+        if (self->items[n].used > 0) { continue; }
+        if (self->items[n].used == 0) { self->used += 1; }
+        item.used = 1;
+        item.hash = hash;
+        item.key = k;
+        item.val = v;
+        self->items[n] = item;
+        self->len += 1;
+        return;
+    }
+    tp_raise(,"_tp_dict_hash_set(%d,%d,%s,%s)",self,hash,TP_CSTR(k),TP_CSTR(v));
+}
+void _tp_dict_tp_realloc(TP,_tp_dict *self,int len) {
+    tp_item *items = self->items;
+    int i,alloc = self->alloc;
+    len = _tp_max(8,len);
+    self->items = (tp_item*)tp_malloc(len*sizeof(tp_item));
+    self->alloc = len; self->mask = len-1;
+    self->len = 0; self->used = 0;
+    for (i=0; i<alloc; i++) {
+        if (items[i].used != 1) { continue; }
+        _tp_dict_hash_set(tp,self,items[i].hash,items[i].key,items[i].val);
+    }
+    tp_free(items);
+}
+int _tp_dict_hash_find(TP,_tp_dict *self, int hash, tp_obj k) {
+    int i,idx = hash&self->mask;
+    for (i=idx; i<idx+self->alloc; i++) {
+        int n = i&self->mask;
+        if (self->items[n].used == 0) { break; }
+        if (self->items[n].used < 0) { continue; }
+        if (self->items[n].hash != hash) { continue; }
+        if (tp_cmp(tp,self->items[n].key,k) != 0) { continue; }
+        return n;
+    }
+    return -1;
+}
+int _tp_dict_find(TP,_tp_dict *self,tp_obj k) {
+    return _tp_dict_hash_find(tp,self,tp_hash(tp,k),k);
+}
+void _tp_dict_setx(TP,_tp_dict *self,tp_obj k, tp_obj v) {
+    int hash = tp_hash(tp,k); int n = _tp_dict_hash_find(tp,self,hash,k);
+    if (n == -1) {
+        if (self->len >= (self->alloc/2)) {
+            _tp_dict_tp_realloc(tp,self,self->alloc*2);
+        } else if (self->used >= (self->alloc*3/4)) {
+            _tp_dict_tp_realloc(tp,self,self->alloc);
+        }
+        _tp_dict_hash_set(tp,self,hash,k,v);
+    } else {
+        self->items[n].val = v;
+    }
+}
+void _tp_dict_set(TP,_tp_dict *self,tp_obj k, tp_obj v) {
+    _tp_dict_setx(tp,self,k,v);
+    tp_grey(tp,k); tp_grey(tp,v);
+}
+tp_obj _tp_dict_get(TP,_tp_dict *self,tp_obj k, const char *error) {
+    int n = _tp_dict_find(tp,self,k);
+    if (n < 0) {
+        tp_raise(tp_None,"%s: KeyError: %s\n",error,TP_CSTR(k));
+    }
+    return self->items[n].val;
+}
+void _tp_dict_del(TP,_tp_dict *self,tp_obj k, const char *error) {
+    int n = _tp_dict_find(tp,self,k);
+    if (n < 0) { tp_raise(,"%s: KeyError: %s\n",error,TP_CSTR(k)); }
+    self->items[n].used = -1;
+    self->len -= 1;
+}
+_tp_dict *_tp_dict_new(void) {
+    _tp_dict *self = (_tp_dict*)tp_malloc(sizeof(_tp_dict));
+    return self;
+}
+tp_obj _tp_dict_copy(TP,tp_obj rr) {
+    tp_obj obj = {TP_DICT};
+    _tp_dict *o = rr.dict.val;
+    _tp_dict *r = _tp_dict_new();
+    *r = *o; r->gci = 0;
+    r->items = (tp_item*)tp_malloc(sizeof(tp_item)*o->alloc);
+    memcpy(r->items,o->items,sizeof(tp_item)*o->alloc);
+    obj.dict.val = r;
+    return tp_track(tp,obj);
+}
+int _tp_dict_next(TP,_tp_dict *self) {
+    if (!self->len) { tp_raise(0,"_tp_dict_next(...)",0); }
+    while (1) {
+        self->cur = ((self->cur + 1) & self->mask);
+        if (self->items[self->cur].used > 0) {
+            return self->cur;
+        }
+    }
+}
+tp_obj tp_merge(TP) {
+    tp_obj self = TP_OBJ();
+    tp_obj v = TP_OBJ();
+    int i; for (i=0; i<v.dict.val->len; i++) {
+        int n = _tp_dict_next(tp,v.dict.val);
+        _tp_dict_set(tp,self.dict.val,
+            v.dict.val->items[n].key,v.dict.val->items[n].val);
+    }
+    return tp_None;
+}
+volatile tp_obj tp_dict(TP) {
+    tp_obj r = {TP_DICT};
+    r.dict.val = _tp_dict_new();
+    return tp ? tp_track(tp,r) : r;
+}
+tp_obj tp_dict_n(TP,int n, tp_obj* argv) {
+    tp_obj r = tp_dict(tp);
+    int i; for (i=0; i<n; i++) { tp_set(tp,r,argv[i*2],argv[i*2+1]); }
+    return r;
+}

 /programs/develop/tinypy/tinypy/encode.py
 ,0 → 1,699
+import tokenize
+from tokenize import Token
+if '.' in str(1.0):
+    from boot import *
+EOF,ADD,SUB,MUL,DIV,POW,AND,OR,CMP,GET,SET,NUMBER,STRING,GGET,GSET,MOVE,DEF,PASS,JUMP,CALL,RETURN,IF,DEBUG,EQ,LE,LT,DICT,LIST,NONE,LEN,POS,PARAMS,IGET,FILE,NAME,NE,HAS,RAISE,SETJMP,MOD,LSH,RSH,ITER,DEL,REGS = 0,1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,36,37,38,39,40,41,42,43,44
+class DState:
+    def __init__(self,code,fname):
+        self.code, self.fname = code,fname
+        self.lines = self.code.split('\n')
+        self.stack,self.out,self._scopei,self.tstack,self._tagi,self.data = [],[('tag','EOF')],0,[],0,{}
+        self.error = False
+    def begin(self,gbl=False):
+        if len(self.stack): self.stack.append((self.vars,self.r2n,self.n2r,self._tmpi,self.mreg,self.snum,self._globals,self.lineno,self.globals,self.cregs,self.tmpc))
+        else: self.stack.append(None)
+        self.vars,self.r2n,self.n2r,self._tmpi,self.mreg,self.snum,self._globals,self.lineno,self.globals,self.cregs,self.tmpc = [],{},{},0,0,str(self._scopei),gbl,-1,[],['regs'],0
+        self._scopei += 1
+        insert(self.cregs)
+    def end(self):
+        self.cregs.append(self.mreg)
+        code(EOF)
+        # This next line forces the encoder to
+        # throw an exception if any tmp regs
+        # were leaked within the frame
+        assert(self.tmpc == 0) #REG
+        if len(self.stack) > 1:
+            self.vars,self.r2n,self.n2r,self._tmpi,self.mreg,self.snum,self._globals,self.lineno,self.globals,self.cregs,self.tmpc = self.stack.pop()
+        else: self.stack.pop()
+def insert(v): D.out.append(v)
+def write(v):
+    if istype(v,'list'):
+        insert(v)
+        return
+    for n in range(0,len(v),4):
+        insert(('data',v[n:n+4]))
+def setpos(v):
+    if '-nopos' in ARGV: return
+    line,x = v
+    if line == D.lineno: return
+    text = D.lines[line-1]
+    D.lineno = line
+    val = text + "\0"*(4-len(text)%4)
+    code_16(POS,len(val)/4,line)
+    write(val)
+def code(i,a=0,b=0,c=0):
+    if not istype(i,'number'): raise
+    if not istype(a,'number'): raise
+    if not istype(b,'number'): raise
+    if not istype(c,'number'): raise
+    write(('code',i,a,b,c))
+def code_16(i,a,b):
+    if b < 0: b += 0x8000
+    code(i,a,(b&0xff00)>>8,(b&0xff)>>0)
+def get_code16(i,a,b):
+    return ('code',i,a,(b&0xff00)>>8,(b&0xff)>>0)
+def _do_string(v,r=None):
+    r = get_tmp(r)
+    val = v + "\0"*(4-len(v)%4)
+    code_16(STRING,r,len(v))
+    write(val)
+    return r
+def do_string(t,r=None):
+    return _do_string(t.val,r)
+def _do_number(v,r=None):
+    r = get_tmp(r)
+    code(NUMBER,r,0,0)
+    write(fpack(number(v)))
+    return r
+def do_number(t,r=None):
+    return _do_number(t.val,r)
+def get_tag():
+    k = str(D._tagi)
+    D._tagi += 1
+    return k
+def stack_tag():
+    k = get_tag()
+    D.tstack.append(k)
+    return k
+def pop_tag():
+    D.tstack.pop()
+def tag(*t):
+    t = D.snum+':'+':'.join([str(v) for v in t])
+    insert(('tag',t))
+def jump(*t):
+    t = D.snum+':'+':'.join([str(v) for v in t])
+    insert(('jump',t))
+def setjmp(*t):
+    t = D.snum+':'+':'.join([str(v) for v in t])
+    insert(('setjmp',t))
+def fnc(*t):
+    t = D.snum+':'+':'.join([str(v) for v in t])
+    r = get_reg(t)
+    insert(('fnc',r,t))
+    return r
+def map_tags():
+    tags = {}
+    out = []
+    n = 0
+    for item in D.out:
+        if item[0] == 'tag':
+            tags[item[1]] = n
+            continue
+        if item[0] == 'regs':
+            out.append(get_code16(REGS,item[1],0))
+            n += 1
+            continue
+        out.append(item)
+        n += 1
+    for n in range(0,len(out)):
+        item = out[n]
+        if item[0] == 'jump':
+            out[n] = get_code16(JUMP,0,tags[item[1]]-n)
+        elif item[0] == 'setjmp':
+            out[n] = get_code16(SETJMP,0,tags[item[1]]-n)
+        elif item[0] == 'fnc':
+            out[n] = get_code16(DEF,item[1],tags[item[2]]-n)
+    for n in range(0,len(out)):
+        item = out[n]
+        if item[0] == 'data':
+            out[n] = item[1]
+        elif item[0] == 'code':
+            i,a,b,c = item[1:]
+            out[n] = chr(i)+chr(a)+chr(b)+chr(c)
+        else:
+            raise str(('huh?',item))
+        if len(out[n]) != 4:
+            raise ('code '+str(n)+' is wrong length '+str(len(out[n])))
+    D.out = out
+def get_tmp(r=None):
+    if r != None: return r
+    return get_tmps(1)[0]
+def get_tmps(t):
+    rs = alloc(t)
+    regs = range(rs,rs+t)
+    for r in regs:
+        set_reg(r,"$"+str(D._tmpi))
+        D._tmpi += 1
+    D.tmpc += t #REG
+    return regs
+def alloc(t):
+    s = ''.join(["01"[r in D.r2n] for r in range(0,min(256,D.mreg+t))])
+    return s.index('0'*t)
+def is_tmp(r):
+    if r is None: return False
+    return (D.r2n[r][0] == '$')
+def un_tmp(r):
+    n = D.r2n[r]
+    free_reg(r)
+    set_reg(r,'*'+n)
+def free_tmp(r):
+    if is_tmp(r): free_reg(r)
+    return r
+def free_tmps(r):
+    for k in r: free_tmp(k)
+def get_reg(n):
+    if n not in D.n2r:
+        set_reg(alloc(1),n)
+    return D.n2r[n]
+#def get_clean_reg(n):
+    #if n in D.n2r: raise
+    #set_reg(D.mreg,n)
+    #return D.n2r[n]
+def set_reg(r,n):
+    D.n2r[n] = r; D.r2n[r] = n
+    D.mreg = max(D.mreg,r+1)
+def free_reg(r):
+    if is_tmp(r): D.tmpc -= 1
+    n = D.r2n[r]; del D.r2n[r]; del D.n2r[n]
+def imanage(orig,fnc):
+    items = orig.items
+    orig.val = orig.val[:-1]
+    t = Token(orig.pos,'symbol','=',[items[0],orig])
+    return fnc(t)
+def infix(i,tb,tc,r=None):
+    r = get_tmp(r)
+    b,c = do(tb,r),do(tc)
+    code(i,r,b,c)
+    if r != b: free_tmp(b)
+    free_tmp(c)
+    return r
+def ss_infix(ss,i,tb,tc,r=None):
+    r = get_tmp(r)
+    r2 = get_tmp()
+    ss = _do_number(ss)
+    t = get_tag()
+    r = do(tb,r)
+    code(EQ,r2,r,ss)
+    code(IF,r2)
+    jump(t,'else')
+    jump(t,'end')
+    tag(t,'else')
+    r = do(tc,r)
+    tag(t,'end')
+    free_tmp(r2) #REG
+    free_tmp(ss) #REG
+    return r
+def _do_none(r=None):
+    r = get_tmp(r)
+    code(NONE,r)
+    return r
+def do_symbol(t,r=None):
+    sets = ['=']
+    isets = ['+=','-=','*=','/=']
+    cmps = ['<','>','<=','>=','==','!=']
+    metas = {
+        '+':ADD,'*':MUL,'/':DIV,'**':POW,
+        '-':SUB,'and':AND,'or':OR,
+        '%':MOD,'>>':RSH,'<<':LSH,
+        '&':AND,'|':OR,
+    }
+    if t.val == 'None': return _do_none(r)
+    if t.val == 'True':
+        return _do_number('1',r)
+    if t.val == 'False':
+        return _do_number('0',r)
+    items = t.items
+    if t.val in ['and','or']:
+        ss = int(t.val == 'or')
+        return ss_infix(ss,metas[t.val],items[0],items[1],r)
+    if t.val in isets:
+        return imanage(t,do_symbol)
+    if t.val == 'is':
+        return infix(EQ,items[0],items[1],r)
+    if t.val == 'isnot':
+        return infix(CMP,items[0],items[1],r)
+    if t.val == 'not':
+        return infix(EQ,Token(t.pos,'number',0),items[0],r)
+    if t.val == 'in':
+        return infix(HAS,items[1],items[0],r)
+    if t.val == 'notin':
+        r = infix(HAS,items[1],items[0],r)
+        zero = _do_number('0')
+        code(EQ,r,r,free_tmp(zero))
+        return r
+    if t.val in sets:
+        return do_set_ctx(items[0],items[1]);
+    elif t.val in cmps:
+        b,c = items[0],items[1]
+        v = t.val
+        if v[0] in ('>','>='):
+            b,c,v = c,b,'<'+v[1:]
+        cd = EQ
+        if v == '<': cd = LT
+        if v == '<=': cd = LE
+        if v == '!=': cd = NE
+        return infix(cd,b,c,r)
+    else:
+        return infix(metas[t.val],items[0],items[1],r)
+def do_set_ctx(k,v):
+    if k.type == 'name':
+        if (D._globals and k.val not in D.vars) or (k.val in D.globals):
+            c = do_string(k)
+            b = do(v)
+            code(GSET,c,b)
+            free_tmp(c)
+            free_tmp(b)
+            return
+        a = do_local(k)
+        b = do(v)
+        code(MOVE,a,b)
+        free_tmp(b)
+        return a
+    elif k.type in ('tuple','list'):
+        if v.type in ('tuple','list'):
+            n,tmps = 0,[]
+            for kk in k.items:
+                vv = v.items[n]
+                tmp = get_tmp(); tmps.append(tmp)
+                r = do(vv)
+                code(MOVE,tmp,r)
+                free_tmp(r) #REG
+                n+=1
+            n = 0
+            for kk in k.items:
+                vv = v.items[n]
+                tmp = tmps[n]
+                free_tmp(do_set_ctx(kk,Token(vv.pos,'reg',tmp))) #REG
+                n += 1
+            return
+        r = do(v); un_tmp(r)
+        n, tmp = 0, Token(v.pos,'reg',r)
+        for tt in k.items:
+            free_tmp(do_set_ctx(tt,Token(tmp.pos,'get',None,[tmp,Token(tmp.pos,'number',str(n))]))) #REG
+            n += 1
+        free_reg(r)
+        return
+    r = do(k.items[0])
+    rr = do(v)
+    tmp = do(k.items[1])
+    code(SET,r,tmp,rr)
+    free_tmp(r) #REG
+    free_tmp(tmp) #REG
+    return rr
+def manage_seq(i,a,items,sav=0):
+    l = max(sav,len(items))
+    n,tmps = 0,get_tmps(l)
+    for tt in items:
+        r = tmps[n]
+        b = do(tt,r)
+        if r != b:
+            code(MOVE,r,b)
+            free_tmp(b)
+        n +=1
+    if not len(tmps):
+        code(i,a,0,0)
+        return 0
+    code(i,a,tmps[0],len(items))
+    free_tmps(tmps[sav:])
+    return tmps[0]
+def p_filter(items):
+    a,b,c,d = [],[],None,None
+    for t in items:
+        if t.type == 'symbol' and t.val == '=': b.append(t)
+        elif t.type == 'args': c = t
+        elif t.type == 'nargs': d = t
+        else: a.append(t)
+    return a,b,c,d
+def do_import(t):
+    for mod in t.items:
+        mod.type = 'string'
+        v = do_call(Token(t.pos,'call',None,[
+            Token(t.pos,'name','import'),
+            mod]))
+        mod.type = 'name'
+        do_set_ctx(mod,Token(t.pos,'reg',v))
+def do_from(t):
+    mod = t.items[0]
+    mod.type = 'string'
+    v = do(Token(t.pos,'call',None,[
+        Token(t.pos,'name','import'),
+        mod]))
+    item = t.items[1]
+    if item.val == '*':
+        free_tmp(do(Token(t.pos,'call',None,[
+            Token(t.pos,'name','merge'),
+            Token(t.pos,'name','__dict__'),
+            Token(t.pos,'reg',v)]))) #REG
+    else:
+        item.type = 'string'
+        free_tmp(do_set_ctx(
+            Token(t.pos,'get',None,[ Token(t.pos,'name','__dict__'),item]),
+            Token(t.pos,'get',None,[ Token(t.pos,'reg',v),item])
+            )) #REG
+def do_globals(t):
+    for t in t.items:
+        if t.val not in D.globals:
+            D.globals.append(t.val)
+def do_del(tt):
+    for t in tt.items:
+        r = do(t.items[0])
+        r2 = do(t.items[1])
+        code(DEL,r,r2)
+        free_tmp(r); free_tmp(r2) #REG
+def do_call(t,r=None):
+    r = get_tmp(r)
+    items = t.items
+    fnc = do(items[0])
+    a,b,c,d = p_filter(t.items[1:])
+    e = None
+    if len(b) != 0 or d != None:
+        e = do(Token(t.pos,'dict',None,[])); un_tmp(e);
+        for p in b:
+            p.items[0].type = 'string'
+            t1,t2 = do(p.items[0]),do(p.items[1])
+            code(SET,e,t1,t2)
+            free_tmp(t1); free_tmp(t2) #REG
+        if d: free_tmp(do(Token(t.pos,'call',None,[Token(t.pos,'name','merge'),Token(t.pos,'reg',e),d.items[0]]))) #REG
+    manage_seq(PARAMS,r,a)
+    if c != None:
+        t1,t2 = _do_string('*'),do(c.items[0])
+        code(SET,r,t1,t2)
+        free_tmp(t1); free_tmp(t2) #REG
+    if e != None:
+        t1 = _do_none()
+        code(SET,r,t1,e)
+        free_tmp(t1) #REG
+    code(CALL,r,fnc,r)
+    free_tmp(fnc) #REG
+    return r
+def do_name(t,r=None):
+    if t.val in D.vars:
+        return do_local(t,r)
+    r = get_tmp(r)
+    c = do_string(t)
+    code(GGET,r,c)
+    free_tmp(c)
+    return r
+def do_local(t,r=None):
+    if t.val not in D.vars:
+        D.vars.append(t.val)
+    return get_reg(t.val)
+def do_def(tok,kls=None):
+    items = tok.items
+    t = get_tag()
+    rf = fnc(t,'end')
+    D.begin()
+    setpos(tok.pos)
+    r = do_local(Token(tok.pos,'name','__params'))
+    do_info(items[0].val)
+    a,b,c,d = p_filter(items[1].items)
+    for p in a:
+        v = do_local(p)
+        tmp = _do_none()
+        code(GET,v,r,tmp)
+        free_tmp(tmp) #REG
+    for p in b:
+        v = do_local(p.items[0])
+        do(p.items[1],v)
+        tmp = _do_none()
+        code(IGET,v,r,tmp)
+        free_tmp(tmp) #REG
+    if c != None:
+        v = do_local(c.items[0])
+        tmp = _do_string('*')
+        code(GET,v,r,tmp)
+        free_tmp(tmp) #REG
+    if d != None:
+        e = do_local(d.items[0])
+        code(DICT,e,0,0)
+        tmp = _do_none()
+        code(IGET,e,r,tmp)
+        free_tmp(tmp) #REG
+    free_tmp(do(items[2])) #REG
+    D.end()
+    tag(t,'end')
+    if kls == None:
+        if D._globals: do_globals(Token(tok.pos,0,0,[items[0]]))
+        r = do_set_ctx(items[0],Token(tok.pos,'reg',rf))
+    else:
+        rn = do_string(items[0])
+        code(SET,kls,rn,rf)
+        free_tmp(rn)
+    free_tmp(rf)
+def do_class(t):
+    tok = t
+    items = t.items
+    parent = None
+    if items[0].type == 'name':
+        name = items[0].val
+    else:
+        name = items[0].items[0].val
+        parent = items[0].items[1].val
+    kls = do(Token(t.pos,'dict',0,[]))
+    ts = _do_string(name)
+    code(GSET,ts,kls)
+    free_tmp(ts) #REG
+    init,_new = False,[]
+    if parent:
+        _new.append(Token(t.pos,'call',None,[
+            Token(t.pos,'get',None,[
+                Token(t.pos,'name',parent),
+                Token(t.pos,'string','__new__'),
+                ]),
+            Token(t.pos,'name','self'),
+            ]))
+    for fc in items[1].items:
+        if fc.type != 'def': continue
+        fn = fc.items[0].val
+        if fn == '__init__': init = True
+        do_def(fc,kls)
+        _new.append(Token(fc.pos,'symbol','=',[
+            Token(fc.pos,'get',None,[
+                Token(fc.pos,'name','self'),
+                Token(fc.pos,'string',fn)]),
+            Token(fc.pos,'call',None,[
+                Token(fc.pos,'name','bind'),
+                Token(fc.pos,'get',None,[
+                    Token(fc.pos,'name',name),
+                    Token(fc.pos,'string',fn)]),
+                Token(fc.pos,'name','self')])
+            ]))
+    do_def(Token(t.pos,'def',None,[
+        Token(t.pos,'name','__new__'),
+        Token(t.pos,'list',None,[Token(t.pos,'name','self')]),
+        Token(t.pos,'statements',None,_new)]),kls)
+    t = get_tag()
+    rf = fnc(t,'end')
+    D.begin()
+    params = do_local(Token(tok.pos,'name','__params'))
+    slf = do_local(Token(tok.pos,'name','self'))
+    code(DICT,slf,0,0)
+    free_tmp(do(Token(tok.pos,'call',None,[
+        Token(tok.pos,'get',None,[
+            Token(tok.pos,'name',name),
+            Token(tok.pos,'string','__new__')]),
+        Token(tok.pos,'name','self')]))) #REG
+    if init:
+        tmp = get_tmp()
+        t3 = _do_string('__init__')
+        code(GET,tmp,slf,t3)
+        t4 = get_tmp()
+        code(CALL,t4,tmp,params)
+        free_tmp(tmp) #REG
+        free_tmp(t3) #REG
+        free_tmp(t4) #REG
+    code(RETURN,slf)
+    D.end()
+    tag(t,'end')
+    ts = _do_string('__call__')
+    code(SET,kls,ts,rf)
+    free_tmp(kls) #REG
+    free_tmp(ts) #REG
+def do_while(t):
+    items = t.items
+    t = stack_tag()
+    tag(t,'begin')
+    tag(t,'continue')
+    r = do(items[0])
+    code(IF,r)
+    free_tmp(r) #REG
+    jump(t,'end')
+    free_tmp(do(items[1])) #REG
+    jump(t,'begin')
+    tag(t,'break')
+    tag(t,'end')
+    pop_tag()
+def do_for(tok):
+    items = tok.items
+    reg = do_local(items[0])
+    itr = do(items[1])
+    i = _do_number('0')
+    t = stack_tag(); tag(t,'loop'); tag(t,'continue')
+    code(ITER,reg,itr,i); jump(t,'end')
+    free_tmp(do(items[2])) #REG
+    jump(t,'loop')
+    tag(t,'break'); tag(t,'end'); pop_tag()
+    free_tmp(itr) #REG
+    free_tmp(i)
+def do_comp(t,r=None):
+    name = 'comp:'+get_tag()
+    r = do_local(Token(t.pos,'name',name))
+    code(LIST,r,0,0)
+    key = Token(t.pos,'get',None,[
+            Token(t.pos,'reg',r),
+            Token(t.pos,'symbol','None')])
+    ap = Token(t.pos,'symbol','=',[key,t.items[0]])
+    do(Token(t.pos,'for',None,[t.items[1],t.items[2],ap]))
+    return r
+def do_if(t):
+    items = t.items
+    t = get_tag()
+    n = 0
+    for tt in items:
+        tag(t,n)
+        if tt.type == 'elif':
+            a = do(tt.items[0]); code(IF,a); free_tmp(a);
+            jump(t,n+1)
+            free_tmp(do(tt.items[1])) #REG
+        elif tt.type == 'else':
+            free_tmp(do(tt.items[0])) #REG
+        else:
+            raise
+        jump(t,'end')
+        n += 1
+    tag(t,n)
+    tag(t,'end')
+def do_try(t):
+    items = t.items
+    t = get_tag()
+    setjmp(t,'except')
+    free_tmp(do(items[0])) #REG
+    jump(t,'end')
+    tag(t,'except')
+    free_tmp(do(items[1].items[1])) #REG
+    tag(t,'end')
+def do_return(t):
+    if t.items: r = do(t.items[0])
+    else: r = _do_none()
+    code(RETURN,r)
+    free_tmp(r)
+    return
+def do_raise(t):
+    if t.items: r = do(t.items[0])
+    else: r = _do_none()
+    code(RAISE,r)
+    free_tmp(r)
+    return
+def do_statements(t):
+    for tt in t.items: free_tmp(do(tt))
+def do_list(t,r=None):
+    r = get_tmp(r)
+    manage_seq(LIST,r,t.items)
+    return r
+def do_dict(t,r=None):
+    r = get_tmp(r)
+    manage_seq(DICT,r,t.items)
+    return r
+def do_get(t,r=None):
+    items = t.items
+    return infix(GET,items[0],items[1],r)
+def do_break(t): jump(D.tstack[-1],'break')
+def do_continue(t): jump(D.tstack[-1],'continue')
+def do_pass(t): code(PASS)
+def do_info(name='?'):
+    if '-nopos' in ARGV: return
+    code(FILE,free_tmp(_do_string(D.fname)))
+    code(NAME,free_tmp(_do_string(name)))
+def do_module(t):
+    do_info()
+    free_tmp(do(t.items[0])) #REG
+def do_reg(t,r=None): return t.val
+fmap = {
+    'module':do_module,'statements':do_statements,'def':do_def,
+    'return':do_return,'while':do_while,'if':do_if,
+    'break':do_break,'pass':do_pass,'continue':do_continue,'for':do_for,
+    'class':do_class,'raise':do_raise,'try':do_try,'import':do_import,
+    'globals':do_globals,'del':do_del,'from':do_from,
+}
+rmap = {
+    'list':do_list, 'tuple':do_list, 'dict':do_dict, 'slice':do_list,
+    'comp':do_comp, 'name':do_name,'symbol':do_symbol,'number':do_number,
+    'string':do_string,'get':do_get, 'call':do_call, 'reg':do_reg,
+}
+def do(t,r=None):
+    if t.pos: setpos(t.pos)
+    try:
+        if t.type in rmap:
+            return rmap[t.type](t,r)
+        return fmap[t.type](t)
+    except:
+        if D.error: raise
+        D.error = True
+        tokenize.u_error('encode',D.code,t.pos)
+def encode(fname,s,t):
+    t = Token((1,1),'module','module',[t])
+    global D
+    s = tokenize.clean(s)
+    D = DState(s,fname)
+    D.begin(True)
+    do(t)
+    D.end()
+    map_tags()
+    out = D.out; D = None
+    return ''.join(out)

 /programs/develop/tinypy/tinypy/gc.c
 ,0 → 1,152
+/* tp_obj tp_track(TP,tp_obj v) { return v; }
+   void tp_grey(TP,tp_obj v) { }
+   void tp_full(TP) { }
+   void tp_gc_init(TP) { }
+   void tp_gc_deinit(TP) { }
+   void tp_delete(TP,tp_obj v) { }*/
+void tp_grey(TP,tp_obj v) {
+    if (v.type < TP_STRING || (!v.gci.data) || *v.gci.data) { return; }
+    *v.gci.data = 1;
+    if (v.type == TP_STRING || v.type == TP_DATA) {
+        _tp_list_appendx(tp,tp->black,v);
+        return;
+    }
+    _tp_list_appendx(tp,tp->grey,v);
+}
+void tp_follow(TP,tp_obj v) {
+    int type = v.type;
+    if (type == TP_LIST) {
+        int n;
+        for (n=0; n<v.list.val->len; n++) {
+            tp_grey(tp,v.list.val->items[n]);
+        }
+    }
+    if (type == TP_DICT) {
+        int i;
+        for (i=0; i<v.dict.val->len; i++) {
+            int n = _tp_dict_next(tp,v.dict.val);
+            tp_grey(tp,v.dict.val->items[n].key);
+            tp_grey(tp,v.dict.val->items[n].val);
+        }
+    }
+    if (type == TP_FNC) {
+        tp_grey(tp,v.fnc.info->self);
+        tp_grey(tp,v.fnc.info->globals);
+    }
+}
+void tp_reset(TP) {
+    int n;
+    _tp_list *tmp;
+    for (n=0; n<tp->black->len; n++) {
+        *tp->black->items[n].gci.data = 0;
+    }
+    tmp = tp->white;
+    tp->white = tp->black;
+    tp->black = tmp;
+}
+void tp_gc_init(TP) {
+    tp->white = _tp_list_new();
+    tp->strings = _tp_dict_new();
+    tp->grey = _tp_list_new();
+    tp->black = _tp_list_new();
+    tp->steps = 0;
+}
+void tp_gc_deinit(TP) {
+    _tp_list_free(tp->white);
+    _tp_dict_free(tp->strings);
+    _tp_list_free(tp->grey);
+    _tp_list_free(tp->black);
+}
+void tp_delete(TP,tp_obj v) {
+    int type = v.type;
+    if (type == TP_LIST) {
+        _tp_list_free(v.list.val);
+        return;
+    } else if (type == TP_DICT) {
+        _tp_dict_free(v.dict.val);
+        return;
+    } else if (type == TP_STRING) {
+        tp_free(v.string.info);
+        return;
+    } else if (type == TP_DATA) {
+        if (v.data.info->free) {
+            v.data.info->free(tp,v);
+        }
+        tp_free(v.data.info);
+        return;
+    } else if (type == TP_FNC) {
+        tp_free(v.fnc.info);
+        return;
+    }
+    tp_raise(,"tp_delete(%s)",TP_CSTR(v));
+}
+void tp_collect(TP) {
+    int n;
+    for (n=0; n<tp->white->len; n++) {
+        tp_obj r = tp->white->items[n];
+        if (*r.gci.data) { continue; }
+        if (r.type == TP_STRING) {
+            /*this can't be moved into tp_delete, because tp_delete is
+               also used by tp_track_s to delete redundant strings*/
+            _tp_dict_del(tp,tp->strings,r,"tp_collect");
+        }
+        tp_delete(tp,r);
+    }
+    tp->white->len = 0;
+    tp_reset(tp);
+}
+void _tp_gcinc(TP) {
+    tp_obj v;
+    if (!tp->grey->len) {
+        return;
+    }
+    v = _tp_list_pop(tp,tp->grey,tp->grey->len-1,"_tp_gcinc");
+    tp_follow(tp,v);
+    _tp_list_appendx(tp,tp->black,v);
+}
+void tp_full(TP) {
+    while (tp->grey->len) {
+        _tp_gcinc(tp);
+    }
+    tp_collect(tp);
+    tp_follow(tp,tp->root);
+}
+void tp_gcinc(TP) {
+    tp->steps += 1;
+    if (tp->steps < TP_GCMAX || tp->grey->len > 0) {
+        _tp_gcinc(tp); _tp_gcinc(tp);
+    }
+    if (tp->steps < TP_GCMAX || tp->grey->len > 0) { return; }
+    tp->steps = 0;
+    tp_full(tp);
+    return;
+}
+tp_obj tp_track(TP,tp_obj v) {
+    if (v.type == TP_STRING) {
+        int i = _tp_dict_find(tp,tp->strings,v);
+        if (i != -1) {
+            tp_delete(tp,v);
+            v = tp->strings->items[i].key;
+            tp_grey(tp,v);
+            return v;
+        }
+        _tp_dict_setx(tp,tp->strings,v,tp_True);
+    }
+    tp_gcinc(tp);
+    tp_grey(tp,v);
+    return v;
+}
+/**/

 /programs/develop/tinypy/tinypy/list.c
 ,0 → 1,133
+void _tp_list_realloc(_tp_list *self,int len) {
+    if (!len) { len=1; }
+    self->items = (tp_obj*)tp_realloc(self->items,len*sizeof(tp_obj));
+    self->alloc = len;
+}
+void _tp_list_set(TP,_tp_list *self,int k, tp_obj v, const char *error) {
+    if (k >= self->len) { tp_raise(,"%s: KeyError: %d\n",error,k); }
+    self->items[k] = v;
+    tp_grey(tp,v);
+}
+void _tp_list_free(_tp_list *self) {
+    tp_free(self->items);
+    tp_free(self);
+}
+tp_obj _tp_list_get(TP,_tp_list *self,int k,const char *error) {
+    if (k >= self->len) { tp_raise(tp_None,"%s: KeyError: %d\n",error,k); }
+    return self->items[k];
+}
+void _tp_list_insertx(TP,_tp_list *self, int n, tp_obj v) {
+    if (self->len >= self->alloc) {
+        _tp_list_realloc(self,self->alloc*2);
+    }
+    if (n < self->len) { memmove(&self->items[n+1],&self->items[n],sizeof(tp_obj)*(self->len-n)); }
+    self->items[n] = v;
+    self->len += 1;
+}
+void _tp_list_appendx(TP,_tp_list *self, tp_obj v) {
+    _tp_list_insertx(tp,self,self->len,v);
+}
+void _tp_list_insert(TP,_tp_list *self, int n, tp_obj v) {
+    _tp_list_insertx(tp,self,n,v);
+    tp_grey(tp,v);
+}
+void _tp_list_append(TP,_tp_list *self, tp_obj v) {
+    _tp_list_insert(tp,self,self->len,v);
+}
+tp_obj _tp_list_pop(TP,_tp_list *self, int n, const char *error) {
+    tp_obj r = _tp_list_get(tp,self,n,error);
+    if (n != self->len-1) { memmove(&self->items[n],&self->items[n+1],sizeof(tp_obj)*(self->len-(n+1))); }
+    self->len -= 1;
+    return r;
+}
+int _tp_list_find(TP,_tp_list *self, tp_obj v) {
+    int n;
+    for (n=0; n<self->len; n++) {
+        if (tp_cmp(tp,v,self->items[n]) == 0) {
+            return n;
+        }
+    }
+    return -1;
+}
+tp_obj tp_index(TP) {
+    tp_obj self = TP_OBJ();
+    tp_obj v = TP_OBJ();
+    int i = _tp_list_find(tp,self.list.val,v);
+    if (i < 0) { tp_raise(tp_None,"tp_index(%s,%s) - item not found",TP_CSTR(self),TP_CSTR(v)); }
+    return tp_number(i);
+}
+_tp_list *_tp_list_new(void) {
+    return (_tp_list*)tp_malloc(sizeof(_tp_list));
+}
+tp_obj _tp_list_copy(TP, tp_obj rr) {
+    tp_obj val = {TP_LIST};
+    _tp_list *o = rr.list.val;
+    _tp_list *r = _tp_list_new();
+    *r = *o; r->gci = 0;
+    r->items = (tp_obj*)tp_malloc(sizeof(tp_obj)*o->alloc);
+    memcpy(r->items,o->items,sizeof(tp_obj)*o->alloc);
+    val.list.val = r;
+    return tp_track(tp,val);
+}
+tp_obj tp_append(TP) {
+    tp_obj self = TP_OBJ();
+    tp_obj v = TP_OBJ();
+    _tp_list_append(tp,self.list.val,v);
+    return tp_None;
+}
+tp_obj tp_pop(TP) {
+    tp_obj self = TP_OBJ();
+    return _tp_list_pop(tp,self.list.val,self.list.val->len-1,"pop");
+}
+tp_obj tp_insert(TP) {
+    tp_obj self = TP_OBJ();
+    int n = TP_NUM();
+    tp_obj v = TP_OBJ();
+    _tp_list_insert(tp,self.list.val,n,v);
+    return tp_None;
+}
+tp_obj tp_extend(TP) {
+    tp_obj self = TP_OBJ();
+    tp_obj v = TP_OBJ();
+    int i;
+    for (i=0; i<v.list.val->len; i++) {
+        _tp_list_append(tp,self.list.val,v.list.val->items[i]);
+    }
+    return tp_None;
+}
+tp_obj tp_list(TP) {
+    tp_obj r = {TP_LIST};
+    r.list.val = _tp_list_new();
+    return tp ? tp_track(tp,r) : r;
+}
+tp_obj tp_list_n(TP,int n,tp_obj *argv) {
+    int i;
+    tp_obj r = tp_list(tp); _tp_list_realloc(r.list.val,n);
+    for (i=0; i<n; i++) {
+        _tp_list_append(tp,r.list.val,argv[i]);
+    }
+    return r;
+}
+int _tp_sort_cmp(tp_obj *a,tp_obj *b) {
+    return tp_cmp(0,*a,*b);
+}
+tp_obj tp_sort(TP) {
+    tp_obj self = TP_OBJ();
+    qsort(self.list.val->items, self.list.val->len, sizeof(tp_obj), (int(*)(const void*,const void*))_tp_sort_cmp);
+    return tp_None;
+}

 /programs/develop/tinypy/tinypy/misc.c
 ,0 → 1,68
+tp_obj *tp_ptr(tp_obj o) {
+    tp_obj *ptr = (tp_obj*)tp_malloc(sizeof(tp_obj)); *ptr = o;
+    return ptr;
+}
+tp_obj _tp_dcall(TP,tp_obj fnc(TP)) {
+    return fnc(tp);
+}
+tp_obj _tp_tcall(TP,tp_obj fnc) {
+    if (fnc.fnc.ftype&2) {
+        _tp_list_insert(tp,tp->params.list.val,0,fnc.fnc.info->self);
+    }
+    return _tp_dcall(tp,(tp_obj (*)(tp_vm *))fnc.fnc.val);
+}
+tp_obj tp_fnc_new(TP,int t, void *v, tp_obj s, tp_obj g) {
+    tp_obj r = {TP_FNC};
+    _tp_fnc *info = (_tp_fnc*)tp_malloc(sizeof(_tp_fnc));
+    info->self = s;
+    info->globals = g;
+    r.fnc.ftype = t;
+    r.fnc.info = info;
+    r.fnc.val = v;
+    return tp_track(tp,r);
+}
+tp_obj tp_def(TP,void *v, tp_obj g) {
+    return tp_fnc_new(tp,1,v,tp_None,g);
+}
+tp_obj tp_fnc(TP,tp_obj v(TP)) {
+    return tp_fnc_new(tp,0,v,tp_None,tp_None);
+}
+tp_obj tp_method(TP,tp_obj self,tp_obj v(TP)) {
+    return tp_fnc_new(tp,2,v,self,tp_None);
+}
+tp_obj tp_data(TP,int magic,void *v) {
+    tp_obj r = {TP_DATA};
+    r.data.info = (_tp_data*)tp_malloc(sizeof(_tp_data));
+    r.data.val = v;
+    r.data.magic = magic;
+    return tp_track(tp,r);
+}
+tp_obj tp_params(TP) {
+    tp_obj r;
+    tp->params = tp->_params.list.val->items[tp->cur];
+    r = tp->_params.list.val->items[tp->cur];
+    r.list.val->len = 0;
+    return r;
+}
+tp_obj tp_params_n(TP,int n, tp_obj argv[]) {
+    tp_obj r = tp_params(tp);
+    int i; for (i=0; i<n; i++) { _tp_list_append(tp,r.list.val,argv[i]); }
+    return r;
+}
+tp_obj tp_params_v(TP,int n,...) {
+    int i;
+    tp_obj r = tp_params(tp);
+    va_list a; va_start(a,n);
+    for (i=0; i<n; i++) {
+        _tp_list_append(tp,r.list.val,va_arg(a,tp_obj));
+    }
+    va_end(a);
+    return r;
+}

 /programs/develop/tinypy/tinypy/parse.py
 ,0 → 1,408
+import tokenize
+from tokenize import Token
+if '.' in str(1.0):
+    from boot import *
+def check(t,*vs):
+    if vs[0] == None: return True
+    if t.type in vs: return True
+    if t.type == 'symbol' and t.val in vs: return True
+    return False
+def tweak(k,v):
+    P.stack.append((k,dmap[k]))
+    if v: dmap[k] = omap[k]
+    else: dmap[k] = {'lbp':0,'nud':itself}
+def restore():
+    k,v = P.stack.pop()
+    dmap[k] = v
+def cpy(d):
+    r = {}
+    for k in d: r[k] = d[k]
+    return r
+class PData:
+    def __init__(self,s,tokens):
+        self.s = s
+        self.tokens = tokens
+        self.pos = 0
+        self.token = None
+        self.stack = []
+    def init(self):
+        global omap,dmap
+        omap = cpy(base_dmap)
+        dmap = cpy(base_dmap)
+        self.advance()
+    def advance(self,val=None):
+        if not check(self.token,val):
+            error('expected '+val,self.token)
+        if self.pos < len(self.tokens):
+            t = self.tokens[self.pos]
+            self.pos += 1
+        else:
+            t = Token((0,0),'eof','eof')
+        self.token = do(t)
+        return t
+def error(ctx,t):
+    print t
+    tokenize.u_error(ctx,P.s,t.pos)
+def nud(t):
+    #if 'nud' not in t:
+    #    error('no nud',t)
+    return t.nud(t)
+def led(t,left):
+    #if 'led' not in t:
+    #    error('no led',t)
+    return t.led(t,left)
+def get_lbp(t):
+    #if 'lbp' not in t:
+    #    error('no lbp',t)
+    return t.lbp
+def get_items(t):
+    #if 'items' not in t:
+    #    error('no items',t)
+    return t.items
+def expression(rbp):
+    t = P.token
+    advance()
+    left = nud(t)
+    while rbp < get_lbp(P.token):
+        t = P.token
+        advance()
+        left = led(t,left)
+    return left
+def infix_led(t,left):
+    t.items = [left,expression(t.bp)]
+    return t
+def infix_is(t,left):
+    if check(P.token,'not'):
+        t.val = 'isnot'
+        advance('not')
+    t.items = [left,expression(t.bp)]
+    return t
+def infix_not(t,left):
+    advance('in')
+    t.val = 'notin'
+    t.items = [left,expression(t.bp)]
+    return t
+def infix_tuple(t,left):
+    r = expression(t.bp)
+    if left.val == ',':
+        left.items.append(r)
+        return left
+    t.items = [left,r]
+    t.type = 'tuple'
+    return t
+def lst(t):
+    if t == None: return []
+    if check(t,',','tuple','statements'):
+        return get_items(t)
+    return [t]
+def ilst(typ,t):
+    return Token(t.pos,typ,typ,lst(t))
+def call_led(t,left):
+    r = Token(t.pos,'call','$',[left])
+    while not check(P.token,')'):
+        tweak(',',0)
+        r.items.append(expression(0))
+        if P.token.val == ',': advance(',')
+        restore()
+    advance(")")
+    return r
+def get_led(t,left):
+    r = Token(t.pos,'get','.',[left])
+    items =  [left]
+    more = False
+    while not check(P.token,']'):
+        more = False
+        if check(P.token,':'):
+            items.append(Token(P.token.pos,'symbol','None'))
+        else:
+            items.append(expression(0))
+        if check(P.token,':'):
+            advance(':')
+            more = True
+    if more:
+        items.append(Token(P.token.pos,'symbol','None'))
+    if len(items) > 2:
+        items = [left,Token(t.pos,'slice',':',items[1:])]
+    r.items = items
+    advance("]")
+    return r
+def dot_led(t,left):
+    r = expression(t.bp)
+    r.type = 'string'
+    t.items = [left,r]
+    return t
+def itself(t):
+    return t
+def paren_nud(t):
+    tweak(',',1)
+    r = expression(0)
+    restore()
+    advance(')')
+    return r
+def list_nud(t):
+    t.type = 'list'
+    t.val = '[]'
+    t.items = []
+    next = P.token
+    tweak(',',0)
+    while not check(P.token,'for',']'):
+        r = expression(0)
+        t.items.append(r)
+        if P.token.val == ',': advance(',')
+    if check(P.token,'for'):
+        t.type = 'comp'
+        advance('for')
+        tweak('in',0)
+        t.items.append(expression(0))
+        advance('in')
+        t.items.append(expression(0))
+        restore()
+    restore()
+    advance(']')
+    return t
+def dict_nud(t):
+    t.type='dict'
+    t.val = '{}'
+    t.items = []
+    tweak(',',0)
+    while not check(P.token,'}'):
+        t.items.append(expression(0))
+        if check(P.token,':',','): advance()
+    restore()
+    advance('}')
+    return t
+def advance(t=None):
+    return P.advance(t)
+def block():
+    items = []
+    tok = P.token
+    while check(P.token,'nl'): advance()
+    if check(P.token,'indent'):
+        advance('indent')
+        while not check(P.token,'dedent'):
+            items.append(expression(0))
+            while check(P.token,';','nl'): advance()
+        advance('dedent')
+    else:
+        items.append(expression(0))
+        while check(P.token,';'):
+            advance(';')
+            items.append(expression(0))
+    while check(P.token,'nl'): advance()
+    if len(items) > 1:
+        return Token(tok.pos,'statements',';',items)
+    return items.pop()
+def def_nud(t):
+    items = t.items = []
+    items.append(P.token); advance()
+    advance('(')
+    r = Token(t.pos,'symbol','():',[])
+    items.append(r)
+    while not check(P.token,')'):
+        tweak(',',0)
+        r.items.append(expression(0))
+        if check(P.token,','): advance(',')
+        restore()
+    advance(')')
+    advance(':')
+    items.append(block())
+    return t
+def while_nud(t):
+    items = t.items = []
+    items.append(expression(0))
+    advance(':')
+    items.append(block())
+    return t
+def class_nud(t):
+    items = t.items = []
+    items.append(expression(0))
+    advance(':')
+    items.append(ilst('methods',block()))
+    return t
+def from_nud(t):
+    items = t.items = []
+    items.append(expression(0))
+    advance('import')
+    items.append(expression(0))
+    return t
+def for_nud(t):
+    items = t.items = []
+    tweak('in',0)
+    items.append(expression(0))
+    advance('in')
+    items.append(expression(0))
+    restore()
+    advance(':')
+    items.append(block())
+    return t
+def if_nud(t):
+    items = t.items = []
+    a = expression(0)
+    advance(':')
+    b = block()
+    items.append(Token(t.pos,'elif','elif',[a,b]))
+    while check(P.token,'elif'):
+        tok = P.token
+        advance('elif')
+        a = expression(0)
+        advance(':')
+        b = block()
+        items.append(Token(tok.pos,'elif','elif',[a,b]))
+    if check(P.token,'else'):
+        tok = P.token
+        advance('else')
+        advance(':')
+        b = block()
+        items.append(Token(tok.pos,'else','else',[b]))
+    return t
+def try_nud(t):
+    items = t.items = []
+    advance(':')
+    b = block()
+    items.append(b)
+    while check(P.token,'except'):
+        tok = P.token
+        advance('except')
+        if not check(P.token,':'): a = expression(0)
+        else: a = Token(tok.pos,'symbol','None')
+        advance(':')
+        b = block()
+        items.append(Token(tok.pos,'except','except',[a,b]))
+    if check(P.token,'else'):
+        tok = P.token
+        advance('else')
+        advance(':')
+        b = block()
+        items.append(Token(tok.pos,'else','else',[b]))
+    return t
+def prefix_nud(t):
+    #bp = 70
+    #if 'bp' in t: bp = t['bp']
+    bp = t.bp
+    t.items = [expression(bp)]
+    return t
+def prefix_nud0(t):
+    if check(P.token,'nl',';','eof','dedent'): return t
+    return prefix_nud(t)
+def prefix_nuds(t):
+    r = expression(0)
+    return ilst(t.type,r)
+def prefix_neg(t):
+    r = expression(50)
+    if r.type == 'number':
+        r.val = str(-float(r.val))
+        return r
+    t.items = [Token(t.pos,'number','0'),r]
+    return t
+def vargs_nud(t):
+    r = prefix_nud(t)
+    t.type = 'args'
+    t.val = '*'
+    return t
+def nargs_nud(t):
+    r = prefix_nud(t)
+    t.type = 'nargs'
+    t.val = '**'
+    return t
+base_dmap = {
+    ',':{'lbp':20,'bp':20,'led':infix_tuple},
+    '+':{'lbp':50,'bp':50,'led':infix_led},
+    '-':{'lbp':50,'nud':prefix_neg,
+        'bp':50,'led':infix_led},
+    'not':{'lbp':35,'nud':prefix_nud,'bp':35,
+        'bp':35,'led':infix_not },
+    '%':{'lbp':60,'bp':60,'led':infix_led},
+    '*':{'lbp':60,'nud':vargs_nud,
+        'bp':60,'led':infix_led,},
+    '**': {'lbp':65,'nud':nargs_nud,
+        'bp':65,'led':infix_led,},
+    '/':{'lbp':60,'bp':60,'led':infix_led},
+    '(':{'lbp':70,'nud':paren_nud,
+        'bp':80,'led':call_led,},
+    '[':{'lbp':70,'nud':list_nud,
+        'bp':80,'led':get_led,},
+    '{':{'lbp':0,'nud':dict_nud,},
+    '.':{'lbp':80,'bp':80,'led':dot_led,'type':'get',},
+    'break':{'lbp':0,'nud':itself,'type':'break'},
+    'pass':{'lbp':0,'nud':itself,'type':'pass'},
+    'continue':{'lbp':0,'nud':itself,'type':'continue'},
+    'eof':{'lbp':0,'type':'eof','val':'eof'},
+    'def':{'lbp':0,'nud':def_nud,'type':'def',},
+    'while':{'lbp':0,'nud':while_nud,'type':'while',},
+    'for':{'lbp':0,'nud':for_nud,'type':'for',},
+    'try':{'lbp':0,'nud':try_nud,'type':'try',},
+    'if':{'lbp':0,'nud':if_nud,'type':'if',},
+    'class':{'lbp':0,'nud':class_nud,'type':'class',},
+    'raise':{'lbp':0,'nud':prefix_nud0,'type':'raise','bp':20,},
+    'return':{'lbp':0,'nud':prefix_nud0,'type':'return','bp':10,},
+    'import':{'lbp':0,'nud':prefix_nuds,'type':'import','bp':20,},
+    'from':{'lbp':0,'nud':from_nud,'type':'from','bp':20,},
+    'del':{'lbp':0,'nud':prefix_nuds,'type':'del','bp':10,},
+    'global':{'lbp':0,'nud':prefix_nuds,'type':'globals','bp':20,},
+    '=':{
+        'lbp':10,'bp':9,'led':infix_led,
+        },
+}
+def i_infix(bp,led,*vs):
+    for v in vs: base_dmap[v] = {'lbp':bp,'bp':bp,'led':led}
+i_infix(40,infix_led,'<','>','<=','>=','!=','==')
+i_infix(40,infix_is,'is','in')
+i_infix(10,infix_led,'+=','-=','*=','/=')
+i_infix(31,infix_led,'and','&')
+i_infix(30,infix_led,'or','|')
+i_infix(36,infix_led,'<<','>>')
+def i_terms(*vs):
+    for v in vs: base_dmap[v] = {'lbp':0,'nud':itself}
+i_terms(')','}',']',';',':','nl','elif','else','True','False','None','name','string','number','indent','dedent','except')
+base_dmap['nl']['val'] = 'nl'
+def gmap(t,v):
+    if v not in dmap:
+        error('unknown "%s"'%v,t)
+    return dmap[v]
+def do(t):
+    if t.type == 'symbol': r = gmap(t,t.val)
+    else: r = gmap(t,t.type)
+    merge(t,r)
+    return t
+def do_module():
+    tok = P.token
+    items = []
+    while not check(P.token,'eof'):
+        items.append(block())
+    if len(items) > 1:
+        return Token(tok.pos,'statements',';',items)
+    return items.pop()
+def parse(s,tokens,wrap=0):
+    global P
+    s = tokenize.clean(s)
+    P=PData(s,tokens); P.init()
+    r = do_module()
+    P = None
+    return r

 /programs/develop/tinypy/tinypy/string.c
 ,0 → 1,165
+#include <stdarg.h>
+tp_obj tp_string_t(TP, int n) {
+    tp_obj r = tp_string_n(0,n);
+    r.string.info = (_tp_string*)tp_malloc(sizeof(_tp_string)+n);
+    r.string.val = r.string.info->s;
+    return r;
+}
+tp_obj tp_printf(TP, char const *fmt,...) {
+    int l;
+    tp_obj r;
+    char tmp[2000];
+    char *s;
+    va_list arg;
+    va_start(arg, fmt);
+    l = vsnprintf(tmp, sizeof(tmp), fmt,arg);
+    r = tp_string_t(tp,l);
+    s = r.string.info->s;
+    va_end(arg);
+    va_start(arg, fmt);
+    vsprintf(s,fmt,arg);
+    va_end(arg);
+    return tp_track(tp,r);
+}
+int _tp_str_index(tp_obj s, tp_obj k) {
+    int i=0;
+    while ((s.string.len - i) >= k.string.len) {
+        if (memcmp(s.string.val+i,k.string.val,k.string.len) == 0) {
+            return i;
+        }
+        i += 1;
+    }
+    return -1;
+}
+tp_obj tp_join(TP) {
+    tp_obj delim = TP_OBJ();
+    tp_obj val = TP_OBJ();
+    int l=0,i;
+    tp_obj r;
+    char *s;
+    for (i=0; i<val.list.val->len; i++) {
+        if (i!=0) { l += delim.string.len; }
+        l += tp_str(tp,val.list.val->items[i]).string.len;
+    }
+    r = tp_string_t(tp,l);
+    s = r.string.info->s;
+    l = 0;
+    for (i=0; i<val.list.val->len; i++) {
+        tp_obj e;
+        if (i!=0) {
+            memcpy(s+l,delim.string.val,delim.string.len); l += delim.string.len;
+        }
+        e = tp_str(tp,val.list.val->items[i]);
+        memcpy(s+l,e.string.val,e.string.len); l += e.string.len;
+    }
+    return tp_track(tp,r);
+}
+tp_obj tp_string_slice(TP,tp_obj s, int a, int b) {
+    tp_obj r = tp_string_t(tp,b-a);
+    char *m = r.string.info->s;
+    memcpy(m,s.string.val+a,b-a);
+    return tp_track(tp,r);
+}
+tp_obj tp_split(TP) {
+    tp_obj v = TP_OBJ();
+    tp_obj d = TP_OBJ();
+    tp_obj r = tp_list(tp);
+    int i;
+    while ((i=_tp_str_index(v,d))!=-1) {
+        _tp_list_append(tp,r.list.val,tp_string_slice(tp,v,0,i));
+        v.string.val += i + d.string.len; v.string.len -= i + d.string.len;
+/*         tp_grey(tp,r); // should stop gc or something instead*/
+    }
+    _tp_list_append(tp,r.list.val,tp_string_slice(tp,v,0,v.string.len));
+/*     tp_grey(tp,r); // should stop gc or something instead*/
+    return r;
+}
+tp_obj tp_find(TP) {
+    tp_obj s = TP_OBJ();
+    tp_obj v = TP_OBJ();
+    return tp_number(_tp_str_index(s,v));
+}
+tp_obj tp_str_index(TP) {
+    tp_obj s = TP_OBJ();
+    tp_obj v = TP_OBJ();
+    int n = _tp_str_index(s,v);
+    if (n >= 0) { return tp_number(n); }
+    tp_raise(tp_None,"tp_str_index(%s,%s)",s,v);
+}
+tp_obj tp_str2(TP) {
+    tp_obj v = TP_OBJ();
+    return tp_str(tp,v);
+}
+tp_obj tp_chr(TP) {
+    int v = TP_NUM();
+    return tp_string_n(tp->chars[(unsigned char)v],1);
+}
+tp_obj tp_ord(TP) {
+    char const *s = TP_STR();
+    return tp_number((unsigned char)s[0]);
+}
+tp_obj tp_strip(TP) {
+    char const *v = TP_STR();
+    int i, l = strlen(v); int a = l, b = 0;
+    tp_obj r;
+    char *s;
+    for (i=0; i<l; i++) {
+        if (v[i] != ' ' && v[i] != '\n' && v[i] != '\t' && v[i] != '\r') {
+            a = _tp_min(a,i); b = _tp_max(b,i+1);
+        }
+    }
+    if ((b-a) < 0) { return tp_string(""); }
+    r = tp_string_t(tp,b-a);
+    s = r.string.info->s;
+    memcpy(s,v+a,b-a);
+    return tp_track(tp,r);
+}
+tp_obj tp_replace(TP) {
+    tp_obj s = TP_OBJ();
+    tp_obj k = TP_OBJ();
+    tp_obj v = TP_OBJ();
+    tp_obj p = s;
+    int i,n = 0;
+    int c;
+    int l;
+    tp_obj rr;
+    char *r;
+    char *d;
+    tp_obj z;
+    while ((i = _tp_str_index(p,k)) != -1) {
+        n += 1;
+        p.string.val += i + k.string.len; p.string.len -= i + k.string.len;
+    }
+/*     fprintf(stderr,"ns: %d\n",n); */
+    l = s.string.len + n * (v.string.len-k.string.len);
+    rr = tp_string_t(tp,l);
+    r = rr.string.info->s;
+    d = r;
+    z = p = s;
+    while ((i = _tp_str_index(p,k)) != -1) {
+        p.string.val += i; p.string.len -= i;
+        memcpy(d,z.string.val,c=(p.string.val-z.string.val)); d += c;
+        p.string.val += k.string.len; p.string.len -= k.string.len;
+        memcpy(d,v.string.val,v.string.len); d += v.string.len;
+        z = p;
+    }
+    memcpy(d,z.string.val,(s.string.val + s.string.len) - z.string.val);
+    return tp_track(tp,rr);
+}

 /programs/develop/tinypy/tinypy/tests.py
 ,0 → 1,750
+# figure out if we're in python or tinypy (tinypy displays "1.0" as "1")
+is_tinypy = (str(1.0) == "1")
+if not is_tinypy:
+    from boot import *
+################################################################################
+RM = 'rm -f '
+VM = './vm '
+TINYPY = './tinypy '
+TMP = 'tmp.txt'
+if '-mingw32' in ARGV or "-win" in ARGV:
+    RM = 'del '
+    VM = 'vm '
+    TINYPY = 'tinypy '
+    TMP = 'tmp.txt'
+    #TMP = 'stdout.txt'
+def system_rm(fname):
+    system(RM+fname)
+################################################################################
+#if not is_tinypy:
+    #v = chksize()
+    #assert (v < 65536)
+################################################################################
+def t_show(t):
+    if t.type == 'string': return '"'+t.val+'"'
+    if t.type == 'number': return t.val
+    if t.type == 'symbol': return t.val
+    if t.type == 'name': return '$'+t.val
+    return t.type
+def t_tokenize(s,exp=''):
+    import tokenize
+    result = tokenize.tokenize(s)
+    res = ' '.join([t_show(t) for t in result])
+    #print(s); print(exp); print(res)
+    assert(res == exp)
+if __name__ == '__main__':
+    t_tokenize("234",'234')
+    t_tokenize("234.234",'234.234')
+    t_tokenize("phil",'$phil')
+    t_tokenize("_phil234",'$_phil234')
+    t_tokenize("'phil'",'"phil"')
+    t_tokenize('"phil"','"phil"')
+    t_tokenize("'phil' x",'"phil" $x')
+    t_tokenize("#comment","")
+    t_tokenize("and","and")
+    t_tokenize("=","=")
+    t_tokenize("()","( )")
+    t_tokenize("(==)","( == )")
+    t_tokenize("phil=234","$phil = 234")
+    t_tokenize("a b","$a $b")
+    t_tokenize("a\nb","$a nl $b")
+    t_tokenize("a\n    b","$a nl indent $b dedent")
+    t_tokenize("a\n    b\n        c", "$a nl indent $b nl indent $c dedent dedent")
+    t_tokenize("a\n    b\n    c", "$a nl indent $b nl $c dedent")
+    t_tokenize("a\n    b\n        \n      c", "$a nl indent $b nl nl indent $c dedent dedent")
+    t_tokenize("a\n    b\nc", "$a nl indent $b nl dedent $c")
+    t_tokenize("a\n  b\n    c\nd", "$a nl indent $b nl indent $c nl dedent dedent $d")
+    t_tokenize("(\n  )","( )")
+    t_tokenize("  x","indent $x dedent")
+    t_tokenize("  #","")
+    t_tokenize("None","None")
+################################################################################
+def t_lisp(t):
+    if t.type == 'block':
+        return """{%s}"""%' '.join([t_lisp(tt) for tt in t.items])
+    if t.type == 'statement':
+        return """%s;"""%' '.join([t_lisp(tt) for tt in t.items])
+    if t.items == None: return t.val
+    args = ''.join([" "+t_lisp(tt) for tt in t.items])
+    return "("+t.val+args+")"
+def t_parse(s,ex=''):
+    import tokenize, parse
+    r = ''
+    tokens = tokenize.tokenize(s)
+    tree = parse.parse(s,tokens)
+    r = t_lisp(tree)
+    #print(s); print(ex); print(r)
+    assert(r==ex)
+if __name__ == '__main__':
+    t_parse('2+4*3', '(+ 2 (* 4 3))')
+    t_parse('4*(2+3)', '(* 4 (+ 2 3))')
+    t_parse('(2+3)*4', '(* (+ 2 3) 4)')
+    t_parse('1<2', '(< 1 2)')
+    t_parse('x=3', '(= x 3)')
+    t_parse('x = 2*3', '(= x (* 2 3))')
+    t_parse('x = y', '(= x y)')
+    t_parse('2,3', '(, 2 3)')
+    t_parse('2,3,4', '(, 2 3 4)')
+    t_parse('[]', '([])')
+    t_parse('[1]', '([] 1)')
+    t_parse('[2,3,4]', '([] 2 3 4)')
+    t_parse('print(3)', '($ print 3)')
+    t_parse('print()', '($ print)')
+    t_parse('print(2,3)', '($ print 2 3)')
+    t_parse('def fnc():pass', '(def fnc (():) pass)')
+    t_parse('def fnc(x):pass', '(def fnc ((): x) pass)')
+    t_parse('def fnc(x,y):pass', '(def fnc ((): x y) pass)')
+    t_parse('x\ny\nz', '(; x y z)')
+    t_parse('return x', '(return x)')
+    t_parse('print(test(2,3))', '($ print ($ test 2 3))')
+    t_parse('x.y', '(. x y)')
+    t_parse('get(2).x', '(. ($ get 2) x)')
+    t_parse('{}', '({})')
+    t_parse('True', 'True')
+    t_parse('False', 'False')
+    t_parse('None', 'None')
+    t_parse('while 1:pass', '(while 1 pass)')
+    t_parse('for x in y:pass', '(for x y pass)')
+    t_parse('print("x")', '($ print x)')
+    t_parse('if 1: pass', '(if (elif 1 pass))')
+    t_parse('x = []', '(= x ([]))')
+    t_parse('x[1]', '(. x 1)')
+    t_parse('import sdl', '(import sdl)')
+    t_parse('2 is 3', '(is 2 3)')
+    t_parse('2 is not 3', '(isnot 2 3)')
+    t_parse('x is None', '(is x None)')
+    t_parse('2 is 3 or 4 is 5', '(or (is 2 3) (is 4 5))')
+    t_parse('e.x == 3 or e.x == 4', '(or (== (. e x) 3) (== (. e x) 4))')
+    t_parse('if 1==2: 3\nelif 4:5\nelse:6', '(if (elif (== 1 2) 3) (elif 4 5) (else 6))')
+    t_parse('x = y(2)*3 + y(4)*5', '(= x (+ (* ($ y 2) 3) (* ($ y 4) 5)))')
+    t_parse('x(1,2)+y(3,4)', '(+ ($ x 1 2) ($ y 3 4))')
+    t_parse('x(a,b,c[d])', '($ x a b (. c d))')
+    t_parse('x(1,2)*j+y(3,4)*k+z(5,6)*l', '(+ (+ (* ($ x 1 2) j) (* ($ y 3 4) k)) (* ($ z 5 6) l))')
+    t_parse('a = b.x/c * 2 - 1', '(= a (- (* (/ (. b x) c) 2) 1))')
+    t_parse('for x in y: z', '(for x y z)')
+    t_parse('min(255,n*2)','($ min 255 (* n 2))')
+    t_parse('c = pal[i*8]','(= c (. pal (* i 8)))')
+    t_parse('{x:y,a:b}','({} x y a b)')
+    t_parse('x[1:2:3]','(. x (: 1 2 3))')
+    if is_tinypy: t_parse('x - -234','(- x -234)')
+    else: t_parse('x - -234','(- x -234.0)')
+    t_parse('x - -y','(- x (- 0 y))')
+    t_parse('x = ((y*4)-2)','(= x (- (* y 4) 2))')
+    if is_tinypy: t_parse('print([1,2,"OK",4][-3:3][1])','($ print (. (. ([] 1 2 OK 4) (: -3 3)) 1))')
+    else: t_parse('print([1,2,"OK",4][-3:3][1])','($ print (. (. ([] 1 2 OK 4) (: -3.0 3)) 1))')
+    t_parse('a,b = 1,2','(= (, a b) (, 1 2))')
+    t_parse('class C: pass','(class C (methods pass))')
+    t_parse('def test(*v): pass','(def test ((): (* v)) pass)')
+    t_parse('def test(**v): pass','(def test ((): (** v)) pass)')
+    t_parse('test(*v)','($ test (* v))')
+    t_parse('test(**v)','($ test (** v))')
+    t_parse('def test(x=y): pass','(def test ((): (= x y)) pass)')
+    t_parse('test(x=y)','($ test (= x y))')
+    t_parse('def test(y="K",x="Z"): pass','(def test ((): (= y K) (= x Z)) pass)')
+    t_parse('return x+y','(return (+ x y))')
+    t_parse('if "a" is not "b": pass','(if (elif (isnot a b) pass))')
+    t_parse('z = 0\nfor x in y: pass','(; (= z 0) (for x y pass))')
+    t_parse('for k in {"OK":0}: pass','(for k ({} OK 0) pass)')
+    t_parse('print(test(10,3,z=50000,*[200],**{"x":4000}))','($ print ($ test 10 3 (= z 50000) (* ([] 200)) (** ({} x 4000))))')
+    t_parse('x="OK";print(x)','(; (= x OK) ($ print x))')
+    t_parse('[(1,3)]','([] (, 1 3))')
+    t_parse('x[:]','(. x (: None None))')
+    t_parse('x[:1]','(. x (: None 1))')
+    t_parse('x[1:]','(. x (: 1 None))')
+    t_parse('return\nx','(; return x)')
+    t_parse('"""test"""','test')
+    t_parse('return a,b','(return (, a b))')
+################################################################################
+def showerror(cmd, ss, ex, res):
+    print(cmd)
+    print("ss : '" + str(ss) + "'")
+    print("ex : '" + str(ex) + "'")
+    print("res: '" + str(res) + "'")
+def t_render(ss,ex,exact=True):
+    import tokenize, parse, encode
+    if not istype(ss,'list'): ss =[ss]
+    n = 1
+    for s in ss:
+        fname = 'tmp'+str(n)+'.tpc'
+        system_rm(fname)
+        tokens = tokenize.tokenize(s)
+        t = parse.parse(s,tokens)
+        r = encode.encode(fname,s,t)
+        f = save(fname,r)
+        n += 1
+    system_rm('tmp.txt')
+    cmd = VM + fname + " > tmp.txt"
+    system(cmd)
+    res = load(TMP).strip()
+    #print(ss,ex,res)
+    if exact:
+        if res != ex: showerror(cmd, ss, ex, res)
+        assert(res == ex)
+    else:
+        if ex not in res: showerror(cmd, ss, ex, res)
+        assert(ex in res)
+def test_range():
+    t_render("""print(str(range(4))[:5])""","<list")
+    t_render("""print(len(range(4)))""","4")
+    t_render("""print(range(4)[0])""","0")
+    t_render("""print(range(4)[1])""","1")
+    t_render("""print(range(4)[-1])""","3")
+    t_render("""print(str(range(-4))[:5])""","<list")
+    t_render("""print(len(range(-4)))""","0")
+    t_render("""print(str(range(0,5,3))[:5])""","<list")
+    t_render("""print(len(range(0,5,3)))""","2")
+    t_render("""print(range(0,5,3)[0])""","0")
+    t_render("""print(range(0,5,3)[1])""","3")
+    t_render("""print(range(0,5,3)[-1])""","3")
+    t_render("""print(str(range(5,0,-3))[:5])""","<list")
+    t_render("""print(len(range(5,0,-3)))""","2")
+    t_render("""print(range(5,0,-3)[0])""","5")
+    t_render("""print(range(5,0,-3)[1])""","2")
+    t_render("""print(range(5,0,-3)[-1])""","2")
+    t_render("""print(str(range(-8,-4))[:5])""","<list")
+    t_render("""print(len(range(-8,-4)))""","4")
+    t_render("""print(range(-8,-4)[0])""","-8")
+    t_render("""print(range(-8,-4)[1])""","-7")
+    t_render("""print(range(-8,-4)[-1])""","-5")
+    t_render("""print(str(range(-4,-8,-1))[:5])""","<list")
+    t_render("""print(len(range(-4,-8,-1)))""","4")
+    t_render("""print(range(-4,-8,-1)[0])""","-4")
+    t_render("""print(range(-4,-8,-1)[1])""","-5")
+    t_render("""print(range(-4,-8,-1)[-1])""","-7")
+    t_render("""print(str(range(-4,-8))[:5])""","<list")
+    t_render("""print(len(range(-4,-8)))""","0")
+    t_render("""print(str(range(-8,-4,-1))[:5])""","<list")
+    t_render("""print(len(range(-8,-4,-1)))""","0")
+    t_render("""print(str(range(0,4,0))[:5])""","<list")
+    t_render("""print(len(range(0,4,0)))""","0")
+if __name__ == '__main__':
+    t_render('print("hello world")',"hello world")
+    t_render('print(234)',"234")
+    t_render('a=3\nprint(a)',"3")
+    t_render('print(2+3)',"5")
+    t_render("""
+x = 2
+x += 3
+print(x)
+"""
+,"5")
+    t_render("""
+x = "OK"
+print(x)
+"""
+,"OK")
+    t_render("""
+a,b = 1,2
+print(a+b)
+"""
+,"3")
+    t_render("""
+x = 1
+if x == 1:
+    print("yes")
+""","yes")
+    t_render("""
+if 0 == 1:
+    print("X")
+else:
+    print("OK")
+"""
+,"OK")
+    t_render("""
+if 0 == 1:
+    print("X")
+elif 1 == 2:
+    print("Y")
+else:
+    print("OK")
+"""
+,"OK")
+    t_render("""
+def test(x,y):
+    return x+y
+r = test(3,5)
+print(r)
+""","8")
+    t_render("""
+x = 1
+t = 0
+while x<=5:
+    t = t+x
+    x = x+1
+print(t)
+""","15")
+    t_render("""
+x = {}
+x.y = "test"
+print(x.y)
+""","test")
+    t_render("""
+if "a" is "a":
+    print("OK")
+"""
+,"OK")
+    t_render("""
+if "a" is not "b":
+    print("OK")
+"""
+,"OK")
+    t_render("""
+if None is None:
+    print("OK")
+"""
+,"OK")
+    t_render("""
+if "x" is "x" or "y" is "y":
+    print("OK")
+"""
+,"OK")
+    t_render("""
+x = 1
+while x < 3:
+    break
+    x = x + 1
+print(x)
+"""
+,"1")
+    t_render("""
+x = 1
+n = 0
+while x < 10:
+    x = x + 1
+    if n == 2:
+        continue
+    n = n + 1
+print(n)
+"""
+,"2")
+    t_render("""
+def test(x): return x
+y = test(1)*2 + test(3)*4 + test(5)*6
+print(y)
+"""
+,"44")
+    t_render("""
+def test(a,b): return a+b
+print(test(1,1)+test(1,1))
+"""
+,"4")
+    t_render("""
+def test(): print("OK")
+x = test
+x()
+"""
+,"OK")
+    t_render("""
+x = [2,4,6]
+print(x[1])
+"""
+,"4")
+    t_render("""
+def test(): print("OK")
+x = [1,test,2]
+x[1]()
+"""
+,"OK")
+    t_render("""
+z = 0
+for x in [1,2,3]:
+    z += x
+print(z)
+"""
+,"6")
+    t_render("""
+z = 0
+for x in range(1,4):
+    z += x
+print(z)
+"""
+,"6")
+    t_render("""
+x = {'a':'OK'}
+print(x.a)
+"""
+,"OK")
+    t_render("""print("1234"[1:3])""","23")
+    t_render("""print("1234"[-3:3])""","23")
+    t_render("""print([1,2,"OK",4][-3:3][1])""","OK")
+    t_render("""
+n = 0
+for x in range(0,10,2):
+    n += 1
+print(n)
+"""
+,"5")
+    t_render("""print(max(3,8,2,6))""","8")
+    t_render("""print(min(3,4,2,6))""","2")
+    t_render("""for k in {'OK':0}: print(k)""","OK")
+    t_render("""
+X = "OK"
+def test(): print(X)
+test()
+"""
+,"OK")
+    t_render("""
+a = 4
+def test(z):
+    for i in range(0,a):
+        z += i
+    return z
+print(test(1))
+"""
+,"7")
+    t_render("""
+def test(self): print(self)
+fnc = bind(test,"OK")
+fnc()
+"""
+,"OK")
+    t_render("""
+class C:
+    def __init__(self,data): self.data = data
+    def print(self): print(self.data)
+C("OK").print()
+"""
+,"OK")
+    t_render("""
+x = [v*v for v in range(0,5)]
+print(x[3])
+"""
+,"9")
+    t_render("""
+t = [[y*10+x for x in range(0,10)] for y in range(0,10)]
+print(t[2][3])
+"""
+,"23")
+    t_render("""
+x = [1]
+x.extend([2,3])
+print(x[1])
+"""
+,"2")
+    #t_render("""
+#x = {'a':3}
+#merge(x,{'b':4})
+#print(x.b)
+#"""
+#,"4")
+    t_render("""
+x = [1,2,3]
+y = copy(x)
+y[0] *= 10
+print(x[0]+y[0])
+"""
+,"11")
+    t_render("""
+x = {'a':3}
+y = copy(x)
+y.a *= 10
+print(x.a+y.a)
+"""
+,"33")
+    t_render("""
+x = {}
+y = x['x']
+"""
+,'KeyError',0)
+    t_render("""
+x = []
+y = x[1]
+"""
+,'KeyError',0)
+    t_render("""print("O"+"K")""","OK")
+    t_render("""print("-".join(["O","K"]))""","O-K")
+    t_render("""print("OK-OK".split("-")[1])""","OK")
+    t_render("""
+def test(*v): return max(v[2])
+print(test(*[1,2,"OK"]))
+"""
+,"OK")
+    t_render("""
+def test(**v): return v['x']
+print(test(**{'x':'OK'}))
+"""
+,"OK")
+    #t_render("""
+#def test(y='K',x='Z'): print(x+y)
+#test(x='O')
+#"""
+#,"OK")
+    t_render("""
+def test(y='K',x='Z'): print(x+y)
+test('O')
+"""
+,"ZO")
+    #t_render("""
+#def test(a,b=2,*c,**d): return a+b+c[0]+d['x']+d['z']
+#print(test(10,3,z=50000,*[200],**{'x':4000}))
+#"""
+#,"54213")
+    t_render("""print("".join(["O"]+["K"]))""","OK")
+    t_render("""x="OK";print(x)""","OK")
+    t_render("""x = [1,2,] ; print(x[1])""","2")
+    t_render("""a,b,d = [0],0,'OK'; print(d)""","OK")
+    t_render("""
+def test(): raise
+try:
+    test()
+except:
+    print("OK")
+""","OK")
+    t_render("""print("OKx"[:-1])""","OK")
+    t_render("""print("xOK"[1:])""","OK")
+    t_render("""a,b = "OK"; print(a+b)""","OK")
+    t_render("""
+def test(a,b):
+    print a+b[2]
+test(1,3)
+""","Exception",False)
+    t_render("""
+def test(): raise
+test()
+""","Exception",False)
+    t_render(['OK="OK"',"import tmp1\nprint(tmp1.OK)"],"OK")
+    t_render(['O="O"','K="K"',"import tmp1, tmp2\nprint(tmp1.O+tmp2.K)"],"OK")
+    t_render("""
+def test(): return
+x = 1
+print(test())
+""","None")
+    t_render("""
+def test(): pass
+x = 1
+print(test())
+""","None")
+    t_render("""
+def test():
+    global x
+    x = "OK"
+test()
+print(x)
+""","OK")
+    t_render("""
+class X:
+    pass
+y = X()
+print("OK")
+""","OK")
+    t_render("""
+class X: pass
+def test(): y = X()
+test()
+print("OK")
+""","OK")
+    t_render(["class X: pass\ndef test(): y = X()","import tmp1\ntmp1.test();print('OK')"],"OK")
+    t_render("print(len([1,2,3]))","3")
+    t_render('if not "?" in "xyz": print("OK")',"OK")
+    t_render('print({1:"OK"}[1])',"OK")
+    t_render('print(len("\0"))',"1")
+    t_render('print(1 in {1:2})',"1")
+    t_render('x = {1:2}; del x[1]; print(len(x))','0')
+    t_render("""
+def test(t):
+    t = "O"+t
+    print(t)
+test("K")
+""","OK")
+    t_render("""print([1,2,3].index(3))""","2")
+    t_render("""print("1,2,3".split(",").index("3"))""","2")
+    t_render("""v = [3,2,1]; v.sort(); print(v[0])""","1")
+    t_render("""print(abs(-5))""","5")
+    t_render("""print(int(1.234))""","1")
+    t_render("print(int(round(1.5)))","2")
+    t_render("print(ord('X'))","88")
+    t_render("print(ord(chr(128)))","128")
+    #t_render("print(fsize('LICENSE.txt'))","181")
+    t_render("print(int('ff',16))","255")
+    t_render("""
+def test(x,y): print(x); return y
+test('a',1) or test('b',1) and test('c',0)
+""","a")
+    t_render("def test(): print('OK')\n{'__call__':test}()","OK")
+    t_render("""
+class A:
+    def __init__(self):
+        self.a = 'O'
+        self.b = 'x'
+    def test(self):
+        print("KO")
+class B(A):
+    def __init__(self):
+        A.__init__(self)
+        self.b = 'K'
+    def test(self):
+        print(self.a+self.b)
+B().test()
+""","OK")
+    t_render("""
+class A:
+    def test(self):
+        print(self)
+A.test("OK")
+""","OK")
+    t_render("""
+def test():
+    def fnc():
+        print("OK")
+    fnc()
+test()
+""","OK")
+    t_render("""print("aa..bbb...ccc".replace("..","X"))""","aaXbbbX.ccc")
+    t_render("""print("..bbb..".replace("..","X"))""","XbbbX")
+    t_render("""print("234".replace("\r\n","\n"))""","234")
+    t_render("""print("a\0b".replace("\0","X"))""","aXb")
+    t_render("""x = "a\0b"; x = x.replace("\0","c"); print(x)""","acb")
+    t_render("""print(0xff)""","255")
+    t_render("""x=(1,3);print({x:'OK'}[x])""","OK")
+    t_render("""x=(1,3);y=(1,3);print({x:'OK'}[y])""","OK")
+    t_render("""print({(1,3):'OK'}[(1,3)])""","OK")
+    t_render("def test(): test()\ntest()","Exception",0)
+    t_render("x = []; x.append(x); print(x<x)","0");
+    t_render("x = []; x.append(x); print({x:'OK'}[x])","OK")
+    #t_render("print(float(str(4294967296))==float('4294967296'))","1")
+    t_render("print(2**3)","8")
+    #t_render("x = 'OK',\nprint(x[0])","OK")
+    test_range()
+    t_render(['v="OK"',"from tmp1 import *\nprint(v)"],"OK")
+    t_render(['v="OK"',"from tmp1 import v\nprint(v)"],"OK")
+    t_render(['x="X";y="K"',"x = 'O'\nfrom tmp1 import y\nprint(x+y)"],"OK")
+    t_render("""
+def test(**e):
+    print(e['x'])
+test(x='OK')
+""","OK")
+    # test register allocator
+    s = "def f():pass\n"+("f()\n"*256)+"print('OK')"
+    t_render(s,"OK")
+    t_render("print(2**3)","8")
+    t_render("print(2*3**2)", "18", False)
+    t_render("""
+def test(**v): return 'OK'
+print(test())
+"""
+,"OK")
+    t_render("""
+def test(**v):
+    v['x'] = 'OK'
+    return v
+print(test()['x'])
+"""
+,"OK")
+################################################################################
+def t_boot(ss,ex,exact=True):
+    if not istype(ss,'list'): ss =[ss]
+    n = 1
+    for s in ss:
+        fname = 'tmp'+str(n)+'.tpc'
+        system_rm(fname)
+        fname = 'tmp'+str(n)+'.py'
+        save(fname,s)
+        n += 1
+    system_rm('tmp.txt')
+    system(TINYPY+fname+' > tmp.txt')
+    res = load(TMP).strip()
+    #print(ss,ex,res)
+    if exact: assert(res == ex)
+    else: assert(ex in res)
+is_boot = False
+try:
+    assert(is_tinypy == True)
+    x = compile('x=3','')
+    is_boot = True
+except:
+    pass
+if is_boot == True and __name__ == '__main__':
+    print("# t_boot")
+    t_boot(["def test(): print('OK')","import tmp1; tmp1.test()"],"OK")

 /programs/develop/tinypy/tinypy/tokenize.py
 ,0 → 1,171
+class Token:
+    def __init__(self,pos=(0,0),type='symbol',val=None,items=None):
+        self.pos,self.type,self.val,self.items=pos,type,val,items
+def u_error(ctx,s,i):
+    y,x = i
+    line = s.split('\n')[y-1]
+    p = ''
+    if y < 10: p += ' '
+    if y < 100: p += '  '
+    r = p + str(y) + ": " + line + "\n"
+    r += "     "+" "*x+"^" +'\n'
+    raise 'error: '+ctx+'\n'+r
+ISYMBOLS = '`-=[];,./~!@$%^&*()+{}:<>?'
+SYMBOLS = [
+    'def','class','yield','return','pass','and','or','not','in','import',
+    'is','while','break','for','continue','if','else','elif','try',
+    'except','raise','True','False','None','global','del','from',
+    '-','+','*','**','/','%','<<','>>',
+    '-=','+=','*=','/=','=','==','!=','<','>',
+    '<=','>=','[',']','{','}','(',')','.',':',',',';','&','|','!',
+    ]
+B_BEGIN,B_END = ['[','(','{'],[']',')','}']
+class TData:
+    def __init__(self):
+        self.y,self.yi,self.nl = 1,0,True
+        self.res,self.indent,self.braces = [],[0],0
+    def add(self,t,v): self.res.append(Token(self.f,t,v))
+def clean(s):
+    s = s.replace('\r\n','\n')
+    s = s.replace('\r','\n')
+    return s
+def tokenize(s):
+    s = clean(s)
+    try: return do_tokenize(s)
+    except: u_error('tokenize',s,T.f)
+def do_tokenize(s):
+    global T
+    T,i,l = TData(),0,len(s)
+    T.f = (T.y,i-T.yi+1)
+    while i < l:
+        c = s[i]; T.f = (T.y,i-T.yi+1)
+        if T.nl: T.nl = False; i = do_indent(s,i,l)
+        elif c == '\n': i = do_nl(s,i,l)
+        elif c in ISYMBOLS: i = do_symbol(s,i,l)
+        elif c >= '0' and c <= '9': i = do_number(s,i,l)
+        elif (c >= 'a' and c <= 'z') or \
+            (c >= 'A' and c <= 'Z') or c == '_':  i = do_name(s,i,l)
+        elif c=='"' or c=="'": i = do_string(s,i,l)
+        elif c=='#': i = do_comment(s,i,l)
+        elif c == '\\' and s[i+1] == '\n':
+            i += 2; T.y,T.yi = T.y+1,i
+        elif c == ' ' or c == '\t': i += 1
+        else: u_error('tokenize',s,T.f)
+    indent(0)
+    r = T.res; T = None
+    return r
+def do_nl(s,i,l):
+    if not T.braces:
+        T.add('nl',None)
+    i,T.nl = i+1,True
+    T.y,T.yi = T.y+1,i
+    return i
+def do_indent(s,i,l):
+    v = 0
+    while i<l:
+        c = s[i]
+        if c != ' ' and c != '\t': break
+        i,v = i+1,v+1
+    if c != '\n' and c != '#' and not T.braces: indent(v)
+    return i
+def indent(v):
+    if v == T.indent[-1]: pass
+    elif v > T.indent[-1]:
+        T.indent.append(v)
+        T.add('indent',v)
+    elif v < T.indent[-1]:
+        n = T.indent.index(v)
+        while len(T.indent) > n+1:
+            v = T.indent.pop()
+            T.add('dedent',v)
+def do_symbol(s,i,l):
+    symbols = []
+    v,f,i = s[i],i,i+1
+    if v in SYMBOLS: symbols.append(v)
+    while i<l:
+        c = s[i]
+        if not c in ISYMBOLS: break
+        v,i = v+c,i+1
+        if v in SYMBOLS: symbols.append(v)
+    v = symbols.pop(); n = len(v); i = f+n
+    T.add('symbol',v)
+    if v in B_BEGIN: T.braces += 1
+    if v in B_END: T.braces -= 1
+    return i
+def do_number(s,i,l):
+    v,i,c =s[i],i+1,s[i]
+    while i<l:
+        c = s[i]
+        if (c < '0' or c > '9') and (c < 'a' or c > 'f') and c != 'x': break
+        v,i = v+c,i+1
+    if c == '.':
+        v,i = v+c,i+1
+        while i<l:
+            c = s[i]
+            if c < '0' or c > '9': break
+            v,i = v+c,i+1
+    T.add('number',v)
+    return i
+def do_name(s,i,l):
+    v,i =s[i],i+1
+    while i<l:
+        c = s[i]
+        if (c < 'a' or c > 'z') and (c < 'A' or c > 'Z') and (c < '0' or c > '9') and c != '_': break
+        v,i = v+c,i+1
+    if v in SYMBOLS: T.add('symbol',v)
+    else: T.add('name',v)
+    return i
+def do_string(s,i,l):
+    v,q,i = '',s[i],i+1
+    if (l-i) >= 5 and s[i] == q and s[i+1] == q: # """
+        i += 2
+        while i<l-2:
+            c = s[i]
+            if c == q and s[i+1] == q and s[i+2] == q:
+                i += 3
+                T.add('string',v)
+                break
+            else:
+                v,i = v+c,i+1
+                if c == '\n': T.y,T.yi = T.y+1,i
+    else:
+        while i<l:
+            c = s[i]
+            if c == "\\":
+                i = i+1; c = s[i]
+                if c == "n": c = '\n'
+                if c == "r": c = chr(13)
+                if c == "t": c = "\t"
+                if c == "0": c = "\0"
+                v,i = v+c,i+1
+            elif c == q:
+                i += 1
+                T.add('string',v)
+                break
+            else:
+                v,i = v+c,i+1
+    return i
+def do_comment(s,i,l):
+    i += 1
+    while i<l:
+        c = s[i]
+        if c == '\n': break
+        i += 1
+    return i

 /programs/develop/tinypy/tinypy/tp.c
 ,0 → 1,32
+#ifndef TP_COMPILER
+#define TP_COMPILER 1
+#endif
+#include "tp.h"
+#include "list.c"
+#include "koconsole.c"
+#include "dict.c"
+#include "misc.c"
+#include "string.c"
+#include "builtins.c"
+#include "gc.c"
+#include "ops.c"
+void tp_compiler(TP);
+#include "vm.c"
+tp_obj tp_None = {TP_NONE};
+#if TP_COMPILER
+#include "bc.c"
+void tp_compiler(TP) {
+    tp_import(tp,0,"tokenize",tp_tokenize);
+    tp_import(tp,0,"parse",tp_parse);
+    tp_import(tp,0,"encode",tp_encode);
+    tp_import(tp,0,"py2bc",tp_py2bc);
+    tp_call(tp,"py2bc","_init",tp_None);
+}
+#else
+void tp_compiler(TP) { }
+#endif
+/**/

 /programs/develop/tinypy/tinypy/tp.h
 ,0 → 1,233
+#ifndef TP_H
+#define TP_H
+#include <setjmp.h>
+#include <sys/stat.h>
+#ifndef __USE_ISOC99
+#define __USE_ISOC99
+#endif
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <stdarg.h>
+#include <math.h>
+#ifdef __GNUC__
+#define tp_inline __inline__
+#endif
+#ifdef _MSC_VER
+#define tp_inline __inline
+#endif
+#ifndef tp_inline
+#error "Unsuported compiler"
+#endif
+#define tp_malloc(x) calloc((x),1)
+#define tp_realloc(x,y) realloc(x,y)
+#define tp_free(x) free(x)
+/* #include <gc/gc.h>
+   #define tp_malloc(x) GC_MALLOC(x)
+   #define tp_realloc(x,y) GC_REALLOC(x,y)
+   #define tp_free(x)*/
+enum {
+    TP_NONE,TP_NUMBER,TP_STRING,TP_DICT,
+    TP_LIST,TP_FNC,TP_DATA,
+};
+typedef double tp_num;
+typedef struct tp_number_ {
+    int type;
+    tp_num val;
+} tp_number_;
+typedef struct tp_string_ {
+    int type;
+    struct _tp_string *info;
+    char const *val;
+    int len;
+} tp_string_;
+typedef struct tp_list_ {
+    int type;
+    struct _tp_list *val;
+} tp_list_;
+typedef struct tp_dict_ {
+    int type;
+    struct _tp_dict *val;
+} tp_dict_;
+typedef struct tp_fnc_ {
+    int type;
+    struct _tp_fnc *info;
+    int ftype;
+    void *val;
+} tp_fnc_;
+typedef struct tp_data_ {
+    int type;
+    struct _tp_data *info;
+    void *val;
+    int magic;
+} tp_data_;
+typedef union tp_obj {
+    int type;
+    tp_number_ number;
+    struct { int type; int *data; } gci;
+    tp_string_ string;
+    tp_dict_ dict;
+    tp_list_ list;
+    tp_fnc_ fnc;
+    tp_data_ data;
+} tp_obj;
+typedef struct _tp_string {
+    int gci;
+    char s[1];
+} _tp_string;
+typedef struct _tp_list {
+    int gci;
+    tp_obj *items;
+    int len;
+    int alloc;
+} _tp_list;
+typedef struct tp_item {
+    int used;
+    int hash;
+    tp_obj key;
+    tp_obj val;
+} tp_item;
+typedef struct _tp_dict {
+    int gci;
+    tp_item *items;
+    int len;
+    int alloc;
+    int cur;
+    int mask;
+    int used;
+} _tp_dict;
+typedef struct _tp_fnc {
+    int gci;
+    tp_obj self;
+    tp_obj globals;
+} _tp_fnc;
+typedef union tp_code {
+    unsigned char i;
+    struct { unsigned char i,a,b,c; } regs;
+    struct { char val[4]; } string;
+    struct { float val; } number;
+} tp_code;
+typedef struct tp_frame_ {
+    tp_code *codes;
+    tp_code *cur;
+    tp_code *jmp;
+    tp_obj *regs;
+    tp_obj *ret_dest;
+    tp_obj fname;
+    tp_obj name;
+    tp_obj line;
+    tp_obj globals;
+    int lineno;
+    int cregs;
+} tp_frame_;
+#define TP_GCMAX 4096
+#define TP_FRAMES 256
+/* #define TP_REGS_PER_FRAME 256*/
+#define TP_REGS 16384
+typedef struct tp_vm {
+    tp_obj builtins;
+    tp_obj modules;
+    tp_frame_ frames[TP_FRAMES];
+    tp_obj _params;
+    tp_obj params;
+    tp_obj _regs;
+    tp_obj *regs;
+    tp_obj root;
+    jmp_buf buf;
+    int jmp;
+    tp_obj ex;
+    char chars[256][2];
+    int cur;
+    /* gc*/
+    _tp_list *white;
+    _tp_list *grey;
+    _tp_list *black;
+    _tp_dict *strings;
+    int steps;
+} tp_vm;
+#define TP tp_vm *tp
+typedef struct _tp_data {
+    int gci;
+    void (*free)(TP,tp_obj);
+} _tp_data;
+/* NOTE: these are the few out of namespace items for convenience*/
+#define tp_True tp_number(1)
+#define tp_False tp_number(0)
+#define TP_CSTR(v) ((tp_str(tp,(v))).string.val)
+extern tp_obj tp_None;
+void tp_set(TP,tp_obj,tp_obj,tp_obj);
+tp_obj tp_get(TP,tp_obj,tp_obj);
+tp_obj tp_len(TP,tp_obj);
+tp_obj tp_str(TP,tp_obj);
+int tp_cmp(TP,tp_obj,tp_obj);
+void _tp_raise(TP,tp_obj);
+tp_obj tp_printf(TP,char const *fmt,...);
+tp_obj tp_track(TP,tp_obj);
+void tp_grey(TP,tp_obj);
+/* __func__ __VA_ARGS__ __FILE__ __LINE__ */
+#define tp_raise(r,fmt,...) { \
+    _tp_raise(tp,tp_printf(tp,fmt,__VA_ARGS__)); \
+    return r; \
+}
+#define TP_OBJ() (tp_get(tp,tp->params,tp_None))
+tp_inline static tp_obj tp_type(TP,int t,tp_obj v) {
+    if (v.type != t) { tp_raise(tp_None,"_tp_type(%d,%s)",t,TP_CSTR(v)); }
+    return v;
+}
+#define TP_TYPE(t) tp_type(tp,t,TP_OBJ())
+#define TP_NUM() (TP_TYPE(TP_NUMBER).number.val)
+#define TP_STR() (TP_CSTR(TP_TYPE(TP_STRING)))
+#define TP_DEFAULT(d) (tp->params.list.val->len?tp_get(tp,tp->params,tp_None):(d))
+#define TP_LOOP(e) \
+    int __l = tp->params.list.val->len; \
+    int __i; for (__i=0; __i<__l; __i++) { \
+    (e) = _tp_list_get(tp,tp->params.list.val,__i,"TP_LOOP");
+#define TP_END \
+    }
+tp_inline static int _tp_min(int a, int b) { return (a<b?a:b); }
+tp_inline static int _tp_max(int a, int b) { return (a>b?a:b); }
+tp_inline static int _tp_sign(tp_num v) { return (v<0?-1:(v>0?1:0)); }
+tp_inline static tp_obj tp_number(tp_num v) {
+    tp_obj val = {TP_NUMBER};
+    val.number.val = v;
+    return val;
+}
+tp_inline static tp_obj tp_string(char const *v) {
+    tp_obj val;
+    tp_string_ s = {TP_STRING, 0, v, 0};
+    s.len = strlen(v);
+    val.string = s;
+    return val;
+}
+tp_inline static tp_obj tp_string_n(char const *v,int n) {
+    tp_obj val;
+    tp_string_ s = {TP_STRING, 0,v,n};
+    val.string = s;
+    return val;
+}
+#endif

 /programs/develop/tinypy/tinypy/vmmain.c
 ,0 → 1,9
+#define TP_COMPILER 0
+#include "tp.c"
+int main(int argc, char *argv[]) {
+    tp_vm *tp = tp_init(argc,argv);
+    tp_import(tp,argv[1],"__main__",0);
+    tp_deinit(tp);
+    return(0);
+}

 /programs/develop/tinypy/modules/kolibri/debug.c
 ,0 → 1,19
+#include "tp.h"
+void debug_write_byte(const char ch){
+    __asm__ __volatile__(
+    "int $0x40"
+    ::"a"(63), "b"(1), "c"(ch)
+    );
+}
+tp_obj kolibri_debug_print(TP)
+{
+    tp_obj str = TP_TYPE(TP_STRING);
+    for(int i=0; i < str.string.len; i++)
+    {
+       debug_write_byte(str.string.val[i]);
+    }
+    return tp_None;
+}

 /programs/develop/tinypy/modules/kolibri/gui.c
 ,0 → 1,163
+#include "tp.h"
+#include <kos32sys.h>
+typedef unsigned short int uint16_t;
+typedef unsigned int uint32_t;
+extern void _tp_raise(TP,tp_obj);
+extern tp_obj tp_dict(TP);
+extern tp_obj tp_method(TP,tp_obj self,tp_obj v(TP));
+extern tp_obj tp_number(tp_num v);
+extern tp_obj tp_list(TP);
+extern void _tp_list_append(TP,_tp_list *self, tp_obj v);
+extern tp_obj tp_call(TP, const char *mod, const char *fnc, tp_obj params);
+extern void _tp_call(TP,tp_obj *dest, tp_obj fnc, tp_obj params);
+extern int tp_bool(TP,tp_obj v);
+extern tp_obj tp_has(TP,tp_obj self, tp_obj k);
+// #define _cdecl __attribute__((cdecl))
+extern int (* _cdecl con_printf)(const char* format,...);
+static tp_obj kolibri_show(TP)
+{
+    tp_obj self = TP_TYPE(TP_DICT);
+    uint16_t xpos = (uint16_t)(tp_get(tp, self, tp_string("x")).number.val);
+    uint16_t ypos = (uint16_t)tp_get(tp, self, tp_string("y")).number.val;
+    uint16_t height = (uint16_t)tp_get(tp, self, tp_string("height")).number.val;
+    uint16_t width = (uint16_t)tp_get(tp, self, tp_string("width")).number.val;
+    uint16_t fixedsize = (uint16_t)tp_get(tp, self, tp_string("fixedsize")).number.val;
+    uint32_t bgcolor = (uint32_t)tp_get(tp, self, tp_string("bgcolor")).number.val;
+    uint32_t status;
+    uint32_t style;
+    uint32_t x = xpos * 0x10000 + width;
+    uint32_t y = ypos * 0x10000 + height;
+    if (fixedsize)
+        style = 0;
+    else
+        style = 0x33000000 + (bgcolor & 0xFFFFFF);
+    asm volatile ("int $0x40"::"a"(12), "b"(1));
+    asm volatile ("int $0x40"::
+                  "a"(0), "b"(x), "c"(y), "d"(style),
+                  "S"(0), "D"(0));
+    asm volatile ("int $0x40"::"a"(12), "b"(2));
+    /* If window has additional handler, run it. */
+    if (tp_bool(tp, tp_has(tp, self, tp_string("on_show"))))
+    {
+        tp_obj result;
+        tp_obj fnc = tp_get(tp, self, tp_string("on_show"));
+        tp_obj param_list = tp_list(tp); /* Prepare parameters. */
+        _tp_list_append(tp, param_list.list.val, self);
+        _tp_call(tp, &result, fnc, param_list);
+    }
+    return tp_None;
+}
+static void window_function(void)
+{
+    uint32_t ev;
+    /* Wait for event. */
+    do {
+        asm volatile("int $0x40":"=a"(ev):"a"(10));
+    } while(ev != 3);
+    asm volatile("int $040"::"a"(-1));
+}
+static tp_obj kolibri_default_handler(TP)
+{
+    return tp_None;
+}
+/* Run window_function() in separated thread. */
+static tp_obj kolibri_run(TP)
+{
+    tp_obj self = TP_TYPE(TP_DICT);
+    tp_obj redraw = tp_get(tp, self, tp_string("show"));
+    tp_obj result;
+    tp_obj key_handler = tp_None;
+    tp_obj button_handler = tp_None;
+    int    button_id;
+    uint32_t ev;
+    int    leave=0;
+    tp_obj param_list;
+    /* Obtain handlers. */
+    if (tp_bool(tp, tp_has(tp, self, tp_string("on_key"))))
+        key_handler = tp_get(tp, self, tp_string("on_key"));
+    if (tp_bool(tp, tp_has(tp, self, tp_string("on_button"))))
+        button_handler = tp_get(tp, self, tp_string("on_button"));
+    while(!leave){
+        asm volatile("int $0x40":"=a"(ev):"a"(10));
+        switch (ev)
+        {
+            case 1:
+                _tp_call(tp, &result, redraw, tp_None);
+                break;
+            case 2:
+                if (key_handler.type == TP_FNC)
+                {
+                    param_list = tp_list(tp); /* Prepare parameters. */
+                    _tp_list_append(tp, param_list.list.val, self);
+                    oskey_t key;
+                    key = get_key();
+                    _tp_list_append(tp, param_list.list.val, tp_number(key.code));
+                    _tp_call(tp, &result, key_handler, param_list);
+                }
+                break;
+            case 3:
+                button_id = get_os_button();
+                if (button_id == 1)
+                    leave = 1;
+                else if (button_handler.type == TP_FNC)
+                {
+                    param_list = tp_list(tp); /* Prepare parameters. */
+                    _tp_list_append(tp, param_list.list.val, self);
+                    _tp_list_append(tp, param_list.list.val, tp_number(button_id));
+                    _tp_call(tp, &result, button_handler, param_list);
+                }
+                break;
+            default:
+                con_printf("Got unknown event %d\n", ev);
+                break;
+        }
+    };
+    return tp_None;
+}
+static tp_obj kolibri_print_text(TP)
+{
+    tp_obj self = TP_TYPE(TP_DICT);
+    uint32_t textcolor = (uint32_t)tp_get(tp, self, tp_string("textcolor")).number.val;
+    uint16_t x = (uint16_t)tp_get(tp, self, tp_string("curx")).number.val;
+    uint16_t y = (uint16_t)tp_get(tp, self, tp_string("cury")).number.val;
+    uint32_t ofs;
+    uint32_t width = (uint32_t)tp_get(tp, self, tp_string("width")).number.val;
+    tp_obj text = TP_TYPE(TP_STRING);
+    draw_text_sys((char *)text.string.val, x, y, text.string.len, textcolor);
+    /* Update cursor position. */
+    ofs = 6 * text.string.len;
+    tp_set(tp, self, tp_string("cury"), tp_number(y + 9 * ((x + ofs) / width)));
+    tp_set(tp, self, tp_string("curx"), tp_number((x + ofs)%width));
+    return tp_None;
+}
+tp_obj kolibri_mainwindow(TP)
+{
+    tp_obj obj = tp_dict(tp);
+    obj = tp_dict(tp);
+    tp_set(tp, obj, tp_string("x"), TP_TYPE(TP_NUMBER));
+    tp_set(tp, obj, tp_string("y"), TP_TYPE(TP_NUMBER));
+    tp_set(tp, obj, tp_string("height"), TP_TYPE(TP_NUMBER));
+    tp_set(tp, obj, tp_string("width"), TP_TYPE(TP_NUMBER));
+    tp_set(tp, obj, tp_string("curx"), tp_number(0));
+    tp_set(tp, obj, tp_string("cury"), tp_number(0));
+    tp_set(tp, obj, tp_string("fixedsize"), TP_TYPE(TP_NUMBER));
+    tp_set(tp, obj, tp_string("textcolor"), tp_number(0x202020));
+    tp_set(tp, obj, tp_string("bgcolor"), tp_number(0xFFFFFF));
+    tp_set(tp, obj, tp_string("show"), tp_method(tp, obj, kolibri_show));
+    tp_set(tp, obj, tp_string("run"), tp_method(tp, obj, kolibri_run));
+    /*tp_set(tp, obj, tp_string("keyhandler"), tp_method(tp, obj, kolibri_default_handler));
+    tp_set(tp, obj, tp_string("buttonhandler"), tp_method(tp, obj, kolibri_default_handler));*/
+    tp_set(tp, obj, tp_string("print_text"), tp_method(tp, obj, kolibri_print_text));
+    return obj;
+}

 /programs/develop/tinypy/modules/kolibri/init.c
 ,0 → 1,29
+#include "tp.h"
+extern tp_obj kolibri_open(TP);
+extern tp_obj kolibri_mainwindow(TP);
+extern tp_obj kolibri_debug_print(TP);
+extern tp_obj kolibri_socket_module(TP);
+extern tp_obj tp_dict(TP);
+extern tp_obj tp_fnc(TP,tp_obj v(TP));
+void kolibri_init(TP)
+{
+    tp_obj kolibri_mod = tp_dict(tp);
+    tp_obj socket_mod = kolibri_socket_module(tp);
+    tp_set(tp, kolibri_mod, tp_string("open"), tp_fnc(tp, kolibri_open));
+    tp_set(tp, kolibri_mod, tp_string("window"), tp_fnc(tp, kolibri_mainwindow));
+    /* debug */
+    tp_set(tp, kolibri_mod, tp_string("debug_print"), tp_fnc(tp, kolibri_debug_print));
+    /* socket is a separated module. */
+    tp_set(tp, kolibri_mod, tp_string("socket"), socket_mod);
+    /* Bind module attributes. */
+    tp_set(tp, kolibri_mod, tp_string("__doc__"),
+        tp_string("KolibriOS system specific functions."));
+    tp_set(tp, kolibri_mod, tp_string("__name__"), tp_string("kolibri"));
+    tp_set(tp, kolibri_mod, tp_string("__file__"), tp_string(__FILE__));
+    /* Bind to tiny modules[] */
+    tp_set(tp, tp->modules, tp_string("kolibri"), kolibri_mod);
+}
 Property changes:
 Added: svn:executable
 +*
 \ No newline at end of property

 /programs/develop/tinypy/modules/kolibri/net.c
 ,0 → 1,296
+#include <sys/socket.h>
+// #include <menuet/net.h>
+#include "tp.h"
+extern tp_obj tp_dict(TP);
+extern tp_obj tp_method(TP,tp_obj self,tp_obj v(TP));
+extern tp_obj tp_fnc(TP,tp_obj v(TP));
+extern tp_obj tp_get(TP,tp_obj self, tp_obj k);
+tp_obj tp_has(TP,tp_obj self, tp_obj k);
+// #define _cdecl __attribute__((cdecl))
+extern int (* _cdecl con_printf)(const char* format,...);
+#define PRECISION 0.000001
+#define GET_SOCKET_DESCRIPTOR(_obj, _sock) do{                  \
+    if (fabs(tp_has(tp, _obj, tp_string("socket")).number.val) < PRECISION)\
+        tp_raise(tp_None, "Socket not open", tp_None);          \
+    _sock = (__u32)(tp_get(tp, _obj, tp_string("socket")).number.val + PRECISION);\
+} while(0)
+/* Socket close method.
+ *
+ * Example:
+ * s.close() # s must be a socket object created by socket.
+ *
+ * Raises exception if socket was not opened. Otherwise returns True.
+ */
+static tp_obj kolibri_close_socket(TP)
+{
+    // tp_obj self = TP_TYPE(TP_DICT);
+    // __u32  socktype;
+    // __u32  s;
+    // GET_SOCKET_DESCRIPTOR(self, s);
+    // socktype = (__u32)tp_get(tp, self, tp_string("type")).number.val;
+    // GET_SOCKET_DESCRIPTOR(self, s);
+    // if (socktype == SOCK_STREAM)
+    //     __menuet__close_TCP_socket(s);
+    // else if (socktype == SOCK_DGRAM)
+    //     __menuet__close_UDP_socket(s);
+    return tp_True;
+}
+/* Socket send method.
+ *
+ * Example:
+ * data="<html><head><title>Preved!!!</title></head><body>Example.</body></html>"
+ * s.send(data)
+ * or:
+ * s.send(data, 20) # Send just 20 bytes
+ */
+static tp_obj kolibri_send(TP)
+{
+    // tp_obj self = TP_TYPE(TP_DICT);
+    // tp_obj data_obj = TP_TYPE(TP_STRING);
+    // __u32  datalen = TP_DEFAULT(tp_False).number.val;
+    // __u32  socktype = (__u32)tp_get(tp, self, tp_string("type")).number.val;
+    // __u32  s;
+    // int result;
+    // GET_SOCKET_DESCRIPTOR(self, s);
+    // if (datalen < 0 || datalen > data_obj.string.len)
+    //     datalen = data_obj.string.len;
+    // if (socktype == SOCK_STREAM)
+    //     result = __menuet__write_TCP_socket(s, datalen, (void *)data_obj.string.val);
+    // else if (socktype == SOCK_DGRAM)
+    //     result = __menuet__write_UDP_socket(s, datalen, (void *)data_obj.string.val);
+    // return tp_number(!(result != 0));
+    return tp_number(0);
+}
+#define __u32 unsigned int
+#define __u8 unsigned char
+/* Socket recv method.
+ *
+ * data="<html><head><title>Preved!!!</title></head><body>Example.</body></html>"
+ * s.recv(data)
+ * or:
+ * s.recv(data, 20) # Send just 20 bytes
+ */
+static tp_obj kolibri_recv(TP)
+{
+    tp_obj self = TP_TYPE(TP_DICT);
+    __u32  datalen = TP_DEFAULT(tp_False).number.val;
+    __u32  s;
+    __u8 c;
+    __u8 *buf, *p;
+    __u32 buf_size;
+    __u32 bytes_read = 0;
+    int i;
+    // GET_SOCKET_DESCRIPTOR(self, s);
+    // if (datalen)
+    //     buf_size = datalen;
+    // else
+    //     buf_size = 2048;
+    // if (!(buf = malloc(datalen)))
+    //     tp_raise(tp_None, "Cannot allocate buffer for received data", tp_None);
+    // p = buf;
+    // while (__menuet__read_socket(s, &c) && bytes_read < buf_size)
+    // {
+    //     *p++ = c;
+    //     bytes_read++;
+    //     if (bytes_read >= buf_size && !datalen)
+    //     {
+    //         buf_size += 1024;
+    //         buf = realloc(buf, buf_size);
+    //     }
+    // }
+    return tp_string_n(buf, bytes_read);
+}
+static void inet_pton(TP, const char *buf, int len, __u32 *addr)
+{
+    char *p = (char *)buf;
+    int i = 0;
+    __u32 val = 0;
+    *addr = 0;
+    while (*p && p < buf + len && i < 4)
+    {
+        if (*p == '.' || !*p)
+        {
+            if (val > 255)
+                tp_raise(tp_None, "ValueError: number > 255 in IP address", tp_None);
+            *addr += (val << ((i++) << 3));
+            val = 0;
+        }
+        else
+        {
+            if (*p < '0' || *p > '9')
+                tp_raise(tp_None, "ValueError: bad char in IP address, digit expected", tp_None);
+            val = val * 10 + *p - '0';
+        }
+        p++;
+    }
+    if (!*p)
+    {
+        if (i == 3)
+            *addr += (val << ((i++) << 3));
+        else
+            tp_raise(tp_None, "ValueError: bad IP address", tp_None);
+    }
+}
+/* Converter from string presentation to binary address. */
+static tp_obj kolibri_inet_pton(TP)
+{
+    tp_obj obj;
+    __u32 addr;
+    obj = TP_TYPE(TP_STRING);
+    // inet_pton(tp, (char *)obj.string.val, (int)obj.string.len, &addr);
+    return tp_number(addr);
+}
+/* Socket bind method.
+ *
+ * In KolibriOS it just sets local address and port.
+ *
+ * Example:
+ * s.bind('10.10.1.2', 6000) #Connects to 10.10.1.2:6000
+ */
+tp_obj kolibri_bind(TP)
+{
+    // tp_obj self = TP_TYPE(TP_DICT);
+    // tp_obj local_addr_obj = TP_OBJ();
+    // __u32  local_port = (__u32)TP_TYPE(TP_NUMBER).number.val;
+    // __u32  local_addr;
+    // if (local_addr_obj.type == TP_NUMBER)
+    //     local_addr = local_addr_obj.number.val;
+    // else if (local_addr_obj.type == TP_STRING)
+    //     inet_pton(tp, (const char *)local_addr_obj.string.val, local_addr_obj.string.len, &local_addr);
+    // tp_set(tp, self, tp_string("local_addr"), tp_number(local_addr));
+    // tp_set(tp, self, tp_string("local_port"), tp_number(local_port));
+    return tp_None;
+}
+/* Socket connect method.
+ *
+ * Example:
+ * s.connect('10.10.1.1', 7000) #Connects to 10.10.1.1:7000
+ */
+tp_obj kolibri_connect(TP)
+{
+    // tp_obj self = TP_TYPE(TP_DICT);
+    // tp_obj  remote_addr_obj = TP_OBJ();
+    // __u32  remote_addr;
+    // __u32  remote_port = (__u32)TP_TYPE(TP_NUMBER).number.val;
+    // __u32  local_port  = tp_get(tp, self, tp_string("local_port")).number.val;
+    // __u32  socktype = (__u32)tp_get(tp, self, tp_string("type")).number.val;
+    // int  s = -1; /* Socket descriptor */
+    // if (remote_addr_obj.type == TP_NUMBER)
+    //     remote_addr = remote_addr_obj.number.val;
+    // else if (remote_addr_obj.type == TP_STRING)
+    //     inet_pton(tp, (const char *)remote_addr_obj.string.val, remote_addr_obj.string.len, &remote_addr);
+    // if (socktype == SOCK_STREAM)
+    //     s = __menuet__open_TCP_socket(local_port, remote_port, remote_addr, 1);
+    // else if (socktype == SOCK_DGRAM)
+    //     s = __menuet__open_UDP_socket(local_port, remote_port, remote_addr);
+    // if (s >= 0)
+    // {
+    //     tp_set(tp, self, tp_string("socket"), tp_number(s));
+    //     return tp_True;
+    // }
+    // else
+        return tp_False;
+}
+/* Socket listen method.
+ *
+ * Example:
+ * s.listen('10.10.1.1', 5000)
+ */
+tp_obj kolibri_listen(TP)
+{
+    // tp_obj self = TP_TYPE(TP_DICT);
+    // tp_obj remote_addr_obj = TP_OBJ();
+    // __u32  remote_addr;
+    // __u32  remote_port = (__u32)TP_TYPE(TP_NUMBER).number.val;
+    // __u32  local_port  = tp_get(tp, self, tp_string("local_port")).number.val;
+    // __u32  socktype = (__u32)tp_get(tp, self, tp_string("type")).number.val;
+    // int  s = -1; /* Socket descriptor */
+    // if (socktype != SOCK_STREAM)
+    //     tp_raise(tp_None, "IOError: attempt to listen on non-TCP socket", tp_None);
+    // if (remote_addr_obj.type == TP_NUMBER)
+    //     remote_addr = remote_addr_obj.number.val;
+    // else if (remote_addr_obj.type == TP_STRING)
+    //     inet_pton(tp, (const char *)remote_addr_obj.string.val, remote_addr_obj.string.len, &remote_addr);
+    // if ((s = __menuet__open_TCP_socket(local_port, remote_port, remote_addr, 0)) >= 0)
+    // {
+    //     tp_set(tp, self, tp_string("socket"), tp_number(s));
+    //     return tp_True;
+    // }
+    // else
+        return tp_False;
+}
+/* Exported function.
+ *
+ * Example:
+ *
+ * s = socket(socket.AF_INET, socket.SOCK_DGRAM)
+ *
+ * Returns socket object.
+ */
+tp_obj kolibri_socket(TP)
+{
+    tp_obj s;
+    tp_obj sockfamily = TP_TYPE(TP_NUMBER);
+    tp_obj socktype = TP_TYPE(TP_NUMBER);
+    // if (fabs(sockfamily.number.val - AF_INET) > PRECISION ||
+    //     (fabs(socktype.number.val - SOCK_STREAM) > PRECISION &&
+    //      fabs(socktype.number.val - SOCK_DGRAM) > PRECISION))
+    //     return tp_None;
+    s = tp_dict(tp);
+    // tp_set(tp, s, tp_string("family"), sockfamily);
+    // tp_set(tp, s, tp_string("type"), socktype);
+    // tp_set(tp, s, tp_string("bind"), tp_method(tp, s, kolibri_bind));
+    // tp_set(tp, s, tp_string("connect"), tp_method(tp, s, kolibri_connect));
+    // tp_set(tp, s, tp_string("send"), tp_method(tp, s, kolibri_send));
+    // tp_set(tp, s, tp_string("recv"), tp_method(tp, s, kolibri_recv));
+    // tp_set(tp, s, tp_string("close"), tp_method(tp, s, kolibri_close_socket));
+    // if (fabs(socktype.number.val - SOCK_STREAM) < PRECISION)
+    //     tp_set(tp, s, tp_string("listen"), tp_method(tp, s, kolibri_listen));
+    return s;
+}
+tp_obj kolibri_socket_module(TP)
+{
+    tp_obj socket_mod = tp_dict(tp);
+    // tp_set(tp, socket_mod, tp_string("AF_INET"), tp_number(AF_INET));
+    // tp_set(tp, socket_mod, tp_string("SOCK_STREAM"), tp_number(SOCK_STREAM));
+    // tp_set(tp, socket_mod, tp_string("SOCK_DGRAM"), tp_number(SOCK_DGRAM));
+    tp_set(tp, socket_mod, tp_string("AF_INET"), tp_number(0));
+    tp_set(tp, socket_mod, tp_string("SOCK_STREAM"), tp_number(0));
+    tp_set(tp, socket_mod, tp_string("SOCK_DGRAM"), tp_number(0));
+    tp_set(tp, socket_mod, tp_string("inet_pton"), tp_fnc(tp, kolibri_inet_pton));
+    tp_set(tp, socket_mod, tp_string("socket"), tp_fnc(tp, kolibri_socket));
+    return socket_mod;
+}

 /programs/develop/tinypy/modules/kolibri/fs.c
 ,0 → 1,258
+#include <string.h>
+#include "tp.h"
+extern tp_obj tp_fnc(TP,tp_obj v(TP));
+extern tp_obj tp_method(TP,tp_obj self,tp_obj v(TP));
+extern tp_obj tp_number(tp_num v);
+extern tp_obj tp_string(char const *v);
+extern tp_obj tp_list(TP);
+extern tp_obj tp_dict(TP);
+extern void _tp_raise(TP,tp_obj);
+// #define _cdecl __attribute__((cdecl))
+extern int (* _cdecl con_printf)(const char* format,...);
+#define call70(par, st) asm volatile ("int   $0x40":"=a"(st):"a"(70), "b"(par))
+#define call70_rw(par, st, cnt) asm volatile ("int   $0x40":"=a"(st), "=b"(cnt):"a"(70), "b"(par))
+typedef unsigned int uint32_t;
+typedef unsigned char uint8_t;
+typedef struct {
+        uint32_t subfnc;
+        uint32_t res1;
+        uint32_t res2;
+        uint32_t res3;
+        uint8_t *data;
+        uint8_t  res4;
+        char    *fn;
+    }__attribute__((__packed__))  info_params_t;
+typedef struct {
+        uint32_t subfnc;
+        uint32_t pos;
+        uint32_t res1;
+        uint32_t cnt;
+        char*    data;
+        uint8_t res2;
+        char*    fn;
+    } __attribute__((__packed__)) rw_params_t;
+static tp_obj kolibri_close(TP)
+{
+    tp_obj self = TP_TYPE(TP_DICT);
+    uint32_t size = tp_get(tp, self, tp_string("size")).number.val;
+    char *mode = (char *)tp_get(tp, self, tp_string("mode")).string.val;
+    tp_set(tp, self, tp_string("closed"), tp_True);
+    return tp_None;
+}
+static tp_obj kolibri_read(TP)
+{
+    uint32_t status, num;
+    tp_obj self = TP_TYPE(TP_DICT);
+    uint32_t pos = tp_get(tp, self, tp_string("pos")).number.val;
+    uint32_t size = tp_get(tp, self, tp_string("size")).number.val;
+    uint32_t cnt;
+    char *buf = (char *)malloc(size - pos);
+    rw_params_t params = {0, pos, 0, size - pos, buf, 0,
+                (char *)tp_get(tp, self, tp_string("name")).string.val};
+    char *mode = (char *)tp_get(tp, self, tp_string("mode")).string.val;
+    if (*mode != 'r')
+        tp_raise(tp_None, "IOError: file not open for reading", tp_None);
+    if (!buf)
+        return tp_None;
+    call70_rw((&params), status, cnt);
+    buf[cnt] = '\0';
+    return tp_string(buf);
+}
+#if 0
+static tp_obj kolibri_readline(TP)
+{
+    return tp_string("Line");
+}
+static tp_obj kolibri_readlines(TP)
+{
+    tp_obj result = tp_list(tp);
+    int i;
+    for(i=0; i < 5; i++)
+        tp_add(result, tp_string("Line"));
+    return result;
+}
+#endif
+/* Write object to file.
+ *
+ * tp   TinyPy virtual machine structure.
+ *
+ * returns tp_True
+ */
+static tp_obj kolibri_write(TP)
+{
+    tp_obj self = TP_TYPE(TP_DICT);
+    tp_obj obj = TP_OBJ(); /* What to write. */
+    char *mode = (char *)tp_get(tp, self, tp_string("mode")).string.val;
+    uint32_t pos = (uint32_t)tp_get(tp, self, tp_string("pos")).number.val;
+    uint32_t size = (uint32_t)tp_get(tp, self, tp_string("size")).number.val;
+    if (*mode != 'w' && *mode != 'a')
+    {
+        tp_raise(tp_None, "IOError: file not open for writing", tp_None);
+    }
+    else
+    {
+        char *data = (char *)TP_CSTR(obj);
+        rw_params_t params = {3, pos, 0, strlen(data), data, 0,
+                             (char *)tp_get(tp, self, tp_string("name")).string.val};
+        uint32_t status;
+        uint32_t cnt;
+        call70_rw((&params), status, cnt);
+        if (status)
+        {
+            tp_raise(tp_None, "IOError: writing failed with status %d", status);
+        }
+        pos += cnt;
+        tp_set(tp, self, tp_string("pos"), tp_number(pos));
+        if (pos > size)
+        {
+            /* If writing has come beyond the file, increase its size. */
+            tp_set(tp, self, tp_string("size"), tp_number(pos));
+        }
+        return tp_True;
+    }
+}
+/* Write line list into file.
+ *
+ * tp   TinyPy virtual machine structure.
+ *
+ * returns tp_None.
+ */
+static tp_obj kolibri_writelines(TP)
+{
+    tp_obj result = tp_None;
+    tp_obj self = TP_TYPE(TP_DICT);
+    tp_obj list = TP_TYPE(TP_LIST); /* What to write. */
+    char *mode = (char *)tp_get(tp, self, tp_string("mode")).string.val;
+    long pos = (long)tp_get(tp, self, tp_string("pos")).number.val;
+    uint32_t size = (uint32_t)tp_get(tp, self, tp_string("size")).number.val;
+    if (*mode != 'w' && *mode != 'a')
+    {
+        tp_raise(tp_None, "IOError: file not open for writing", tp_None);
+    }
+    else
+    {
+        int i;
+        char *fn = (char *)tp_get(tp, self, tp_string("name")).string.val;
+        rw_params_t params = {3, 0, 0, 0, NULL, 0, fn};
+        for (i = 0; i < list.list.val->len; i++)
+        {
+            char *data = (char *)TP_CSTR(list.list.val->items[i]);
+            uint32_t status;
+            uint32_t cnt;
+            params.data = data;
+            params.cnt = strlen(data);
+            params.pos = pos;
+            call70_rw((&params), status, cnt);
+            if (status)
+                tp_raise(tp_None, "IOError: writing failed with status %d", status);
+            pos += cnt;
+        }
+        tp_set(tp, self, tp_string("pos"), tp_number(pos));
+        if (pos > size)
+        {
+            /* If writing has come beyond the file, increase its size. */
+            tp_set(tp, self, tp_string("size"), tp_number(pos));
+        }
+        return tp_True;
+    }
+}
+/* Get file size.
+ *
+ * fn   ASCIIZ absolute file path.
+ */
+long long int kolibri_filesize(const char *fn)
+{
+    uint8_t data[40];
+    uint32_t status;
+    long long int result;
+    info_params_t params = {5, 0, 0, 0, data, 0, (char *)fn};
+    call70((&params), status);
+    /* File size is at offset 32. */
+    if (status == 0)
+        result = *(long long*)(&data[32]);
+    else
+        result = -status;
+    return result;
+}
+/* Open file.
+ *
+ * tp   TinyPy virtual machine structure.
+ *
+ * returns file object.
+ */
+tp_obj kolibri_open(TP) {
+    tp_obj obj;
+    char *fn = (char *)(TP_TYPE(TP_STRING).string.val);
+    tp_obj mode_obj = TP_OBJ();
+    long long int size;
+    long long int pos = 0;
+    uint32_t status;
+    info_params_t params = {2, 0, 0, 0, NULL, 0, fn};
+    if (mode_obj.type == TP_NONE)
+        mode_obj = tp_string("r");
+    else if (mode_obj.type != TP_STRING)
+        tp_raise(tp_None, "ValueError: bad file access mode %s", TP_CSTR(mode_obj));
+    switch(mode_obj.string.val[0])
+    {
+        case 'w':
+            call70((&params), status);
+            if (status)
+                tp_raise(tp_None, "IOError: cannot open file for writing", tp_None);
+            size = 0;
+            break;
+        case 'a':
+            pos = size;
+            break;
+        case 'r':
+            break;
+        default:
+            tp_raise(tp_None, "ValueError: mode string must begin with 'r', 'w', or 'a'", tp_None);
+    }
+    if ((size = kolibri_filesize(fn)) < 0)
+        tp_raise(tp_None, "IOError: filesize returned %d", tp_number(size));
+    obj = tp_dict(tp);
+    tp_set(tp, obj, tp_string("name"), tp_string(fn));
+    tp_set(tp, obj, tp_string("size"), tp_number(size));
+    tp_set(tp, obj, tp_string("pos"), tp_number(pos));
+    tp_set(tp, obj, tp_string("mode"), mode_obj);
+#if 0
+    tp_set(tp, obj, tp_string("__doc__"),
+           tp_string("File object.\nAttributes:\n  name: file name\n"
+                     "  closed: boolean indicating whether file was closed\n"
+                     "Methods:\n  read: read the entire file into string\n"
+                     "  readlines: get list of lines\n"
+                     "  close: close the file\n"
+                     ));
+#endif
+    tp_set(tp, obj, tp_string("closed"), tp_False);
+    tp_set(tp, obj, tp_string("close"), tp_method(tp, obj, kolibri_close));
+    tp_set(tp, obj, tp_string("read"), tp_method(tp, obj, kolibri_read));
+    tp_set(tp, obj, tp_string("write"), tp_method(tp, obj, kolibri_write));
+    tp_set(tp, obj, tp_string("writelines"), tp_method(tp, obj, kolibri_writelines));
+    return obj;
+}
 Property changes:
 Added: svn:executable
 +*
 \ No newline at end of property

 /programs/develop/tinypy/modules/random/init.c
 ,0 → 1,52
+#include "random.c"
+/*
+ * random_mod_init()
+ *
+ * random module initialization function
+ */
+void random_init(TP)
+{
+    /*
+     * module dict for random
+     */
+    tp_obj random_mod = tp_dict(tp);
+    /*
+     * bind functions to random module
+     */
+    tp_set(tp, random_mod, tp_string("seed"),       tp_fnc(tp, random_seed));
+    tp_set(tp, random_mod, tp_string("getstate"),   tp_fnc(tp, random_getstate));
+    tp_set(tp, random_mod, tp_string("setstate"),   tp_fnc(tp, random_setstate));
+    tp_set(tp, random_mod, tp_string("jumpahead"),  tp_fnc(tp, random_jumpahead));
+    tp_set(tp, random_mod, tp_string("random"),     tp_fnc(tp, random_random));
+    /*
+     * bind usual distribution random variable generator
+     */
+    tp_set(tp, random_mod, tp_string("uniform"),        tp_fnc(tp, random_uniform));
+    tp_set(tp, random_mod, tp_string("normalvariate"),  tp_fnc(tp, random_normalvariate));
+    tp_set(tp, random_mod, tp_string("lognormvariate"), tp_fnc(tp, random_lognormvariate));
+    tp_set(tp, random_mod, tp_string("expovariate"),    tp_fnc(tp, random_expovariate));
+    tp_set(tp, random_mod, tp_string("vonmisesvariate"), tp_fnc(tp, random_vonmisesvariate));
+    tp_set(tp, random_mod, tp_string("gammavariate"),   tp_fnc(tp, random_gammavariate));
+    tp_set(tp, random_mod, tp_string("betavariate"),    tp_fnc(tp, random_betavariate));
+    tp_set(tp, random_mod, tp_string("paretovariate"),  tp_fnc(tp, random_paretovariate));
+    tp_set(tp, random_mod, tp_string("weibullvariate"), tp_fnc(tp, random_weibullvariate));
+    tp_set(tp, random_mod, tp_string("randrange"),      tp_fnc(tp, random_randrange));
+    tp_set(tp, random_mod, tp_string("randint"),        tp_fnc(tp, random_randint));
+    tp_set(tp, random_mod, tp_string("choice"),         tp_fnc(tp, random_choice));
+    tp_set(tp, random_mod, tp_string("shuffle"),        tp_fnc(tp, random_shuffle));
+    /*
+     * bind special attributes to random module
+     */
+    tp_set(tp, random_mod, tp_string("__doc__"),  tp_string("Random variable generators."));
+    tp_set(tp, random_mod, tp_string("__name__"), tp_string("random"));
+    tp_set(tp, random_mod, tp_string("__file__"), tp_string(__FILE__));
+    /*
+     * bind random module to tinypy modules[]
+     */
+    tp_set(tp, tp->modules, tp_string("random"), random_mod);
+}

 /programs/develop/tinypy/modules/random/random.c
 ,0 → 1,1107
+#include <stdlib.h>
+#include <time.h>
+#include <errno.h>
+#include <math.h>
+#ifndef M_E
+ #define M_E     2.7182818284590452354
+#endif
+#ifndef M_PI
+ #define M_PI    3.14159265358979323846
+#endif
+/*
+ * following random generators are mutual exclusive.
+ */
+#define __USE_MERSENNE_TWISTER_RANDOM_GENERATOR
+/*#define __USE_WICHMANN_HILL_RANDOM_GENERATOR*/
+/*#define __USE_POSIX_RANDOM_GENERATOR*/
+#if defined(__USE_MERSENNE_TWISTER_RANDOM_GENERATOR)
+/***********************************************************
+ * following code is borrowed from Python's _randommodule.c
+ ***********************************************************/
+/* Random objects */
+/* ------------------------------------------------------------------
+   The code in this module was based on a download from:
+      http://www.math.keio.ac.jp/~matumoto/MT2002/emt19937ar.html
+   It was modified in 2002 by Raymond Hettinger as follows:
+    * the principal computational lines untouched except for tabbing.
+    * renamed genrand_res53() to random_random() and wrapped
+      in python calling/return code.
+    * genrand_int32() and the helper functions, init_genrand()
+      and init_by_array(), were declared static, wrapped in
+      Python calling/return code.  also, their global data
+      references were replaced with structure references.
+    * unused functions from the original were deleted.
+      new, original C python code was added to implement the
+      Random() interface.
+   The following are the verbatim comments from the original code:
+   A C-program for MT19937, with initialization improved 2002/1/26.
+   Coded by Takuji Nishimura and Makoto Matsumoto.
+   Before using, initialize the state by using init_genrand(seed)
+   or init_by_array(init_key, key_length).
+   Copyright (C) 1997 - 2002, Makoto Matsumoto and Takuji Nishimura,
+   All rights reserved.
+   Redistribution and use in source and binary forms, with or without
+   modification, are permitted provided that the following conditions
+   are met:
+. Redistributions of source code must retain the above copyright
+    notice, this list of conditions and the following disclaimer.
+. Redistributions in binary form must reproduce the above copyright
+    notice, this list of conditions and the following disclaimer in the
+    documentation and/or other materials provided with the distribution.
+. The names of its contributors may not be used to endorse or promote
+    products derived from this software without specific prior written
+    permission.
+   THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+   "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+   LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
+   A PARTICULAR PURPOSE ARE DISCLAIMED.  IN NO EVENT SHALL THE COPYRIGHT OWNER OR
+   CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+   EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO,
+   PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR
+   PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF
+   LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+   NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+   SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+   Any feedback is very welcome.
+   http://www.math.keio.ac.jp/matumoto/emt.html
+   email: matumoto@math.keio.ac.jp
+*/
+/* Period parameters -- These are all magic.  Don't change. */
+#define N 624
+#define M 397
+#define MATRIX_A 0x9908b0dfUL   /* constant vector a */
+#define UPPER_MASK 0x80000000UL /* most significant w-r bits */
+#define LOWER_MASK 0x7fffffffUL /* least significant r bits */
+typedef struct {
+    unsigned long state[N];
+    int index;
+    int has_seed;
+} RandomObject;
+/* generates a random number on [0,0xffffffff]-interval */
+static unsigned long
+genrand_int32(RandomObject *self)
+{
+    unsigned long y;
+    static unsigned long mag01[2]={0x0UL, MATRIX_A};
+    /* mag01[x] = x * MATRIX_A  for x=0,1 */
+    unsigned long *mt;
+    mt = self->state;
+    if (self->index >= N) { /* generate N words at one time */
+        int kk;
+        for (kk=0;kk<N-M;kk++) {
+            y = (mt[kk]&UPPER_MASK)|(mt[kk+1]&LOWER_MASK);
+            mt[kk] = mt[kk+M] ^ (y >> 1) ^ mag01[y & 0x1UL];
+        }
+        for (;kk<N-1;kk++) {
+            y = (mt[kk]&UPPER_MASK)|(mt[kk+1]&LOWER_MASK);
+            mt[kk] = mt[kk+(M-N)] ^ (y >> 1) ^ mag01[y & 0x1UL];
+        }
+        y = (mt[N-1]&UPPER_MASK)|(mt[0]&LOWER_MASK);
+        mt[N-1] = mt[M-1] ^ (y >> 1) ^ mag01[y & 0x1UL];
+        self->index = 0;
+    }
+    y = mt[self->index++];
+    y ^= (y >> 11);
+    y ^= (y << 7) & 0x9d2c5680UL;
+    y ^= (y << 15) & 0xefc60000UL;
+    y ^= (y >> 18);
+    return y;
+}
+/* initializes mt[N] with a seed */
+static void
+init_genrand(RandomObject *self, unsigned long s)
+{
+    int mti;
+    unsigned long *mt;
+    mt = self->state;
+    mt[0]= s & 0xffffffffUL;
+    for (mti=1; mti<N; mti++) {
+        mt[mti] =
+        (1812433253UL * (mt[mti-1] ^ (mt[mti-1] >> 30)) + mti);
+        /* See Knuth TAOCP Vol2. 3rd Ed. P.106 for multiplier. */
+        /* In the previous versions, MSBs of the seed affect   */
+        /* only MSBs of the array mt[].                */
+        /* 2002/01/09 modified by Makoto Matsumoto         */
+        mt[mti] &= 0xffffffffUL;
+        /* for >32 bit machines */
+    }
+    self->index = mti;
+    return;
+}
+/* initialize by an array with array-length */
+/* init_key is the array for initializing keys */
+/* key_length is its length */
+static void
+init_by_array(RandomObject *self, unsigned long init_key[], unsigned long key_length)
+{
+    unsigned int i, j, k;   /* was signed in the original code. RDH 12/16/2002 */
+    unsigned long *mt;
+    mt = self->state;
+    init_genrand(self, 19650218UL);
+    i=1; j=0;
+    k = (N>key_length ? N : key_length);
+    for (; k; k--) {
+        mt[i] = (mt[i] ^ ((mt[i-1] ^ (mt[i-1] >> 30)) * 1664525UL))
+             + init_key[j] + j; /* non linear */
+        mt[i] &= 0xffffffffUL; /* for WORDSIZE > 32 machines */
+        i++; j++;
+        if (i>=N) { mt[0] = mt[N-1]; i=1; }
+        if (j>=key_length) j=0;
+    }
+    for (k=N-1; k; k--) {
+        mt[i] = (mt[i] ^ ((mt[i-1] ^ (mt[i-1] >> 30)) * 1566083941UL))
+             - i; /* non linear */
+        mt[i] &= 0xffffffffUL; /* for WORDSIZE > 32 machines */
+        i++;
+        if (i>=N) { mt[0] = mt[N-1]; i=1; }
+    }
+    mt[0] = 0x80000000UL; /* MSB is 1; assuring non-zero initial array */
+    return;
+}
+/*----------------------end of Mersenne Twister Algorithm----------------*/
+/*************************************************************************
+ * following are tinypy related stuffs.
+ *************************************************************************/
+static RandomObject _gRandom;       /* random object */
+static tp_obj random_seed(TP)
+{
+    tp_obj arg = TP_DEFAULT(tp_None);
+    if (arg.type == TP_NONE) {
+        time_t now;
+        (void)time(&now);
+        init_genrand(&_gRandom, (unsigned long)now);
+        _gRandom.has_seed = 1;
+    } else if (arg.type == TP_NUMBER) {
+        init_genrand(&_gRandom, (unsigned long)arg.number.val);
+        _gRandom.has_seed = 1;
+    } else if (arg.type == TP_STRING) {
+        unsigned long seed;
+        seed = (unsigned long)tp_hash(tp, arg);
+        init_genrand(&_gRandom, seed);
+        _gRandom.has_seed = 1;
+    } else {
+        tp_raise(tp_None,tp_printf(tp, "%s", "invalid argument for seed()"));
+    }
+    return (tp_None);
+}
+static tp_obj random_getstate(TP)
+{
+    tp_obj state_list = tp_list(tp);
+    int i;
+    for (i = 0; i < N; i++) {
+        _tp_list_append(tp, state_list.list.val, tp_number(_gRandom.state[i]));
+    }
+    _tp_list_append(tp, state_list.list.val, tp_number(_gRandom.index));
+    return (state_list);
+}
+/*
+ * @state_list  must contain exactly N+1(625) integer.
+ */
+static tp_obj random_setstate(TP)
+{
+    tp_obj state_list = TP_OBJ();
+    tp_obj state_elem;
+    tp_obj len;
+    int i;
+    len = tp_len(tp, state_list);
+    if (len.number.val != N+1) {
+        tp_raise(tp_None,tp_printf(tp, "%s: state vector's size invalid(should be %d)",
+                __func__, N+1));
+    }
+    for (i = 0; i < N; i++) {
+        state_elem = tp_get(tp, state_list, tp_number(i));
+        _gRandom.state[i] = (unsigned long)state_elem.number.val;
+    }
+    state_elem = tp_get(tp, state_list, tp_number(i));
+    _gRandom.index = (int)state_elem.number.val;
+    return (tp_None);
+}
+/*
+ * Jumpahead should be a fast way advance the generator n-steps ahead, but
+ * lacking a formula for that, the next best is to use n and the existing
+ * state to create a new state far away from the original.
+ *
+ * The generator uses constant spaced additive feedback, so shuffling the
+ * state elements ought to produce a state which would not be encountered
+ * (in the near term) by calls to random().  Shuffling is normally
+ * implemented by swapping the ith element with another element ranging
+ * from 0 to i inclusive.  That allows the element to have the possibility
+ * of not being moved.  Since the goal is to produce a new, different
+ * state, the swap element is ranged from 0 to i-1 inclusive.  This assures
+ * that each element gets moved at least once.
+ *
+ * To make sure that consecutive calls to jumpahead(n) produce different
+ * states (even in the rare case of involutory shuffles), i+1 is added to
+ * each element at position i.  Successive calls are then guaranteed to
+ * have changing (growing) values as well as shuffled positions.
+ *
+ * Finally, the self->index value is set to N so that the generator itself
+ * kicks in on the next call to random().  This assures that all results
+ * have been through the generator and do not just reflect alterations to
+ * the underlying state.
+ */
+static tp_obj random_jumpahead(TP)
+{
+    long n = (long)TP_NUM();
+    long i, j;
+    unsigned long *mt;
+    unsigned long tmp;
+    mt = _gRandom.state;
+    for (i = N-1; i > 1; i--) {
+        j = n % i;
+        if (j == -1L) {
+            tp_raise(tp_None,tp_printf(tp, "error: %s: j = %ld", __func__, j));
+        }
+        tmp   = mt[i];
+        mt[i] = mt[j];
+        mt[j] = tmp;
+    }
+    for (i = 0; i < N; i++)
+        mt[i] += i + 1;
+    _gRandom.index = N;
+    return (tp_None);
+}
+/* random_random is the function named genrand_res53 in the original code;
+ * generates a random number on [0,1) with 53-bit resolution; note that
+ * 9007199254740992 == 2**53; I assume they're spelling "/2**53" as
+ * multiply-by-reciprocal in the (likely vain) hope that the compiler will
+ * optimize the division away at compile-time.  67108864 is 2**26.  In
+ * effect, a contains 27 random bits shifted left 26, and b fills in the
+ * lower 26 bits of the 53-bit numerator.
+ * The orginal code credited Isaku Wada for this algorithm, 2002/01/09.
+ */
+static tp_obj random_random(TP)
+{
+    RandomObject *self = &_gRandom;
+    unsigned long a, b;
+    if (! self->has_seed)
+        random_seed(tp);
+    a = genrand_int32(self)>>5;
+    b = genrand_int32(self)>>6;
+    return tp_number((a*67108864.0+b)*(1.0/9007199254740992.0));
+}
+#elif defined(__USE_WICHMANN_HILL_RANDOM_GENERATOR)
+/*************************************************
+ * divmod(x, y)
+ * a helper function borrowed from Python
+ *************************************************/
+/* Compute Python divmod(x, y), returning the quotient and storing the
+ * remainder into *r.  The quotient is the floor of x/y, and that's
+ * the real point of this.  C will probably truncate instead (C99
+ * requires truncation; C89 left it implementation-defined).
+ * Simplification:  we *require* that y > 0 here.  That's appropriate
+ * for all the uses made of it.  This simplifies the code and makes
+ * the overflow case impossible (divmod(LONG_MIN, -1) is the only
+ * overflow case).
+ */
+#include <assert.h>
+static int
+divmod(int x, int y, int *r)
+{
+    int quo;
+    assert(y > 0);
+    quo = x / y;
+    *r = x - quo * y;
+    if (*r < 0) {
+        --quo;
+        *r += y;
+    }
+    assert(0 <= *r && *r < y);
+    return quo;
+}
+typedef struct WH_RandomObject {
+    struct seed {
+        unsigned long   x;
+        unsigned long   y;
+        unsigned long   z;
+    } seed;
+    int has_seed;
+} WH_RandomObject;
+static WH_RandomObject _gWhRandom;
+static tp_obj random_seed(TP)
+{
+    long a;
+    int x, y, z;
+    tp_obj arg = TP_DEFAULT(tp_None);
+    if (arg.type == TP_NONE) {
+        time_t now;
+        (void)time(&now);
+        a = (long)now * 256;
+    } else if (arg.type == TP_NUMBER) {
+        a = (long)arg.number.val;
+    } else {
+        tp_raise(tp_None,tp_printf(tp, "%s", "invalid argument for seed()"));
+    }
+    a = divmod(a, 30268, &x);
+    a = divmod(a, 30306, &y);
+    a = divmod(a, 30322, &z);
+    _gWhRandom.seed.x = (int)x + 1;
+    _gWhRandom.seed.y = (int)y + 1;
+    _gWhRandom.seed.z = (int)z + 1;
+    _gWhRandom.has_seed = 1;
+    return (tp_None);
+}
+/*
+ * following comments are from Python's random.py
+ *---------------------------------------
+ * Wichman-Hill random number generator.
+ *
+ * Wichmann, B. A. & Hill, I. D. (1982)
+ * Algorithm AS 183:
+ * An efficient and portable pseudo-random number generator
+ * Applied Statistics 31 (1982) 188-190
+ *
+ * see also:
+ *        Correction to Algorithm AS 183
+ *        Applied Statistics 33 (1984) 123
+ *
+ *        McLeod, A. I. (1985)
+ *        A remark on Algorithm AS 183
+ *        Applied Statistics 34 (1985),198-200
+ * This part is thread-unsafe:
+ * BEGIN CRITICAL SECTION
+ */
+static tp_obj random_random(TP)
+{
+    long x, y, z;
+    double r;
+    if (! _gWhRandom.has_seed)
+        random_seed(tp);
+    x = _gWhRandom.seed.x;
+    y = _gWhRandom.seed.y;
+    z = _gWhRandom.seed.z;
+    x = (171 * x) % 30269;
+    y = (172 * y) % 30307;
+    z = (170 * z) % 30323;
+    _gWhRandom.seed.x = x;
+    _gWhRandom.seed.y = y;
+    _gWhRandom.seed.z = z;
+    /*
+     * Note:  on a platform using IEEE-754 double arithmetic, this can
+     * never return 0.0 (asserted by Tim; proof too long for a comment).
+     */
+    errno = 0;
+    r = fmod(((double)x/30269.0+(double)y/30307.0+(double)z/30323.0), 1.0);
+    if (errno == EDOM)
+        tp_raise(tp_None,tp_printf(tp, "%s", "fmod(): denominator can't be zero"));
+    return tp_number(r);
+}
+/*
+ * for compatibility
+ */
+static tp_obj random_setstate(TP)
+{
+    return (tp_None);
+}
+/*
+ * for compatibility
+ */
+static tp_obj random_getstate(TP)
+{
+    return (tp_None);
+}
+/*
+ * FIXME: risk of overflow.
+ * following comments are from Python's random.py
+ * --------------------------------------------
+ * Act as if n calls to random() were made, but quickly.
+ *
+ * n is an int, greater than or equal to 0.
+ *
+ * Example use:  If you have 2 threads and know that each will
+ * consume no more than a million random numbers, create two Random
+ * objects r1 and r2, then do
+ *      r2.setstate(r1.getstate())
+ *      r2.jumpahead(1000000)
+ * Then r1 and r2 will use guaranteed-disjoint segments of the full
+ * period.
+ */
+static tp_obj random_jumpahead(TP)
+{
+    int n = (int)TP_NUM();
+    long x, y, z;
+    if (n < 0)
+        tp_raise(tp_None,tp_printf(tp, "%s: n = %d invalid, should >= 0", __func__, n));
+    x = _gWhRandom.seed.x;
+    y = _gWhRandom.seed.y;
+    z = _gWhRandom.seed.z;
+    x = (int)(x * ((long)pow(171, n) % 30269)) % 30269;
+    y = (int)(y * ((long)pow(172, n) % 30307)) % 30307;
+    z = (int)(z * ((long)pow(170, n) % 30323)) % 30323;
+    _gWhRandom.seed.x = x;
+    _gWhRandom.seed.y = y;
+    _gWhRandom.seed.z = z;
+    return (tp_None);
+}
+#elif defined(__USE_POSIX_RANDOM_GENERATOR)
+/*
+ * judge whether seeded
+ */
+static int has_seed = 0;
+static tp_obj random_seed(TP)
+{
+    tp_obj arg = TP_DEFAULT(tp_None);
+    if (arg.type == TP_NONE) {
+        time_t now;
+        (void)time(&now);
+        srandom((unsigned int)now);
+        has_seed = 1;
+    } else if (arg.type == TP_NUMBER) {
+        srandom((unsigned long)arg.number.val);
+        has_seed = 1;
+    } else {
+        tp_raise(tp_None,tp_printf(tp, "%s", "invalid argument for seed()"));
+    }
+    return (tp_None);
+}
+/*
+ * random()
+ *
+ * generate successive pseudo random number ranging from [0.0, 1.0).
+ * usually RAND_MAX is huge number, thus the periods of the success-
+ * ive random number is very long, about 16*((2**31)-1).
+ * NOTE: if seed() not called before random(), random() will
+ * automatically call seed() with current time.
+ */
+tp_obj random_random(TP)
+{
+    double r = 0.0;
+    if (! has_seed)
+        random_seed(tp);
+    r = (tp_num)random()/(tp_num)RAND_MAX;
+    return (tp_number(r));
+}
+/*
+ * setstate(state)
+ *
+ * for compatibility.
+ */
+tp_obj random_setstate(TP)
+{
+    return (tp_None);
+}
+/*
+ * getstate()
+ *
+ * for compatibility.
+ */
+tp_obj random_getstate(TP)
+{
+    return (tp_None);
+}
+/*
+ * jumpahead()
+ *
+ * for compatibility.
+ */
+tp_obj random_jumpahead(TP)
+{
+    return (tp_None);
+}
+#else
+#error no underlying random generator is specified
+#endif
+/************************************************************
+ * some usual distributions
+ ************************************************************/
+/*
+ * return real number in range [a, b)
+ * a and b can be negtive, but a must be less than b.
+ */
+tp_obj random_uniform(TP)
+{
+    double a = TP_NUM();
+    double b = TP_NUM();
+    double r = 0.0;
+    tp_obj rvo;         /* random variable object */
+    if (a >= b)
+        tp_raise(tp_None,tp_printf(tp, "%s: a(%f) must be less than b(%f)", a, b));
+    rvo = random_random(tp);
+    r = a + (b - a) * rvo.number.val;
+    return (tp_number(r));
+}
+/*
+ * Normal distribution
+ * @mu      mean
+ * @sigma   standard deviation
+ *-----------------------------
+ * Uses Kinderman and Monahan method. Reference: Kinderman,
+ * A.J. and Monahan, J.F., "Computer generation of random
+ * variables using the ratio of uniform deviates", ACM Trans
+ * Math Software, 3, (1977), pp257-260.
+ */
+tp_obj random_normalvariate(TP)
+{
+    double mu = TP_NUM();
+    double sigma = TP_NUM();
+    double NV_MAGICCONST;
+    double u1, u2;
+    double z, zz;
+    double r = 0.0;
+    tp_obj rvo;         /* random variable object */
+    NV_MAGICCONST = 4.0 * exp(-0.5) / sqrt(2.0);
+    while (1) {
+        rvo = random_random(tp);
+        u1  = rvo.number.val;
+        rvo = random_random(tp);
+        u2  = 1.0 - rvo.number.val;
+        z   = NV_MAGICCONST * (u1 - 0.5) / u2;
+        zz  = z * z / 4.0;
+        if (zz <= - log(u2))
+            break;
+    }
+    r = mu + z * sigma;
+    return (tp_number(r));
+}
+/*
+ * Log normal distribution
+ *
+ * If take natural logarithm on log normal distribution, normal
+ * distribution with mean mu and standard deviation sigma will
+ * return.
+ * @mu      mean, can be any value
+ * @sigma   standard deviation, must be > 0.
+ */
+tp_obj random_lognormvariate(TP)
+{
+    double mu = TP_NUM();
+    double sigma = TP_NUM();
+    tp_obj params;
+    tp_obj normvar;     /* normal distribution variate */
+    double r = 0.0;
+    /*
+     * call random_normalvariate() actually
+     */
+    params = tp_params_v(tp, 2, tp_number(mu), tp_number(sigma));
+    normvar = tp_ez_call(tp, "random", "normalvariate", params);
+    r = exp(normvar.number.val);
+    return (tp_number(r));
+}
+/*
+ * Exponential distribution
+ *
+ * @lambda      reciprocal of mean.
+ * return value range (0, +inf)
+ */
+tp_obj random_expovariate(TP)
+{
+    double lambda = TP_NUM();
+    double u, r;
+    tp_obj rvo;
+    do {
+        rvo = random_random(tp);
+        u = rvo.number.val;
+    } while (u <= 0.0000001);
+    r = -log(u) / lambda;
+    return (tp_number(r));
+}
+/*
+ * Circular data distribution.
+ *
+ * mu is the mean angle, expressed in radians between 0 and 2*pi, and
+ * kappa is the concentration parameter, which must be greater than or
+ * equal to zero.  If kappa is equal to zero, this distribution reduces
+ * to a uniform random angle over the range 0 to 2*pi.
+ *
+ * mu:    mean angle (in radians between 0 and 2*pi)
+ * kappa: concentration parameter kappa (>= 0)
+ * if kappa = 0 generate uniform random angle
+ *
+ * Based upon an algorithm published in: Fisher, N.I.,
+ * "Statistical Analysis of Circular Data", Cambridge
+ * University Press, 1993.
+ *
+ * Thanks to Magnus Kessler for a correction to the
+ * implementation of step 4.
+ */
+tp_obj random_vonmisesvariate(TP)
+{
+    double mu = TP_NUM();
+    double kappa = TP_NUM();
+    tp_obj rvo;
+    double a, b, c, r;
+    double u1, u2, u3, z, f;
+    double theta;
+    double TWOPI = 2.0 * M_PI;
+    if (kappa <= 1e-6) {
+        rvo = random_random(tp);
+        theta = TWOPI * rvo.number.val;
+        return (tp_number(theta));
+    }
+    a = 1.0 + sqrt(1.0 + 4.0 * kappa * kappa);
+    b = (a - sqrt(2.0 * a))/(2.0 * kappa);
+    r = (1.0 + b * b)/(2.0 * b);
+    while (1) {
+        rvo = random_random(tp);
+        u1 = rvo.number.val;
+        z = cos(M_PI * u1);
+        f = (1.0 + r * z)/(r + z);
+        c = kappa * (r - f);
+        rvo = random_random(tp);
+        u2 = rvo.number.val;
+        if ((u2 < (c * (2.0 - c))) ||
+            (u2 <= (c * exp(1.0 - c))))
+            break;
+    }
+    rvo = random_random(tp);
+    u3 = rvo.number.val;
+    if (u3 > 0.5)
+        theta = fmod(mu, TWOPI) + acos(f);
+    else
+        theta = fmod(mu, TWOPI) - acos(f);
+    return (tp_number(theta));
+}
+/*
+ * Gamma distribution.  Not the gamma function!
+ *
+ * Conditions on the parameters are alpha > 0 and beta > 0.
+ */
+tp_obj random_gammavariate(TP)
+{
+    double alpha = TP_NUM();
+    double beta  = TP_NUM();
+    tp_obj rvo;
+    double res;
+    double LOG4 = log(4.0);
+    double SG_MAGICCONST = 1.0 + log(4.5);
+    /*
+     * alpha > 0, beta > 0, mean is alpha*beta, variance is alpha*beta**2
+     * Warning: a few older sources define the gamma distribution in terms
+     * of alpha > -1.0
+     */
+    if ((alpha <= 0.0) || (beta <= 0.0))
+        tp_raise(tp_None,tp_printf(tp, "%s: alpha(%f) and beta(%f) must be > 0.0",
+                __func__, alpha, beta));
+    if (alpha > 1.0) {
+        /*
+         * Uses R.C.H. Cheng, "The generation of Gamma
+         * variables with non-integral shape parameters",
+         * Applied Statistics, (1977), 26, No. 1, p71-74
+         */
+        double ainv;
+        double bbb, ccc;
+        double u1, u2;
+        double v, x, z, r;
+        ainv = sqrt(2.0 * alpha - 1.0);
+        bbb = alpha - LOG4;
+        ccc = alpha + ainv;
+        while (1) {
+            rvo = random_random(tp);
+            u1 = rvo.number.val;
+            if (! ((1e-7 < u1) && (u1 < 0.9999999)))
+                continue;
+            rvo = random_random(tp);
+            u2 = 1.0 - rvo.number.val;
+            v = log(u1 / (1.0 - u1)) / ainv;
+            x = alpha * exp(v);
+            z = u1 * u1 * u2;
+            r = bbb + ccc * v - x;
+            if ((r + SG_MAGICCONST - 4.5 * z >= 0.0) ||
+                (r >= log(z))) {
+                res = x * beta;
+                return (tp_number(res));
+            }
+        }
+    }
+    else if (alpha == 1.0) {
+        /*
+         * expovariate(1)
+         */
+        double u;
+        do {
+            rvo = random_random(tp);
+            u = rvo.number.val;
+        } while (u <= 1e-7);
+        res = - log(u) * beta;
+        return (tp_number(res));
+    } else {
+        /*
+         * alpha is between 0 and 1 (exclusive)
+         *
+         * Uses ALGORITHM GS of Statistical Computing - Kennedy & Gentle
+         */
+        double b, p, u, u1, x;
+        while (1) {
+            rvo = random_random(tp);
+            u = rvo.number.val;
+            b = (M_E + alpha) / M_E;
+            p = b * u;
+            if (p <= 1.0)
+                /*FIXME: x = p ** (1.0/alpha)*/
+                x = pow(p, 1.0/alpha);
+            else
+                x = - log((b - p) / alpha);
+            rvo = random_random(tp);
+            u1 = rvo.number.val;
+            if (p > 1.0) {
+                /*FIXME: if u1 <= x ** (alpha - 1.0):*/
+                if (u1 <= pow(x, alpha - 1.0))
+                    break;
+            }
+            else if (u1 <= exp(-x))
+                break;
+        }
+        res = x * beta;
+        return (tp_number(res));
+    }
+}
+/*
+ * Beta distribution.
+ *
+ *        Conditions on the parameters are alpha > 0 and beta > 0.
+ *        Returned values range between 0 and 1.
+ *
+ *        # This version due to Janne Sinkkonen, and matches all the std
+ *        # texts (e.g., Knuth Vol 2 Ed 3 pg 134 "the beta distribution").
+ *
+ * See also:
+ * http://sourceforge.net/bugs/?func=detailbug&bug_id=130030&group_id=5470
+ * for Ivan Frohne's insightful analysis of why the original implementation:
+ *
+ *    def betavariate(self, alpha, beta):
+ *        # Discrete Event Simulation in C, pp 87-88.
+ *
+ *        y = self.expovariate(alpha)
+ *        z = self.expovariate(1.0/beta)
+ *        return z/(y+z)
+ *
+ * was dead wrong, and how it probably got that way.
+ *
+ */
+tp_obj random_betavariate(TP)
+{
+    double alpha = TP_NUM();
+    double beta  = TP_NUM();
+    double t;
+    double r = 0.0;
+    tp_obj y;
+    tp_obj params;
+    params = tp_params_v(tp, 2, tp_number(alpha), tp_number(1.0));
+    y = tp_ez_call(tp, "random", "gammavariate", params);
+    if (y.number.val == 0) {
+        return (y);
+    } else {
+        params = tp_params_v(tp, 2, tp_number(beta), tp_number(1.0));
+        t = y.number.val;
+        y = tp_ez_call(tp, "random", "gammavariate", params);
+        r = t / (t + y.number.val);
+        return (tp_number(r));
+    }
+}
+/*
+ * Pareto distribution.  alpha is the shape parameter.
+ * # Jain, pg. 495
+ */
+tp_obj random_paretovariate(TP)
+{
+    double alpha = TP_NUM();
+    double u;
+    double r;
+    tp_obj rvo;
+    rvo = random_random(tp);
+    u = 1.0 - rvo.number.val;
+    r = 1.0 / pow(u, 1.0/alpha);
+    return (tp_number(r));
+}
+/*
+ * Weibull distribution.
+ *
+ * alpha is the scale parameter and beta is the shape parameter.
+ *
+ * Jain, pg. 499; bug fix courtesy Bill Arms
+ */
+tp_obj random_weibullvariate(TP)
+{
+    double alpha = TP_NUM();
+    double beta  = TP_NUM();
+    double u;
+    double r;
+    tp_obj rvo;
+    rvo = random_random(tp);
+    u = 1.0 - rvo.number.val;
+    r = alpha * pow(-log(u), 1.0/beta);
+    return (tp_number(r));
+}
+/*
+ * randomly select an element from range ([start,] stop[, step])
+ *
+ * 'stop' must be larger than 'start', both can be negative;
+ * 'step' must be integer larger than zero.
+ */
+tp_obj random_randrange(TP)
+{
+    tp_obj start = TP_OBJ();
+    tp_obj stop = TP_DEFAULT(tp_None);
+    tp_obj step = TP_DEFAULT(tp_number(1));
+    tp_obj rvo = random_random(tp);
+    int istart = (int)start.number.val;
+    int istep = (int)step.number.val;
+    int istop;
+    int iwidth;
+    double res;
+    if (stop.type == TP_NONE) {
+        /*
+                        * if only one argument, then start just means stop
+                        */
+        istop = istart;
+        res = (rvo.number.val * istop);
+        return (tp_number(res));
+    } else if (stop.type == TP_NUMBER) {
+        istop = (int)stop.number.val;
+        iwidth = istop - istart;
+        if (iwidth < 0)
+            tp_raise(tp_None,tp_printf(tp, "%s", "stop must be > start"));
+        if (istep <= 0)
+            tp_raise(tp_None,tp_printf(tp, "%s", "step must be integer larger than 0"));
+        if (istep == 1) {
+            res = (int)(istart + (int)(rvo.number.val * iwidth));
+            return (tp_number(res));
+        } else {
+            int n = (iwidth + istep - 1) / istep;
+            res = (int)(istart + istep * (int)(n * rvo.number.val));
+            return (tp_number(res));
+        }
+    } else {
+        tp_raise(tp_None,tp_printf(tp, "%s", "wrong type of stop"));
+    }
+}
+/*
+ * return random integer between [a, b]
+ */
+tp_obj random_randint(TP)
+{
+    double a = TP_NUM();
+    double b = TP_NUM();
+    tp_obj r;
+    tp_obj params;
+    params = tp_params_v(tp, 2, tp_number(a), tp_number(b + 1));
+    r = tp_ez_call(tp, "random", "randrange", params);
+    return (r);
+}
+/*
+ * return a random element of sequence 'seq'. 'seq' mustn't be empty.
+ */
+tp_obj random_choice(TP)
+{
+    tp_obj seq = TP_OBJ();
+    tp_obj len;
+    tp_obj rvo;
+    tp_obj r;
+    int i;
+    len = tp_len(tp, seq);
+    if (len.number.val <= 0)
+        tp_raise(tp_None,tp_printf(tp, "%s", "seq mustn't be empty"));
+    rvo = random_random(tp);
+    i = (int)(len.number.val * rvo.number.val);
+    r = tp_get(tp, seq, tp_number(i));
+    return (r);
+}
+/*
+ * shuffle sequence 'seq' in place, return None
+ */
+tp_obj random_shuffle(TP)
+{
+    tp_obj seq = TP_OBJ();
+    tp_obj elmi;
+    tp_obj elmj;
+    tp_obj params;
+    tp_obj rvo;
+    tp_obj len = tp_len(tp, seq);
+    int i, j;
+    if (len.number.val <= 0)
+        return (tp_None);
+    for (i = len.number.val - 1; i > len.number.val / 2; i--) {
+        /*
+                       * randomly exchange elment i and elment j, element i from the behind end of 'seq', while
+                       * element j from the front end of 'seq'.
+                       */
+        params = tp_params_v(tp, 2, tp_number(0), tp_number(len.number.val / 2));
+        rvo = tp_ez_call(tp, "random", "randint", params);
+        j = (int)rvo.number.val;
+        elmi = tp_get(tp, seq, tp_number(i));
+        elmj = tp_get(tp, seq, tp_number(j));
+        tp_set(tp, seq, tp_number(i), elmj);
+        tp_set(tp, seq, tp_number(j), elmi);
+    }
+    for (i = len.number.val / 2; i >= 0; i--) {
+        /*
+                       * randomly exchange elment i and elment j, element i from the front end of 'seq', while
+                       * element j from the behind end of 'seq'.
+                       */
+        params = tp_params_v(tp, 2, tp_number(len.number.val / 2), tp_number(len.number.val - 1));
+        rvo = tp_ez_call(tp, "random", "randint", params);
+        j = (int)rvo.number.val;
+        elmi = tp_get(tp, seq, tp_number(i));
+        elmj = tp_get(tp, seq, tp_number(j));
+        tp_set(tp, seq, tp_number(i), elmj);
+        tp_set(tp, seq, tp_number(j), elmi);
+    }
+    return (tp_None);
+}

 /programs/develop/tinypy/modules/random/tests.py
 ,0 → 1,176
+#!/usr/bin/env python
+import random
+#from math import log, exp, sqrt, pi
+def test_seed_state():
+    """test seed() and getstate()/setstate()
+    """
+    # random ought to be able to deal with seeds in any form, of follows.
+    # following code shouldn't cause an exception.
+    random.seed()
+    random.seed(0)
+    random.seed(-1)
+    random.seed(0.1)
+    random.seed(-0.1)
+    random.seed("a")
+    random.seed("abc")
+    random.seed("abcd")
+    random.seed("fasdfasdfasdfadgaldhgldahlgahdlghadlgladh")
+    random.seed("lxhlh90yowhldshlgah;")
+    # state1 and state2 should be different for different seeds
+    random.seed(1)
+    state1 = random.getstate()
+    random.seed(2)
+    state2 = random.getstate()
+    rep = 0
+    for ind in range(len(state1)):
+        elem1 = state1[ind]
+        elem2 = state2[ind]
+        if (elem1 == elem2): rep += 1
+    if (rep > len(state1) / 2):
+        print("rep = ", rep, "len(state1) = ", len(state1))
+        raise "state1 and state2 should be different"
+    # for the same seeds, state1 and state2 should be the same
+    random.seed(100)
+    state1 = random.getstate()
+    random.seed(100)
+    state2 = random.getstate()
+    rep = 0
+    for ind in range(len(state1)):
+        elem1 = state1[ind]
+        elem2 = state2[ind]
+        if (elem1 == elem2): rep += 1
+    if (rep != len(state1)):
+        raise "state1 and state2 should be the same"
+def test_jumpahead():
+    """jumpahead will change the pseudo-number generator's internal state
+    """
+    random.seed()
+    state1 = random.getstate()
+    random.jumpahead(20)
+    state2 = random.getstate()
+    rep = 0
+    for ind in range(len(state1)):
+        elem1 = state1[ind]
+        elem2 = state2[ind]
+        if (elem1 == elem2): rep += 1
+    if (rep > len(state1) / 2):
+        raise "state1 and state2 can't be the same"
+def test_setstate():
+    """
+    """
+    random.seed()
+    oldState = random.getstate()
+    oldRandSeq = [random.random() for i in range(10)]
+    random.setstate(oldState)
+    newRandSeq = [random.random() for i in range(10)]
+    rep = 0
+    for ind in range(len(oldRandSeq)):
+        elem1 = oldRandSeq[ind]
+        elem2 = newRandSeq[ind]
+        if (elem1 == elem2): rep += 1
+    if (rep != len(oldRandSeq)):
+        raise "oldRandSeq and newRandSeq should be the same"
+def test_random():
+    """generate a random number list
+    """
+    x = [random.random() for i in range(100)]
+def test_distribution():
+    """these lines are borrowed from python, they shouldn't
+        cause any exception.
+    """
+    g = random
+    g.uniform(1,10)
+    g.paretovariate(1.0)
+    g.expovariate(1.0)
+    g.weibullvariate(1.0, 1.0)
+    g.normalvariate(0.0, 1.0)
+    g.lognormvariate(0.0, 1.0)
+    g.vonmisesvariate(0.0, 1.0)
+    g.gammavariate(0.01, 1.0)
+    g.gammavariate(1.0, 1.0)
+    g.gammavariate(200.0, 1.0)
+    g.betavariate(3.0, 3.0)
+def test_randrange():
+    """these input to randrange() shouldn't cause any exception.
+    """
+    random.randrange(100000)
+    random.randrange(-100000)
+    random.randrange(0)
+    random.randrange(-10.2)
+    random.randrange(-10, 10)
+    random.randrange(2, 1000)
+    random.randrange(0, 1)
+    random.randrange(-1, 0)
+    random.randrange(10, 2000, 2)
+    random.randrange(-2000, 100, 5)
+    random.randrange(-1000.3, 1000.7, 2)
+def test_randint():
+    """for any valid pair (a, b), randint(a, b) should lay between [a, b]
+    """
+    for i in range(1000):
+        r = random.randint(-10000, 10000)
+        if (-10000 <= r <= 10000): continue
+        else: raise "error: random.randint()"
+def test_choice():
+    """random.choice() should be able to deal with string, list.
+    """
+    S = "abcdefg123*@#$%)("
+    L = [1, 2, 3, -1, 0.2, -0.1, -10000, "cyc"]
+    if random.choice(S) not in S:
+        raise "error: random.choice(S)"
+    if random.choice(L) not in L:
+        raise "error: random.choice(L)"
+def test_shuffle():
+    """test random.shuffle() on list. since string is not writable in-place,
+        random.shuffle() can not be applied on string.
+        Note: to copy items from a list to a new list, must use syntax like:
+            newList = oldList[:]
+        if use syntax like: newList = oldList, newList is just an alias of oldList.
+    """
+    oldL = [1, 2, 3, -1, 0.2, -0.1, -10000, "cyc"]
+    newL = oldL[:]
+    random.shuffle(newL)
+    rep = 0
+    for ind in range(len(oldL)):
+        elem1 = oldL[ind]
+        elem2 = newL[ind]
+        if (elem1 == elem2): rep += 1
+    if (rep > len(oldL) / 2):
+        raise "oldL and newL shouldn't be the same"
+def test_53_bits_per_float():
+    pass
+def main():
+    test_seed_state()
+    test_jumpahead()
+    test_setstate()
+    test_random()
+    test_distribution()
+    test_randrange()
+    test_randint()
+    test_choice()
+    test_shuffle()
+    test_53_bits_per_float()
+    print("#OK")
+if __name__ == '__main__':
+    main()

 /programs/develop/tinypy/modules/re/init.c
 ,0 → 1,710
+/*
+ * regular expression module
+ *
+ * Important Note: do not support group name index
+ *
+ * $Id$
+ */
+#include <stdio.h>
+#include <assert.h>
+#include "regexpr.c"
+/* tinypy API to be use in this unit */
+extern tp_obj tp_data(TP,int magic,void *v);
+extern tp_obj tp_object_new(TP);
+extern tp_obj tp_object(TP);
+extern tp_obj tp_method(TP,tp_obj self,tp_obj v(TP));
+extern tp_obj tp_string_copy(TP, const char *s, int n);
+extern tp_obj tp_list(TP);
+extern tp_obj tp_copy(TP);
+/* last error message */
+static const char * LastError = NULL;
+/* lower level regex object */
+typedef struct {
+        struct re_pattern_buffer re_patbuf;     /* The compiled expression */
+        struct re_registers re_regs;            /* The registers from the last match */
+        char re_fastmap[256];                           /* Storage for fastmap */
+        unsigned char *re_translate;            /* String object for translate table */
+        unsigned char *re_lastok;                       /* String object last matched/searched */
+        /* supplementary */
+        int re_errno;                                           /* error num */
+        int re_syntax;                                          /* syntax */
+} regexobject;
+/* local declarations */
+static regexobject* getre(TP, tp_obj rmobj);
+static tp_obj match_obj_group(TP);
+static tp_obj match_obj_groups(TP);
+static tp_obj match_obj_start(TP);
+static tp_obj match_obj_end(TP);
+static tp_obj match_obj_span(TP);
+/*
+ * helper function: return lower level regex object
+ * rmobj        - regex or match object
+ */
+static regexobject * getre(TP, tp_obj rmobj)
+{
+        tp_obj reobj_data = tp_get(tp, rmobj, tp_string("__data__"));
+        regexobject *re = NULL;
+        /* validate magic */
+        if (reobj_data.data.magic != sizeof(regexobject)) {
+                LastError = "broken regex object";
+                return (NULL);
+        }
+        re = (regexobject*)reobj_data.data.val;
+        assert(re);
+        return (re);
+}
+/*
+ * derive match object from regex object
+ */
+static tp_obj match_object(TP, tp_obj reobj)
+{
+        tp_obj mo = tp_object(tp);      /* match object */
+        tp_obj redata;                          /* regex object data */
+        tp_obj madata;                          /* match object data */
+        regexobject *re = NULL;         /* lower level regex object */
+        redata = tp_get(tp, reobj, tp_string("__data__"));
+        re = (regexobject *)redata.data.val;
+        assert(re);
+        madata = tp_data(tp, (int)sizeof(regexobject), re);
+        tp_set(tp, mo, tp_string("group"),      tp_method(tp, mo, match_obj_group));
+        tp_set(tp, mo, tp_string("groups"),     tp_method(tp, mo, match_obj_groups));
+        tp_set(tp, mo, tp_string("start"),      tp_method(tp, mo, match_obj_start));
+        tp_set(tp, mo, tp_string("end"),        tp_method(tp, mo, match_obj_end));
+        tp_set(tp, mo, tp_string("span"),       tp_method(tp, mo, match_obj_span));
+        tp_set(tp, mo, tp_string("__data__"), madata);
+        return (mo);
+}
+/*
+ * FUNC: regexobj.search(str[,pos=0])
+ * self         - regex object
+ * str          - string to be searched
+ * pos          - optional starting offset
+ *
+ * RETURN:
+ * match object - when matched
+ * None                 - not matched
+ */
+static tp_obj regex_obj_search(TP)
+{
+        tp_obj self = TP_OBJ();         /* regex object */
+        tp_obj str = TP_STR();
+        tp_obj pos = TP_DEFAULT(tp_number(0));
+        tp_obj maobj;                           /* match object */
+        regexobject *re = NULL;
+        int r = -2;                                     /* -2 indicate exception */
+        int range;
+        if (pos.number.val < 0 || pos.number.val > str.string.len) {
+                LastError = "search offset out of range";
+                goto exception;
+        }
+        range = str.string.len - pos.number.val;
+        re = getre(tp, self);
+        re->re_lastok = NULL;
+        r = re_search(&re->re_patbuf, (unsigned char *)str.string.val,
+                        str.string.len, pos.number.val, range, &re->re_regs);
+        /* cannot match pattern */
+        if (r == -1)
+                goto notfind;
+        /* error occurred */
+        if (r == -2)
+                goto exception;
+        /* matched */
+        re->re_lastok = (unsigned char *)str.string.val;
+        /* match obj */
+        maobj = match_object(tp, self);
+        return (maobj);
+notfind:
+        re->re_lastok = NULL;
+        return (tp_None);
+exception:
+        re->re_lastok = NULL;
+        tp_raise(tp_None, tp_string("regex search error"));
+}
+/*
+ * FUNC: regexobj.match(str[,pos=0])
+ * self         - regex object
+ * str          - string to be matched
+ * pos          - optional starting position
+ *
+ * RETURN:
+ * match object - when matched
+ * None                 - not matched
+ */
+static tp_obj regex_obj_match(TP)
+{
+        tp_obj self = TP_OBJ();         /* regex object */
+        tp_obj str = TP_STR();
+        tp_obj pos = TP_DEFAULT(tp_number(0));
+        tp_obj maobj;                           /* match object */
+        regexobject *re = NULL;
+        int r = -2;                                     /* -2 indicate exception */
+        re = getre(tp, self);
+        re->re_lastok = NULL;
+        r = re_match(&re->re_patbuf, (unsigned char *)str.string.val,
+                        str.string.len, pos.number.val, &re->re_regs);
+        /* cannot match pattern */
+        if (r == -1)
+                goto nomatch;
+        /* error occurred */
+        if (r == -2)
+                goto exception;
+        /* matched */
+        re->re_lastok = (unsigned char *)str.string.val;
+        /* match obj */
+        maobj = match_object(tp, self);
+        return (maobj);
+nomatch:
+        re->re_lastok = NULL;
+        return (tp_None);
+exception:
+        re->re_lastok = NULL;
+        tp_raise(tp_None, tp_string("regex match error"));
+}
+/*
+ * regex object split()
+ * self         - regex object
+ * restr        - regex string
+ * maxsplit     - max split field, default 0, mean no limit
+ */
+static tp_obj regex_obj_split(TP)
+{
+        tp_obj self             = TP_OBJ();     /* regex object */
+        tp_obj restr    = TP_OBJ();     /* string */
+        tp_obj maxsplit = TP_DEFAULT(tp_number(0));
+        tp_obj maobj;                           /* match object */
+        regexobject *re = NULL;         /* lower level regex object */
+        tp_obj result   = tp_list(tp);
+        tp_obj grpstr;                          /* group string */
+        int     slen;                                   /* string length */
+        int srchloc;                            /* search location */
+        /* maxsplit == 0 means no limit */
+        if ((int)maxsplit.number.val == 0)
+                maxsplit.number.val = RE_NREGS;
+        assert(maxsplit.number.val > 0);
+        srchloc = 0;
+        slen = strlen((char *)restr.string.val);
+        do {
+                /* generate a temp match object */
+                tp_params_v(tp, 3, self, restr, tp_number(srchloc));
+                maobj = regex_obj_search(tp);
+                if (!tp_bool(tp, maobj))
+                        break;
+                re = getre(tp, maobj);
+                if (re->re_lastok == NULL) {
+                        tp_raise(tp_None, tp_string("no match for split()"));
+                }
+                /* extract fields */
+                if ((int)maxsplit.number.val > 0) {
+                        int start = re->re_regs.start[0];
+                        int end   = re->re_regs.end[0];
+                        /*printf("%s:start(%d),end(%d)\n", __func__, start, end);*/
+                        if (start < 0 || end < 0)
+                                break;
+                        grpstr = tp_string_copy(tp,
+                                        (const char *)re->re_lastok + srchloc, start - srchloc);
+                        if (tp_bool(tp, grpstr)) {
+                                tp_set(tp, result, tp_None, grpstr);
+                                maxsplit.number.val--;
+                        }
+                        srchloc = end;
+                }
+        } while (srchloc < slen && (int)maxsplit.number.val > 0);
+        /* collect remaining string, if necessary */
+        if (srchloc < slen) {
+                grpstr = tp_string_copy(tp,
+                                (const char *)restr.string.val + srchloc, slen - srchloc);
+                if (tp_bool(tp, grpstr))
+                        tp_set(tp, result, tp_None, grpstr);
+        }
+        return (result);
+}
+/*
+ * regex object findall()
+ * self         - regex object
+ * restr        - regex string
+ * pos          - starting position, default 0
+ */
+static tp_obj regex_obj_findall(TP)
+{
+        tp_obj self             = TP_OBJ();     /* regex object */
+        tp_obj restr    = TP_OBJ();     /* string */
+        tp_obj pos              = TP_DEFAULT(tp_number(0));
+        tp_obj maobj;                           /* match object */
+        regexobject *re = NULL;         /* lower level regex object */
+        tp_obj result   = tp_list(tp);
+        tp_obj grpstr;                          /* group string */
+        int     slen;                                   /* string length */
+        int srchloc;                            /* search location */
+        srchloc = (int)pos.number.val;
+        slen    = strlen((char *)restr.string.val);
+        if (srchloc < 0 || srchloc >= slen)
+                tp_raise(tp_None, tp_string("starting position out of range"));
+        do {
+                /* generate a temp match object */
+                tp_params_v(tp, 3, self, restr, tp_number(srchloc));
+                maobj = regex_obj_search(tp);
+                if (!tp_bool(tp, maobj))
+                        break;
+                re = getre(tp, maobj);
+                if (re->re_lastok == NULL) {
+                        tp_raise(tp_None, tp_string("no match for findall()"));
+                }
+                /* extract fields */
+                if (srchloc < slen) {
+                        int start = re->re_regs.start[0];
+                        int end   = re->re_regs.end[0];
+                        /*printf("%s:start(%d),end(%d)\n", __func__, start, end);*/
+                        if (start < 0 || end < 0)
+                                break;
+                        grpstr = tp_string_copy(tp,
+                                        (const char *)re->re_lastok + start, end - start);
+                        if (tp_bool(tp, grpstr)) {
+                                tp_set(tp, result, tp_None, grpstr);
+                        }
+                        srchloc = end;
+                }
+        } while (srchloc < slen);
+        return (result);
+}
+/*
+ * FUNC: matchobj.group([group1, ...])
+ * self         - match object
+ * args         - optional group indices, default 0
+ *
+ * return specified group.
+ */
+static tp_obj match_obj_group(TP)
+{
+        tp_obj self = TP_OBJ();         /* match object */
+        tp_obj grpidx;                          /* a group index */
+        regexobject *re = NULL;
+        int indices[RE_NREGS];
+        int start;
+        int end;
+        int i;
+        int single = 0;                         /* single group index? */
+        tp_obj result;
+        /* get lower level regex object representation */
+        re = getre(tp, self);
+        if (re->re_lastok == NULL)
+                tp_raise(tp_None,
+                                tp_string("group() only valid after successful match/search"));
+        for (i = 0; i < RE_NREGS; i++)
+                indices[i] = -1;
+        /*
+         * if no group index provided, supply default group index 0; else
+         * fill in indices[] with provided group index list.
+         */
+        if (tp->params.list.val->len == 0) {
+                indices[0] = 0;
+                single = 1;
+        } else if (tp->params.list.val->len == 1) {
+                indices[0] = (int)TP_NUM();
+                single = 1;
+        } else {
+                i = 0;
+                TP_LOOP(grpidx)
+                if (grpidx.number.val < 0 || grpidx.number.val > RE_NREGS)
+                        tp_raise(tp_None, tp_string("group() grpidx out of range"));
+                indices[i++] = (int)grpidx.number.val;
+                TP_END
+        }
+        /* generate result string list */
+        result = tp_list(tp);
+        for (i = 0; i < RE_NREGS && indices[i] >= 0; i++) {
+                tp_obj grpstr;
+                start = re->re_regs.start[indices[i]];
+                end   = re->re_regs.end[indices[i]];
+                if (start < 0 || end < 0) {
+                        grpstr = tp_None;
+                } else {
+                        grpstr = tp_string_copy(tp, (const char *)re->re_lastok + start,
+                                        end - start);
+                }
+                tp_set(tp, result, tp_None, grpstr);
+        }
+        return (single ? tp_get(tp, result, tp_number(0)) : result);
+}
+/*
+ * FUNC: matchobj.groups()
+ * self - match object.
+ * return all groups.
+ * Note: CPython allow a 'default' argument, but we disallow it.
+ */
+static tp_obj match_obj_groups(TP)
+{
+        tp_obj self = TP_OBJ();         /* match object */
+        regexobject *re = NULL;
+        int start;
+        int end;
+        int i;
+        tp_obj result = tp_list(tp);
+        re = getre(tp, self);
+        if (re->re_lastok == NULL) {
+                tp_raise(tp_None,
+                                tp_string("groups() only valid after successful match/search"));
+        }
+        for (i = 1; i < RE_NREGS; i++) {
+                start = re->re_regs.start[i];
+                end   = re->re_regs.end[i];
+                if (start < 0 || end < 0)
+                        break;
+                tp_obj grpstr = tp_string_copy(tp,
+                                (const char *)re->re_lastok + start, end - start);
+                if (tp_bool(tp, grpstr))
+                        tp_set(tp, result, tp_None, grpstr);
+        }
+        return (result);
+}
+/*
+ * FUNC: matchobj.start([group])
+ * self         - match object
+ * group        - group index
+ * return starting position of matched 'group' substring.
+ */
+static tp_obj match_obj_start(TP)
+{
+        tp_obj self = TP_OBJ();                                         /* match object */
+        tp_obj group = TP_DEFAULT(tp_number(0));        /* group */
+        regexobject *re = NULL;
+        int start;
+        re = getre(tp, self);
+        if (re->re_lastok == NULL) {
+                tp_raise(tp_None,
+                                tp_string("start() only valid after successful match/search"));
+        }
+        if (group.number.val < 0 || group.number.val > RE_NREGS)
+                tp_raise(tp_None, tp_string("IndexError: group index out of range"));
+        start = re->re_regs.start[(int)group.number.val];
+        return (tp_number(start));
+}
+/*
+ * FUNC: matchobj.end([group])
+ * self         - match object
+ * group        - group index
+ * return ending position of matched 'group' substring.
+ */
+static tp_obj match_obj_end(TP)
+{
+        tp_obj self = TP_OBJ();                                         /* match object */
+        tp_obj group = TP_DEFAULT(tp_number(0));        /* group */
+        regexobject *re = NULL;
+        int end;
+        re = getre(tp, self);
+        if (re->re_lastok == NULL) {
+                tp_raise(tp_None,
+                                tp_string("end() only valid after successful match/search"));
+        }
+        if (group.number.val < 0 || group.number.val > RE_NREGS)
+                tp_raise(tp_None, tp_string("IndexError: group index out of range"));
+        end = re->re_regs.end[(int)group.number.val];
+        return (tp_number(end));
+}
+/*
+ * FUNC: matchobj.span([group])
+ * self         - match object
+ * group        - group index
+ * return [start,end] position pair of matched 'group' substring.
+ */
+static tp_obj match_obj_span(TP)
+{
+        tp_obj self = TP_OBJ();                                         /* match object */
+        tp_obj group = TP_DEFAULT(tp_number(0));        /* group */
+        regexobject *re = NULL;
+        int start;
+        int end;
+        tp_obj result;
+        re = getre(tp, self);
+        if (re->re_lastok == NULL) {
+                tp_raise(tp_None,
+                                tp_string("span() only valid after successful match/search"));
+        }
+        if (group.number.val < 0 || group.number.val > RE_NREGS)
+                tp_raise(tp_None, tp_string("IndexError: group index out of range"));
+        start = re->re_regs.start[(int)group.number.val];
+        end   = re->re_regs.end[(int)group.number.val];
+        result = tp_list(tp);
+        tp_set(tp, result, tp_None, tp_number(start));
+        tp_set(tp, result, tp_None, tp_number(end));
+        return (result);
+}
+/*
+ * compile out a re object
+ * repat        - regex pattern
+ * resyn        - regex syntax
+ */
+static tp_obj regex_compile(TP)
+{
+        char *error = NULL;
+        char const *pat = NULL;
+        int size = 0;
+        tp_obj reobj_data;
+        tp_obj repat = TP_TYPE(TP_STRING);                                              /* pattern */
+        tp_obj resyn = TP_DEFAULT(tp_number(RE_SYNTAX_EMACS));  /* syntax */
+        tp_obj reobj;   /* regex object */
+        regexobject *re;
+        /*
+         * create regex object, its parent is builtin 'object'
+         */
+        reobj = tp_object(tp);
+        re = (regexobject *)malloc(sizeof(regexobject));
+        if (!re) {
+                error = "malloc lower level regex object failed";
+                goto finally;
+        }
+        re->re_patbuf.buffer = NULL;
+        re->re_patbuf.allocated = 0;
+        re->re_patbuf.fastmap = (unsigned char *)re->re_fastmap;
+        re->re_patbuf.translate = NULL;
+        re->re_translate = NULL;
+        re->re_lastok = NULL;
+        re->re_errno = 0;
+        re->re_syntax = (int)resyn.number.val;
+        pat = repat.string.val;
+        size = repat.string.len;
+        error = re_compile_pattern((unsigned char *)pat, size, &re->re_patbuf);
+        if (error != NULL) {
+                LastError = error;
+                goto finally;
+        }
+        /* regexobject's size as magic */
+        reobj_data = tp_data(tp, (int)sizeof(regexobject), re);
+        /*
+         * bind to regex object
+         */
+        tp_set(tp, reobj, tp_string("search"),
+                        tp_method(tp, reobj, regex_obj_search));
+        tp_set(tp, reobj, tp_string("match"),
+                        tp_method(tp, reobj, regex_obj_match));
+        tp_set(tp, reobj, tp_string("split"),
+                        tp_method(tp, reobj, regex_obj_split));
+        tp_set(tp, reobj, tp_string("findall"),
+                        tp_method(tp, reobj, regex_obj_findall));
+        tp_set(tp, reobj, tp_string("__data__"), reobj_data);
+        tp_set(tp, reobj, tp_string("__name__"),
+                        tp_string("regular expression object"));
+        tp_set(tp, reobj, tp_string("__doc__"), tp_string(
+                                "regular expression object, support methods:\n"
+                                "search(str[,pos=0])-search 'str' from 'pos'\n"
+                                "match(str[,pos=0])     -match 'str' from 'pos'\n"
+                                ));
+        return (reobj);
+finally:
+        tp_raise(tp_None, tp_string(error));
+}
+/*
+ * module level search()
+ */
+static tp_obj regex_search(TP)
+{
+        tp_obj repat = TP_OBJ();        /* pattern */
+        tp_obj restr = TP_OBJ();        /* string */
+        tp_obj resyn = TP_DEFAULT(tp_number(RE_SYNTAX_EMACS));
+        tp_obj reobj;                           /* regex object */
+        tp_obj maobj;                           /* match object */
+        /* compile out regex object */
+        tp_params_v(tp, 2, repat, resyn);
+        reobj = regex_compile(tp);
+        /* call r.search() */
+        tp_params_v(tp, 3, reobj, restr, tp_number(0));
+        maobj = regex_obj_search(tp);
+        return (maobj);
+}
+/*
+ * module level match()
+ */
+static tp_obj regex_match(TP)
+{
+        tp_obj repat = TP_OBJ();        /* pattern */
+        tp_obj restr = TP_OBJ();        /* string */
+        tp_obj resyn = TP_DEFAULT(tp_number(RE_SYNTAX_EMACS));
+        tp_obj reobj;                           /* regex object */
+        tp_obj maobj;                           /* match object */
+        /* compile out regex object */
+        tp_params_v(tp, 2, repat, resyn);
+        reobj = regex_compile(tp);
+        /* call r.search() */
+        tp_params_v(tp, 3, reobj, restr, tp_number(0));
+        maobj = regex_obj_match(tp);
+        return (maobj);
+}
+/*
+ * module level split()
+ * repat        - regex pattern
+ * restr        - regex string
+ * maxsplit     - max split field, default 0, mean no limit
+ */
+static tp_obj regex_split(TP)
+{
+        tp_obj repat = TP_OBJ();        /* pattern */
+        tp_obj restr = TP_OBJ();        /* string */
+        tp_obj maxsplit = TP_DEFAULT(tp_number(0));
+        tp_obj reobj;                           /* regex object */
+        /* generate a temp regex object */
+        tp_params_v(tp, 2, repat, tp_number(RE_SYNTAX_EMACS));
+        reobj = regex_compile(tp);
+        tp_params_v(tp, 3, reobj, restr, maxsplit);
+        return regex_obj_split(tp);
+}
+/*
+ * module level findall()
+ * repat        - regex pattern
+ * restr        - regex string
+ * resyn        - regex syntax, optional, default RE_SYNTAX_EMAC
+ */
+static tp_obj regex_findall(TP)
+{
+        tp_obj repat = TP_OBJ();        /* pattern */
+        tp_obj restr = TP_OBJ();        /* string */
+        tp_obj resyn = TP_DEFAULT(tp_number(RE_SYNTAX_EMACS));
+        tp_obj reobj;                           /* regex object */
+        /* generate a temp regex object */
+        tp_params_v(tp, 2, repat, resyn);
+        reobj = regex_compile(tp);
+        tp_params_v(tp, 2, reobj, restr);
+        return regex_obj_findall(tp);
+}
+/*
+ * re mod can only support 'set_syntax', 'get_syntax', and 'compile' functions,
+ * 'compile' function will return a 'reobj', and this 'reobj' will support
+ * methods 'search', 'match', 'group', 'groupall', el al.
+ */
+void re_init(TP)
+{
+        /*
+         * module dict for re
+         */
+        tp_obj re_mod = tp_dict(tp);
+        /*
+         * bind to re module
+         */
+        tp_set(tp, re_mod, tp_string("compile"),          tp_fnc(tp, regex_compile));
+        tp_set(tp, re_mod, tp_string("search"),           tp_fnc(tp, regex_search));
+        tp_set(tp, re_mod, tp_string("match"),            tp_fnc(tp, regex_match));
+        tp_set(tp, re_mod, tp_string("split"),            tp_fnc(tp, regex_split));
+        tp_set(tp, re_mod, tp_string("findall"),          tp_fnc(tp, regex_findall));
+        tp_set(tp, re_mod, tp_string("AWK_SYNTAX"),   tp_number(RE_SYNTAX_AWK));
+        tp_set(tp, re_mod, tp_string("EGREP_SYNTAX"), tp_number(RE_SYNTAX_EGREP));
+        tp_set(tp, re_mod, tp_string("GREP_SYNTAX"),  tp_number(RE_SYNTAX_GREP));
+        tp_set(tp, re_mod, tp_string("EMACS_SYNTAX"), tp_number(RE_SYNTAX_EMACS));
+        /*
+         * bind special attibutes to re module
+         */
+        tp_set(tp, re_mod, tp_string("__name__"),
+                        tp_string("regular expression module"));
+        tp_set(tp, re_mod, tp_string("__file__"), tp_string(__FILE__));
+        tp_set(tp, re_mod, tp_string("__doc__"),
+                        tp_string("simple regular express implementation"));
+        /*
+         * bind regex module to tinypy modules[]
+         */
+        tp_set(tp, tp->modules, tp_string("re"), re_mod);
+}

 /programs/develop/tinypy/modules/re/regexpr.c
 ,0 → 1,2124
+/*
+ * to eliminate dependence on CPython, I stripped out
+ * some CPython error handling function calls.
+ */
+/* regexpr.c
+ *
+ * Author: Tatu Ylonen <ylo@ngs.fi>
+ *
+ * Copyright (c) 1991 Tatu Ylonen, Espoo, Finland
+ *
+ * Permission to use, copy, modify, distribute, and sell this software
+ * and its documentation for any purpose is hereby granted without
+ * fee, provided that the above copyright notice appear in all copies.
+ * This software is provided "as is" without express or implied
+ * warranty.
+ *
+ * Created: Thu Sep 26 17:14:05 1991 ylo
+ * Last modified: Mon Nov  4 17:06:48 1991 ylo
+ * Ported to Think C: 19 Jan 1992 guido@cwi.nl
+ *
+ * This code draws many ideas from the regular expression packages by
+ * Henry Spencer of the University of Toronto and Richard Stallman of
+ * the Free Software Foundation.
+ *
+ * Emacs-specific code and syntax table code is almost directly borrowed
+ * from GNU regexp.
+ *
+ * Bugs fixed and lots of reorganization by Jeffrey C. Ollie, April
+ * 1997 Thanks for bug reports and ideas from Andrew Kuchling, Tim
+ * Peters, Guido van Rossum, Ka-Ping Yee, Sjoerd Mullender, and
+ * probably one or two others that I'm forgetting.
+ *
+ * $Id$ */
+#include <stdlib.h>
+#include <string.h>
+#include "regexpr.h"
+/* The original code blithely assumed that sizeof(short) == 2.  Not
+ * always true.  Original instances of "(short)x" were replaced by
+ * SHORT(x), where SHORT is #defined below.  */
+#define SHORT(x) ((x) & 0x8000 ? (x) - 0x10000 : (x))
+/* The stack implementation is taken from an idea by Andrew Kuchling.
+ * It's a doubly linked list of arrays. The advantages of this over a
+ * simple linked list are that the number of mallocs required are
+ * reduced. It also makes it possible to statically allocate enough
+ * space so that small patterns don't ever need to call malloc.
+ *
+ * The advantages over a single array is that is periodically
+ * realloced when more space is needed is that we avoid ever copying
+ * the stack. */
+/* item_t is the basic stack element.  Defined as a union of
+ * structures so that both registers, failure points, and counters can
+ * be pushed/popped from the stack.  There's nothing built into the
+ * item to keep track of whether a certain stack item is a register, a
+ * failure point, or a counter. */
+typedef union item_t
+{
+        struct
+        {
+                int num;
+                int level;
+                unsigned char *start;
+                unsigned char *end;
+        } reg;
+        struct
+        {
+                int count;
+                int level;
+                int phantom;
+                unsigned char *code;
+                unsigned char *text;
+        } fail;
+        struct
+        {
+                int num;
+                int level;
+                int count;
+        } cntr;
+} item_t;
+#define STACK_PAGE_SIZE 256
+#define NUM_REGISTERS 256
+/* A 'page' of stack items. */
+typedef struct item_page_t
+{
+        item_t items[STACK_PAGE_SIZE];
+        struct item_page_t *prev;
+        struct item_page_t *next;
+} item_page_t;
+typedef struct match_state
+{
+        /* The number of registers that have been pushed onto the stack
+         * since the last failure point. */
+        int count;
+        /* Used to control when registers need to be pushed onto the
+         * stack. */
+        int level;
+        /* The number of failure points on the stack. */
+        int point;
+        /* Storage for the registers.  Each register consists of two
+         * pointers to characters.  So register N is represented as
+         * start[N] and end[N].  The pointers must be converted to
+         * offsets from the beginning of the string before returning the
+         * registers to the calling program. */
+        unsigned char *start[NUM_REGISTERS];
+        unsigned char *end[NUM_REGISTERS];
+        /* Keeps track of whether a register has changed recently. */
+        int changed[NUM_REGISTERS];
+        /* Structure to encapsulate the stack. */
+        struct
+        {
+                /* index into the current page.  If index == 0 and you need
+                 * to pop an item, move to the previous page and set index
+                 * = STACK_PAGE_SIZE - 1.  Otherwise decrement index to
+                 * push a page. If index == STACK_PAGE_SIZE and you need
+                 * to push a page move to the next page and set index =
+                 * 0. If there is no new next page, allocate a new page
+                 * and link it in. Otherwise, increment index to push a
+                 * page. */
+                int index;
+                item_page_t *current; /* Pointer to the current page. */
+                item_page_t first; /* First page is statically allocated. */
+        } stack;
+} match_state;
+/* Initialize a state object */
+/* #define NEW_STATE(state) \ */
+/* memset(&state, 0, (void *)(&state.stack) - (void *)(&state)); \ */
+/* state.stack.current = &state.stack.first; \ */
+/* state.stack.first.prev = NULL; \ */
+/* state.stack.first.next = NULL; \ */
+/* state.stack.index = 0; \ */
+/* state.level = 1 */
+#define NEW_STATE(state, nregs) \
+{ \
+        int i; \
+        for (i = 0; i < nregs; i++) \
+        { \
+                state.start[i] = NULL; \
+                state.end[i] = NULL; \
+                state.changed[i] = 0; \
+        } \
+        state.stack.current = &state.stack.first; \
+        state.stack.first.prev = NULL; \
+        state.stack.first.next = NULL; \
+        state.stack.index = 0; \
+        state.level = 1; \
+        state.count = 0; \
+        state.level = 0; \
+        state.point = 0; \
+}
+/* Free any memory that might have been malloc'd */
+#define FREE_STATE(state) \
+while(state.stack.first.next != NULL) \
+{ \
+        state.stack.current = state.stack.first.next; \
+        state.stack.first.next = state.stack.current->next; \
+        free(state.stack.current); \
+}
+/* Discard the top 'count' stack items. */
+#define STACK_DISCARD(stack, count, on_error) \
+stack.index -= count; \
+while (stack.index < 0) \
+{ \
+        if (stack.current->prev == NULL) \
+                on_error; \
+        stack.current = stack.current->prev; \
+        stack.index += STACK_PAGE_SIZE; \
+}
+/* Store a pointer to the previous item on the stack. Used to pop an
+ * item off of the stack. */
+#define STACK_PREV(stack, top, on_error) \
+if (stack.index == 0) \
+{ \
+        if (stack.current->prev == NULL) \
+                on_error; \
+        stack.current = stack.current->prev; \
+        stack.index = STACK_PAGE_SIZE - 1; \
+} \
+else \
+{ \
+        stack.index--; \
+} \
+top = &(stack.current->items[stack.index])
+/* Store a pointer to the next item on the stack. Used to push an item
+ * on to the stack. */
+#define STACK_NEXT(stack, top, on_error) \
+if (stack.index == STACK_PAGE_SIZE) \
+{ \
+        if (stack.current->next == NULL) \
+        { \
+                stack.current->next = (item_page_t *)malloc(sizeof(item_page_t)); \
+                if (stack.current->next == NULL) \
+                        on_error; \
+                stack.current->next->prev = stack.current; \
+                stack.current->next->next = NULL; \
+        } \
+        stack.current = stack.current->next; \
+        stack.index = 0; \
+} \
+top = &(stack.current->items[stack.index++])
+/* Store a pointer to the item that is 'count' items back in the
+ * stack. STACK_BACK(stack, top, 1, on_error) is equivalent to
+ * STACK_TOP(stack, top, on_error).  */
+#define STACK_BACK(stack, top, count, on_error) \
+{ \
+        int index; \
+        item_page_t *current; \
+        current = stack.current; \
+        index = stack.index - (count); \
+        while (index < 0) \
+        { \
+                if (current->prev == NULL) \
+                        on_error; \
+                current = current->prev; \
+                index += STACK_PAGE_SIZE; \
+        } \
+        top = &(current->items[index]); \
+}
+/* Store a pointer to the top item on the stack. Execute the
+ * 'on_error' code if there are no items on the stack. */
+#define STACK_TOP(stack, top, on_error) \
+if (stack.index == 0) \
+{ \
+        if (stack.current->prev == NULL) \
+                on_error; \
+        top = &(stack.current->prev->items[STACK_PAGE_SIZE - 1]); \
+} \
+else \
+{ \
+        top = &(stack.current->items[stack.index - 1]); \
+}
+/* Test to see if the stack is empty */
+#define STACK_EMPTY(stack) ((stack.index == 0) && \
+                            (stack.current->prev == NULL))
+/* Return the start of register 'reg' */
+#define GET_REG_START(state, reg) (state.start[reg])
+/* Return the end of register 'reg' */
+#define GET_REG_END(state, reg) (state.end[reg])
+/* Set the start of register 'reg'. If the state of the register needs
+ * saving, push it on the stack. */
+#define SET_REG_START(state, reg, text, on_error) \
+if(state.changed[reg] < state.level) \
+{ \
+        item_t *item; \
+        STACK_NEXT(state.stack, item, on_error); \
+        item->reg.num = reg; \
+        item->reg.start = state.start[reg]; \
+        item->reg.end = state.end[reg]; \
+        item->reg.level = state.changed[reg]; \
+        state.changed[reg] = state.level; \
+        state.count++; \
+} \
+state.start[reg] = text
+/* Set the end of register 'reg'. If the state of the register needs
+ * saving, push it on the stack. */
+#define SET_REG_END(state, reg, text, on_error) \
+if(state.changed[reg] < state.level) \
+{ \
+        item_t *item; \
+        STACK_NEXT(state.stack, item, on_error); \
+        item->reg.num = reg; \
+        item->reg.start = state.start[reg]; \
+        item->reg.end = state.end[reg]; \
+        item->reg.level = state.changed[reg]; \
+        state.changed[reg] = state.level; \
+        state.count++; \
+} \
+state.end[reg] = text
+#define PUSH_FAILURE(state, xcode, xtext, on_error) \
+{ \
+        item_t *item; \
+        STACK_NEXT(state.stack, item, on_error); \
+        item->fail.code = xcode; \
+        item->fail.text = xtext; \
+        item->fail.count = state.count; \
+        item->fail.level = state.level; \
+        item->fail.phantom = 0; \
+        state.count = 0; \
+        state.level++; \
+        state.point++; \
+}
+/* Update the last failure point with a new position in the text. */
+#define UPDATE_FAILURE(state, xtext, on_error) \
+{ \
+        item_t *item; \
+        STACK_BACK(state.stack, item, state.count + 1, on_error); \
+        if (!item->fail.phantom) \
+        { \
+                item_t *item2; \
+                STACK_NEXT(state.stack, item2, on_error); \
+                item2->fail.code = item->fail.code; \
+                item2->fail.text = xtext; \
+                item2->fail.count = state.count; \
+                item2->fail.level = state.level; \
+                item2->fail.phantom = 1; \
+                state.count = 0; \
+                state.level++; \
+                state.point++; \
+        } \
+        else \
+        { \
+                STACK_DISCARD(state.stack, state.count, on_error); \
+                STACK_TOP(state.stack, item, on_error); \
+                item->fail.text = xtext; \
+                state.count = 0; \
+                state.level++; \
+        } \
+}
+#define POP_FAILURE(state, xcode, xtext, on_empty, on_error) \
+{ \
+        item_t *item; \
+        do \
+        { \
+                while(state.count > 0) \
+                { \
+                        STACK_PREV(state.stack, item, on_error); \
+                        state.start[item->reg.num] = item->reg.start; \
+                        state.end[item->reg.num] = item->reg.end; \
+                        state.changed[item->reg.num] = item->reg.level; \
+                        state.count--; \
+                } \
+                STACK_PREV(state.stack, item, on_empty); \
+                xcode = item->fail.code; \
+                xtext = item->fail.text; \
+                state.count = item->fail.count; \
+                state.level = item->fail.level; \
+                state.point--; \
+        } \
+        while (item->fail.text == NULL); \
+}
+enum regexp_compiled_ops /* opcodes for compiled regexp */
+{
+        Cend,                 /* end of pattern reached */
+        Cbol,                 /* beginning of line */
+        Ceol,                 /* end of line */
+        Cset,                 /* character set.  Followed by 32 bytes of set. */
+        Cexact,               /* followed by a byte to match */
+        Canychar,             /* matches any character except newline */
+        Cstart_memory,        /* set register start addr (followed by reg number) */
+        Cend_memory,          /* set register end addr (followed by reg number) */
+        Cmatch_memory,        /* match a duplicate of reg contents (regnum follows)*/
+        Cjump,                /* followed by two bytes (lsb,msb) of displacement. */
+        Cstar_jump,           /* will change to jump/update_failure_jump at runtime */
+        Cfailure_jump,        /* jump to addr on failure */
+        Cupdate_failure_jump, /* update topmost failure point and jump */
+        Cdummy_failure_jump,  /* push a dummy failure point and jump */
+        Cbegbuf,              /* match at beginning of buffer */
+        Cendbuf,              /* match at end of buffer */
+        Cwordbeg,             /* match at beginning of word */
+        Cwordend,             /* match at end of word */
+        Cwordbound,           /* match if at word boundary */
+        Cnotwordbound,        /* match if not at word boundary */
+        Csyntaxspec,          /* matches syntax code (1 byte follows) */
+        Cnotsyntaxspec,       /* matches if syntax code does not match (1 byte follows) */
+        Crepeat1
+};
+enum regexp_syntax_op   /* syntax codes for plain and quoted characters */
+{
+        Rend,             /* special code for end of regexp */
+        Rnormal,          /* normal character */
+        Ranychar,         /* any character except newline */
+        Rquote,           /* the quote character */
+        Rbol,             /* match beginning of line */
+        Reol,             /* match end of line */
+        Roptional,        /* match preceding expression optionally */
+        Rstar,            /* match preceding expr zero or more times */
+        Rplus,            /* match preceding expr one or more times */
+        Ror,              /* match either of alternatives */
+        Ropenpar,         /* opening parenthesis */
+        Rclosepar,        /* closing parenthesis */
+        Rmemory,          /* match memory register */
+        Rextended_memory, /* \vnn to match registers 10-99 */
+        Ropenset,         /* open set.  Internal syntax hard-coded below. */
+        /* the following are gnu extensions to "normal" regexp syntax */
+        Rbegbuf,          /* beginning of buffer */
+        Rendbuf,          /* end of buffer */
+        Rwordchar,        /* word character */
+        Rnotwordchar,     /* not word character */
+        Rwordbeg,         /* beginning of word */
+        Rwordend,         /* end of word */
+        Rwordbound,       /* word bound */
+        Rnotwordbound,    /* not word bound */
+        Rnum_ops
+};
+/* customized errno */
+int re_errno = TP_RE_NOERR;
+static int re_compile_initialized = 0;
+static int regexp_syntax = 0;
+int re_syntax = 0; /* Exported copy of regexp_syntax */
+static unsigned char regexp_plain_ops[256];
+static unsigned char regexp_quoted_ops[256];
+static unsigned char regexp_precedences[Rnum_ops];
+static int regexp_context_indep_ops;
+static int regexp_ansi_sequences;
+#define NUM_LEVELS  5    /* number of precedence levels in use */
+#define MAX_NESTING 100  /* max nesting level of operators */
+#define SYNTAX(ch) re_syntax_table[(unsigned char)(ch)]
+unsigned char re_syntax_table[256];
+int re_err_occurred(void)
+{
+        if (re_errno == TP_RE_NOERR)
+                return (0);
+        return (1);
+}
+void re_compile_initialize(void)
+{
+        int a;
+        static int syntax_table_inited = 0;
+        if (!syntax_table_inited)
+        {
+                syntax_table_inited = 1;
+                memset(re_syntax_table, 0, 256);
+                for (a = 'a'; a <= 'z'; a++)
+                        re_syntax_table[a] = Sword;
+                for (a = 'A'; a <= 'Z'; a++)
+                        re_syntax_table[a] = Sword;
+                for (a = '0'; a <= '9'; a++)
+                        re_syntax_table[a] = Sword | Sdigit | Shexdigit;
+                for (a = '0'; a <= '7'; a++)
+                        re_syntax_table[a] |= Soctaldigit;
+                for (a = 'A'; a <= 'F'; a++)
+                        re_syntax_table[a] |= Shexdigit;
+                for (a = 'a'; a <= 'f'; a++)
+                        re_syntax_table[a] |= Shexdigit;
+                re_syntax_table['_'] = Sword;
+                for (a = 9; a <= 13; a++)
+                        re_syntax_table[a] = Swhitespace;
+                re_syntax_table[' '] = Swhitespace;
+        }
+        re_compile_initialized = 1;
+        for (a = 0; a < 256; a++)
+        {
+                regexp_plain_ops[a] = Rnormal;
+                regexp_quoted_ops[a] = Rnormal;
+        }
+        for (a = '0'; a <= '9'; a++)
+                regexp_quoted_ops[a] = Rmemory;
+        regexp_plain_ops['\134'] = Rquote;
+        if (regexp_syntax & RE_NO_BK_PARENS)
+        {
+                regexp_plain_ops['('] = Ropenpar;
+                regexp_plain_ops[')'] = Rclosepar;
+        }
+        else
+        {
+                regexp_quoted_ops['('] = Ropenpar;
+                regexp_quoted_ops[')'] = Rclosepar;
+        }
+        if (regexp_syntax & RE_NO_BK_VBAR)
+                regexp_plain_ops['\174'] = Ror;
+        else
+                regexp_quoted_ops['\174'] = Ror;
+        regexp_plain_ops['*'] = Rstar;
+        if (regexp_syntax & RE_BK_PLUS_QM)
+        {
+                regexp_quoted_ops['+'] = Rplus;
+                regexp_quoted_ops['?'] = Roptional;
+        }
+        else
+        {
+                regexp_plain_ops['+'] = Rplus;
+                regexp_plain_ops['?'] = Roptional;
+        }
+        if (regexp_syntax & RE_NEWLINE_OR)
+                regexp_plain_ops['\n'] = Ror;
+        regexp_plain_ops['\133'] = Ropenset;
+        regexp_plain_ops['\136'] = Rbol;
+        regexp_plain_ops['$'] = Reol;
+        regexp_plain_ops['.'] = Ranychar;
+        if (!(regexp_syntax & RE_NO_GNU_EXTENSIONS))
+        {
+                regexp_quoted_ops['w'] = Rwordchar;
+                regexp_quoted_ops['W'] = Rnotwordchar;
+                regexp_quoted_ops['<'] = Rwordbeg;
+                regexp_quoted_ops['>'] = Rwordend;
+                regexp_quoted_ops['b'] = Rwordbound;
+                regexp_quoted_ops['B'] = Rnotwordbound;
+                regexp_quoted_ops['`'] = Rbegbuf;
+                regexp_quoted_ops['\''] = Rendbuf;
+        }
+        if (regexp_syntax & RE_ANSI_HEX)
+                regexp_quoted_ops['v'] = Rextended_memory;
+        for (a = 0; a < Rnum_ops; a++)
+                regexp_precedences[a] = 4;
+        if (regexp_syntax & RE_TIGHT_VBAR)
+        {
+                regexp_precedences[Ror] = 3;
+                regexp_precedences[Rbol] = 2;
+                regexp_precedences[Reol] = 2;
+        }
+        else
+        {
+                regexp_precedences[Ror] = 2;
+                regexp_precedences[Rbol] = 3;
+                regexp_precedences[Reol] = 3;
+        }
+        regexp_precedences[Rclosepar] = 1;
+        regexp_precedences[Rend] = 0;
+        regexp_context_indep_ops = (regexp_syntax & RE_CONTEXT_INDEP_OPS) != 0;
+        regexp_ansi_sequences = (regexp_syntax & RE_ANSI_HEX) != 0;
+}
+int re_set_syntax(int syntax)
+{
+        int ret;
+        ret = regexp_syntax;
+        regexp_syntax = syntax;
+        re_syntax = syntax; /* Exported copy */
+        re_compile_initialize();
+        return ret;
+}
+static int hex_char_to_decimal(int ch)
+{
+        if (ch >= '0' && ch <= '9')
+                return ch - '0';
+        if (ch >= 'a' && ch <= 'f')
+                return ch - 'a' + 10;
+        if (ch >= 'A' && ch <= 'F')
+                return ch - 'A' + 10;
+        return 16;
+}
+static void re_compile_fastmap_aux(unsigned char *code, int pos,
+                                   unsigned char *visited,
+                                   unsigned char *can_be_null,
+                                   unsigned char *fastmap)
+{
+        int a;
+        int b;
+        int syntaxcode;
+        if (visited[pos])
+                return;  /* we have already been here */
+        visited[pos] = 1;
+        for (;;)
+                switch (code[pos++]) {
+                case Cend:
+                        {
+                                *can_be_null = 1;
+                                return;
+                        }
+                case Cbol:
+                case Cbegbuf:
+                case Cendbuf:
+                case Cwordbeg:
+                case Cwordend:
+                case Cwordbound:
+                case Cnotwordbound:
+                {
+                        for (a = 0; a < 256; a++)
+                                fastmap[a] = 1;
+                        break;
+                }
+                case Csyntaxspec:
+                {
+                        syntaxcode = code[pos++];
+                        for (a = 0; a < 256; a++)
+                                if (SYNTAX(a) & syntaxcode)
+                                        fastmap[a] = 1;
+                        return;
+                }
+                case Cnotsyntaxspec:
+                {
+                        syntaxcode = code[pos++];
+                        for (a = 0; a < 256; a++)
+                                if (!(SYNTAX(a) & syntaxcode) )
+                                        fastmap[a] = 1;
+                        return;
+                }
+                case Ceol:
+                {
+                        fastmap['\n'] = 1;
+                        if (*can_be_null == 0)
+                                *can_be_null = 2; /* can match null, but only at end of buffer*/
+                        return;
+                }
+                case Cset:
+                {
+                        for (a = 0; a < 256/8; a++)
+                                if (code[pos + a] != 0)
+                                        for (b = 0; b < 8; b++)
+                                                if (code[pos + a] & (1 << b))
+                                                        fastmap[(a << 3) + b] = 1;
+                        pos += 256/8;
+                        return;
+                }
+                case Cexact:
+                {
+                        fastmap[(unsigned char)code[pos]] = 1;
+                        return;
+                }
+                case Canychar:
+                {
+                        for (a = 0; a < 256; a++)
+                                if (a != '\n')
+                                        fastmap[a] = 1;
+                        return;
+                }
+                case Cstart_memory:
+                case Cend_memory:
+                {
+                        pos++;
+                        break;
+                }
+                case Cmatch_memory:
+                {
+                        for (a = 0; a < 256; a++)
+                                fastmap[a] = 1;
+                        *can_be_null = 1;
+                        return;
+                }
+                case Cjump:
+                case Cdummy_failure_jump:
+                case Cupdate_failure_jump:
+                case Cstar_jump:
+                {
+                        a = (unsigned char)code[pos++];
+                        a |= (unsigned char)code[pos++] << 8;
+                        pos += (int)SHORT(a);
+                        if (visited[pos])
+                        {
+                                /* argh... the regexp contains empty loops.  This is not
+                                   good, as this may cause a failure stack overflow when
+                                   matching.  Oh well. */
+                                /* this path leads nowhere; pursue other paths. */
+                                return;
+                        }
+                        visited[pos] = 1;
+                        break;
+                }
+                case Cfailure_jump:
+                {
+                        a = (unsigned char)code[pos++];
+                        a |= (unsigned char)code[pos++] << 8;
+                        a = pos + (int)SHORT(a);
+                        re_compile_fastmap_aux(code, a, visited, can_be_null, fastmap);
+                        break;
+                }
+                case Crepeat1:
+                {
+                        pos += 2;
+                        break;
+                }
+                default:
+                {
+                        /*PyErr_SetString(PyExc_SystemError, "Unknown regex opcode: memory corrupted?");*/
+                                re_errno = TP_RE_UNKNOWN_OPCODE;
+                        return;
+                        /*NOTREACHED*/
+                }
+                }
+}
+static int re_do_compile_fastmap(unsigned char *buffer, int used, int pos,
+                                 unsigned char *can_be_null,
+                                 unsigned char *fastmap)
+{
+        unsigned char small_visited[512], *visited;
+        if (used <= sizeof(small_visited))
+                visited = small_visited;
+        else
+        {
+                visited = (unsigned char *)malloc(used);
+                if (!visited)
+                        return 0;
+        }
+        *can_be_null = 0;
+        memset(fastmap, 0, 256);
+        memset(visited, 0, used);
+        re_compile_fastmap_aux(buffer, pos, visited, can_be_null, fastmap);
+        if (visited != small_visited)
+                free(visited);
+        return 1;
+}
+void re_compile_fastmap(regexp_t bufp)
+{
+        if (!bufp->fastmap || bufp->fastmap_accurate)
+                return;
+        assert(bufp->used > 0);
+        if (!re_do_compile_fastmap(bufp->buffer,
+                                   bufp->used,
+,
+                                   &bufp->can_be_null,
+                                   bufp->fastmap))
+                return;
+        /*if (PyErr_Occurred()) return;*/
+        if (re_err_occurred()) return;
+        if (bufp->buffer[0] == Cbol)
+                bufp->anchor = 1;   /* begline */
+        else
+                if (bufp->buffer[0] == Cbegbuf)
+                        bufp->anchor = 2; /* begbuf */
+                else
+                        bufp->anchor = 0; /* none */
+        bufp->fastmap_accurate = 1;
+}
+/*
+ * star is coded as:
+ * 1: failure_jump 2
+ *    ... code for operand of star
+ *    star_jump 1
+ * 2: ... code after star
+ *
+ * We change the star_jump to update_failure_jump if we can determine
+ * that it is safe to do so; otherwise we change it to an ordinary
+ * jump.
+ *
+ * plus is coded as
+ *
+ *    jump 2
+ * 1: failure_jump 3
+ * 2: ... code for operand of plus
+ *    star_jump 1
+ * 3: ... code after plus
+ *
+ * For star_jump considerations this is processed identically to star.
+ *
+ */
+static int re_optimize_star_jump(regexp_t bufp, unsigned char *code)
+{
+        unsigned char map[256];
+        unsigned char can_be_null;
+        unsigned char *p1;
+        unsigned char *p2;
+        unsigned char ch;
+        int a;
+        int b;
+        int num_instructions = 0;
+        a = (unsigned char)*code++;
+        a |= (unsigned char)*code++ << 8;
+        a = (int)SHORT(a);
+        p1 = code + a + 3; /* skip the failure_jump */
+        /* Check that the jump is within the pattern */
+        if (p1<bufp->buffer || bufp->buffer+bufp->used<p1)
+          {
+            /*PyErr_SetString(PyExc_SystemError, "Regex VM jump out of bounds (failure_jump opt)");*/
+                re_errno = TP_RE_JUMP_OUT_BOUNDS;
+            return 0;
+          }
+        assert(p1[-3] == Cfailure_jump);
+        p2 = code;
+        /* p1 points inside loop, p2 points to after loop */
+        if (!re_do_compile_fastmap(bufp->buffer, bufp->used,
+                                   (int)(p2 - bufp->buffer),
+                                   &can_be_null, map))
+                goto make_normal_jump;
+        /* If we might introduce a new update point inside the
+         * loop, we can't optimize because then update_jump would
+         * update a wrong failure point.  Thus we have to be
+         * quite careful here.
+         */
+        /* loop until we find something that consumes a character */
+  loop_p1:
+        num_instructions++;
+        switch (*p1++)
+        {
+        case Cbol:
+        case Ceol:
+        case Cbegbuf:
+        case Cendbuf:
+        case Cwordbeg:
+        case Cwordend:
+        case Cwordbound:
+        case Cnotwordbound:
+        {
+                goto loop_p1;
+        }
+        case Cstart_memory:
+        case Cend_memory:
+        {
+                p1++;
+                goto loop_p1;
+        }
+        case Cexact:
+        {
+                ch = (unsigned char)*p1++;
+                if (map[(int)ch])
+                        goto make_normal_jump;
+                break;
+        }
+        case Canychar:
+        {
+                for (b = 0; b < 256; b++)
+                        if (b != '\n' && map[b])
+                                goto make_normal_jump;
+                break;
+        }
+        case Cset:
+        {
+                for (b = 0; b < 256; b++)
+                        if ((p1[b >> 3] & (1 << (b & 7))) && map[b])
+                                goto make_normal_jump;
+                p1 += 256/8;
+                break;
+        }
+        default:
+        {
+                goto make_normal_jump;
+        }
+        }
+        /* now we know that we can't backtrack. */
+        while (p1 != p2 - 3)
+        {
+                num_instructions++;
+                switch (*p1++)
+                {
+                case Cend:
+                {
+                        return 0;
+                }
+                case Cbol:
+                case Ceol:
+                case Canychar:
+                case Cbegbuf:
+                case Cendbuf:
+                case Cwordbeg:
+                case Cwordend:
+                case Cwordbound:
+                case Cnotwordbound:
+                {
+                        break;
+                }
+                case Cset:
+                {
+                        p1 += 256/8;
+                        break;
+                }
+                case Cexact:
+                case Cstart_memory:
+                case Cend_memory:
+                case Cmatch_memory:
+                case Csyntaxspec:
+                case Cnotsyntaxspec:
+                {
+                        p1++;
+                        break;
+                }
+                case Cjump:
+                case Cstar_jump:
+                case Cfailure_jump:
+                case Cupdate_failure_jump:
+                case Cdummy_failure_jump:
+                {
+                        goto make_normal_jump;
+                }
+                default:
+                {
+                        return 0;
+                }
+                }
+        }
+        /* make_update_jump: */
+        code -= 3;
+        a += 3;  /* jump to after the Cfailure_jump */
+        code[0] = Cupdate_failure_jump;
+        code[1] = a & 0xff;
+        code[2] = a >> 8;
+        if (num_instructions > 1)
+                return 1;
+        assert(num_instructions == 1);
+        /* if the only instruction matches a single character, we can do
+         * better */
+        p1 = code + 3 + a;   /* start of sole instruction */
+        if (*p1 == Cset || *p1 == Cexact || *p1 == Canychar ||
+            *p1 == Csyntaxspec || *p1 == Cnotsyntaxspec)
+                code[0] = Crepeat1;
+        return 1;
+  make_normal_jump:
+        code -= 3;
+        *code = Cjump;
+        return 1;
+}
+static int re_optimize(regexp_t bufp)
+{
+        unsigned char *code;
+        code = bufp->buffer;
+        while(1)
+        {
+                switch (*code++)
+                {
+                case Cend:
+                {
+                        return 1;
+                }
+                case Canychar:
+                case Cbol:
+                case Ceol:
+                case Cbegbuf:
+                case Cendbuf:
+                case Cwordbeg:
+                case Cwordend:
+                case Cwordbound:
+                case Cnotwordbound:
+                {
+                        break;
+                }
+                case Cset:
+                {
+                        code += 256/8;
+                        break;
+                }
+                case Cexact:
+                case Cstart_memory:
+                case Cend_memory:
+                case Cmatch_memory:
+                case Csyntaxspec:
+                case Cnotsyntaxspec:
+                {
+                        code++;
+                        break;
+                }
+                case Cstar_jump:
+                {
+                        if (!re_optimize_star_jump(bufp, code))
+                        {
+                                return 0;
+                        }
+                        /* fall through */
+                }
+                case Cupdate_failure_jump:
+                case Cjump:
+                case Cdummy_failure_jump:
+                case Cfailure_jump:
+                case Crepeat1:
+                {
+                        code += 2;
+                        break;
+                }
+                default:
+                {
+                        return 0;
+                }
+                }
+        }
+}
+#define NEXTCHAR(var) \
+{ \
+        if (pos >= size) \
+                goto ends_prematurely; \
+        (var) = regex[pos]; \
+        pos++; \
+}
+#define ALLOC(amount) \
+{ \
+          if (pattern_offset+(amount) > alloc) \
+          { \
+                  alloc += 256 + (amount); \
+                  pattern = (unsigned char *)realloc(pattern, alloc); \
+                  if (!pattern) \
+                          goto out_of_memory; \
+          } \
+}
+#define STORE(ch) pattern[pattern_offset++] = (ch)
+#define CURRENT_LEVEL_START (starts[starts_base + current_level])
+#define SET_LEVEL_START starts[starts_base + current_level] = pattern_offset
+#define PUSH_LEVEL_STARTS \
+if (starts_base < (MAX_NESTING-1)*NUM_LEVELS) \
+        starts_base += NUM_LEVELS; \
+else \
+        goto too_complex \
+#define POP_LEVEL_STARTS starts_base -= NUM_LEVELS
+#define PUT_ADDR(offset,addr) \
+{ \
+        int disp = (addr) - (offset) - 2; \
+        pattern[(offset)] = disp & 0xff; \
+        pattern[(offset)+1] = (disp>>8) & 0xff; \
+}
+#define INSERT_JUMP(pos,type,addr) \
+{ \
+        int a, p = (pos), t = (type), ad = (addr); \
+        for (a = pattern_offset - 1; a >= p; a--) \
+                pattern[a + 3] = pattern[a]; \
+        pattern[p] = t; \
+        PUT_ADDR(p+1,ad); \
+        pattern_offset += 3; \
+}
+#define SETBIT(buf,offset,bit) (buf)[(offset)+(bit)/8] |= (1<<((bit) & 7))
+#define SET_FIELDS \
+{ \
+        bufp->allocated = alloc; \
+        bufp->buffer = pattern; \
+        bufp->used = pattern_offset; \
+}
+#define GETHEX(var) \
+{ \
+        unsigned char gethex_ch, gethex_value; \
+        NEXTCHAR(gethex_ch); \
+        gethex_value = hex_char_to_decimal(gethex_ch); \
+        if (gethex_value == 16) \
+                goto hex_error; \
+        NEXTCHAR(gethex_ch); \
+        gethex_ch = hex_char_to_decimal(gethex_ch); \
+        if (gethex_ch == 16) \
+                goto hex_error; \
+        (var) = gethex_value * 16 + gethex_ch; \
+}
+#define ANSI_TRANSLATE(ch) \
+{ \
+        switch (ch) \
+        { \
+        case 'a': \
+        case 'A': \
+        { \
+                ch = 7; /* audible bell */ \
+                break; \
+        } \
+        case 'b': \
+        case 'B': \
+        { \
+                ch = 8; /* backspace */ \
+                break; \
+        } \
+        case 'f': \
+        case 'F': \
+        { \
+                ch = 12; /* form feed */ \
+                break; \
+        } \
+        case 'n': \
+        case 'N': \
+        { \
+                ch = 10; /* line feed */ \
+                break; \
+        } \
+        case 'r': \
+        case 'R': \
+        { \
+                ch = 13; /* carriage return */ \
+                break; \
+        } \
+        case 't': \
+        case 'T': \
+        { \
+              ch = 9; /* tab */ \
+              break; \
+        } \
+        case 'v': \
+        case 'V': \
+        { \
+                ch = 11; /* vertical tab */ \
+                break; \
+        } \
+        case 'x': /* hex code */ \
+        case 'X': \
+        { \
+                GETHEX(ch); \
+                break; \
+        } \
+        default: \
+        { \
+                /* other characters passed through */ \
+                if (translate) \
+                        ch = translate[(unsigned char)ch]; \
+                break; \
+        } \
+        } \
+}
+char *re_compile_pattern(unsigned char *regex, int size, regexp_t bufp)
+{
+        int a;
+        int pos;
+        int op;
+        int current_level;
+        int level;
+        int opcode;
+        int pattern_offset = 0, alloc;
+        int starts[NUM_LEVELS * MAX_NESTING];
+        int starts_base;
+        int future_jumps[MAX_NESTING];
+        int num_jumps;
+        unsigned char ch = '\0';
+        unsigned char *pattern;
+        unsigned char *translate;
+        int next_register;
+        int paren_depth;
+        int num_open_registers;
+        int open_registers[RE_NREGS];
+        int beginning_context;
+        if (!re_compile_initialized)
+                re_compile_initialize();
+        bufp->used = 0;
+        bufp->fastmap_accurate = 0;
+        bufp->uses_registers = 1;
+        bufp->num_registers = 1;
+        translate = bufp->translate;
+        pattern = bufp->buffer;
+        alloc = bufp->allocated;
+        if (alloc == 0 || pattern == NULL)
+        {
+                alloc = 256;
+                pattern = (unsigned char *)malloc(alloc);
+                if (!pattern)
+                        goto out_of_memory;
+        }
+        pattern_offset = 0;
+        starts_base = 0;
+        num_jumps = 0;
+        current_level = 0;
+        SET_LEVEL_START;
+        num_open_registers = 0;
+        next_register = 1;
+        paren_depth = 0;
+        beginning_context = 1;
+        op = -1;
+        /* we use Rend dummy to ensure that pending jumps are updated
+           (due to low priority of Rend) before exiting the loop. */
+        pos = 0;
+        while (op != Rend)
+        {
+                if (pos >= size)
+                        op = Rend;
+                else
+                {
+                        NEXTCHAR(ch);
+                        if (translate)
+                                ch = translate[(unsigned char)ch];
+                        op = regexp_plain_ops[(unsigned char)ch];
+                        if (op == Rquote)
+                        {
+                                NEXTCHAR(ch);
+                                op = regexp_quoted_ops[(unsigned char)ch];
+                                if (op == Rnormal && regexp_ansi_sequences)
+                                        ANSI_TRANSLATE(ch);
+                        }
+                }
+                level = regexp_precedences[op];
+                /* printf("ch='%c' op=%d level=%d current_level=%d
+                   curlevstart=%d\n", ch, op, level, current_level,
+                   CURRENT_LEVEL_START); */
+                if (level > current_level)
+                {
+                        for (current_level++; current_level < level; current_level++)
+                                SET_LEVEL_START;
+                        SET_LEVEL_START;
+                }
+                else
+                        if (level < current_level)
+                        {
+                                current_level = level;
+                                for (;num_jumps > 0 &&
+                                             future_jumps[num_jumps-1] >= CURRENT_LEVEL_START;
+                                     num_jumps--)
+                                        PUT_ADDR(future_jumps[num_jumps-1], pattern_offset);
+                        }
+                switch (op)
+                {
+                case Rend:
+                {
+                        break;
+                }
+                case Rnormal:
+                {
+                  normal_char:
+                        opcode = Cexact;
+                  store_opcode_and_arg: /* opcode & ch must be set */
+                        SET_LEVEL_START;
+                        ALLOC(2);
+                        STORE(opcode);
+                        STORE(ch);
+                        break;
+                }
+                case Ranychar:
+                {
+                        opcode = Canychar;
+                  store_opcode:
+                        SET_LEVEL_START;
+                        ALLOC(1);
+                        STORE(opcode);
+                        break;
+                }
+                case Rquote:
+                {
+                        /*Py_FatalError("Rquote");*/
+                        re_errno = TP_RE_QUOTE_ERR;
+                        abort();        /* XXX: may need to jump to error handler */
+                        /*NOTREACHED*/
+                }
+                case Rbol:
+                {
+                        if (!beginning_context) {
+                                if (regexp_context_indep_ops)
+                                        goto op_error;
+                                else
+                                        goto normal_char;
+                        }
+                        opcode = Cbol;
+                        goto store_opcode;
+                }
+                case Reol:
+                {
+                        if (!((pos >= size) ||
+                              ((regexp_syntax & RE_NO_BK_VBAR) ?
+                               (regex[pos] == '\174') :
+                               (pos+1 < size && regex[pos] == '\134' &&
+                                regex[pos+1] == '\174')) ||
+                              ((regexp_syntax & RE_NO_BK_PARENS)?
+                               (regex[pos] == ')'):
+                               (pos+1 < size && regex[pos] == '\134' &&
+                                regex[pos+1] == ')')))) {
+                                if (regexp_context_indep_ops)
+                                        goto op_error;
+                                else
+                                        goto normal_char;
+                        }
+                        opcode = Ceol;
+                        goto store_opcode;
+                        /* NOTREACHED */
+                        break;
+                }
+                case Roptional:
+                {
+                        if (beginning_context) {
+                                if (regexp_context_indep_ops)
+                                        goto op_error;
+                                else
+                                        goto normal_char;
+                        }
+                        if (CURRENT_LEVEL_START == pattern_offset)
+                                break; /* ignore empty patterns for ? */
+                        ALLOC(3);
+                        INSERT_JUMP(CURRENT_LEVEL_START, Cfailure_jump,
+                                    pattern_offset + 3);
+                        break;
+                }
+                case Rstar:
+                case Rplus:
+                {
+                        if (beginning_context) {
+                                if (regexp_context_indep_ops)
+                                        goto op_error;
+                                else
+                                        goto normal_char;
+                        }
+                        if (CURRENT_LEVEL_START == pattern_offset)
+                                break; /* ignore empty patterns for + and * */
+                        ALLOC(9);
+                        INSERT_JUMP(CURRENT_LEVEL_START, Cfailure_jump,
+                                    pattern_offset + 6);
+                        INSERT_JUMP(pattern_offset, Cstar_jump, CURRENT_LEVEL_START);
+                        if (op == Rplus)  /* jump over initial failure_jump */
+                                INSERT_JUMP(CURRENT_LEVEL_START, Cdummy_failure_jump,
+                                            CURRENT_LEVEL_START + 6);
+                        break;
+                }
+                case Ror:
+                {
+                        ALLOC(6);
+                        INSERT_JUMP(CURRENT_LEVEL_START, Cfailure_jump,
+                                    pattern_offset + 6);
+                        if (num_jumps >= MAX_NESTING)
+                                goto too_complex;
+                        STORE(Cjump);
+                        future_jumps[num_jumps++] = pattern_offset;
+                        STORE(0);
+                        STORE(0);
+                        SET_LEVEL_START;
+                        break;
+                }
+                case Ropenpar:
+                {
+                        SET_LEVEL_START;
+                        if (next_register < RE_NREGS)
+                        {
+                                bufp->uses_registers = 1;
+                                ALLOC(2);
+                                STORE(Cstart_memory);
+                                STORE(next_register);
+                                open_registers[num_open_registers++] = next_register;
+                                bufp->num_registers++;
+                                next_register++;
+                        }
+                        paren_depth++;
+                        PUSH_LEVEL_STARTS;
+                        current_level = 0;
+                        SET_LEVEL_START;
+                        break;
+                }
+                case Rclosepar:
+                {
+                        if (paren_depth <= 0)
+                                goto parenthesis_error;
+                        POP_LEVEL_STARTS;
+                        current_level = regexp_precedences[Ropenpar];
+                        paren_depth--;
+                        if (paren_depth < num_open_registers)
+                        {
+                                bufp->uses_registers = 1;
+                                ALLOC(2);
+                                STORE(Cend_memory);
+                                num_open_registers--;
+                                STORE(open_registers[num_open_registers]);
+                        }
+                        break;
+                }
+                case Rmemory:
+                {
+                        if (ch == '0')
+                                goto bad_match_register;
+                        assert(ch >= '0' && ch <= '9');
+                        bufp->uses_registers = 1;
+                        opcode = Cmatch_memory;
+                        ch -= '0';
+                        goto store_opcode_and_arg;
+                }
+                case Rextended_memory:
+                {
+                        NEXTCHAR(ch);
+                        if (ch < '0' || ch > '9')
+                                goto bad_match_register;
+                        NEXTCHAR(a);
+                        if (a < '0' || a > '9')
+                                goto bad_match_register;
+                        ch = 10 * (a - '0') + ch - '0';
+                        if (ch == 0 || ch >= RE_NREGS)
+                                goto bad_match_register;
+                        bufp->uses_registers = 1;
+                        opcode = Cmatch_memory;
+                        goto store_opcode_and_arg;
+                }
+                case Ropenset:
+                {
+                        int complement;
+                        int prev;
+                        int offset;
+                        int range;
+                        int firstchar;
+                        SET_LEVEL_START;
+                        ALLOC(1+256/8);
+                        STORE(Cset);
+                        offset = pattern_offset;
+                        for (a = 0; a < 256/8; a++)
+                                STORE(0);
+                        NEXTCHAR(ch);
+                        if (translate)
+                                ch = translate[(unsigned char)ch];
+                        if (ch == '\136')
+                        {
+                                complement = 1;
+                                NEXTCHAR(ch);
+                                if (translate)
+                                        ch = translate[(unsigned char)ch];
+                        }
+                        else
+                                complement = 0;
+                        prev = -1;
+                        range = 0;
+                        firstchar = 1;
+                        while (ch != '\135' || firstchar)
+                        {
+                                firstchar = 0;
+                                if (regexp_ansi_sequences && ch == '\134')
+                                {
+                                        NEXTCHAR(ch);
+                                        ANSI_TRANSLATE(ch);
+                                }
+                                if (range)
+                                {
+                                        for (a = prev; a <= (int)ch; a++)
+                                                SETBIT(pattern, offset, a);
+                                        prev = -1;
+                                        range = 0;
+                                }
+                                else
+                                        if (prev != -1 && ch == '-')
+                                                range = 1;
+                                        else
+                                        {
+                                                SETBIT(pattern, offset, ch);
+                                                prev = ch;
+                                        }
+                                NEXTCHAR(ch);
+                                if (translate)
+                                        ch = translate[(unsigned char)ch];
+                        }
+                        if (range)
+                                SETBIT(pattern, offset, '-');
+                        if (complement)
+                        {
+                                for (a = 0; a < 256/8; a++)
+                                        pattern[offset+a] ^= 0xff;
+                        }
+                        break;
+                }
+                case Rbegbuf:
+                {
+                        opcode = Cbegbuf;
+                        goto store_opcode;
+                }
+                case Rendbuf:
+                {
+                        opcode = Cendbuf;
+                        goto store_opcode;
+                }
+                case Rwordchar:
+                {
+                        opcode = Csyntaxspec;
+                        ch = Sword;
+                        goto store_opcode_and_arg;
+                }
+                case Rnotwordchar:
+                {
+                        opcode = Cnotsyntaxspec;
+                        ch = Sword;
+                        goto store_opcode_and_arg;
+                }
+                case Rwordbeg:
+                {
+                        opcode = Cwordbeg;
+                        goto store_opcode;
+                }
+                case Rwordend:
+                {
+                        opcode = Cwordend;
+                        goto store_opcode;
+                }
+                case Rwordbound:
+                {
+                        opcode = Cwordbound;
+                        goto store_opcode;
+                }
+                case Rnotwordbound:
+                {
+                        opcode = Cnotwordbound;
+                        goto store_opcode;
+                }
+                default:
+                {
+                        abort();
+                }
+                }
+                beginning_context = (op == Ropenpar || op == Ror);
+        }
+        if (starts_base != 0)
+                goto parenthesis_error;
+        assert(num_jumps == 0);
+        ALLOC(1);
+        STORE(Cend);
+        SET_FIELDS;
+        if(!re_optimize(bufp))
+                return "Optimization error";
+        return NULL;
+  op_error:
+        SET_FIELDS;
+        return "Badly placed special character";
+  bad_match_register:
+        SET_FIELDS;
+        return "Bad match register number";
+  hex_error:
+        SET_FIELDS;
+        return "Bad hexadecimal number";
+  parenthesis_error:
+        SET_FIELDS;
+        return "Badly placed parenthesis";
+  out_of_memory:
+        SET_FIELDS;
+        return "Out of memory";
+  ends_prematurely:
+        SET_FIELDS;
+        return "Regular expression ends prematurely";
+  too_complex:
+        SET_FIELDS;
+        return "Regular expression too complex";
+}
+#undef CHARAT
+#undef NEXTCHAR
+#undef GETHEX
+#undef ALLOC
+#undef STORE
+#undef CURRENT_LEVEL_START
+#undef SET_LEVEL_START
+#undef PUSH_LEVEL_STARTS
+#undef POP_LEVEL_STARTS
+#undef PUT_ADDR
+#undef INSERT_JUMP
+#undef SETBIT
+#undef SET_FIELDS
+#define PREFETCH if (text == textend) goto fail
+#define NEXTCHAR(var) \
+PREFETCH; \
+var = (unsigned char)*text++; \
+if (translate) \
+        var = translate[var]
+int re_match(regexp_t bufp, unsigned char *string, int size, int pos,
+             regexp_registers_t old_regs)
+{
+        unsigned char *code;
+        unsigned char *translate;
+        unsigned char *text;
+        unsigned char *textstart;
+        unsigned char *textend;
+        int a;
+        int b;
+        int ch;
+        int reg;
+        int match_end;
+        unsigned char *regstart;
+        unsigned char *regend;
+        int regsize;
+        match_state state;
+        assert(pos >= 0 && size >= 0);
+        assert(pos <= size);
+        text = string + pos;
+        textstart = string;
+        textend = string + size;
+        code = bufp->buffer;
+        translate = bufp->translate;
+        NEW_STATE(state, bufp->num_registers);
+  continue_matching:
+        switch (*code++)
+        {
+        case Cend:
+        {
+                match_end = text - textstart;
+                if (old_regs)
+                {
+                        old_regs->start[0] = pos;
+                        old_regs->end[0] = match_end;
+                        if (!bufp->uses_registers)
+                        {
+                                for (a = 1; a < RE_NREGS; a++)
+                                {
+                                        old_regs->start[a] = -1;
+                                        old_regs->end[a] = -1;
+                                }
+                        }
+                        else
+                        {
+                                for (a = 1; a < bufp->num_registers; a++)
+                                {
+                                        if ((GET_REG_START(state, a) == NULL) ||
+                                            (GET_REG_END(state, a) == NULL))
+                                        {
+                                                old_regs->start[a] = -1;
+                                                old_regs->end[a] = -1;
+                                                continue;
+                                        }
+                                        old_regs->start[a] = GET_REG_START(state, a) - textstart;
+                                        old_regs->end[a] = GET_REG_END(state, a) - textstart;
+                                }
+                                for (; a < RE_NREGS; a++)
+                                {
+                                        old_regs->start[a] = -1;
+                                        old_regs->end[a] = -1;
+                                }
+                        }
+                }
+                FREE_STATE(state);
+                return match_end - pos;
+        }
+        case Cbol:
+        {
+                if (text == textstart || text[-1] == '\n')
+                        goto continue_matching;
+                goto fail;
+        }
+        case Ceol:
+        {
+                if (text == textend || *text == '\n')
+                        goto continue_matching;
+                goto fail;
+        }
+        case Cset:
+        {
+                NEXTCHAR(ch);
+                if (code[ch/8] & (1<<(ch & 7)))
+                {
+                        code += 256/8;
+                        goto continue_matching;
+                }
+                goto fail;
+        }
+        case Cexact:
+        {
+                NEXTCHAR(ch);
+                if (ch != (unsigned char)*code++)
+                        goto fail;
+                goto continue_matching;
+        }
+        case Canychar:
+        {
+                NEXTCHAR(ch);
+                if (ch == '\n')
+                        goto fail;
+                goto continue_matching;
+        }
+        case Cstart_memory:
+        {
+                reg = *code++;
+                SET_REG_START(state, reg, text, goto error);
+                goto continue_matching;
+        }
+        case Cend_memory:
+        {
+                reg = *code++;
+                SET_REG_END(state, reg, text, goto error);
+                goto continue_matching;
+        }
+        case Cmatch_memory:
+        {
+                reg = *code++;
+                regstart = GET_REG_START(state, reg);
+                regend = GET_REG_END(state, reg);
+                if ((regstart == NULL) || (regend == NULL))
+                        goto fail;  /* or should we just match nothing? */
+                regsize = regend - regstart;
+                if (regsize > (textend - text))
+                        goto fail;
+                if(translate)
+                {
+                        for (; regstart < regend; regstart++, text++)
+                                if (translate[*regstart] != translate[*text])
+                                        goto fail;
+                }
+                else
+                        for (; regstart < regend; regstart++, text++)
+                                if (*regstart != *text)
+                                        goto fail;
+                goto continue_matching;
+        }
+        case Cupdate_failure_jump:
+        {
+                UPDATE_FAILURE(state, text, goto error);
+                /* fall to next case */
+        }
+        /* treat Cstar_jump just like Cjump if it hasn't been optimized */
+        case Cstar_jump:
+        case Cjump:
+        {
+                a = (unsigned char)*code++;
+                a |= (unsigned char)*code++ << 8;
+                code += (int)SHORT(a);
+                if (code<bufp->buffer || bufp->buffer+bufp->used<code) {
+                        /*PyErr_SetString(PyExc_SystemError, "Regex VM jump out of bounds (Cjump)");*/
+                        re_errno = TP_RE_JUMP_OUT_BOUNDS;
+                        FREE_STATE(state);
+                        return -2;
+                }
+                goto continue_matching;
+        }
+        case Cdummy_failure_jump:
+        {
+                unsigned char *failuredest;
+                a = (unsigned char)*code++;
+                a |= (unsigned char)*code++ << 8;
+                a = (int)SHORT(a);
+                assert(*code == Cfailure_jump);
+                b = (unsigned char)code[1];
+                b |= (unsigned char)code[2] << 8;
+                failuredest = code + (int)SHORT(b) + 3;
+                if (failuredest<bufp->buffer || bufp->buffer+bufp->used < failuredest) {
+                        /*PyErr_SetString(PyExc_SystemError, "Regex VM jump out of bounds (Cdummy_failure_jump failuredest)");*/
+                        re_errno = TP_RE_JUMP_OUT_BOUNDS;
+                        FREE_STATE(state);
+                        return -2;
+                }
+                PUSH_FAILURE(state, failuredest, NULL, goto error);
+                code += a;
+                if (code<bufp->buffer || bufp->buffer+bufp->used < code) {
+                        /*PyErr_SetString(PyExc_SystemError, "Regex VM jump out of bounds (Cdummy_failure_jump code)");*/
+                        re_errno = TP_RE_JUMP_OUT_BOUNDS;
+                        FREE_STATE(state);
+                        return -2;
+                }
+                goto continue_matching;
+        }
+        case Cfailure_jump:
+        {
+                a = (unsigned char)*code++;
+                a |= (unsigned char)*code++ << 8;
+                a = (int)SHORT(a);
+                if (code+a<bufp->buffer || bufp->buffer+bufp->used < code+a) {
+                        /*PyErr_SetString(PyExc_SystemError, "Regex VM jump out of bounds (Cfailure_jump)");*/
+                        re_errno = TP_RE_JUMP_OUT_BOUNDS;
+                        FREE_STATE(state);
+                        return -2;
+                }
+                PUSH_FAILURE(state, code + a, text, goto error);
+                goto continue_matching;
+        }
+        case Crepeat1:
+        {
+                unsigned char *pinst;
+                a = (unsigned char)*code++;
+                a |= (unsigned char)*code++ << 8;
+                a = (int)SHORT(a);
+                pinst = code + a;
+                if (pinst<bufp->buffer || bufp->buffer+bufp->used<pinst) {
+                        /*PyErr_SetString(PyExc_SystemError, "Regex VM jump out of bounds (Crepeat1)");*/
+                        re_errno = TP_RE_JUMP_OUT_BOUNDS;
+                        FREE_STATE(state);
+                        return -2;
+                }
+                /* pinst is sole instruction in loop, and it matches a
+                 * single character.  Since Crepeat1 was originally a
+                 * Cupdate_failure_jump, we also know that backtracking
+                 * is useless: so long as the single-character
+                 * expression matches, it must be used.  Also, in the
+                 * case of +, we've already matched one character, so +
+                 * can't fail: nothing here can cause a failure.  */
+                switch (*pinst++)
+                {
+                        case Cset:
+                                {
+                                        if (translate)
+                                        {
+                                                while (text < textend)
+                                                {
+                                                        ch = translate[(unsigned char)*text];
+                                                        if (pinst[ch/8] & (1<<(ch & 7)))
+                                                                text++;
+                                                        else
+                                                                break;
+                                                }
+                                        }
+                                        else
+                                        {
+                                                while (text < textend)
+                                                {
+                                                        ch = (unsigned char)*text;
+                                                        if (pinst[ch/8] & (1<<(ch & 7)))
+                                                                text++;
+                                                        else
+                                                                break;
+                                                }
+                                        }
+                                        break;
+                                }
+                        case Cexact:
+                                {
+                                        ch = (unsigned char)*pinst;
+                                        if (translate)
+                                        {
+                                                while (text < textend &&
+                                                                translate[(unsigned char)*text] == ch)
+                                                        text++;
+                                        }
+                                        else
+                                        {
+                                                while (text < textend && (unsigned char)*text == ch)
+                                                        text++;
+                                        }
+                                        break;
+                                }
+                        case Canychar:
+                                {
+                                        while (text < textend && (unsigned char)*text != '\n')
+                                                text++;
+                                        break;
+                                }
+                        case Csyntaxspec:
+                                {
+                                        a = (unsigned char)*pinst;
+                                        if (translate)
+                                        {
+                                                while (text < textend &&
+                                                                (SYNTAX(translate[*text]) & a) )
+                                                        text++;
+                                        }
+                                        else
+                                        {
+                                                while (text < textend && (SYNTAX(*text) & a) )
+                                                        text++;
+                                        }
+                                        break;
+                                }
+                        case Cnotsyntaxspec:
+                                {
+                                        a = (unsigned char)*pinst;
+                                        if (translate)
+                                        {
+                                                while (text < textend &&
+                                                                !(SYNTAX(translate[*text]) & a) )
+                                                        text++;
+                                        }
+                                        else
+                                        {
+                                                while (text < textend && !(SYNTAX(*text) & a) )
+                                                        text++;
+                                        }
+                                        break;
+                                }
+                        default:
+                                {
+                                        FREE_STATE(state);
+                                        /*PyErr_SetString(PyExc_SystemError, "Unknown regex opcode: memory corrupted?");*/
+                                        re_errno = TP_RE_UNKNOWN_OPCODE;
+                                        return -2;
+                                        /*NOTREACHED*/
+                                }
+                }
+                /* due to the funky way + and * are compiled, the top
+                 * failure- stack entry at this point is actually a
+                 * success entry -- update it & pop it */
+                UPDATE_FAILURE(state, text, goto error);
+                goto fail;      /* i.e., succeed <wink/sigh> */
+        }
+        case Cbegbuf:
+        {
+                if (text == textstart)
+                        goto continue_matching;
+                goto fail;
+        }
+        case Cendbuf:
+        {
+                if (text == textend)
+                        goto continue_matching;
+                goto fail;
+        }
+        case Cwordbeg:
+        {
+                if (text == textend)
+                        goto fail;
+                if (!(SYNTAX(*text) & Sword))
+                        goto fail;
+                if (text == textstart)
+                        goto continue_matching;
+                if (!(SYNTAX(text[-1]) & Sword))
+                        goto continue_matching;
+                goto fail;
+        }
+        case Cwordend:
+        {
+                if (text == textstart)
+                        goto fail;
+                if (!(SYNTAX(text[-1]) & Sword))
+                        goto fail;
+                if (text == textend)
+                        goto continue_matching;
+                if (!(SYNTAX(*text) & Sword))
+                        goto continue_matching;
+                goto fail;
+        }
+        case Cwordbound:
+        {
+                /* Note: as in gnu regexp, this also matches at the
+                 * beginning and end of buffer.  */
+                if (text == textstart || text == textend)
+                        goto continue_matching;
+                if ((SYNTAX(text[-1]) & Sword) ^ (SYNTAX(*text) & Sword))
+                        goto continue_matching;
+                goto fail;
+        }
+        case Cnotwordbound:
+        {
+                /* Note: as in gnu regexp, this never matches at the
+                 * beginning and end of buffer.  */
+                if (text == textstart || text == textend)
+                        goto fail;
+                if (!((SYNTAX(text[-1]) & Sword) ^ (SYNTAX(*text) & Sword)))
+                        goto continue_matching;
+                goto fail;
+        }
+        case Csyntaxspec:
+        {
+                NEXTCHAR(ch);
+                if (!(SYNTAX(ch) & (unsigned char)*code++))
+                        goto fail;
+                goto continue_matching;
+        }
+        case Cnotsyntaxspec:
+        {
+                NEXTCHAR(ch);
+                if (SYNTAX(ch) & (unsigned char)*code++)
+                        goto fail;
+                goto continue_matching;
+        }
+        default:
+        {
+                FREE_STATE(state);
+                /*PyErr_SetString(PyExc_SystemError, "Unknown regex opcode: memory corrupted?");*/
+                re_errno = TP_RE_UNKNOWN_OPCODE;
+                return -2;
+                /*NOTREACHED*/
+        }
+        }
+#if 0 /* This line is never reached --Guido */
+        abort();
+#endif
+        /*
+         *NOTREACHED
+         */
+        /* Using "break;" in the above switch statement is equivalent to "goto fail;" */
+  fail:
+        POP_FAILURE(state, code, text, goto done_matching, goto error);
+        goto continue_matching;
+  done_matching:
+/*   if(translated != NULL) */
+/*      free(translated); */
+        FREE_STATE(state);
+        return -1;
+  error:
+/*   if (translated != NULL) */
+/*      free(translated); */
+        FREE_STATE(state);
+        return -2;
+}
+#undef PREFETCH
+#undef NEXTCHAR
+int re_search(regexp_t bufp, unsigned char *string, int size, int pos,
+              int range, regexp_registers_t regs)
+{
+        unsigned char *fastmap;
+        unsigned char *translate;
+        unsigned char *text;
+        unsigned char *partstart;
+        unsigned char *partend;
+        int dir;
+        int ret;
+        unsigned char anchor;
+        assert(size >= 0 && pos >= 0);
+        assert(pos + range >= 0 && pos + range <= size); /* Bugfix by ylo */
+        fastmap = bufp->fastmap;
+        translate = bufp->translate;
+        if (fastmap && !bufp->fastmap_accurate) {
+                re_compile_fastmap(bufp);
+                if (re_err_occurred()) return -2;
+        }
+        anchor = bufp->anchor;
+        if (bufp->can_be_null == 1) /* can_be_null == 2: can match null at eob */
+                fastmap = NULL;
+        if (range < 0)
+        {
+                dir = -1;
+                range = -range;
+        }
+        else
+                dir = 1;
+        if (anchor == 2) {
+                if (pos != 0)
+                        return -1;
+                else
+                        range = 0;
+        }
+        for (; range >= 0; range--, pos += dir)
+        {
+                if (fastmap)
+                {
+                        if (dir == 1)
+                        { /* searching forwards */
+                                text = string + pos;
+                                partend = string + size;
+                                partstart = text;
+                                if (translate)
+                                        while (text != partend &&
+                                               !fastmap[(unsigned char) translate[(unsigned char)*text]])
+                                                text++;
+                                else
+                                        while (text != partend && !fastmap[(unsigned char)*text])
+                                                text++;
+                                pos += text - partstart;
+                                range -= text - partstart;
+                                if (pos == size && bufp->can_be_null == 0)
+                                        return -1;
+                        }
+                        else
+                        { /* searching backwards */
+                                text = string + pos;
+                                partstart = string + pos - range;
+                                partend = text;
+                                if (translate)
+                                        while (text != partstart &&
+                                               !fastmap[(unsigned char)
+                                                       translate[(unsigned char)*text]])
+                                                text--;
+                                else
+                                        while (text != partstart &&
+                                               !fastmap[(unsigned char)*text])
+                                                text--;
+                                pos -= partend - text;
+                                range -= partend - text;
+                        }
+                }
+                if (anchor == 1)
+                { /* anchored to begline */
+                        if (pos > 0 && (string[pos - 1] != '\n'))
+                                continue;
+                }
+                assert(pos >= 0 && pos <= size);
+                ret = re_match(bufp, string, size, pos, regs);
+                if (ret >= 0)
+                        return pos;
+                if (ret == -2)
+                        return -2;
+        }
+        return -1;
+}
+/*
+** Local Variables:
+** mode: c
+** c-file-style: "python"
+** End:
+*/

 /programs/develop/tinypy/modules/re/regexpr.h
 ,0 → 1,160
+/*
+ * -*- mode: c-mode; c-file-style: python -*-
+ */
+#ifndef Py_REGEXPR_H
+#define Py_REGEXPR_H
+#ifdef __cplusplus
+extern "C" {
+#endif
+/*
+ * regexpr.h
+ *
+ * Author: Tatu Ylonen <ylo@ngs.fi>
+ *
+ * Copyright (c) 1991 Tatu Ylonen, Espoo, Finland
+ *
+ * Permission to use, copy, modify, distribute, and sell this software
+ * and its documentation for any purpose is hereby granted without fee,
+ * provided that the above copyright notice appear in all copies.  This
+ * software is provided "as is" without express or implied warranty.
+ *
+ * Created: Thu Sep 26 17:15:36 1991 ylo
+ * Last modified: Mon Nov  4 15:49:46 1991 ylo
+ */
+/* $Id$ */
+#ifndef REGEXPR_H
+#define REGEXPR_H
+#define RE_NREGS        100  /* number of registers available */
+typedef struct re_pattern_buffer
+{
+        unsigned char *buffer;          /* compiled pattern */
+        int allocated;         /* allocated size of compiled pattern */
+        int used;              /* actual length of compiled pattern */
+        unsigned char *fastmap;         /* fastmap[ch] is true if ch can start pattern */
+        unsigned char *translate;       /* translation to apply during compilation/matching */
+        unsigned char fastmap_accurate; /* true if fastmap is valid */
+        unsigned char can_be_null;      /* true if can match empty string */
+        unsigned char uses_registers;   /* registers are used and need to be initialized */
+        int num_registers;     /* number of registers used */
+        unsigned char anchor;           /* anchor: 0=none 1=begline 2=begbuf */
+} *regexp_t;
+typedef struct re_registers
+{
+        int start[RE_NREGS];  /* start offset of region */
+        int end[RE_NREGS];    /* end offset of region */
+} *regexp_registers_t;
+/* bit definitions for syntax */
+#define RE_NO_BK_PARENS         1    /* no quoting for parentheses */
+#define RE_NO_BK_VBAR           2    /* no quoting for vertical bar */
+#define RE_BK_PLUS_QM           4    /* quoting needed for + and ? */
+#define RE_TIGHT_VBAR           8    /* | binds tighter than ^ and $ */
+#define RE_NEWLINE_OR           16   /* treat newline as or */
+#define RE_CONTEXT_INDEP_OPS    32   /* ^$?*+ are special in all contexts */
+#define RE_ANSI_HEX             64   /* ansi sequences (\n etc) and \xhh */
+#define RE_NO_GNU_EXTENSIONS   128   /* no gnu extensions */
+#define TP_RE_NOERR             0
+#define TP_RE_UNKNOWN_OPCODE    (-1)
+#define TP_RE_JUMP_OUT_BOUNDS   1
+#define TP_RE_QUOTE_ERR         2
+/* definitions for some common regexp styles */
+#define RE_SYNTAX_AWK   (RE_NO_BK_PARENS|RE_NO_BK_VBAR|RE_CONTEXT_INDEP_OPS)
+#define RE_SYNTAX_EGREP (RE_SYNTAX_AWK|RE_NEWLINE_OR)
+#define RE_SYNTAX_GREP  (RE_BK_PLUS_QM|RE_NEWLINE_OR)
+#define RE_SYNTAX_EMACS 0
+#define Sword       1
+#define Swhitespace 2
+#define Sdigit      4
+#define Soctaldigit 8
+#define Shexdigit   16
+/* Rename all exported symbols to avoid conflicts with similarly named
+   symbols in some systems' standard C libraries... */
+#define re_syntax _Py_re_syntax
+#define re_syntax_table _Py_re_syntax_table
+#define re_compile_initialize _Py_re_compile_initialize
+#define re_set_syntax _Py_re_set_syntax
+#define re_compile_pattern _Py_re_compile_pattern
+#define re_match _Py_re_match
+#define re_search _Py_re_search
+#define re_compile_fastmap _Py_re_compile_fastmap
+#define re_comp _Py_re_comp
+#define re_exec _Py_re_exec
+#ifdef HAVE_PROTOTYPES
+extern int re_syntax;
+/* This is the actual syntax mask.  It was added so that Python could do
+ * syntax-dependent munging of patterns before compilation. */
+extern unsigned char re_syntax_table[256];
+void re_compile_initialize(void);
+int re_set_syntax(int syntax);
+/* This sets the syntax to use and returns the previous syntax.  The
+ * syntax is specified by a bit mask of the above defined bits. */
+char *re_compile_pattern(unsigned char *regex, int regex_size, regexp_t compiled);
+/* This compiles the regexp (given in regex and length in regex_size).
+ * This returns NULL if the regexp compiled successfully, and an error
+ * message if an error was encountered.  The buffer field must be
+ * initialized to a memory area allocated by malloc (or to NULL) before
+ * use, and the allocated field must be set to its length (or 0 if
+ * buffer is NULL).  Also, the translate field must be set to point to a
+ * valid translation table, or NULL if it is not used. */
+int re_match(regexp_t compiled, unsigned char *string, int size, int pos,
+             regexp_registers_t old_regs);
+/* This tries to match the regexp against the string.  This returns the
+ * length of the matched portion, or -1 if the pattern could not be
+ * matched and -2 if an error (such as failure stack overflow) is
+ * encountered. */
+int re_search(regexp_t compiled, unsigned char *string, int size, int startpos,
+              int range, regexp_registers_t regs);
+/* This searches for a substring matching the regexp.  This returns the
+ * first index at which a match is found.  range specifies at how many
+ * positions to try matching; positive values indicate searching
+ * forwards, and negative values indicate searching backwards.  mstop
+ * specifies the offset beyond which a match must not go.  This returns
+ * -1 if no match is found, and -2 if an error (such as failure stack
+ * overflow) is encountered. */
+void re_compile_fastmap(regexp_t compiled);
+/* This computes the fastmap for the regexp.  For this to have any effect,
+ * the calling program must have initialized the fastmap field to point
+ * to an array of 256 characters. */
+#else /* HAVE_PROTOTYPES */
+extern int re_syntax;
+extern unsigned char re_syntax_table[256];
+void re_compile_initialize();
+int re_set_syntax();
+char *re_compile_pattern();
+int re_match();
+int re_search();
+void re_compile_fastmap();
+#endif /* HAVE_PROTOTYPES */
+#endif /* REGEXPR_H */
+#ifdef __cplusplus
+}
+#endif
+#endif /* !Py_REGEXPR_H */

 /programs/develop/tinypy/modules/re/tests.py
 ,0 → 1,648
+"""
+test case for re module
+"""
+import re
+import testsuite
+SUCCEED, FAIL, SYNTAX_ERROR = range(3)
+def RAISE():
+    raise("testing failed")
+def main():
+    #print("begin re tests")
+    assert(re.__name__ != None)
+    assert(re.__doc__ != None)
+    assert(re.__file__ != None)
+    test_re_obj_search()
+    test_re_obj_match()
+    test_re_mod_search()
+    test_re_mod_match()
+    test_re_obj_split()
+    test_re_mod_split()
+    test_re_obj_findall()
+    test_re_mod_findall()
+    test_mat_obj_groups()
+    test_mat_obj_start()
+    test_mat_obj_end()
+    test_mat_obj_span()
+    print("#OK: re tests passed")
+def test_re_obj_search(verbose = None):
+    """
+    some tests borrowed from cpython
+    testing re.compile(), reobj.search(), and matobj.group()
+    """
+    regex_tests = testsuite.search_regex_tests
+    for t in regex_tests:
+        pattern=s=outcome=repl=expected=None
+        if len(t)==5:
+            pattern, s, outcome, repl, expected = t
+        elif len(t)==3:
+            pattern, s, outcome = t
+        else:
+            raise ('Test tuples should have 3 or 5 fields',t)
+        try:
+            obj=re.compile(pattern)
+        except:
+            if outcome==SYNTAX_ERROR: continue    # Expected a syntax error
+            else:
+                # Regex syntax errors aren't yet reported, so for
+                # the official test suite they'll be quietly ignored.
+                pass
+        try:
+            matobj=obj.search(s)
+        except:
+            print('=== Unexpected exception:', obj, matobj, pattern, s)
+            RAISE()
+        if outcome==SYNTAX_ERROR:
+            # This should have been a syntax error; forget it.
+            pass
+        elif outcome==FAIL:
+            if matobj==None: pass   # No match, as expected
+            else: print('=== Succeeded incorrectly', obj, matobj, pattern, s)
+        elif outcome==SUCCEED:
+            if matobj!=None:
+                # Matched, as expected, so now we compute the
+                # result string and compare it to our expected result.
+                found=matobj.group(0)
+                repl = repl.replace("found", str(found))
+                for i in range(1,11):
+                    if "g"+str(i) in repl:
+                        gi = str(matobj.group(i))
+                        repl = repl.replace("g"+str(i), gi)
+                if len(t) == 5:
+                    repl = repl.replace('+', '')
+                    repl = repl.replace('\"', '')
+                    if repl!=expected:
+                        print( '=== grouping error', t,
+                                str(repl)+' should be '+str(expected))
+                        RAISE()
+            else:
+                print ('=== Failed incorrectly', t)
+def test_re_obj_match(verbose = None):
+    """
+    some tests borrowed from cpython
+    testing re.compile(), reobj.match() and matobj.group()
+    """
+    regex_tests = testsuite.match_regex_tests
+    for t in regex_tests:
+        pattern=s=outcome=repl=expected=None
+        if len(t)==5:
+            pattern, s, outcome, repl, expected = t
+        elif len(t)==3:
+            pattern, s, outcome = t
+        else:
+            raise ('Test tuples should have 3 or 5 fields',t)
+        try:
+            obj=re.compile(pattern)
+        except:
+            if outcome==SYNTAX_ERROR: continue    # Expected a syntax error
+            else:
+                # Regex syntax errors aren't yet reported, so for
+                # the official test suite they'll be quietly ignored.
+                pass
+        try:
+            matobj=obj.match(s)
+        except:
+            print('=== Unexpected exception:', obj, matobj, pattern, s)
+        if outcome==SYNTAX_ERROR:
+            # This should have been a syntax error; forget it.
+            pass
+        elif outcome==FAIL:
+            if matobj==None: pass   # No match, as expected
+            else: print('=== Succeeded incorrectly', obj, matobj, pattern, s)
+        elif outcome==SUCCEED:
+            if matobj!=None:
+                # Matched, as expected, so now we compute the
+                # result string and compare it to our expected result.
+                found=matobj.group(0)
+                repl = repl.replace("found", str(found))
+                for i in range(1,11):
+                    if "g"+str(i) in repl:
+                        gi = str(matobj.group(i))
+                        repl = repl.replace("g"+str(i), gi)
+                if len(t) == 5:
+                    repl = repl.replace('+', '')
+                    repl = repl.replace('\"', '')
+                    if repl!=expected:
+                        print( '=== grouping error', t,
+                                str(repl)+' should be '+str(expected))
+                        RAISE()
+            else:
+                print ('=== Failed incorrectly', obj, matobj, pattern, s)
+def test_re_mod_search(verbose = None):
+    """
+    some tests borrowed from cpython
+    testing re.search(), and matobj.group()
+    """
+    regex_tests = testsuite.search_regex_tests
+    for t in regex_tests:
+        pattern=s=outcome=repl=expected=None
+        if len(t)==5:
+            pattern, s, outcome, repl, expected = t
+        elif len(t)==3:
+            pattern, s, outcome = t
+        else:
+            raise ('Test tuples should have 3 or 5 fields',t)
+        try:
+            matobj=re.search(pattern, s)
+        except:
+            if outcome==SYNTAX_ERROR:
+                # This should have been a syntax error; forget it.
+                pass
+            else:
+                print('=== Unexpected exception:', matobj, pattern, s)
+        if outcome==FAIL:
+            if matobj==None: pass   # No match, as expected
+            else: print('=== Succeeded incorrectly', obj, matobj, pattern, s)
+        elif outcome==SUCCEED:
+            if matobj!=None:
+                # Matched, as expected, so now we compute the
+                # result string and compare it to our expected result.
+                found=matobj.group(0)
+                repl = repl.replace("found", str(found))
+                for i in range(1,11):
+                    if "g"+str(i) in repl:
+                        gi = str(matobj.group(i))
+                        repl = repl.replace("g"+str(i), gi)
+                if len(t) == 5:
+                    repl = repl.replace('+', '')
+                    repl = repl.replace('\"', '')
+                    if repl!=expected:
+                        print( '=== grouping error', t,
+                                str(repl)+' should be '+str(expected))
+                        RAISE()
+            else:
+                print ('=== Failed incorrectly', t)
+def test_re_mod_match(verbose = None):
+    """
+    some tests borrowed from cpython
+    testing re.match(), and matobj.group()
+    """
+    regex_tests = testsuite.match_regex_tests
+    for t in regex_tests:
+        pattern=s=outcome=repl=expected=None
+        if len(t)==5:
+            pattern, s, outcome, repl, expected = t
+        elif len(t)==3:
+            pattern, s, outcome = t
+        else:
+            raise ('Test tuples should have 3 or 5 fields',t)
+        try:
+            matobj=re.match(pattern, s)
+        except:
+            if outcome==SYNTAX_ERROR:
+                # This should have been a syntax error; forget it.
+                pass
+            else:
+                print('=== Unexpected exception:', matobj, pattern, s)
+        if outcome==FAIL:
+            if matobj==None: pass   # No match, as expected
+            else: print('=== Succeeded incorrectly', matobj, pattern, s)
+        elif outcome==SUCCEED:
+            if matobj!=None:
+                # Matched, as expected, so now we compute the
+                # result string and compare it to our expected result.
+                found=matobj.group(0)
+                repl = repl.replace("found", str(found))
+                for i in range(1,11):
+                    if "g"+str(i) in repl:
+                        gi = str(matobj.group(i))
+                        repl = repl.replace("g"+str(i), gi)
+                if len(t) == 5:
+                    repl = repl.replace('+', '')
+                    repl = repl.replace('\"', '')
+                    if repl!=expected:
+                        print( '=== grouping error', t,
+                                str(repl)+' should be '+str(expected))
+                        RAISE()
+            else:
+                print ('=== Failed incorrectly', t)
+def test_re_obj_split(verbose = None):
+    """
+    test re.compile(), and reobj.split()
+    """
+    regex_tests = testsuite.split_regex_tests
+    for t in regex_tests:
+        pattern, s, outcome, maxsplit, fields = t
+        try:
+            reobj = re.compile(pattern)
+        except:
+            if outcome==SYNTAX_ERROR:
+                # This should have been a syntax error; forget it.
+                pass
+            else:
+                print('=== Unexpected exception:', pattern, s,
+                                    outcome, maxsplit, fields)
+        try:
+            fldlst=reobj.split(s, maxsplit)
+        except:
+            if outcome == SYNTAX_ERROR:
+                continue
+            else:
+                print('=== Unexpected exception:', pattern, s,
+                                    outcome, maxsplit, fields)
+        if outcome==FAIL:
+            pass    # No match, as expected
+        elif outcome==SUCCEED:
+            if fldlst:
+                # Matched, as expected, so now we compute the
+                # result string and compare it to our expected result.
+                if verbose:
+                    fldstr = fieldstr = ""
+                    for item in fldlst:
+                        fldstr = fldstr + str(item) + " | "
+                    for item in fields:
+                        fieldstr = fieldstr + str(item) + " | "
+                    print(fldstr, "~~~", fieldstr)
+                if len(fields) != len(fldlst):
+                    print('=== Not coherent 1')
+                    RAISE()
+                for i in range(len(fields)):
+                    if fields[i] != fldlst[i]:
+                        if verbose:
+                            print('=== Not coherent 2', pattern, s,
+                                    outcome, maxsplit, fields, i,
+                                    fields[i],'(',len(fields[i]),')', ' | ',
+                                    fldlst[i],'(',len(fldlst[i]),')')
+                        else:
+                            print('=== Not coherent 2')
+                        RAISE()
+            else:
+                print ('=== Failed incorrectly', pattern, s,
+                        outcome, maxsplit, fields)
+def test_re_mod_split(verbose = None):
+    """
+    test re.split()
+    """
+    regex_tests = testsuite.split_regex_tests
+    for t in regex_tests:
+        pattern, s, outcome, maxsplit, fields = t
+        try:
+            fldlst=re.split(pattern, s, maxsplit)
+        except:
+            if outcome==SYNTAX_ERROR:
+                # This should have been a syntax error; forget it.
+                continue
+            else:
+                print('=== Unexpected exception:', pattern, s,
+                                    outcome, maxsplit, fields)
+        if outcome==FAIL:
+            pass    # No match, as expected
+        elif outcome==SUCCEED:
+            if fldlst:
+                # Matched, as expected, so now we compute the
+                # result string and compare it to our expected result.
+                if verbose:
+                    fldstr = fieldstr = ""
+                    for item in fldlst:
+                        fldstr = fldstr + str(item) + " | "
+                    for item in fields:
+                        fieldstr = fieldstr + str(item) + " | "
+                    print(fldstr, "~~~", fieldstr)
+                if len(fields) != len(fldlst):
+                    print('=== Not coherent 1')
+                    RAISE()
+                for i in range(len(fields)):
+                    if fields[i] != fldlst[i]:
+                        if verbose:
+                            print('=== Not coherent 2', pattern, s,
+                                    outcome, maxsplit, fields, i,
+                                    fields[i],'(',len(fields[i]),')', ' | ',
+                                    fldlst[i],'(',len(fldlst[i]),')')
+                        else:
+                            print('=== Not coherent 2')
+                        RAISE()
+            else:
+                print ('=== Failed incorrectly', pattern, s,
+                        outcome, maxsplit, fields)
+def test_re_obj_findall(verbose = None):
+    """
+    test re.compile(), and reobj.findall()
+    """
+    regex_tests = testsuite.findall_regex_tests
+    for t in regex_tests:
+        pattern, s, outcome, pos, fields = t
+        try:
+            reobj = re.compile(pattern)
+        except:
+            if outcome==SYNTAX_ERROR:
+                # This should have been a syntax error; forget it.
+                pass
+            else:
+                print('=== Unexpected exception:', pattern, s,
+                                    outcome, pos, fields)
+        try:
+            fldlst=reobj.findall(s, pos)
+        except:
+            if outcome == SYNTAX_ERROR:
+                continue
+            else:
+                print('=== Unexpected exception:', pattern, s,
+                                    outcome, pos, fields)
+        if outcome==FAIL:
+            pass    # No match, as expected
+        elif outcome==SUCCEED:
+            if fldlst:
+                # Matched, as expected, so now we compute the
+                # result string and compare it to our expected result.
+                if verbose:
+                    fldstr = fieldstr = ""
+                    for item in fldlst:
+                        fldstr = fldstr + str(item) + " | "
+                    for item in fields:
+                        fieldstr = fieldstr + str(item) + " | "
+                    print(fldstr, "~~~", fieldstr)
+                if len(fields) != len(fldlst):
+                    print('=== Not coherent 1')
+                    RAISE()
+                for i in range(len(fields)):
+                    if fields[i] != fldlst[i]:
+                        if verbose:
+                            print('=== Not coherent 2', pattern, s,
+                                    outcome, maxsplit, fields, i,
+                                    fields[i],'(',len(fields[i]),')', ' | ',
+                                    fldlst[i],'(',len(fldlst[i]),')')
+                        else:
+                            print('=== Not coherent 2')
+                        RAISE()
+            else:
+                print ('=== Failed incorrectly', pattern, s,
+                        outcome, pos, fields)
+def test_re_mod_findall(verbose = None):
+    """
+    test re.findall()
+    """
+    regex_tests = testsuite.mod_findall_regex_tests
+    for t in regex_tests:
+        pattern, s, outcome, pos, fields = t    # pos is not used
+        try:
+            fldlst=re.findall(pattern, s)
+        except:
+            if outcome==SYNTAX_ERROR:
+                # This should have been a syntax error; forget it.
+                continue
+            else:
+                print('=== Unexpected exception:', pattern, s,
+                                    outcome, pos, fields)
+        if outcome==FAIL:
+            pass    # No match, as expected
+        elif outcome==SUCCEED:
+            if fldlst:
+                # Matched, as expected, so now we compute the
+                # result string and compare it to our expected result.
+                if verbose:
+                    fldstr = fieldstr = ""
+                    for item in fldlst:
+                        fldstr = fldstr + str(item) + " | "
+                    for item in fields:
+                        fieldstr = fieldstr + str(item) + " | "
+                    print(fldstr, "~~~", fieldstr)
+                if len(fields) != len(fldlst):
+                    print('=== Not coherent 1')
+                    RAISE()
+                for i in range(len(fields)):
+                    if fields[i] != fldlst[i]:
+                        if verbose:
+                            print('=== Not coherent 2', pattern, s,
+                                    outcome, maxsplit, fields, i,
+                                    fields[i],'(',len(fields[i]),')', ' | ',
+                                    fldlst[i],'(',len(fldlst[i]),')')
+                        else:
+                            print('=== Not coherent 2')
+                        RAISE()
+            else:
+                print ('=== Failed incorrectly', pattern, s,
+                        outcome, pos, fields)
+def test_mat_obj_groups(verbose = None):
+    """
+    test re.search(), and matobj.groups()
+    'verbose' is for debugging, when 'verbose' is true, print extra info
+    """
+    regex_tests = testsuite.matobj_groups_regex_tests
+    for t in regex_tests:
+        pattern, s, outcome, fields, grpidx, start, end = t
+        try:
+            matobj=re.search(pattern, s)
+        except:
+            if outcome==SYNTAX_ERROR:
+                # This should have been a syntax error; forget it.
+                continue
+            else:
+                print('=== Unexpected exception 1:', pattern, s,
+                                    outcome,fields)
+        try:
+            if outcome==SUCCEED: assert(matobj != None)
+            fldlst = matobj.groups()
+        except:
+            if outcome==SYNTAX_ERROR:
+                # This should have been a syntax error; forget it.
+                continue
+            else:
+                print('=== Unexpected exception 2:', pattern, s,
+                                    outcome,fields)
+        if outcome==FAIL:
+            pass    # No match, as expected
+        elif outcome==SUCCEED:
+            if fldlst and fields:
+                # Matched, as expected, so now we compute the
+                # result string and compare it to our expected result.
+                if verbose:
+                    fldstr = fieldstr = ""
+                    for item in fldlst:
+                        fldstr = fldstr + str(item) + " | "
+                    for item in fields:
+                        fieldstr = fieldstr + str(item) + " | "
+                    print(fldstr, "~~~", fieldstr)
+                if len(fields) != len(fldlst):
+                    print('=== Not coherent 2')
+                    RAISE()
+                for i in range(len(fields)):
+                    if fields[i] != fldlst[i]:
+                        if verbose:
+                            print('=== Not coherent', pattern, s,
+                                    outcome,fields, i,
+                                    fields[i],'(',len(fields[i]),')', ' | ',
+                                    fldlst[i],'(',len(fldlst[i]),')')
+                        else:
+                            print('=== Not coherent')
+                        RAISE()
+            elif not len(fldlst) and not len(fields):
+                # output is empty, as expected
+                if verbose:
+                    print("output is empty, as expected")
+                continue
+            else:
+                if verbose:
+                    for item in fldlst:
+                        print(item,)
+                    print()
+                    for item in fields:
+                        print(item,)
+                    print()
+                print ('=== Failed incorrectly', pattern, s,
+                        outcome,fields,fldlst)
+def test_mat_obj_start(verbose = None):
+    """
+    test re.search(), and matobj.start()
+    'verbose' is for debugging, when 'verbose' is true, print extra info
+    """
+    regex_tests = testsuite.matobj_groups_regex_tests
+    for t in regex_tests:
+        pattern, s, outcome, fields, grpidx, start, end = t
+        try:
+            matobj=re.search(pattern, s)
+        except:
+            if outcome==SYNTAX_ERROR:
+                # This should have been a syntax error; forget it.
+                continue
+            else:
+                print('=== Unexpected exception 1:', pattern, s,
+                                    outcome,fields)
+        try:
+            if outcome==SUCCEED: assert(matobj != None)
+            fldlst = matobj.groups()
+        except:
+            if outcome==SYNTAX_ERROR:
+                # This should have been a syntax error; forget it.
+                continue
+            else:
+                print('=== Unexpected exception 2:', pattern, s,
+                                    outcome,fields)
+        if outcome==FAIL:
+            pass    # No match, as expected
+        elif outcome==SUCCEED:
+            if grpidx > 0:
+                if matobj.start(grpidx) == start:
+                    pass
+                else:
+                    if verbose:
+                        print ('=== Failed incorrectly', pattern, s,
+                            outcome,fields,fldlst)
+                    raise("testing failed")
+def test_mat_obj_end(verbose = None):
+    """
+    test re.search(), and matobj.end()
+    'verbose' is for debugging, when 'verbose' is true, print extra info
+    """
+    regex_tests = testsuite.matobj_groups_regex_tests
+    for t in regex_tests:
+        pattern, s, outcome, fields, grpidx, start, end = t
+        try:
+            matobj=re.search(pattern, s)
+        except:
+            if outcome==SYNTAX_ERROR:
+                # This should have been a syntax error; forget it.
+                continue
+            else:
+                print('=== Unexpected exception 1:', pattern, s,
+                                    outcome,fields)
+        try:
+            if outcome==SUCCEED: assert(matobj != None)
+            fldlst = matobj.groups()
+        except:
+            if outcome==SYNTAX_ERROR:
+                # This should have been a syntax error; forget it.
+                continue
+            else:
+                print('=== Unexpected exception 2:', pattern, s,
+                                    outcome,fields)
+        if outcome==FAIL:
+            pass    # No match, as expected
+        elif outcome==SUCCEED:
+            if grpidx > 0:
+                if matobj.end(grpidx) == end:
+                    pass
+                else:
+                    if verbose:
+                        print ('=== Failed incorrectly', pattern, s,
+                            outcome,fields,fldlst, matobj.end(grpidx), end)
+                    raise("testing failed")
+def test_mat_obj_span(verbose = None):
+    """
+    test re.search(), and matobj.span()
+    'verbose' is for debugging, when 'verbose' is true, print extra info
+    """
+    regex_tests = testsuite.matobj_groups_regex_tests
+    for t in regex_tests:
+        pattern, s, outcome, fields, grpidx, start, end = t
+        try:
+            matobj=re.search(pattern, s)
+        except:
+            if outcome==SYNTAX_ERROR:
+                # This should have been a syntax error; forget it.
+                continue
+            else:
+                print('=== Unexpected exception 1:', pattern, s,
+                                    outcome,fields)
+        try:
+            if outcome==SUCCEED: assert(matobj != None)
+            fldlst = matobj.groups()
+        except:
+            if outcome==SYNTAX_ERROR:
+                # This should have been a syntax error; forget it.
+                continue
+            else:
+                print('=== Unexpected exception 2:', pattern, s,
+                                    outcome,fields)
+        if outcome==FAIL:
+            pass    # No match, as expected
+        elif outcome==SUCCEED:
+            if (grpidx > 0):
+                spstart, spend = matobj.span(grpidx)
+                if spstart == start and spend == end:
+                    pass
+                else:
+                    if verbose:
+                        print ('=== Failed incorrectly', pattern, s,
+                            outcome,fields,fldlst)
+                    raise("testing failed")
+if __name__ == "__main__":
+        main()

 /programs/develop/tinypy/modules/re/testsuite.py
 ,0 → 1,367
+# Test suite (for verifying correctness)
+#
+# The test suite is a list of 5- or 3-tuples.  The 5 parts of a
+# complete tuple are:
+# element 0: a string containing the pattern
+#         1: the string to match against the pattern
+#         2: the expected result (0 - SUCCEED, 1 - FAIL, 2 - SYNTAX_ERROR)
+#         3: a string that will be eval()'ed to produce a test string.
+#            This is an arbitrary Python expression; the available
+#            variables are "found" (the whole match), and "g1", "g2", ...
+#            up to "g10" contain the contents of each group, or the
+#            string 'None' if the group wasn't given a value.
+#         4: The expected result of evaluating the expression.
+#            If the two don't match, an error is reported.
+#
+# If the regex isn't expected to work, the latter two elements can be omitted.
+# test suite for search
+search_regex_tests=[
+['abc', 'abc', 0, 'found', 'abc'],
+['abc', 'xbc', 1],
+['abc', 'axc', 1],
+['abc', 'abx', 1],
+['abc', 'xabcy', 0, 'found', 'abc'],
+['abc', 'ababc', 0, 'found', 'abc'],
+['ab*c', 'abc', 0, 'found', 'abc'],
+['ab*bc', 'abc', 0, 'found', 'abc'],
+['ab*bc', 'abbc', 0, 'found', 'abbc'],
+['ab*bc', 'abbbbc', 0, 'found', 'abbbbc'],
+['ab+bc', 'abbc', 0, 'found', 'abbc'],
+['ab+bc', 'abc', 1],
+['ab+bc', 'abq', 1],
+['ab+bc', 'abbbbc', 0, 'found', 'abbbbc'],
+['ab?bc', 'abbc', 0, 'found', 'abbc'],
+['ab?bc', 'abc', 0, 'found', 'abc'],
+['ab?bc', 'abbbbc', 1],
+['ab?c', 'abc', 0, 'found', 'abc'],
+['^abc$', 'abc', 0, 'found', 'abc'],
+['^abc$', 'abcc', 1],
+['^abc', 'abcc', 0, 'found', 'abc'],
+['^abc$', 'aabc', 1],
+['abc$', 'aabc', 0, 'found', 'abc'],
+['^', 'abc', 0, 'found+"-"', '-'],
+['$', 'abc', 0, 'found+"-"', '-'],
+['a.c', 'abc', 0, 'found', 'abc'],
+['a.c', 'axc', 0, 'found', 'axc'],
+['a.*c', 'axyzc', 0, 'found', 'axyzc'],
+['a.*c', 'axyzd', 1],
+['a[bc]d', 'abc', 1],
+['a[bc]d', 'abd', 0, 'found', 'abd'],
+['a[b-d]e', 'abd', 1],
+['a[b-d]e', 'ace', 0, 'found', 'ace'],
+['a[b-d]', 'aac', 0, 'found', 'ac'],
+['a[-b]', 'a-', 0, 'found', 'a-'],
+['a[b-]', 'a-', 0, 'found', 'a-'],
+['a[]b', '-', 2],
+['a[', '-', 2],
+['a\\', '-', 2],
+['abc\\)', '-', 2],
+['\\(abc', '-', 2],
+['a]', 'a]', 0, 'found', 'a]'],
+['a[]]b', 'a]b', 0, 'found', 'a]b'],
+['a[^bc]d', 'aed', 0, 'found', 'aed'],
+['a[^bc]d', 'abd', 1],
+['a[^-b]c', 'adc', 0, 'found', 'adc'],
+['a[^-b]c', 'a-c', 1],
+['a[^]b]c', 'a]c', 1],
+['a[^]b]c', 'adc', 0, 'found', 'adc'],
+['\\ba\\b', 'a-', 0, '"-"', '-'],
+['\\ba\\b', '-a', 0, '"-"', '-'],
+['\\ba\\b', '-a-', 0, '"-"', '-'],
+['\\by\\b', 'xy', 1],
+['\\by\\b', 'yz', 1],
+['\\by\\b', 'xyz', 1],
+['ab\\|cd', 'abc', 0, 'found', 'ab'],
+['ab\\|cd', 'abcd', 0, 'found', 'ab'],
+['\\(\\)ef', 'def', 0, 'found+"-"+g1', 'ef-'],
+['$b', 'b', 1],
+['a(b', 'a(b', 0, 'found+"-"+g1', 'a(b-None'],
+['a(*b', 'ab', 0, 'found', 'ab'],
+['a(*b', 'a((b', 0, 'found', 'a((b'],
+['a\\\\b', 'a\\b', 0, 'found', 'a\\b'],
+['\\(\\(a\\)\\)', 'abc', 0, 'found+"-"+g1+"-"+g2', 'a-a-a'],
+['\\(a\\)b\\(c\\)', 'abc', 0, 'found+"-"+g1+"-"+g2', 'abc-a-c'],
+['a+b+c', 'aabbabc', 0, 'found', 'abc'],
+['\\(a+\\|b\\)*', 'ab', 0, 'found+"-"+g1', 'ab-b'],
+['\\(a+\\|b\\)+', 'ab', 0, 'found+"-"+g1', 'ab-b'],
+['\\(a+\\|b\\)?', 'ab', 0, 'found+"-"+g1', 'a-a'],
+['\\)\\(', '-', 2],
+['[^ab]*', 'cde', 0, 'found', 'cde'],
+['abc', '', 1],
+['a*', '', 0, 'found', ''],
+['a\\|b\\|c\\|d\\|e', 'e', 0, 'found', 'e'],
+['\\(a\\|b\\|c\\|d\\|e\\)f', 'ef', 0, 'found+"-"+g1', 'ef-e'],
+['abcd*efg', 'abcdefg', 0, 'found', 'abcdefg'],
+['ab*', 'xabyabbbz', 0, 'found', 'ab'],
+['ab*', 'xayabbbz', 0, 'found', 'a'],
+['\\(ab\\|cd\\)e', 'abcde', 0, 'found+"-"+g1', 'cde-cd'],
+['[abhgefdc]ij', 'hij', 0, 'found', 'hij'],
+['^\\(ab\\|cd\\)e', 'abcde', 1, 'xg1y', 'xy'],
+['\\(abc\\|\\)ef', 'abcdef', 0, 'found+"-"+g1', 'ef-'],
+['\\(a\\|b\\)c*d', 'abcd', 0, 'found+"-"+g1', 'bcd-b'],
+['\\(ab\\|ab*\\)bc', 'abc', 0, 'found+"-"+g1', 'abc-a'],
+['a\\([bc]*\\)c*', 'abc', 0, 'found+"-"+g1', 'abc-bc'],
+['a\\([bc]*\\)\\(c*d\\)', 'abcd', 0, 'found+"-"+g1+"-"+g2', 'abcd-bc-d'],
+['a\\([bc]+\\)\\(c*d\\)', 'abcd', 0, 'found+"-"+g1+"-"+g2', 'abcd-bc-d'],
+['a\\([bc]*\\)\\(c+d\\)', 'abcd', 0, 'found+"-"+g1+"-"+g2', 'abcd-b-cd'],
+['a[bcd]*dcdcde', 'adcdcde', 0, 'found', 'adcdcde'],
+['a[bcd]+dcdcde', 'adcdcde', 1],
+['\\(ab\\|a\\)b*c', 'abc', 0, 'found+"-"+g1', 'abc-ab'],
+['\\(\\(a\\)\\(b\\)c\\)\\(d\\)', 'abcd', 0, 'g1+"-"+g2+"-"+g3+"-"+g4', 'abc-a-b-d'],
+['[a-zA-Z_][a-zA-Z0-9_]*', 'alpha', 0, 'found', 'alpha'],
+['^a\\(bc+\\|b[eh]\\)g\\|.h$', 'abh', 0, 'found+"-"+g1', 'bh-None'],
+['\\(bc+d$\\|ef*g.\\|h?i\\(j\\|k\\)\\)', 'effgz', 0, 'found+"-"+g1+"-"+g2', 'effgz-effgz-None'],
+['\\(bc+d$\\|ef*g.\\|h?i\\(j\\|k\\)\\)', 'ij', 0, 'found+"-"+g1+"-"+g2', 'ij-ij-j'],
+['\\(bc+d$\\|ef*g.\\|h?i\\(j\\|k\\)\\)', 'effg', 1],
+['\\(bc+d$\\|ef*g.\\|h?i\\(j\\|k\\)\\)', 'bcdd', 1],
+['\\(bc+d$\\|ef*g.\\|h?i\\(j\\|k\\)\\)', 'reffgz', 0, 'found+"-"+g1+"-"+g2', 'effgz-effgz-None'],
+['\\(\\(\\(\\(\\(\\(\\(\\(\\(a\\)\\)\\)\\)\\)\\)\\)\\)\\)', 'a', 0, 'found', 'a'],
+['multiple words of text', 'uh-uh', 1],
+['multiple words', 'multiple words, yeah', 0, 'found', 'multiple words'],
+['\\(.*\\)c\\(.*\\)', 'abcde', 0, 'found+"-"+g1+"-"+g2', 'abcde-ab-de'],
+['(\\(.*\\), \\(.*\\))', '(a, b)', 0, 'g2+"-"+g1', 'b-a'],
+['[k]', 'ab', 1],
+['a[-]?c', 'ac', 0, 'found', 'ac'],
+['\\(abc\\)\\1', 'abcabc', 0, 'g1', 'abc'],
+['\\([a-c]*\\)\\1', 'abcabc', 0, 'g1', 'abc'],
+['^\\(.+\\)?B', 'AB', 0, 'g1', 'A'],
+['\\(a+\\).\\1$', 'aaaaa', 0, 'found+"-"+g1', 'aaaaa-aa'],
+['^\\(a+\\).\\1$', 'aaaa', 1],
+['\\(abc\\)\\1', 'abcabc', 0, 'found+"-"+g1', 'abcabc-abc'],
+['\\([a-c]+\\)\\1', 'abcabc', 0, 'found+"-"+g1', 'abcabc-abc'],
+['\\(a\\)\\1', 'aa', 0, 'found+"-"+g1', 'aa-a'],
+['\\(a+\\)\\1', 'aa', 0, 'found+"-"+g1', 'aa-a'],
+['\\(a+\\)+\\1', 'aa', 0, 'found+"-"+g1', 'aa-a'],
+['\\(a\\).+\\1', 'aba', 0, 'found+"-"+g1', 'aba-a'],
+['\\(a\\)ba*\\1', 'aba', 0, 'found+"-"+g1', 'aba-a'],
+['\\(aa\\|a\\)a\\1$', 'aaa', 0, 'found+"-"+g1', 'aaa-a'],
+['\\(a\\|aa\\)a\\1$', 'aaa', 0, 'found+"-"+g1', 'aaa-a'],
+['\\(a+\\)a\\1$', 'aaa', 0, 'found+"-"+g1', 'aaa-a'],
+['\\([abc]*\\)\\1', 'abcabc', 0, 'found+"-"+g1', 'abcabc-abc'],
+['\\(a\\)\\(b\\)c\\|ab', 'ab', 0, 'found+"-"+g1+"-"+g2', 'ab-None-None'],
+['\\(a\\)+x', 'aaax', 0, 'found+"-"+g1', 'aaax-a'],
+['\\([ac]\\)+x', 'aacx', 0, 'found+"-"+g1', 'aacx-c'],
+['\\([^/]*/\\)*sub1/', 'd:msgs/tdir/sub1/trial/away.cpp', 0, 'found+"-"+g1', 'd:msgs/tdir/sub1/-tdir/'],
+['\\([^.]*\\)\\.\\([^:]*\\):[T ]+\\(.*\\)', 'track1.title:TBlah blah blah', 0, 'found+"-"+g1+"-"+g2+"-"+g3', 'track1.title:TBlah blah blah-track1-title-Blah blah blah'],
+['\\([^N]*N\\)+', 'abNNxyzN', 0, 'found+"-"+g1', 'abNNxyzN-xyzN'],
+['\\([^N]*N\\)+', 'abNNxyz', 0, 'found+"-"+g1', 'abNN-N'],
+['\\([abc]*\\)x', 'abcx', 0, 'found+"-"+g1', 'abcx-abc'],
+['\\([abc]*\\)x', 'abc', 1],
+['\\([xyz]*\\)x', 'abcx', 0, 'found+"-"+g1', 'x-'],
+['\\(a\\)+b\\|aac', 'aac', 0, 'found+"-"+g1', 'aac-None'],
+['\\<a', 'a', 0, 'found', 'a'],
+['\\<a', '!', 1],
+['a\\<b', 'ab', 1],
+['a\\>', 'ab', 1],
+['a\\>', 'a!', 0, 'found', 'a'],
+['a\\>', 'a', 0, 'found', 'a'],
+]
+# test suite for match
+match_regex_tests=[
+['abc', 'abc', 0, 'found', 'abc'],
+['abc', 'xbc', 1],
+['abc', 'axc', 1],
+['abc', 'abx', 1],
+['abc', 'xabcy', 1],
+['abc', 'ababc', 1],
+['ab*c', 'abc', 0, 'found', 'abc'],
+['ab*bc', 'abc', 0, 'found', 'abc'],
+['ab*bc', 'abbc', 0, 'found', 'abbc'],
+['ab*bc', 'abbbbc', 0, 'found', 'abbbbc'],
+['ab+bc', 'abbc', 0, 'found', 'abbc'],
+['ab+bc', 'abc', 1],
+['ab+bc', 'abq', 1],
+['ab+bc', 'abbbbc', 0, 'found', 'abbbbc'],
+['ab?bc', 'abbc', 0, 'found', 'abbc'],
+['ab?bc', 'abc', 0, 'found', 'abc'],
+['ab?bc', 'abbbbc', 1],
+['ab?c', 'abc', 0, 'found', 'abc'],
+['^abc$', 'abc', 0, 'found', 'abc'],
+['^abc$', 'abcc', 1],
+['^abc', 'abcc', 0, 'found', 'abc'],
+['^abc$', 'aabc', 1],
+['abc$', 'aabc', 1],
+['^', 'abc', 0, 'found+"-"', '-'],
+['$', 'abc', 1],
+['a.c', 'abc', 0, 'found', 'abc'],
+['a.c', 'axc', 0, 'found', 'axc'],
+['a.*c', 'axyzc', 0, 'found', 'axyzc'],
+['a.*c', 'axyzd', 1],
+['a[bc]d', 'abc', 1],
+['a[bc]d', 'abd', 0, 'found', 'abd'],
+['a[b-d]e', 'abd', 1],
+['a[b-d]e', 'ace', 0, 'found', 'ace'],
+['a[b-d]', 'aac', 1],
+['a[-b]', 'a-', 0, 'found', 'a-'],
+['a[b-]', 'a-', 0, 'found', 'a-'],
+['a[]b', '-', 2],
+['a[', '-', 2],
+['a\\', '-', 2],
+['abc\\)', '-', 2],
+['\\(abc', '-', 2],
+['a]', 'a]', 0, 'found', 'a]'],
+['a[]]b', 'a]b', 0, 'found', 'a]b'],
+['a[^bc]d', 'aed', 0, 'found', 'aed'],
+['a[^bc]d', 'abd', 1],
+['a[^-b]c', 'adc', 0, 'found', 'adc'],
+['a[^-b]c', 'a-c', 1],
+['a[^]b]c', 'a]c', 1],
+['a[^]b]c', 'adc', 0, 'found', 'adc'],
+['\\ba\\b', 'a-', 0, '"-"', '-'],
+['\\ba\\b', '-a', 1],
+['\\ba\\b', '-a-', 1],
+['\\by\\b', 'xy', 1],
+['\\by\\b', 'yz', 1],
+['\\by\\b', 'xyz', 1],
+['ab\\|cd', 'abc', 0, 'found', 'ab'],
+['ab\\|cd', 'abcd', 0, 'found', 'ab'],
+['\\(\\)ef', 'def', 1],
+['$b', 'b', 1],
+['a(b', 'a(b', 0, 'found+"-"+g1', 'a(b-None'],
+['a(*b', 'ab', 0, 'found', 'ab'],
+['a(*b', 'a((b', 0, 'found', 'a((b'],
+['a\\\\b', 'a\\b', 0, 'found', 'a\\b'],
+['\\(\\(a\\)\\)', 'abc', 0, 'found+"-"+g1+"-"+g2', 'a-a-a'],
+['\\(a\\)b\\(c\\)', 'abc', 0, 'found+"-"+g1+"-"+g2', 'abc-a-c'],
+['a+b+c', 'aabbabc', 1],
+['\\(a+\\|b\\)*', 'ab', 0, 'found+"-"+g1', 'ab-b'],
+['\\(a+\\|b\\)+', 'ab', 0, 'found+"-"+g1', 'ab-b'],
+['\\(a+\\|b\\)?', 'ab', 0, 'found+"-"+g1', 'a-a'],
+['\\)\\(', '-', 2],
+['[^ab]*', 'cde', 0, 'found', 'cde'],
+['abc', '', 1],
+['a*', '', 0, 'found', ''],
+['a\\|b\\|c\\|d\\|e', 'e', 0, 'found', 'e'],
+['\\(a\\|b\\|c\\|d\\|e\\)f', 'ef', 0, 'found+"-"+g1', 'ef-e'],
+['abcd*efg', 'abcdefg', 0, 'found', 'abcdefg'],
+['ab*', 'xabyabbbz', 1],
+['ab*', 'xayabbbz', 1],
+['\\(ab\\|cd\\)e', 'abcde', 1],
+['[abhgefdc]ij', 'hij', 0, 'found', 'hij'],
+['^\\(ab\\|cd\\)e', 'abcde', 1, 'xg1y', 'xy'],
+['\\(abc\\|\\)ef', 'abcdef', 1],
+['\\(a\\|b\\)c*d', 'abcd', 1],
+['\\(ab\\|ab*\\)bc', 'abc', 0, 'found+"-"+g1', 'abc-a'],
+['a\\([bc]*\\)c*', 'abc', 0, 'found+"-"+g1', 'abc-bc'],
+['a\\([bc]*\\)\\(c*d\\)', 'abcd', 0, 'found+"-"+g1+"-"+g2', 'abcd-bc-d'],
+['a\\([bc]+\\)\\(c*d\\)', 'abcd', 0, 'found+"-"+g1+"-"+g2', 'abcd-bc-d'],
+['a\\([bc]*\\)\\(c+d\\)', 'abcd', 0, 'found+"-"+g1+"-"+g2', 'abcd-b-cd'],
+['a[bcd]*dcdcde', 'adcdcde', 0, 'found', 'adcdcde'],
+['a[bcd]+dcdcde', 'adcdcde', 1],
+['\\(ab\\|a\\)b*c', 'abc', 0, 'found+"-"+g1', 'abc-ab'],
+['\\(\\(a\\)\\(b\\)c\\)\\(d\\)', 'abcd', 0, 'g1+"-"+g2+"-"+g3+"-"+g4', 'abc-a-b-d'],
+['[a-zA-Z_][a-zA-Z0-9_]*', 'alpha', 0, 'found', 'alpha'],
+['^a\\(bc+\\|b[eh]\\)g\\|.h$', 'abh', 1],
+['\\(bc+d$\\|ef*g.\\|h?i\\(j\\|k\\)\\)', 'effgz', 0, 'found+"-"+g1+"-"+g2', 'effgz-effgz-None'],
+['\\(bc+d$\\|ef*g.\\|h?i\\(j\\|k\\)\\)', 'ij', 0, 'found+"-"+g1+"-"+g2', 'ij-ij-j'],
+['\\(bc+d$\\|ef*g.\\|h?i\\(j\\|k\\)\\)', 'effg', 1],
+['\\(bc+d$\\|ef*g.\\|h?i\\(j\\|k\\)\\)', 'bcdd', 1],
+['\\(bc+d$\\|ef*g.\\|h?i\\(j\\|k\\)\\)', 'reffgz', 1],
+['\\(\\(\\(\\(\\(\\(\\(\\(\\(a\\)\\)\\)\\)\\)\\)\\)\\)\\)', 'a', 0, 'found', 'a'],
+['multiple words of text', 'uh-uh', 1],
+['multiple words', 'multiple words, yeah', 0, 'found', 'multiple words'],
+['\\(.*\\)c\\(.*\\)', 'abcde', 0, 'found+"-"+g1+"-"+g2', 'abcde-ab-de'],
+['(\\(.*\\), \\(.*\\))', '(a, b)', 0, 'g2+"-"+g1', 'b-a'],
+['[k]', 'ab', 1],
+['a[-]?c', 'ac', 0, 'found', 'ac'],
+['\\(abc\\)\\1', 'abcabc', 0, 'g1', 'abc'],
+['\\([a-c]*\\)\\1', 'abcabc', 0, 'g1', 'abc'],
+['^\\(.+\\)?B', 'AB', 0, 'g1', 'A'],
+['\\(a+\\).\\1$', 'aaaaa', 0, 'found+"-"+g1', 'aaaaa-aa'],
+['^\\(a+\\).\\1$', 'aaaa', 1],
+['\\(abc\\)\\1', 'abcabc', 0, 'found+"-"+g1', 'abcabc-abc'],
+['\\([a-c]+\\)\\1', 'abcabc', 0, 'found+"-"+g1', 'abcabc-abc'],
+['\\(a\\)\\1', 'aa', 0, 'found+"-"+g1', 'aa-a'],
+['\\(a+\\)\\1', 'aa', 0, 'found+"-"+g1', 'aa-a'],
+['\\(a+\\)+\\1', 'aa', 0, 'found+"-"+g1', 'aa-a'],
+['\\(a\\).+\\1', 'aba', 0, 'found+"-"+g1', 'aba-a'],
+['\\(a\\)ba*\\1', 'aba', 0, 'found+"-"+g1', 'aba-a'],
+['\\(aa\\|a\\)a\\1$', 'aaa', 0, 'found+"-"+g1', 'aaa-a'],
+['\\(a\\|aa\\)a\\1$', 'aaa', 0, 'found+"-"+g1', 'aaa-a'],
+['\\(a+\\)a\\1$', 'aaa', 0, 'found+"-"+g1', 'aaa-a'],
+['\\([abc]*\\)\\1', 'abcabc', 0, 'found+"-"+g1', 'abcabc-abc'],
+['\\(a\\)\\(b\\)c\\|ab', 'ab', 0, 'found+"-"+g1+"-"+g2', 'ab-None-None'],
+['\\(a\\)+x', 'aaax', 0, 'found+"-"+g1', 'aaax-a'],
+['\\([ac]\\)+x', 'aacx', 0, 'found+"-"+g1', 'aacx-c'],
+['\\([^/]*/\\)*sub1/', 'd:msgs/tdir/sub1/trial/away.cpp', 0, 'found+"-"+g1', 'd:msgs/tdir/sub1/-tdir/'],
+['\\([^.]*\\)\\.\\([^:]*\\):[T ]+\\(.*\\)', 'track1.title:TBlah blah blah', 0, 'found+"-"+g1+"-"+g2+"-"+g3', 'track1.title:TBlah blah blah-track1-title-Blah blah blah'],
+['\\([^N]*N\\)+', 'abNNxyzN', 0, 'found+"-"+g1', 'abNNxyzN-xyzN'],
+['\\([^N]*N\\)+', 'abNNxyz', 0, 'found+"-"+g1', 'abNN-N'],
+['\\([abc]*\\)x', 'abcx', 0, 'found+"-"+g1', 'abcx-abc'],
+['\\([abc]*\\)x', 'abc', 1],
+['\\([xyz]*\\)x', 'abcx', 1],
+['\\(a\\)+b\\|aac', 'aac', 0, 'found+"-"+g1', 'aac-None'],
+['\\<a', 'a', 0, 'found', 'a'],
+['\\<a', '!', 1],
+['a\\<b', 'ab', 1],
+['a\\>', 'ab', 1],
+['a\\>', 'a!', 0, 'found', 'a'],
+['a\\>', 'a', 0, 'found', 'a'],
+]
+# test suite for split()
+# element 0: pattern
+#         1: string to split
+#         3: compile result
+#         4: maxsplit
+#         5: splitted fields list
+split_regex_tests = [
+["[ |,]", "with you, nothing, and me", 0, 0, ["with","you","nothing","and","me"]],
+["[ |,]", "with you, nothing, and me", 0, 1, ["with", "you, nothing, and me"]],
+["\\ ", "send email to apply", 0, 0, ["send", "email", "to", "apply"]],
+["\\ ", "send email to apply", 0, 2, ["send", "email", "to apply"]],
+["[+ | -]", "+86-028-83201034", 0, 0, ["86", "028", "83201034"]],
+["[+ | -]", "+86-028-83201034", 0, 1, ["86", "028-83201034"]],
+["[*|#]", "slide show", 0, 0, ["slide show"]],
+["(", "whats ever", 0, 1, ["whats ever"]],
+["@#!~$%^&*()<>\n", "who knows", 0, 1, ["who knows"]],
+]
+# test suite for findall()
+# element 0: pattern
+#         1: string to match
+#         3: compile result
+#         4: starting position
+#         5: grouped fields list
+# reobj.find()
+findall_regex_tests = [
+["\\ ", "send email to apply", 0, 0, [" ", " ", " "]],
+["\\ ", "send email to apply", 0, 5, [" ", " "]],
+["[+ | -]", "+86-028-83201034", 0, 0, ["+", "-", "-"]],
+["[+ | -]", "+86-028-83201034", 0, 1, ["-", "-"]],
+["sl.*e\\|#", "slide show at Room #3", 0, 0, ["slide", "#"]],
+["w.+s\\|e.*r", "whats ever", 0, 0, ["whats", "ever"]],
+["Euler\\|Gauss", "Both Euler and Gauss are great mathematicians", 0, 0, ["Euler", "Gauss"]],
+]
+# module re.findall()
+mod_findall_regex_tests = [
+["\\ ", "send email to apply", 0, 0, [" ", " ", " "]],
+["\\ ", "send email to apply", 0, 0, [" ", " ", " "]],
+["[+ | -]", "+86-028-83201034", 0, 0, ["+", "-", "-"]],
+["[+ | -]", "+86-028-83201034", 0, 0, ["+", "-", "-"]],
+["sl.*e\\|#", "slide show at Room #3", 0, 0, ["slide", "#"]],
+["w.+s\\|e.*r", "whats ever", 0, 0, ["whats", "ever"]],
+["Euler\\|Gauss", "Both Euler and Gauss are great mathematicians", 0, 0, ["Euler", "Gauss"]],
+]
+# test for match object's groups() method
+# element 0: pattern
+#                 1: string
+#                 2: compile result
+#                 3: matched fields, for groups()
+#                 4: group index, valid when > 0, for start(), end(), and span()
+#                 5: pattern's starting index in string, for start() and span()
+#                 6: pattern's ending index in string, for end() and span
+matobj_groups_regex_tests = [
+["\\(abc\\(.*xyz\\)\\(.*31415926\\)\\)", "where is abc and flurry xyz, which is pi 31415926, derived from ms", 0, ["abc and flurry xyz, which is pi 31415926"," and flurry xyz",", which is pi 31415926"], 2, 12, 27],
+["[a\\|b]\\(.+\\)shoe\\([t]+\\)d", "bbbshoetttdxrznmlkjp", 0, ["bb", "ttt"], 1, 1, 3],
+["abcdef", "xyah2oewoyqe030uabcdefwhalsdewnkhgiohyczb", 0, [], -1, 0, 0],
+]

 /programs/develop/tinypy/modules/math/init.c
 ,0 → 1,66
+#include "math.c"
+#include "../../tinypy/tp.h"
+/*
+ * init math module, namely, set its dictionary
+ */
+void math_init(TP)
+{
+    /*
+     * new a module dict for math
+     */
+    tp_obj math_mod = tp_dict(tp);
+    /*
+     * initialize pi and e
+     */
+    math_pi = tp_number(M_PI);
+    math_e  = tp_number(M_E);
+    /*
+     * bind math functions to math module
+     */
+    tp_set(tp, math_mod, tp_string("pi"), math_pi);
+    tp_set(tp, math_mod, tp_string("e"), math_e);
+    tp_set(tp, math_mod, tp_string("acos"), tp_fnc(tp, math_acos));
+    tp_set(tp, math_mod, tp_string("asin"), tp_fnc(tp, math_asin));
+    tp_set(tp, math_mod, tp_string("atan"), tp_fnc(tp, math_atan));
+    tp_set(tp, math_mod, tp_string("atan2"), tp_fnc(tp, math_atan2));
+    tp_set(tp, math_mod, tp_string("ceil"), tp_fnc(tp, math_ceil));
+    tp_set(tp, math_mod, tp_string("cos"), tp_fnc(tp, math_cos));
+    tp_set(tp, math_mod, tp_string("cosh"), tp_fnc(tp, math_cosh));
+    tp_set(tp, math_mod, tp_string("degrees"), tp_fnc(tp, math_degrees));
+    tp_set(tp, math_mod, tp_string("exp"), tp_fnc(tp, math_exp));
+    tp_set(tp, math_mod, tp_string("fabs"), tp_fnc(tp, math_fabs));
+    tp_set(tp, math_mod, tp_string("floor"), tp_fnc(tp, math_floor));
+    tp_set(tp, math_mod, tp_string("fmod"), tp_fnc(tp, math_fmod));
+    tp_set(tp, math_mod, tp_string("frexp"), tp_fnc(tp, math_frexp));
+    tp_set(tp, math_mod, tp_string("hypot"), tp_fnc(tp, math_hypot));
+    tp_set(tp, math_mod, tp_string("ldexp"), tp_fnc(tp, math_ldexp));
+    tp_set(tp, math_mod, tp_string("log"), tp_fnc(tp, math_log));
+    tp_set(tp, math_mod, tp_string("log10"), tp_fnc(tp, math_log10));
+    tp_set(tp, math_mod, tp_string("modf"), tp_fnc(tp, math_modf));
+    tp_set(tp, math_mod, tp_string("pow"), tp_fnc(tp, math_pow));
+    tp_set(tp, math_mod, tp_string("radians"), tp_fnc(tp, math_radians));
+    tp_set(tp, math_mod, tp_string("sin"), tp_fnc(tp, math_sin));
+    tp_set(tp, math_mod, tp_string("sinh"), tp_fnc(tp, math_sinh));
+    tp_set(tp, math_mod, tp_string("sqrt"), tp_fnc(tp, math_sqrt));
+    tp_set(tp, math_mod, tp_string("tan"), tp_fnc(tp, math_tan));
+    tp_set(tp, math_mod, tp_string("tanh"), tp_fnc(tp, math_tanh));
+    /*
+     * bind special attributes to math module
+     */
+    tp_set(tp, math_mod, tp_string("__doc__"),
+            tp_string(
+                "This module is always available.  It provides access to the\n"
+                "mathematical functions defined by the C standard."));
+    tp_set(tp, math_mod, tp_string("__name__"), tp_string("math"));
+    tp_set(tp, math_mod, tp_string("__file__"), tp_string(__FILE__));
+    /*
+     * bind to tiny modules[]
+     */
+    tp_set(tp, tp->modules, tp_string("math"), math_mod);
+}

 /programs/develop/tinypy/modules/math/math.c
 ,0 → 1,365
+#include <math.h>
+#ifndef M_E
+ #define M_E     2.7182818284590452354
+#endif
+#ifndef M_PI
+ #define M_PI    3.14159265358979323846
+#endif
+#include <errno.h>
+/*
+ * template for tinypy math functions
+ * with one parameter.
+ *
+ * @cfunc is the coresponding function name in C
+ * math library.
+ */
+#define TP_MATH_FUNC1(cfunc)                        \
+    static tp_obj math_##cfunc(TP) {                \
+        double x = TP_NUM();                        \
+        double r = 0.0;                             \
+                                                    \
+        errno = 0;                                  \
+        r = cfunc(x);                               \
+        if (errno == EDOM || errno == ERANGE) {     \
+            tp_raise(tp_None, "%s(x): x=%f, "          \
+                    "out of range", __func__, x);   \
+        }                                           \
+                                                    \
+        return (tp_number(r));                      \
+    }
+/*
+ * template for tinypy math functions
+ * with two parameters.
+ *
+ * @cfunc is the coresponding function name in C
+ * math library.
+ */
+#define TP_MATH_FUNC2(cfunc)                        \
+    static tp_obj math_##cfunc(TP) {                \
+        double x = TP_NUM();                        \
+        double y = TP_NUM();                        \
+        double r = 0.0;                             \
+                                                    \
+        errno = 0;                                  \
+        r = cfunc(x, y);                            \
+        if (errno == EDOM || errno == ERANGE) {     \
+            tp_raise(tp_None, "%s(x, y): x=%f,y=%f "   \
+                    "out of range", __func__, x, y);\
+        }                                           \
+                                                    \
+        return (tp_number(r));                      \
+    }
+/*
+ * PI definition: 3.1415926535897931
+ */
+static tp_obj   math_pi;
+/*
+ * E definition: 2.7182818284590451
+ */
+static tp_obj   math_e;
+/*
+ * acos(x)
+ *
+ * return arc cosine of x, return value is measured in radians.
+ * if x falls out -1 to 1, raise out-of-range exception.
+ */
+TP_MATH_FUNC1(acos)
+/*
+ * asin(x)
+ *
+ * return arc sine of x, measured in radians, actually [-PI/2, PI/2]
+ * if x falls out of -1 to 1, raise out-of-range exception
+ */
+TP_MATH_FUNC1(asin)
+/*
+ * atan(x)
+ *
+ * return arc tangent of x, measured in radians,
+ */
+TP_MATH_FUNC1(atan)
+/*
+ * atan2(x, y)
+ *
+ * return arc tangent of x/y, measured in radians.
+ * unlike atan(x/y), both the signs of x and y
+ * are considered to determine the quaderant of
+ * the result.
+ */
+TP_MATH_FUNC2(atan2)
+/*
+ * ceil(x)
+ *
+ * return the ceiling of x, i.e, the smallest
+ * integer >= x.
+ */
+TP_MATH_FUNC1(ceil)
+/*
+ * cos(x)
+ *
+ * return cosine of x. x is measured in radians.
+ */
+TP_MATH_FUNC1(cos)
+/*
+ * cosh(x)
+ *
+ * return hyperbolic cosine of x.
+ */
+TP_MATH_FUNC1(cosh)
+/*
+ * degrees(x)
+ *
+ * converts angle x from radians to degrees.
+ * NOTE: this function is introduced by python,
+ * so we cannot wrap it directly in TP_MATH_FUNC1(),
+ * here the solution is defining a new
+ * C function - degrees().
+ */
+static const double degToRad =
+.141592653589793238462643383 / 180.0;
+static double degrees(double x)
+{
+    return (x / degToRad);
+}
+TP_MATH_FUNC1(degrees)
+/*
+ * exp(x)
+ *
+ * return the value e raised to power of x.
+ * e is the base of natural logarithms.
+ */
+TP_MATH_FUNC1(exp)
+/*
+ * fabs(x)
+ *
+ * return the absolute value of x.
+ */
+TP_MATH_FUNC1(fabs)
+/*
+ * floor(x)
+ *
+ * return the floor of x, i.e, the largest integer <= x
+ */
+TP_MATH_FUNC1(floor)
+/*
+ * fmod(x, y)
+ *
+ * return the remainder of dividing x by y. that is,
+ * return x - n * y, where n is the quotient of x/y.
+ * NOTE: this function relies on the underlying platform.
+ */
+TP_MATH_FUNC2(fmod)
+/*
+ * frexp(x)
+ *
+ * return a pair (r, y), which satisfies:
+ * x = r * (2 ** y), and r is normalized fraction
+ * which is laid between 1/2 <= abs(r) < 1.
+ * if x = 0, the (r, y) = (0, 0).
+ */
+static tp_obj math_frexp(TP) {
+    double x = TP_NUM();
+    int    y = 0;
+    double r = 0.0;
+    tp_obj rList = tp_list(tp);
+    errno = 0;
+    r = frexp(x, &y);
+    if (errno == EDOM || errno == ERANGE) {
+        tp_raise(tp_None, "%s(x): x=%f, "
+                "out of range", __func__, x);
+    }
+    _tp_list_append(tp, rList.list.val, tp_number(r));
+    _tp_list_append(tp, rList.list.val, tp_number((tp_num)y));
+    return (rList);
+}
+/*
+ * hypot(x, y)
+ *
+ * return Euclidean distance, namely,
+ * sqrt(x*x + y*y)
+ */
+TP_MATH_FUNC2(hypot)
+/*
+ * ldexp(x, y)
+ *
+ * return the result of multiplying x by 2
+ * raised to y.
+ */
+TP_MATH_FUNC2(ldexp)
+/*
+ * log(x, [base])
+ *
+ * return logarithm of x to given base. If base is
+ * not given, return the natural logarithm of x.
+ * Note: common logarithm(log10) is used to compute
+ * the denominator and numerator. based on fomula:
+ * log(x, base) = log10(x) / log10(base).
+ */
+static tp_obj math_log(TP) {
+    double x = TP_NUM();
+    tp_obj b = TP_DEFAULT(tp_None);
+    double y = 0.0;
+    double den = 0.0;   /* denominator */
+    double num = 0.0;   /* numinator */
+    double r = 0.0;     /* result */
+    if (b.type == TP_NONE)
+        y = M_E;
+    else if (b.type == TP_NUMBER)
+        y = (double)b.number.val;
+    else
+        tp_raise(tp_None, "%s(x, [base]): base invalid", __func__);
+    errno = 0;
+    num = log10(x);
+    if (errno == EDOM || errno == ERANGE)
+        goto excep;
+    errno = 0;
+    den = log10(y);
+    if (errno == EDOM || errno == ERANGE)
+        goto excep;
+    r = num / den;
+    return (tp_number(r));
+excep:
+    tp_raise(tp_None, "%s(x, y): x=%f,y=%f "
+            "out of range", __func__, x, y);
+}
+/*
+ * log10(x)
+ *
+ * return 10-based logarithm of x.
+ */
+TP_MATH_FUNC1(log10)
+/*
+ * modf(x)
+ *
+ * return a pair (r, y). r is the integral part of
+ * x and y is the fractional part of x, both holds
+ * the same sign as x.
+ */
+static tp_obj math_modf(TP) {
+    double x = TP_NUM();
+    double y = 0.0;
+    double r = 0.0;
+    tp_obj rList = tp_list(tp);
+    errno = 0;
+    r = modf(x, &y);
+    if (errno == EDOM || errno == ERANGE) {
+        tp_raise(tp_None, "%s(x): x=%f, "
+                "out of range", __func__, x);
+    }
+    _tp_list_append(tp, rList.list.val, tp_number(r));
+    _tp_list_append(tp, rList.list.val, tp_number(y));
+    return (rList);
+}
+/*
+ * pow(x, y)
+ *
+ * return value of x raised to y. equivalence of x ** y.
+ * NOTE: conventionally, tp_pow() is the implementation
+ * of builtin function pow(); whilst, math_pow() is an
+ * alternative in math module.
+ */
+static tp_obj math_pow(TP) {
+    double x = TP_NUM();
+    double y = TP_NUM();
+    double r = 0.0;
+    errno = 0;
+    r = pow(x, y);
+    if (errno == EDOM || errno == ERANGE) {
+        tp_raise(tp_None, "%s(x, y): x=%f,y=%f "
+                "out of range", __func__, x, y);
+    }
+    return (tp_number(r));
+}
+/*
+ * radians(x)
+ *
+ * converts angle x from degrees to radians.
+ * NOTE: this function is introduced by python,
+ * adopt same solution as degrees(x).
+ */
+static double radians(double x)
+{
+    return (x * degToRad);
+}
+TP_MATH_FUNC1(radians)
+/*
+ * sin(x)
+ *
+ * return sine of x, x is measured in radians.
+ */
+TP_MATH_FUNC1(sin)
+/*
+ * sinh(x)
+ *
+ * return hyperbolic sine of x.
+ * mathematically, sinh(x) = (exp(x) - exp(-x)) / 2.
+ */
+TP_MATH_FUNC1(sinh)
+/*
+ * sqrt(x)
+ *
+ * return square root of x.
+ * if x is negtive, raise out-of-range exception.
+ */
+TP_MATH_FUNC1(sqrt)
+/*
+ * tan(x)
+ *
+ * return tangent of x, x is measured in radians.
+ */
+TP_MATH_FUNC1(tan)
+/*
+ * tanh(x)
+ *
+ * return hyperbolic tangent of x.
+ * mathematically, tanh(x) = sinh(x) / cosh(x).
+ */
+TP_MATH_FUNC1(tanh)

 /programs/develop/tinypy/modules/math/tests.py
 ,0 → 1,176
+### This file is grabbed from Python's Lib/test/test_math.py
+###---------------------------------------------------------
+# Python test set -- math module
+# XXXX Should not do tests around zero only
+eps = 0.00001
+#print('math module, testing with eps ', eps)
+import math
+def testit(name, value, expected):
+    if abs(value-expected) > eps:
+        msg = name + " returned " + str(value) + " expected " + str(expected)
+        raise msg
+#print 'constants'
+testit('pi', math.pi, 3.1415926)
+testit('e', math.e, 2.7182818)
+#print 'acos'
+testit('acos(-1)', math.acos(-1), math.pi)
+testit('acos(0)', math.acos(0), math.pi/2)
+testit('acos(1)', math.acos(1), 0)
+#print 'asin'
+testit('asin(-1)', math.asin(-1), -math.pi/2)
+testit('asin(0)', math.asin(0), 0)
+testit('asin(1)', math.asin(1), math.pi/2)
+#print 'atan'
+testit('atan(-1)', math.atan(-1), -math.pi/4)
+testit('atan(0)', math.atan(0), 0)
+testit('atan(1)', math.atan(1), math.pi/4)
+#print 'atan2'
+testit('atan2(-1, 0)', math.atan2(-1, 0), -math.pi/2)
+testit('atan2(-1, 1)', math.atan2(-1, 1), -math.pi/4)
+testit('atan2(0, 1)', math.atan2(0, 1), 0)
+testit('atan2(1, 1)', math.atan2(1, 1), math.pi/4)
+testit('atan2(1, 0)', math.atan2(1, 0), math.pi/2)
+#print 'ceil'
+testit('ceil(0.5)', math.ceil(0.5), 1)
+testit('ceil(1.0)', math.ceil(1.0), 1)
+testit('ceil(1.5)', math.ceil(1.5), 2)
+testit('ceil(-0.5)', math.ceil(-0.5), 0)
+testit('ceil(-1.0)', math.ceil(-1.0), -1)
+testit('ceil(-1.5)', math.ceil(-1.5), -1)
+#print 'cos'
+testit('cos(-pi/2)', math.cos(-math.pi/2), 0)
+testit('cos(0)', math.cos(0), 1)
+testit('cos(pi/2)', math.cos(math.pi/2), 0)
+testit('cos(pi)', math.cos(math.pi), -1)
+#print 'cosh'
+testit('cosh(0)', math.cosh(0), 1)
+testit('cosh(2)-2*(cosh(1)**2)', math.cosh(2)-2*(math.cosh(1)**2), -1) # Thanks to Lambert
+#print 'degrees'
+testit('degrees(pi)', math.degrees(math.pi), 180.0)
+testit('degrees(pi/2)', math.degrees(math.pi/2), 90.0)
+testit('degrees(-pi/4)', math.degrees(-math.pi/4), -45.0)
+#print 'exp'
+testit('exp(-1)', math.exp(-1), 1/math.e)
+testit('exp(0)', math.exp(0), 1)
+testit('exp(1)', math.exp(1), math.e)
+#print 'fabs'
+testit('fabs(-1)', math.fabs(-1), 1)
+testit('fabs(0)', math.fabs(0), 0)
+testit('fabs(1)', math.fabs(1), 1)
+#print 'floor'
+testit('floor(0.5)', math.floor(0.5), 0)
+testit('floor(1.0)', math.floor(1.0), 1)
+testit('floor(1.5)', math.floor(1.5), 1)
+testit('floor(-0.5)', math.floor(-0.5), -1)
+testit('floor(-1.0)', math.floor(-1.0), -1)
+testit('floor(-1.5)', math.floor(-1.5), -2)
+#print 'fmod'
+testit('fmod(10,1)', math.fmod(10,1), 0)
+testit('fmod(10,0.5)', math.fmod(10,0.5), 0)
+testit('fmod(10,1.5)', math.fmod(10,1.5), 1)
+testit('fmod(-10,1)', math.fmod(-10,1), 0)
+testit('fmod(-10,0.5)', math.fmod(-10,0.5), 0)
+testit('fmod(-10,1.5)', math.fmod(-10,1.5), -1)
+#print 'frexp'
+def testfrexp(name, value, expected):
+    mant = value[0]
+    exp  = value[1]
+    emant = expected[0]
+    eexp  = expected[1]
+    if abs(mant-emant) > eps or exp != eexp:
+        raise '%s returned (%f, %f), expected (%f, %f)'%\
+              (name, mant, exp, emant,eexp)
+testfrexp('frexp(-1)', math.frexp(-1), (-0.5, 1))
+testfrexp('frexp(0)', math.frexp(0), (0, 0))
+testfrexp('frexp(1)', math.frexp(1), (0.5, 1))
+testfrexp('frexp(2)', math.frexp(2), (0.5, 2))
+#print 'hypot'
+testit('hypot(0,0)', math.hypot(0,0), 0)
+testit('hypot(3,4)', math.hypot(3,4), 5)
+#print 'ldexp'
+testit('ldexp(0,1)', math.ldexp(0,1), 0)
+testit('ldexp(1,1)', math.ldexp(1,1), 2)
+testit('ldexp(1,-1)', math.ldexp(1,-1), 0.5)
+testit('ldexp(-1,1)', math.ldexp(-1,1), -2)
+#print 'log'
+testit('log(1/e)', math.log(1/math.e), -1)
+testit('log(1)', math.log(1), 0)
+testit('log(e)', math.log(math.e), 1)
+testit('log(32,2)', math.log(32,2), 5)
+testit('log(10**40, 10)', math.log(10**40, 10), 40)
+testit('log(10**40, 10**20)', math.log(10**40, 10**20), 2)
+#print 'log10'
+testit('log10(0.1)', math.log10(0.1), -1)
+testit('log10(1)', math.log10(1), 0)
+testit('log10(10)', math.log10(10), 1)
+#print 'modf'
+def testmodf(name, value, expected):
+    v1 = value[0]
+    v2 = value[1]
+    e1 = expected[0]
+    e2 = expected[1]
+    if abs(v1-e1) > eps or abs(v2-e2):
+        raise '%s returned (%f, %f), expected (%f, %f)'%\
+              (name, v1,v2, e1,e2)
+testmodf('modf(1.5)', math.modf(1.5), (0.5, 1.0))
+testmodf('modf(-1.5)', math.modf(-1.5), (-0.5, -1.0))
+#print 'pow'
+testit('pow(0,1)', math.pow(0,1), 0)
+testit('pow(1,0)', math.pow(1,0), 1)
+testit('pow(2,1)', math.pow(2,1), 2)
+testit('pow(2,-1)', math.pow(2,-1), 0.5)
+#print 'radians'
+testit('radians(180)', math.radians(180), math.pi)
+testit('radians(90)', math.radians(90), math.pi/2)
+testit('radians(-45)', math.radians(-45), -math.pi/4)
+#print 'sin'
+testit('sin(0)', math.sin(0), 0)
+testit('sin(pi/2)', math.sin(math.pi/2), 1)
+testit('sin(-pi/2)', math.sin(-math.pi/2), -1)
+#print 'sinh'
+testit('sinh(0)', math.sinh(0), 0)
+testit('sinh(1)**2-cosh(1)**2', math.sinh(1)**2-math.cosh(1)**2, -1)
+testit('sinh(1)+sinh(-1)', math.sinh(1)+math.sinh(-1), 0)
+#print 'sqrt'
+testit('sqrt(0)', math.sqrt(0), 0)
+testit('sqrt(1)', math.sqrt(1), 1)
+testit('sqrt(4)', math.sqrt(4), 2)
+#print 'tan'
+testit('tan(0)', math.tan(0), 0)
+testit('tan(pi/4)', math.tan(math.pi/4), 1)
+testit('tan(-pi/4)', math.tan(-math.pi/4), -1)
+#print 'tanh'
+testit('tanh(0)', math.tanh(0), 0)
+testit('tanh(1)+tanh(-1)', math.tanh(1)+math.tanh(-1), 0)
+#print("OK: math module test pass")

 /programs/develop/tinypy/modules/pygame/init.c
 ,0 → 1,182
+#include "SDL.h"
+/* utility functions */
+Uint32 pygame_list_to_color(TP,tp_obj clr,SDL_Surface *s) {
+    int r,g,b;
+    r = tp_get(tp,clr,tp_number(0)).number.val;
+    g = tp_get(tp,clr,tp_number(1)).number.val;
+    b = tp_get(tp,clr,tp_number(2)).number.val;
+    return SDL_MapRGB(s->format,r,g,b);
+}
+/* surface */
+#define PYGAME_TYPE_SURF 0x1001
+void pygame_surf_free(TP,tp_obj d) {
+    if (d.data.magic != PYGAME_TYPE_SURF) { tp_raise(,"%s","not a surface"); }
+    SDL_FreeSurface((SDL_Surface*)d.data.val);
+}
+SDL_Surface *pygame_obj_to_surf(TP,tp_obj self) {
+    tp_obj d = tp_get(tp,self,tp_string("__surf"));
+    if (d.data.magic != PYGAME_TYPE_SURF) { tp_raise(0,"%s","not a surface"); }
+    return (SDL_Surface*)d.data.val;
+}
+tp_obj pygame_surface_set_at(TP) {
+    tp_obj self = TP_OBJ();
+    tp_obj pos = TP_TYPE(TP_LIST);
+    tp_obj clr = TP_TYPE(TP_LIST);
+    SDL_Rect r;
+    r.x = tp_get(tp,pos,tp_number(0)).number.val;
+    r.y = tp_get(tp,pos,tp_number(1)).number.val;
+    r.w = 1; r.h = 1;
+    SDL_Surface *s =pygame_obj_to_surf(tp,self);
+    Uint32 c = pygame_list_to_color(tp,clr,s);
+    SDL_FillRect(s, &r, c);
+    return tp_None;
+}
+tp_obj pygame_surf_to_obj(TP,SDL_Surface *s) {
+    tp_obj self = tp_dict(tp);
+    tp_obj d = tp_data(tp,PYGAME_TYPE_SURF,s);
+    d.data.info->free = pygame_surf_free;
+    tp_set(tp,self,tp_string("__surf"),d);
+    tp_set(tp,self,tp_string("set_at"),tp_method(tp,self,pygame_surface_set_at));
+    return self;
+}
+/* display module */
+tp_obj pygame_display_set_mode(TP) {
+    tp_obj sz = TP_TYPE(TP_LIST);
+    int w = tp_get(tp,sz,tp_number(0)).number.val;
+    int h = tp_get(tp,sz,tp_number(1)).number.val;
+    SDL_Surface *s = SDL_SetVideoMode(w, h, 0, 0);
+    return pygame_surf_to_obj(tp,s);
+}
+tp_obj pygame_display_flip(TP) {
+    SDL_Flip(SDL_GetVideoSurface());
+    return tp_None;
+}
+SDL_Rect pygame_list_to_rect(TP,tp_obj o) {
+    SDL_Rect r;
+    r.x = tp_get(tp,o,tp_number(0)).number.val;
+    r.y = tp_get(tp,o,tp_number(1)).number.val;
+    r.w = tp_get(tp,o,tp_number(2)).number.val;
+    r.h = tp_get(tp,o,tp_number(3)).number.val;
+    return r;
+}
+tp_obj pygame_display_update(TP) {
+    SDL_Rect r = pygame_list_to_rect(tp,TP_TYPE(TP_LIST));
+    SDL_UpdateRects(SDL_GetVideoSurface(), 1, &r);
+    return tp_None;
+}
+/* event module */
+tp_obj pygame_event_get(TP) {
+    SDL_Event e;
+    tp_obj r = tp_list(tp);
+    while (SDL_PollEvent(&e)) {
+        tp_obj d = tp_dict(tp);
+        tp_set(tp,d,tp_string("type"),tp_number(e.type));
+        switch (e.type) {
+            case SDL_KEYDOWN:
+            case SDL_KEYUP:
+                tp_set(tp,d,tp_string("key"),tp_number(e.key.keysym.sym));
+                tp_set(tp,d,tp_string("mod"),tp_number(e.key.keysym.mod));
+                break;
+            case SDL_MOUSEMOTION:
+                tp_set(tp,d,tp_string("pos"),tp_list_n(tp,2,(tp_obj[]){tp_number(e.motion.x),tp_number(e.motion.y)}));
+                tp_set(tp,d,tp_string("rel"),tp_list_n(tp,2,(tp_obj[]){tp_number(e.motion.xrel),tp_number(e.motion.yrel)}));
+                tp_set(tp,d,tp_string("state"),tp_number(e.motion.state));
+                break;
+            case SDL_MOUSEBUTTONDOWN:
+            case SDL_MOUSEBUTTONUP:
+                tp_set(tp,d,tp_string("pos"),tp_list_n(tp,2,(tp_obj[]){tp_number(e.button.x),tp_number(e.button.y)}));
+                tp_set(tp,d,tp_string("button"),tp_number(e.button.button));
+                break;
+        }
+        tp_set(tp,r,tp_None,d);
+    }
+    return r;
+}
+/* mouse */
+tp_obj pygame_mouse_get_pos(TP) {
+    int x,y;
+    SDL_GetMouseState(&x,&y);
+    tp_obj r = tp_list_n(tp,2,(tp_obj[]){tp_number(x),tp_number(y)});
+    return r;
+}
+/* time */
+tp_obj pygame_time_get_ticks(TP) {
+    return tp_number(SDL_GetTicks());
+}
+/* pygame */
+#define PYGAME_LOCALS(a,b) tp_set(tp,m,tp_string(a),tp_number(b));
+tp_obj _pygame_init(TP) {
+    SDL_Init(SDL_INIT_VIDEO);
+    return tp_None;
+}
+void pygame_init(TP) {
+    tp_obj g,m;
+    g = tp_dict(tp);
+    tp_set(tp,tp->modules,tp_string("pygame"),g);
+    tp_set(tp,g,tp_string("init"),tp_fnc(tp,_pygame_init));
+    /* display */
+    m = tp_dict(tp); tp_set(tp,g,tp_string("display"),m);
+    tp_set(tp,m,tp_string("set_mode"),tp_fnc(tp,pygame_display_set_mode));
+    tp_set(tp,m,tp_string("flip"),tp_fnc(tp,pygame_display_flip));
+    tp_set(tp,m,tp_string("update"),tp_fnc(tp,pygame_display_update));
+    /* event */
+    m = tp_dict(tp); tp_set(tp,g,tp_string("event"),m);
+    tp_set(tp,m,tp_string("get"),tp_fnc(tp,pygame_event_get));
+    /* locals */
+    m = tp_dict(tp); tp_set(tp,g,tp_string("locals"),m);
+    PYGAME_LOCALS("QUIT",SDL_QUIT);
+    PYGAME_LOCALS("KEYDOWN",SDL_KEYDOWN);
+    PYGAME_LOCALS("KEYUP",SDL_KEYUP);
+    PYGAME_LOCALS("MOUSEBUTTONDOWN",SDL_MOUSEBUTTONDOWN);
+    PYGAME_LOCALS("MOUSEBUTTONUP",SDL_MOUSEBUTTONUP);
+    PYGAME_LOCALS("MOUSEMOTION",SDL_MOUSEMOTION);
+    PYGAME_LOCALS("K_UP",SDLK_UP);
+    PYGAME_LOCALS("K_DOWN",SDLK_DOWN);
+    PYGAME_LOCALS("K_LEFT",SDLK_LEFT);
+    PYGAME_LOCALS("K_RIGHT",SDLK_RIGHT);
+    PYGAME_LOCALS("K_ESCAPE",SDLK_ESCAPE);
+    PYGAME_LOCALS("K_SPACE",SDLK_SPACE);
+    PYGAME_LOCALS("K_RETURN",SDLK_RETURN);
+    /* mouse */
+    m = tp_dict(tp); tp_set(tp,g,tp_string("mouse"),m);
+    tp_set(tp,m,tp_string("get_pos"),tp_fnc(tp,pygame_mouse_get_pos));
+    /* time */
+    m = tp_dict(tp); tp_set(tp,g,tp_string("time"),m);
+    tp_set(tp,m,tp_string("get_ticks"),tp_fnc(tp,pygame_time_get_ticks));
+}
+/**/

Subversion Repositories Kolibri OS

Compare Revisions

Regard whitespace Rev 8535 → Rev 8534